summaryrefslogtreecommitdiffstats
path: root/hw/fsp/fsp-console.c
Commit message (Collapse)AuthorAgeFilesLines
* Move include lock.h to fsp-console.h from console.hStewart Smith2018-06-181-0/+1
| | | | | | It's only used there, let's minimise our needed includes. Signed-off-by: Stewart Smith <stewart@linux.ibm.com>
* fsp/console: Always establish OPAL console API backendBenjamin Herrenschmidt2018-05-241-2/+3
| | | | | | | | | | | | | | | | | Currently we only call set_opal_console() to establish the backend used by the OPAL console API if we find at least one FSP serial port in HDAT. On systems where there is none (IPMI only), we fail to set it, causing the console code to try to use the dummy console causing an assertion failure during boot due to clashing on the device-tree node names. So always set it if an FSP is present Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org> Reviewed-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.ibm.com>
* Revert "console(lpc/fsp-console): Use only stdout-path property on P9 and above"Stewart Smith2018-03-061-11/+3
| | | | | | | | | | | | | This reverts commit 20f685a3627a2a522c465716377561a8fbcc608f. We've hit problems on Zaius machines and the needed petitboot changes haven't made it upstream yet. Let's revert for the time being while we sort everything out. We probably have to keep both around for a few years. Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console(lpc/fsp-console): Use only stdout-path property on P9 and abovePridhiviraj Paidipeddi2018-03-011-3/+11
| | | | | | | | | | | | | | | | | | | dtc tool complaining about below warning as usage of linux,stdout-path property under /chosen node is deprecated. dts: Warning (chosen_node_stdout_path): Use 'stdout-path' instead of 'linux,stdout-path' So this patch fix this by using stdout-path property on all the systems and keep linux,stdout-path only on P8 and before. This property refers to a node which represents the device to be used for boot console output. Verified boot on both P8 and P9 systems with new and older kernels. And also verified dtc warnings got fixed in both P8 and P9. Signed-off-by: Pridhiviraj Paidipeddi <ppaidipe@linux.vnet.ibm.com> [stewart: simplify logic] Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: remove redundant flush_all_input() call in fsp_console_reset()Vasant Hegde2017-10-301-2/+0
| | | | | Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Disable notification on unresponsive consolesVasant Hegde2017-10-301-3/+5
| | | | | | | | | | | | | | | | | Commit fd6b71fc fixed the situation where ipmi console was open (hvc0) but got data on different console (hvc1). During FSP R/R OPAL closes all consoles. After R/R complete FSP requests to open hvc1 and sends data on this. If hvc1 registration failed or not opened in host kernel then it will not read data and results in RCU stalls. Note that this is workaround for older kernel where we don't have separate irq for each console. Latest kernel works fine without this patch. CC: stable CC: Sam Mendoza-Jonas <sam@mendozajonas.com> Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Limit number of error loggingVasant Hegde2017-10-111-8/+13
| | | | | | | | | | | | | | | | Commit c8a7535f (FSP/CONSOLE: Workaround for unresponsive ipmi daemon) added error logging when buffer is full. In some corner cases kernel may call this function multiple time and we may endup logging error again and again. This patch fixes it by generating error log only once. I think this is enough to indicate something went wrong. Also with previous patch, once console buffer is full, OPAL is returning error to payload from fsp_console_write_buffer_space(). So payload will never call fsp_console_write(). Hence move error logging logic to right place. Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Fix fsp_console_write_buffer_space() callVasant Hegde2017-10-111-1/+35
| | | | | | | | | | | | | | | | | | | | | | | | | Kernel calls fsp_console_write_buffer_space() to check console buffer space availability. If there is enough buffer space to write data, then kernel will call fsp_console_write() to write actual data. In some extreme corner cases (like one explained in commit c8a7535f) console becomes full and this function returns 0 to kernel (or space available in console buffer < next incoming data size). Kernel will continue retrying until it gets enough space. So we will start seeing RCU stalls. This patch keeps track of previous available space. If previous space is same as current means not enough space in console buffer to write incoming data. It may be due to very high console write operation and slow response from FSP -OR- FSP has stopped processing data (ex: because of ipmi daemon died). At this point we will start timer with timeout of SER_BUFFER_OUT_TIMEOUT (10 secs). If situation is not improved within 10 seconds means something went bad. Lets return OPAL_RESOURCE so that kernel can drop console write and continue. CC: Ananth N Mavinakayanahalli <ananth@linux.vnet.ibm.com> CC: Stewart Smith <stewart@linux.vnet.ibm.com> Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> [stewart: reset timeout in fsp_console_write() path] Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Close SOL session during R/RVasant Hegde2017-10-111-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Presently we are not closing SOL and FW console sessions during R/R. Host will continue to write to SOL buffer during FSP R/R. If there is heavy console write operation happening during FSP R/R (like running `top` command inside console), then at some point console buffer becomes full. fsp_console_write_buffer_space() returns 0 (or less than required space to write data) to host. While one thread is busy writing to console, if some other threads tries to write data to console we may see RCU stalls (like below) in kernel. kernel call trace: ------------------ [ 2082.828363] INFO: rcu_sched detected stalls on CPUs/tasks: { 32} (detected by 16, t=6002 jiffies, g=23154, c=23153, q=254769) [ 2082.828365] Task dump for CPU 32: [ 2082.828368] kworker/32:3 R running task 0 4637 2 0x00000884 [ 2082.828375] Workqueue: events dump_work_fn [ 2082.828376] Call Trace: [ 2082.828382] [c000000f1633fa00] [c00000000013b6b0] console_unlock+0x570/0x600 (unreliable) [ 2082.828384] [c000000f1633fae0] [c00000000013ba34] vprintk_emit+0x2f4/0x5c0 [ 2082.828389] [c000000f1633fb60] [c00000000099e644] printk+0x84/0x98 [ 2082.828391] [c000000f1633fb90] [c0000000000851a8] dump_work_fn+0x238/0x250 [ 2082.828394] [c000000f1633fc60] [c0000000000ecb98] process_one_work+0x198/0x4b0 [ 2082.828396] [c000000f1633fcf0] [c0000000000ed3dc] worker_thread+0x18c/0x5a0 [ 2082.828399] [c000000f1633fd80] [c0000000000f4650] kthread+0x110/0x130 [ 2082.828403] [c000000f1633fe30] [c000000000009674] ret_from_kernel_thread+0x5c/0x68 Hence lets close SOL (and FW console) during FSP R/R. CC: Benjamin Herrenschmidt <benh@kernel.crashing.org> Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Do not associate unavailable consoleVasant Hegde2017-10-111-0/+11
| | | | | | | | | | | | | | | Presently OPAL sends associate/unassociate MBOX command for all FSP serial console (like below OPAL message). We have to check console is available or not before sending this message. OPAL log: ------- [ 5013.227994012,7] FSP: Reassociating HVSI console 1 [ 5013.227997540,7] FSP: Reassociating HVSI console 2 Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Acked-by: Ananth N Mavinakayanahalli <ananth@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Do not enable input irq in write pathVasant Hegde2017-07-211-3/+0
| | | | | | | | | | | We use irq for reading input from console, but not in output path. Hence do not enable input irq in write path. Fixes : 583c8203 (fsp/console: Allocate irq for each hvc console) CC: Sam Mendoza-Jonas <sam@mendozajonas.com> Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Acked-By: Samuel Mendoza-Jonas <sam@mendozajonas.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Fix possible NULL dereferenceVasant Hegde2017-06-191-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | Fix coverity warning message. Null pointer dereferences (NULL_RETURNS) /hw/fsp/fsp-console.c: 295 in fsp_open_vserial() 289 290 fs->open = true; 291 292 fs->poke_msg = fsp_mkmsg(FSP_CMD_VSERIAL_OUT, 2, 293 msg->data.words[0], 294 msg->data.words[1] & 0xffff); >>> CID 145796: Null pointer dereferences (NULL_RETURNS) >>> Dereferencing a null pointer "fs->poke_msg". 295 fs->poke_msg->user_data = fs; 296 297 fs->in_buf->partition_id = fs->out_buf->partition_id = part_id; 298 fs->in_buf->session_id = fs->out_buf->session_id = sess_id; 299 fs->in_buf->hmc_id = fs->out_buf->hmc_id = hmc_indx; 300 fs->in_buf->data_offset = fs->out_buf->data_offset = Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Workaround for unresponsive ipmi daemonVasant Hegde2017-06-141-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We use TCE mapped area to write data to console. Console header (fsp_serbuf_hdr) is modified by both FSP and OPAL (OPAL updates next_in pointer in fsp_serbuf_hdr and FSP updates next_out pointer). Kernel makes opal_console_write() OPAL call to write data to console. OPAL write data to TCE mapped area and sends MBOX command to FSP. If our console becomes full and we have data to write to console, we keep on waiting until FSP reads data. In some corner cases, where FSP is active but not responding to console MBOX message (due to buggy IPMI) and we have heavy console write happening from kernel, then eventually our console buffer becomes full. At this point OPAL starts sending OPAL_BUSY_EVENT to kernel. Kernel will keep on retrying. This is creating kernel soft lockups. In some extreme case when every CPU is trying to write to console, user will not be able to ssh and thinks system is hang. If we reset FSP or restart IPMI daemon on FSP, system recovers and everything becomes normal. This patch adds workaround to above issue by returning OPAL_HARDWARE when cosole is full. Side effect of this patch is, we may endup dropping latest console data. But better to drop console data than system hang. Alternative approach is to drop old data from console buffer, make space for new data. But in normal condition only FSP can update 'next_out' pointer and if we touch that pointer, it may introduce some other race conditions. Hence we decided to just new console write request. Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Acked-by: Vaidyanathan Srinivasan <svaidy@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Do not free fsp_msg in error pathVasant Hegde2017-06-081-1/+0
| | | | | | | .. as we reuse same msg to send next output message. Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* FSP/CONSOLE: Remove __unused attribute from fsp_console_read()Vasant Hegde2017-06-081-1/+1
| | | | | | | ..as we use buffer to copy data. Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console: use opal_con_ops APIOliver O'Halloran2017-01-041-6/+3
| | | | | | | | | | | | | | | | | | Adds a new structure that contains the implementations of the various OPAL console handlers. This is intended to replace the existing ad-hoc mechanism where the OPAL call handlers are overwritten in the OPAL console driver's init function. Currently this just moves the site where the OPAL call handlers are overwritten to inside of console.c, but it is intended to give us a mechanism for implementing features such as pointer validation for the OPAL console calls without having to manually update each driver. This also helps to clarify differences between the internal (skiboot) console and the external (OPAL) console. Signed-off-by: Oliver O'Halloran <oohall@gmail.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console: add opal_con_ops structureOliver O'Halloran2017-01-041-0/+15
| | | | | | | | | | Adds a separate structure to house the operations for the OPAL console. This is used to define a new API for dealing with the OPAL console in the next patch. Signed-off-by: Oliver O'Halloran <oohall@gmail.com> Reviewed-by: Andrew Donnellan <andrew.donnellan@au1.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console: add helper to create serial console nodesOliver O'Halloran2017-01-041-16/+8
| | | | | | | | | | The creation of /ibm,skiboot/console/serial@<xyz> nodes is pretty much identical across the various OPAL console drivers. This patch moves it into a helper function as a cleanup. Reviewed-by: Andrew Donnellan <andrew.donnellan@au1.ibm.com> Signed-off-by: Oliver O'Halloran <oohall@gmail.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console: don't use __flush_console() outside console.cOliver O'Halloran2017-01-041-1/+1
| | | | | | | | | | | There is only one use of this function outside of console.c and that usage is broken. As the name suggests this is an internal function that is only safe when the console lock held is held. flush_console() will acquire the lock for the caller so that should be used instead. Reviewed-by: Andrew Donnellan <andrew.donnellan@au1.ibm.com> Signed-off-by: Oliver O'Halloran <oohall@gmail.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Fast reboot for P8Benjamin Herrenschmidt2016-10-171-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an experimental patch that implements "Fast reboot" on P8 machines. The basic idea is that when the OS calls OPAL reboot, we gather all the threads in the system using a combination of patching the reset vector and soft-resetting them, then cleanup a few bits of hardware (we do re-probe PCIe for example), and reload & restart the bootloader. For Trusted Boot, this means we *add* measurements to the TPM, so you will get *different* PCR values as compared to a full IPL. This makes sense as if you want to be sure you are running something known then, well, do a full IPL as soft reset should never be trusted to clear any malicious code. This is very experimental and needs a lot of testing and also auditing code for other bits of HW that might need to be cleaned up. BenH TODO: I also need to check if we are properly PERST'ing PCI devices. This is partially based on old code I had to do that on P7. I only support it on P8 though as there are issues with the PSI interrupts on P7 that cannot be reliably solved. Even though this should be considered somewhat experimental, we've had a lot of success on a variety of machines. Dozens/hundreds of reboots across Tuleta, Garrison and Habanero. Currently, we've hidden it behind a NVRAM config option, which *is* liable to change in the future (to ensure that only those who know what they're doing enable it) You can enable the experimental support via nvram option: nvram -p ibm,skiboot --update-config experimental-fast-reset=feeling-lucky Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org> [stewart@linux.vnet.ibm.com: hide behind nvram option, include Mambo fixes from Mikey] Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* fsp/console: Allocate irq for each hvc consoleSam Mendoza-Jonas2016-09-221-5/+21
| | | | | | | | | Allocate an irq number for each hvc console and set its interrupt-parent property so that Linux can use the opal irqchip instead of the OPAL_EVENT_CONSOLE_INPUT interface. Signed-off-by: Samuel Mendoza-Jonas <sam@mendozajonas.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* fsp/console: Ignore data on unresponsive consolesSam Mendoza-Jonas2016-07-151-2/+16
| | | | | | | | | | | | | | | | Linux kernels from v4.1 onwards will try to request an irq for each hvc console using OPAL_EVENT_CONSOLE_INPUT, however because the IRQF_SHARED flag is not set any console after the first will fail. If there is data on one of these failed consoles OPAL will set OPAL_EVENT_CONSOLE_INPUT every time fsp_console_read is called, leading to RCU stalls in the kernel. As a workaround for unpatched kernels, cease setting OPAL_EVENT_CONSOLE_INPUT for consoles that we have noticed are not being read. Signed-off-by: Samuel Mendoza-Jonas <sam@mendozajonas.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Fix possible buffer overflowAnanth N Mavinakayanahalli2015-06-191-1/+2
| | | | | | | NULL terminate and truncate size of copy into char buffer to the right size. Signed-off-by: Ananth N Mavinakayanahalli <ananth@in.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Remove redundant includes of opal-api.hMichael Ellerman2015-04-011-1/+0
| | | | | | | | Now that opal.h includes opal-api.h, there are a bunch of files that include both but don't need to. Signed-off-by: Michael Ellerman <mpe@ellerman.id.au> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* fsp/console: Don't time_wait with lock heldBenjamin Herrenschmidt2015-02-181-2/+2
| | | | | Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Move skiboot internal things from opal.h to opal-api.hStewart Smith2015-02-061-0/+1
| | | | | | | | | | This is probably not the best collection of things in the world, but it means that opal.h is much closer to being directly usable by an OS. This triggers a bunch of #include fixes throughout the tree. Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Console: Fix unused result warnings in console driverAnanth N Mavinakayanahalli2014-12-101-22/+79
| | | | | | | | Fix Wunused-result Signed-off-by: Ananth N Mavinakayanahalli <ananth@in.ibm.com> Signed-off-by: Vasant Hegde <hegdevasant@linux.vnet.ibm.com> Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Be less verbose in logging about FSP ConsoleStewart Smith2014-10-151-21/+22
| | | | | | For the most part, PR_DEBUG. Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* Make FSP console a bit quieter, most can be PR_DEBUGStewart Smith2014-10-151-23/+23
| | | | Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com>
* console/sysparam: Use the system param to switch console selectionBenjamin Herrenschmidt2014-08-181-24/+47
| | | | | | | | | | The patch provides the in-band support for reading the 'console-select' system parameter. It also adds the console support to honour the system param for switching the console type in P8 systems. Tested-by: Neelesh Gupta <neelegup@linux.vnet.ibm.com> Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org> Signed-off-by: Jeremy Kerr <jeremy.kerr@au.ibm.com>
* lock: Fix races when setting in_con_lockBenjamin Herrenschmidt2014-08-081-0/+3
| | | | | | | | | | | When setting the flag in a lock that indicates that it's on the console path, we need to take and release that lock to ensure that any other processor that might have taken it before the flag was set has released it, otherwise the lock might still be held without the console count properly incremented, which can cause it to go negative or cause the deadlock that we mean to avoid by that to still occur. Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
* Write log messages with log_level > PR_NOTICE only to in memory logStewart Smith2014-08-081-1/+1
| | | | | | | | | | | We modify write() (adding console_write()) which calls down to a modified __flush_console() which can now decide if it's flushing the added console contents to the console drivers or not. A future patch may add support for changing PR_NOTICE to some other level Signed-off-by: Stewart Smith <stewart@linux.vnet.ibm.com> Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
* fsp: Make more message asynchronousBenjamin Herrenschmidt2014-07-081-10/+7
| | | | | | | | It's not a great idea to try to call fsp_sync_msg from an FSP callback since the pollers won't run if we already have the poll lock (we might do something about that at some point but not just yet) Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
* fsp-console: Don't wait synchronously on console assoc/deassocBenjamin Herrenschmidt2014-07-081-20/+0
| | | | | | | | We can be called from a poller, calling the poller again has no effect and we might just end up dead locking. There is no reason to be synchronous anyway. Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
* opal: Replace fsp_poll() with a full run of all OPAL pollersBenjamin Herrenschmidt2014-07-081-5/+5
| | | | | | | | | Otherwise we don't handle surveillance and PSI link monitoring This should fix cases of surveillance timeouts during things like code update such as BZ109939 Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
* Initial commit of Open Source releaseBenjamin Herrenschmidt2014-07-021-0/+922
Signed-off-by: Benjamin Herrenschmidt <benh@kernel.crashing.org>
OpenPOWER on IntegriCloud