diff options
Diffstat (limited to 'tools')
167 files changed, 4892 insertions, 1987 deletions
diff --git a/tools/arch/x86/include/asm/cpufeatures.h b/tools/arch/x86/include/asm/cpufeatures.h index 578793e97431..fb00a2fca990 100644 --- a/tools/arch/x86/include/asm/cpufeatures.h +++ b/tools/arch/x86/include/asm/cpufeatures.h @@ -198,7 +198,6 @@ #define X86_FEATURE_CAT_L2 ( 7*32+ 5) /* Cache Allocation Technology L2 */ #define X86_FEATURE_CDP_L3 ( 7*32+ 6) /* Code and Data Prioritization L3 */ #define X86_FEATURE_INVPCID_SINGLE ( 7*32+ 7) /* Effectively INVPCID && CR4.PCIDE=1 */ - #define X86_FEATURE_HW_PSTATE ( 7*32+ 8) /* AMD HW-PState */ #define X86_FEATURE_PROC_FEEDBACK ( 7*32+ 9) /* AMD ProcFeedbackInterface */ #define X86_FEATURE_SME ( 7*32+10) /* AMD Secure Memory Encryption */ @@ -207,13 +206,19 @@ #define X86_FEATURE_RETPOLINE_AMD ( 7*32+13) /* "" AMD Retpoline mitigation for Spectre variant 2 */ #define X86_FEATURE_INTEL_PPIN ( 7*32+14) /* Intel Processor Inventory Number */ #define X86_FEATURE_CDP_L2 ( 7*32+15) /* Code and Data Prioritization L2 */ - +#define X86_FEATURE_MSR_SPEC_CTRL ( 7*32+16) /* "" MSR SPEC_CTRL is implemented */ +#define X86_FEATURE_SSBD ( 7*32+17) /* Speculative Store Bypass Disable */ #define X86_FEATURE_MBA ( 7*32+18) /* Memory Bandwidth Allocation */ #define X86_FEATURE_RSB_CTXSW ( 7*32+19) /* "" Fill RSB on context switches */ #define X86_FEATURE_SEV ( 7*32+20) /* AMD Secure Encrypted Virtualization */ - #define X86_FEATURE_USE_IBPB ( 7*32+21) /* "" Indirect Branch Prediction Barrier enabled */ #define X86_FEATURE_USE_IBRS_FW ( 7*32+22) /* "" Use IBRS during runtime firmware calls */ +#define X86_FEATURE_SPEC_STORE_BYPASS_DISABLE ( 7*32+23) /* "" Disable Speculative Store Bypass. */ +#define X86_FEATURE_LS_CFG_SSBD ( 7*32+24) /* "" AMD SSBD implementation via LS_CFG MSR */ +#define X86_FEATURE_IBRS ( 7*32+25) /* Indirect Branch Restricted Speculation */ +#define X86_FEATURE_IBPB ( 7*32+26) /* Indirect Branch Prediction Barrier */ +#define X86_FEATURE_STIBP ( 7*32+27) /* Single Thread Indirect Branch Predictors */ +#define X86_FEATURE_ZEN ( 7*32+28) /* "" CPU is AMD family 0x17 (Zen) */ /* Virtualization flags: Linux defined, word 8 */ #define X86_FEATURE_TPR_SHADOW ( 8*32+ 0) /* Intel TPR Shadow */ @@ -274,9 +279,10 @@ #define X86_FEATURE_CLZERO (13*32+ 0) /* CLZERO instruction */ #define X86_FEATURE_IRPERF (13*32+ 1) /* Instructions Retired Count */ #define X86_FEATURE_XSAVEERPTR (13*32+ 2) /* Always save/restore FP error pointers */ -#define X86_FEATURE_IBPB (13*32+12) /* Indirect Branch Prediction Barrier */ -#define X86_FEATURE_IBRS (13*32+14) /* Indirect Branch Restricted Speculation */ -#define X86_FEATURE_STIBP (13*32+15) /* Single Thread Indirect Branch Predictors */ +#define X86_FEATURE_AMD_IBPB (13*32+12) /* "" Indirect Branch Prediction Barrier */ +#define X86_FEATURE_AMD_IBRS (13*32+14) /* "" Indirect Branch Restricted Speculation */ +#define X86_FEATURE_AMD_STIBP (13*32+15) /* "" Single Thread Indirect Branch Predictors */ +#define X86_FEATURE_VIRT_SSBD (13*32+25) /* Virtualized Speculative Store Bypass Disable */ /* Thermal and Power Management Leaf, CPUID level 0x00000006 (EAX), word 14 */ #define X86_FEATURE_DTHERM (14*32+ 0) /* Digital Thermal Sensor */ @@ -334,6 +340,7 @@ #define X86_FEATURE_SPEC_CTRL (18*32+26) /* "" Speculation Control (IBRS + IBPB) */ #define X86_FEATURE_INTEL_STIBP (18*32+27) /* "" Single Thread Indirect Branch Predictors */ #define X86_FEATURE_ARCH_CAPABILITIES (18*32+29) /* IA32_ARCH_CAPABILITIES MSR (Intel) */ +#define X86_FEATURE_SPEC_CTRL_SSBD (18*32+31) /* "" Speculative Store Bypass Disable */ /* * BUG word(s) @@ -363,5 +370,6 @@ #define X86_BUG_CPU_MELTDOWN X86_BUG(14) /* CPU is affected by meltdown attack and needs kernel page table isolation */ #define X86_BUG_SPECTRE_V1 X86_BUG(15) /* CPU is affected by Spectre variant 1 attack with conditional branches */ #define X86_BUG_SPECTRE_V2 X86_BUG(16) /* CPU is affected by Spectre variant 2 attack with indirect branches */ +#define X86_BUG_SPEC_STORE_BYPASS X86_BUG(17) /* CPU is affected by speculative store bypass attack */ #endif /* _ASM_X86_CPUFEATURES_H */ diff --git a/tools/include/linux/compiler-gcc.h b/tools/include/linux/compiler-gcc.h index a3a4427441bf..70fe61295733 100644 --- a/tools/include/linux/compiler-gcc.h +++ b/tools/include/linux/compiler-gcc.h @@ -21,6 +21,9 @@ /* &a[0] degrades to a pointer: a different type from an array */ #define __must_be_array(a) BUILD_BUG_ON_ZERO(__same_type((a), &(a)[0])) +#ifndef __pure +#define __pure __attribute__((pure)) +#endif #define noinline __attribute__((noinline)) #ifndef __packed #define __packed __attribute__((packed)) diff --git a/tools/include/linux/spinlock.h b/tools/include/linux/spinlock.h index b21b586b9854..1738c0391da4 100644 --- a/tools/include/linux/spinlock.h +++ b/tools/include/linux/spinlock.h @@ -6,8 +6,9 @@ #include <stdbool.h> #define spinlock_t pthread_mutex_t -#define DEFINE_SPINLOCK(x) pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER; +#define DEFINE_SPINLOCK(x) pthread_mutex_t x = PTHREAD_MUTEX_INITIALIZER #define __SPIN_LOCK_UNLOCKED(x) (pthread_mutex_t)PTHREAD_MUTEX_INITIALIZER +#define spin_lock_init(x) pthread_mutex_init(x, NULL) #define spin_lock_irqsave(x, f) (void)f, pthread_mutex_lock(x) #define spin_unlock_irqrestore(x, f) (void)f, pthread_mutex_unlock(x) diff --git a/tools/include/uapi/linux/bpf.h b/tools/include/uapi/linux/bpf.h index c5ec89732a8d..8c317737ba3f 100644 --- a/tools/include/uapi/linux/bpf.h +++ b/tools/include/uapi/linux/bpf.h @@ -1017,6 +1017,7 @@ struct bpf_prog_info { __aligned_u64 map_ids; char name[BPF_OBJ_NAME_LEN]; __u32 ifindex; + __u32 :32; __u64 netns_dev; __u64 netns_ino; } __attribute__((aligned(8))); @@ -1030,6 +1031,7 @@ struct bpf_map_info { __u32 map_flags; char name[BPF_OBJ_NAME_LEN]; __u32 ifindex; + __u32 :32; __u64 netns_dev; __u64 netns_ino; } __attribute__((aligned(8))); diff --git a/tools/include/uapi/linux/prctl.h b/tools/include/uapi/linux/prctl.h index af5f8c2df87a..db9f15f5db04 100644 --- a/tools/include/uapi/linux/prctl.h +++ b/tools/include/uapi/linux/prctl.h @@ -207,4 +207,16 @@ struct prctl_mm_map { # define PR_SVE_VL_LEN_MASK 0xffff # define PR_SVE_VL_INHERIT (1 << 17) /* inherit across exec */ +/* Per task speculation control */ +#define PR_GET_SPECULATION_CTRL 52 +#define PR_SET_SPECULATION_CTRL 53 +/* Speculation control variants */ +# define PR_SPEC_STORE_BYPASS 0 +/* Return and control values for PR_SET/GET_SPECULATION_CTRL */ +# define PR_SPEC_NOT_AFFECTED 0 +# define PR_SPEC_PRCTL (1UL << 0) +# define PR_SPEC_ENABLE (1UL << 1) +# define PR_SPEC_DISABLE (1UL << 2) +# define PR_SPEC_FORCE_DISABLE (1UL << 3) + #endif /* _LINUX_PRCTL_H */ diff --git a/tools/lib/api/fs/tracing_path.c b/tools/lib/api/fs/tracing_path.c index 7b7fd0b18551..120037496f77 100644 --- a/tools/lib/api/fs/tracing_path.c +++ b/tools/lib/api/fs/tracing_path.c @@ -13,11 +13,9 @@ #include "tracing_path.h" - -char tracing_mnt[PATH_MAX] = "/sys/kernel/debug"; -char tracing_path[PATH_MAX] = "/sys/kernel/debug/tracing"; -char tracing_events_path[PATH_MAX] = "/sys/kernel/debug/tracing/events"; - +static char tracing_mnt[PATH_MAX] = "/sys/kernel/debug"; +static char tracing_path[PATH_MAX] = "/sys/kernel/debug/tracing"; +static char tracing_events_path[PATH_MAX] = "/sys/kernel/debug/tracing/events"; static void __tracing_path_set(const char *tracing, const char *mountpoint) { @@ -76,7 +74,7 @@ char *get_tracing_file(const char *name) { char *file; - if (asprintf(&file, "%s/%s", tracing_path, name) < 0) + if (asprintf(&file, "%s/%s", tracing_path_mount(), name) < 0) return NULL; return file; @@ -87,6 +85,34 @@ void put_tracing_file(char *file) free(file); } +char *get_events_file(const char *name) +{ + char *file; + + if (asprintf(&file, "%s/events/%s", tracing_path_mount(), name) < 0) + return NULL; + + return file; +} + +void put_events_file(char *file) +{ + free(file); +} + +DIR *tracing_events__opendir(void) +{ + DIR *dir = NULL; + char *path = get_tracing_file("events"); + + if (path) { + dir = opendir(path); + put_events_file(path); + } + + return dir; +} + int tracing_path__strerror_open_tp(int err, char *buf, size_t size, const char *sys, const char *name) { @@ -129,7 +155,7 @@ int tracing_path__strerror_open_tp(int err, char *buf, size_t size, snprintf(buf, size, "Error:\tNo permissions to read %s/%s\n" "Hint:\tTry 'sudo mount -o remount,mode=755 %s'\n", - tracing_events_path, filename, tracing_mnt); + tracing_events_path, filename, tracing_path_mount()); } break; default: diff --git a/tools/lib/api/fs/tracing_path.h b/tools/lib/api/fs/tracing_path.h index 0066f06cc381..a19136b086dc 100644 --- a/tools/lib/api/fs/tracing_path.h +++ b/tools/lib/api/fs/tracing_path.h @@ -3,9 +3,9 @@ #define __API_FS_TRACING_PATH_H #include <linux/types.h> +#include <dirent.h> -extern char tracing_path[]; -extern char tracing_events_path[]; +DIR *tracing_events__opendir(void); void tracing_path_set(const char *mountpoint); const char *tracing_path_mount(void); @@ -13,5 +13,10 @@ const char *tracing_path_mount(void); char *get_tracing_file(const char *name); void put_tracing_file(char *file); +char *get_events_file(const char *name); +void put_events_file(char *file); + +#define zput_events_file(ptr) ({ free(*ptr); *ptr = NULL; }) + int tracing_path__strerror_open_tp(int err, char *buf, size_t size, const char *sys, const char *name); #endif /* __API_FS_TRACING_PATH_H */ diff --git a/tools/lib/bpf/libbpf.c b/tools/lib/bpf/libbpf.c index 5922443063f0..0f9f06df49bc 100644 --- a/tools/lib/bpf/libbpf.c +++ b/tools/lib/bpf/libbpf.c @@ -2035,7 +2035,7 @@ int bpf_prog_load_xattr(const struct bpf_prog_load_attr *attr, return -EINVAL; obj = bpf_object__open(attr->file); - if (IS_ERR(obj)) + if (IS_ERR_OR_NULL(obj)) return -ENOENT; bpf_object__for_each_program(prog, obj) { diff --git a/tools/lib/symbol/kallsyms.c b/tools/lib/symbol/kallsyms.c index 689b6a130dd7..96d830545bbb 100644 --- a/tools/lib/symbol/kallsyms.c +++ b/tools/lib/symbol/kallsyms.c @@ -10,6 +10,12 @@ u8 kallsyms2elf_type(char type) return (type == 't' || type == 'w') ? STT_FUNC : STT_OBJECT; } +bool kallsyms__is_function(char symbol_type) +{ + symbol_type = toupper(symbol_type); + return symbol_type == 'T' || symbol_type == 'W'; +} + int kallsyms__parse(const char *filename, void *arg, int (*process_symbol)(void *arg, const char *name, char type, u64 start)) diff --git a/tools/lib/symbol/kallsyms.h b/tools/lib/symbol/kallsyms.h index bc40101d72c1..72ab9870454b 100644 --- a/tools/lib/symbol/kallsyms.h +++ b/tools/lib/symbol/kallsyms.h @@ -20,6 +20,8 @@ static inline u8 kallsyms2elf_binding(char type) u8 kallsyms2elf_type(char type); +bool kallsyms__is_function(char symbol_type); + int kallsyms__parse(const char *filename, void *arg, int (*process_symbol)(void *arg, const char *name, char type, u64 start)); diff --git a/tools/memory-model/Documentation/cheatsheet.txt b/tools/memory-model/Documentation/cheatsheet.txt index 956b1ae4aafb..33ba98d72b16 100644 --- a/tools/memory-model/Documentation/cheatsheet.txt +++ b/tools/memory-model/Documentation/cheatsheet.txt @@ -1,6 +1,6 @@ Prior Operation Subsequent Operation --------------- --------------------------- - C Self R W RWM Self R W DR DW RMW SV + C Self R W RMW Self R W DR DW RMW SV -- ---- - - --- ---- - - -- -- --- -- Store, e.g., WRITE_ONCE() Y Y @@ -14,7 +14,7 @@ smp_wmb() Y W Y Y W smp_mb() & synchronize_rcu() CP Y Y Y Y Y Y Y Y Successful full non-void RMW CP Y Y Y Y Y Y Y Y Y Y Y smp_mb__before_atomic() CP Y Y Y a a a a Y -smp_mb__after_atomic() CP a a Y Y Y Y Y +smp_mb__after_atomic() CP a a Y Y Y Y Y Y Key: C: Ordering is cumulative @@ -26,4 +26,5 @@ Key: C: Ordering is cumulative DR: Dependent read (address dependency) DW: Dependent write (address, data, or control dependency) RMW: Atomic read-modify-write operation - SV Same-variable access + SELF: Orders self, as opposed to accesses before and/or after + SV: Orders later accesses to the same variable diff --git a/tools/memory-model/Documentation/explanation.txt b/tools/memory-model/Documentation/explanation.txt index a727c82bd434..1b09f3175a1f 100644 --- a/tools/memory-model/Documentation/explanation.txt +++ b/tools/memory-model/Documentation/explanation.txt @@ -27,7 +27,7 @@ Explanation of the Linux-Kernel Memory Consistency Model 19. AND THEN THERE WAS ALPHA 20. THE HAPPENS-BEFORE RELATION: hb 21. THE PROPAGATES-BEFORE RELATION: pb - 22. RCU RELATIONS: link, gp-link, rscs-link, and rcu-path + 22. RCU RELATIONS: rcu-link, gp, rscs, rcu-fence, and rb 23. ODDS AND ENDS @@ -1451,8 +1451,8 @@ they execute means that it cannot have cycles. This requirement is the content of the LKMM's "propagation" axiom. -RCU RELATIONS: link, gp-link, rscs-link, and rcu-path ------------------------------------------------------ +RCU RELATIONS: rcu-link, gp, rscs, rcu-fence, and rb +---------------------------------------------------- RCU (Read-Copy-Update) is a powerful synchronization mechanism. It rests on two concepts: grace periods and read-side critical sections. @@ -1509,8 +1509,8 @@ y, which occurs before the end of the critical section, did not propagate to P1 before the end of the grace period, violating the Guarantee. -In the kernel's implementations of RCU, the business about stores -propagating to every CPU is realized by placing strong fences at +In the kernel's implementations of RCU, the requirements for stores +to propagate to every CPU are fulfilled by placing strong fences at suitable places in the RCU-related code. Thus, if a critical section starts before a grace period does then the critical section's CPU will execute an smp_mb() fence after the end of the critical section and @@ -1523,72 +1523,124 @@ executes. What exactly do we mean by saying that a critical section "starts before" or "ends after" a grace period? Some aspects of the meaning are pretty obvious, as in the example above, but the details aren't -entirely clear. The LKMM formalizes this notion by means of a -relation with the unfortunately generic name "link". It is a very -general relation; among other things, X ->link Z includes cases where -X happens-before or is equal to some event Y which is equal to or -comes before Z in the coherence order. Taking Y = Z, this says that -X ->rfe Z implies X ->link Z, and taking Y = X, it says that X ->fr Z -and X ->co Z each imply X ->link Z. - -The formal definition of the link relation is more than a little +entirely clear. The LKMM formalizes this notion by means of the +rcu-link relation. rcu-link encompasses a very general notion of +"before": Among other things, X ->rcu-link Z includes cases where X +happens-before or is equal to some event Y which is equal to or comes +before Z in the coherence order. When Y = Z this says that X ->rfe Z +implies X ->rcu-link Z. In addition, when Y = X it says that X ->fr Z +and X ->co Z each imply X ->rcu-link Z. + +The formal definition of the rcu-link relation is more than a little obscure, and we won't give it here. It is closely related to the pb relation, and the details don't matter unless you want to comb through a somewhat lengthy formal proof. Pretty much all you need to know -about link is the information in the preceding paragraph. - -The LKMM goes on to define the gp-link and rscs-link relations. They -bring grace periods and read-side critical sections into the picture, -in the following way: - - E ->gp-link F means there is a synchronize_rcu() fence event S - and an event X such that E ->po S, either S ->po X or S = X, - and X ->link F. In other words, E and F are connected by a - grace period followed by an instance of link. - - E ->rscs-link F means there is a critical section delimited by - an rcu_read_lock() fence L and an rcu_read_unlock() fence U, - and an event X such that E ->po U, either L ->po X or L = X, - and X ->link F. Roughly speaking, this says that some event - in the same critical section as E is connected by link to F. - -If we think of the link relation as standing for an extended "before", -then E ->gp-link F says that E executes before a grace period which -ends before F executes. (In fact it says more than this, because it -includes cases where E executes before a grace period and some store -propagates to F's CPU before F executes and doesn't propagate to some -other CPU until after the grace period ends.) Similarly, -E ->rscs-link F says that E is part of (or before the start of) a -critical section which starts before F executes. +about rcu-link is the information in the preceding paragraph. + +The LKMM also defines the gp and rscs relations. They bring grace +periods and read-side critical sections into the picture, in the +following way: + + E ->gp F means there is a synchronize_rcu() fence event S such + that E ->po S and either S ->po F or S = F. In simple terms, + there is a grace period po-between E and F. + + E ->rscs F means there is a critical section delimited by an + rcu_read_lock() fence L and an rcu_read_unlock() fence U, such + that E ->po U and either L ->po F or L = F. You can think of + this as saying that E and F are in the same critical section + (in fact, it also allows E to be po-before the start of the + critical section and F to be po-after the end). + +If we think of the rcu-link relation as standing for an extended +"before", then X ->gp Y ->rcu-link Z says that X executes before a +grace period which ends before Z executes. (In fact it covers more +than this, because it also includes cases where X executes before a +grace period and some store propagates to Z's CPU before Z executes +but doesn't propagate to some other CPU until after the grace period +ends.) Similarly, X ->rscs Y ->rcu-link Z says that X is part of (or +before the start of) a critical section which starts before Z +executes. + +The LKMM goes on to define the rcu-fence relation as a sequence of gp +and rscs links separated by rcu-link links, in which the number of gp +links is >= the number of rscs links. For example: + + X ->gp Y ->rcu-link Z ->rscs T ->rcu-link U ->gp V + +would imply that X ->rcu-fence V, because this sequence contains two +gp links and only one rscs link. (It also implies that X ->rcu-fence T +and Z ->rcu-fence V.) On the other hand: + + X ->rscs Y ->rcu-link Z ->rscs T ->rcu-link U ->gp V + +does not imply X ->rcu-fence V, because the sequence contains only +one gp link but two rscs links. + +The rcu-fence relation is important because the Grace Period Guarantee +means that rcu-fence acts kind of like a strong fence. In particular, +if W is a write and we have W ->rcu-fence Z, the Guarantee says that W +will propagate to every CPU before Z executes. + +To prove this in full generality requires some intellectual effort. +We'll consider just a very simple case: + + W ->gp X ->rcu-link Y ->rscs Z. + +This formula means that there is a grace period G and a critical +section C such that: + + 1. W is po-before G; + + 2. X is equal to or po-after G; + + 3. X comes "before" Y in some sense; + + 4. Y is po-before the end of C; + + 5. Z is equal to or po-after the start of C. + +From 2 - 4 we deduce that the grace period G ends before the critical +section C. Then the second part of the Grace Period Guarantee says +not only that G starts before C does, but also that W (which executes +on G's CPU before G starts) must propagate to every CPU before C +starts. In particular, W propagates to every CPU before Z executes +(or finishes executing, in the case where Z is equal to the +rcu_read_lock() fence event which starts C.) This sort of reasoning +can be expanded to handle all the situations covered by rcu-fence. + +Finally, the LKMM defines the RCU-before (rb) relation in terms of +rcu-fence. This is done in essentially the same way as the pb +relation was defined in terms of strong-fence. We will omit the +details; the end result is that E ->rb F implies E must execute before +F, just as E ->pb F does (and for much the same reasons). Putting this all together, the LKMM expresses the Grace Period -Guarantee by requiring that there are no cycles consisting of gp-link -and rscs-link connections in which the number of gp-link instances is ->= the number of rscs-link instances. It does this by defining the -rcu-path relation to link events E and F whenever it is possible to -pass from E to F by a sequence of gp-link and rscs-link connections -with at least as many of the former as the latter. The LKMM's "rcu" -axiom then says that there are no events E such that E ->rcu-path E. - -Justifying this axiom takes some intellectual effort, but it is in -fact a valid formalization of the Grace Period Guarantee. We won't -attempt to go through the detailed argument, but the following -analysis gives a taste of what is involved. Suppose we have a -violation of the first part of the Guarantee: A critical section -starts before a grace period, and some store propagates to the -critical section's CPU before the end of the critical section but -doesn't propagate to some other CPU until after the end of the grace -period. +Guarantee by requiring that the rb relation does not contain a cycle. +Equivalently, this "rcu" axiom requires that there are no events E and +F with E ->rcu-link F ->rcu-fence E. Or to put it a third way, the +axiom requires that there are no cycles consisting of gp and rscs +alternating with rcu-link, where the number of gp links is >= the +number of rscs links. + +Justifying the axiom isn't easy, but it is in fact a valid +formalization of the Grace Period Guarantee. We won't attempt to go +through the detailed argument, but the following analysis gives a +taste of what is involved. Suppose we have a violation of the first +part of the Guarantee: A critical section starts before a grace +period, and some store propagates to the critical section's CPU before +the end of the critical section but doesn't propagate to some other +CPU until after the end of the grace period. Putting symbols to these ideas, let L and U be the rcu_read_lock() and rcu_read_unlock() fence events delimiting the critical section in question, and let S be the synchronize_rcu() fence event for the grace period. Saying that the critical section starts before S means there are events E and F where E is po-after L (which marks the start of the -critical section), E is "before" F in the sense of the link relation, -and F is po-before the grace period S: +critical section), E is "before" F in the sense of the rcu-link +relation, and F is po-before the grace period S: - L ->po E ->link F ->po S. + L ->po E ->rcu-link F ->po S. Let W be the store mentioned above, let Z come before the end of the critical section and witness that W propagates to the critical @@ -1600,16 +1652,19 @@ some event X which is po-after S. Symbolically, this amounts to: The fr link from Y to W indicates that W has not propagated to Y's CPU at the time that Y executes. From this, it can be shown (see the -discussion of the link relation earlier) that X and Z are connected by -link, yielding: +discussion of the rcu-link relation earlier) that X and Z are related +by rcu-link, yielding: + + S ->po X ->rcu-link Z ->po U. + +The formulas say that S is po-between F and X, hence F ->gp X. They +also say that Z comes before the end of the critical section and E +comes after its start, hence Z ->rscs E. From all this we obtain: - S ->po X ->link Z ->po U. + F ->gp X ->rcu-link Z ->rscs E ->rcu-link F, -These formulas say that S is po-between F and X, hence F ->gp-link Z -via X. They also say that Z comes before the end of the critical -section and E comes after its start, hence Z ->rscs-link F via E. But -now we have a forbidden cycle: F ->gp-link Z ->rscs-link F. Thus the -"rcu" axiom rules out this violation of the Grace Period Guarantee. +a forbidden cycle. Thus the "rcu" axiom rules out this violation of +the Grace Period Guarantee. For something a little more down-to-earth, let's see how the axiom works out in practice. Consider the RCU code example from above, this @@ -1635,18 +1690,18 @@ time with statement labels added to the memory access instructions: } -If r2 = 0 at the end then P0's store at X overwrites the value -that P1's load at Z reads from, so we have Z ->fre X and thus -Z ->link X. In addition, there is a synchronize_rcu() between Y and -Z, so therefore we have Y ->gp-link X. +If r2 = 0 at the end then P0's store at X overwrites the value that +P1's load at Z reads from, so we have Z ->fre X and thus Z ->rcu-link X. +In addition, there is a synchronize_rcu() between Y and Z, so therefore +we have Y ->gp Z. If r1 = 1 at the end then P1's load at Y reads from P0's store at W, -so we have W ->link Y. In addition, W and X are in the same critical -section, so therefore we have X ->rscs-link Y. +so we have W ->rcu-link Y. In addition, W and X are in the same critical +section, so therefore we have X ->rscs W. -This gives us a cycle, Y ->gp-link X ->rscs-link Y, with one gp-link -and one rscs-link, violating the "rcu" axiom. Hence the outcome is -not allowed by the LKMM, as we would expect. +Then X ->rscs W ->rcu-link Y ->gp Z ->rcu-link X is a forbidden cycle, +violating the "rcu" axiom. Hence the outcome is not allowed by the +LKMM, as we would expect. For contrast, let's see what can happen in a more complicated example: @@ -1682,15 +1737,11 @@ For contrast, let's see what can happen in a more complicated example: } If r0 = r1 = r2 = 1 at the end, then similar reasoning to before shows -that W ->rscs-link Y via X, Y ->gp-link U via Z, and U ->rscs-link W -via V. And just as before, this gives a cycle: - - W ->rscs-link Y ->gp-link U ->rscs-link W. - -However, this cycle has fewer gp-link instances than rscs-link -instances, and consequently the outcome is not forbidden by the LKMM. -The following instruction timing diagram shows how it might actually -occur: +that W ->rscs X ->rcu-link Y ->gp Z ->rcu-link U ->rscs V ->rcu-link W. +However this cycle is not forbidden, because the sequence of relations +contains fewer instances of gp (one) than of rscs (two). Consequently +the outcome is allowed by the LKMM. The following instruction timing +diagram shows how it might actually occur: P0 P1 P2 -------------------- -------------------- -------------------- diff --git a/tools/memory-model/Documentation/references.txt b/tools/memory-model/Documentation/references.txt index ba2e34c2ec3f..b177f3e4a614 100644 --- a/tools/memory-model/Documentation/references.txt +++ b/tools/memory-model/Documentation/references.txt @@ -63,15 +63,22 @@ o Shaked Flur, Susmit Sarkar, Christopher Pulte, Kyndylan Nienhuis, Principles of Programming Languages (POPL 2017). ACM, New York, NY, USA, 429–442. +o Christopher Pulte, Shaked Flur, Will Deacon, Jon French, + Susmit Sarkar, and Peter Sewell. 2018. "Simplifying ARM concurrency: + multicopy-atomic axiomatic and operational models for ARMv8". In + Proceedings of the ACM on Programming Languages, Volume 2, Issue + POPL, Article No. 19. ACM, New York, NY, USA. + Linux-kernel memory model ========================= -o Andrea Parri, Alan Stern, Luc Maranget, Paul E. McKenney, - and Jade Alglave. 2017. "A formal model of - Linux-kernel memory ordering - companion webpage". - http://moscova.inria.fr/∼maranget/cats7/linux/. (2017). [Online; - accessed 30-January-2017]. +o Jade Alglave, Luc Maranget, Paul E. McKenney, Andrea Parri, and + Alan Stern. 2018. "Frightening small children and disconcerting + grown-ups: Concurrency in the Linux kernel". In Proceedings of + the 23rd International Conference on Architectural Support for + Programming Languages and Operating Systems (ASPLOS 2018). ACM, + New York, NY, USA, 405-418. Webpage: http://diy.inria.fr/linux/. o Jade Alglave, Luc Maranget, Paul E. McKenney, Andrea Parri, and Alan Stern. 2017. "A formal kernel memory-ordering model (part 1)" diff --git a/tools/memory-model/README b/tools/memory-model/README index 0b3a5f3c9ccd..734f7feaa5dc 100644 --- a/tools/memory-model/README +++ b/tools/memory-model/README @@ -20,7 +20,7 @@ that litmus test to be exercised within the Linux kernel. REQUIREMENTS ============ -Version 7.48 of the "herd7" and "klitmus7" tools must be downloaded +Version 7.49 of the "herd7" and "klitmus7" tools must be downloaded separately: https://github.com/herd/herdtools7 diff --git a/tools/memory-model/linux-kernel.bell b/tools/memory-model/linux-kernel.bell index 432c7cf71b23..64f5740e0e75 100644 --- a/tools/memory-model/linux-kernel.bell +++ b/tools/memory-model/linux-kernel.bell @@ -5,10 +5,10 @@ * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu>, * Andrea Parri <parri.andrea@gmail.com> * - * An earlier version of this file appears in the companion webpage for + * An earlier version of this file appeared in the companion webpage for * "Frightening small children and disconcerting grown-ups: Concurrency * in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, - * which is to appear in ASPLOS 2018. + * which appeared in ASPLOS 2018. *) "Linux-kernel memory consistency model" diff --git a/tools/memory-model/linux-kernel.cat b/tools/memory-model/linux-kernel.cat index df97db03b6c2..59b5cbe6b624 100644 --- a/tools/memory-model/linux-kernel.cat +++ b/tools/memory-model/linux-kernel.cat @@ -5,10 +5,10 @@ * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu>, * Andrea Parri <parri.andrea@gmail.com> * - * An earlier version of this file appears in the companion webpage for + * An earlier version of this file appeared in the companion webpage for * "Frightening small children and disconcerting grown-ups: Concurrency * in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, - * which is to appear in ASPLOS 2018. + * which appeared in ASPLOS 2018. *) "Linux-kernel memory consistency model" @@ -100,22 +100,29 @@ let rscs = po ; crit^-1 ; po? * one but two non-rf relations, but only in conjunction with an RCU * read-side critical section. *) -let link = hb* ; pb* ; prop +let rcu-link = hb* ; pb* ; prop -(* Chains that affect the RCU grace-period guarantee *) -let gp-link = gp ; link -let rscs-link = rscs ; link +(* + * Any sequence containing at least as many grace periods as RCU read-side + * critical sections (joined by rcu-link) acts as a generalized strong fence. + *) +let rec rcu-fence = gp | + (gp ; rcu-link ; rscs) | + (rscs ; rcu-link ; gp) | + (gp ; rcu-link ; rcu-fence ; rcu-link ; rscs) | + (rscs ; rcu-link ; rcu-fence ; rcu-link ; gp) | + (rcu-fence ; rcu-link ; rcu-fence) + +(* rb orders instructions just as pb does *) +let rb = prop ; rcu-fence ; hb* ; pb* + +irreflexive rb as rcu (* - * A cycle containing at least as many grace periods as RCU read-side - * critical sections is forbidden. + * The happens-before, propagation, and rcu constraints are all + * expressions of temporal ordering. They could be replaced by + * a single constraint on an "executes-before" relation, xb: + * + * let xb = hb | pb | rb + * acyclic xb as executes-before *) -let rec rcu-path = - gp-link | - (gp-link ; rscs-link) | - (rscs-link ; gp-link) | - (rcu-path ; rcu-path) | - (gp-link ; rcu-path ; rscs-link) | - (rscs-link ; rcu-path ; gp-link) - -irreflexive rcu-path as rcu diff --git a/tools/memory-model/linux-kernel.def b/tools/memory-model/linux-kernel.def index 397e4e67e8c8..6fa3eb28d40b 100644 --- a/tools/memory-model/linux-kernel.def +++ b/tools/memory-model/linux-kernel.def @@ -1,9 +1,9 @@ // SPDX-License-Identifier: GPL-2.0+ // -// An earlier version of this file appears in the companion webpage for +// An earlier version of this file appeared in the companion webpage for // "Frightening small children and disconcerting grown-ups: Concurrency // in the Linux kernel" by Alglave, Maranget, McKenney, Parri, and Stern, -// which is to appear in ASPLOS 2018. +// which appeared in ASPLOS 2018. // ONCE READ_ONCE(X) __load{once}(X) @@ -14,14 +14,15 @@ smp_store_release(X,V) { __store{release}(*X,V); } smp_load_acquire(X) __load{acquire}(*X) rcu_assign_pointer(X,V) { __store{release}(X,V); } rcu_dereference(X) __load{once}(X) +smp_store_mb(X,V) { __store{once}(X,V); __fence{mb}; } // Fences -smp_mb() { __fence{mb} ; } -smp_rmb() { __fence{rmb} ; } -smp_wmb() { __fence{wmb} ; } -smp_mb__before_atomic() { __fence{before-atomic} ; } -smp_mb__after_atomic() { __fence{after-atomic} ; } -smp_mb__after_spinlock() { __fence{after-spinlock} ; } +smp_mb() { __fence{mb}; } +smp_rmb() { __fence{rmb}; } +smp_wmb() { __fence{wmb}; } +smp_mb__before_atomic() { __fence{before-atomic}; } +smp_mb__after_atomic() { __fence{after-atomic}; } +smp_mb__after_spinlock() { __fence{after-spinlock}; } // Exchange xchg(X,V) __xchg{mb}(X,V) @@ -34,26 +35,27 @@ cmpxchg_acquire(X,V,W) __cmpxchg{acquire}(X,V,W) cmpxchg_release(X,V,W) __cmpxchg{release}(X,V,W) // Spinlocks -spin_lock(X) { __lock(X) ; } -spin_unlock(X) { __unlock(X) ; } +spin_lock(X) { __lock(X); } +spin_unlock(X) { __unlock(X); } spin_trylock(X) __trylock(X) +spin_is_locked(X) __islocked(X) // RCU rcu_read_lock() { __fence{rcu-lock}; } -rcu_read_unlock() { __fence{rcu-unlock};} +rcu_read_unlock() { __fence{rcu-unlock}; } synchronize_rcu() { __fence{sync-rcu}; } synchronize_rcu_expedited() { __fence{sync-rcu}; } // Atomic atomic_read(X) READ_ONCE(*X) -atomic_set(X,V) { WRITE_ONCE(*X,V) ; } +atomic_set(X,V) { WRITE_ONCE(*X,V); } atomic_read_acquire(X) smp_load_acquire(X) atomic_set_release(X,V) { smp_store_release(X,V); } -atomic_add(V,X) { __atomic_op(X,+,V) ; } -atomic_sub(V,X) { __atomic_op(X,-,V) ; } -atomic_inc(X) { __atomic_op(X,+,1) ; } -atomic_dec(X) { __atomic_op(X,-,1) ; } +atomic_add(V,X) { __atomic_op(X,+,V); } +atomic_sub(V,X) { __atomic_op(X,-,V); } +atomic_inc(X) { __atomic_op(X,+,1); } +atomic_dec(X) { __atomic_op(X,-,1); } atomic_add_return(V,X) __atomic_op_return{mb}(X,+,V) atomic_add_return_relaxed(V,X) __atomic_op_return{once}(X,+,V) diff --git a/tools/memory-model/litmus-tests/.gitignore b/tools/memory-model/litmus-tests/.gitignore new file mode 100644 index 000000000000..6e2ddc54152f --- /dev/null +++ b/tools/memory-model/litmus-tests/.gitignore @@ -0,0 +1 @@ +*.litmus.out diff --git a/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus b/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus index 50d5db9ea983..98a3716efa37 100644 --- a/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus +++ b/tools/memory-model/litmus-tests/IRIW+mbonceonces+OnceOnce.litmus @@ -7,7 +7,7 @@ C IRIW+mbonceonces+OnceOnce * between each pairs of reads. In other words, is smp_mb() sufficient to * cause two different reading processes to agree on the order of a pair * of writes, where each write is to a different variable by a different - * process? + * process? This litmus test exercises LKMM's "propagation" rule. *) {} diff --git a/tools/memory-model/litmus-tests/MP+polockmbonce+poacquiresilsil.litmus b/tools/memory-model/litmus-tests/MP+polockmbonce+poacquiresilsil.litmus new file mode 100644 index 000000000000..50f4d62bbf0e --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+polockmbonce+poacquiresilsil.litmus @@ -0,0 +1,35 @@ +C MP+polockmbonce+poacquiresilsil + +(* + * Result: Never + * + * Do spinlocks combined with smp_mb__after_spinlock() provide order + * to outside observers using spin_is_locked() to sense the lock-held + * state, ordered by acquire? Note that when the first spin_is_locked() + * returns false and the second true, we know that the smp_load_acquire() + * executed before the lock was acquired (loosely speaking). + *) + +{ +} + +P0(spinlock_t *lo, int *x) +{ + spin_lock(lo); + smp_mb__after_spinlock(); + WRITE_ONCE(*x, 1); + spin_unlock(lo); +} + +P1(spinlock_t *lo, int *x) +{ + int r1; + int r2; + int r3; + + r1 = smp_load_acquire(x); + r2 = spin_is_locked(lo); + r3 = spin_is_locked(lo); +} + +exists (1:r1=1 /\ 1:r2=0 /\ 1:r3=1) diff --git a/tools/memory-model/litmus-tests/MP+polockonce+poacquiresilsil.litmus b/tools/memory-model/litmus-tests/MP+polockonce+poacquiresilsil.litmus new file mode 100644 index 000000000000..abf81e7a0895 --- /dev/null +++ b/tools/memory-model/litmus-tests/MP+polockonce+poacquiresilsil.litmus @@ -0,0 +1,34 @@ +C MP+polockonce+poacquiresilsil + +(* + * Result: Sometimes + * + * Do spinlocks provide order to outside observers using spin_is_locked() + * to sense the lock-held state, ordered by acquire? Note that when the + * first spin_is_locked() returns false and the second true, we know that + * the smp_load_acquire() executed before the lock was acquired (loosely + * speaking). + *) + +{ +} + +P0(spinlock_t *lo, int *x) +{ + spin_lock(lo); + WRITE_ONCE(*x, 1); + spin_unlock(lo); +} + +P1(spinlock_t *lo, int *x) +{ + int r1; + int r2; + int r3; + + r1 = smp_load_acquire(x); + r2 = spin_is_locked(lo); + r3 = spin_is_locked(lo); +} + +exists (1:r1=1 /\ 1:r2=0 /\ 1:r3=1) diff --git a/tools/memory-model/litmus-tests/README b/tools/memory-model/litmus-tests/README index 04096fb8b8d9..17eb9a8c222d 100644 --- a/tools/memory-model/litmus-tests/README +++ b/tools/memory-model/litmus-tests/README @@ -23,7 +23,8 @@ IRIW+mbonceonces+OnceOnce.litmus between each pairs of reads. In other words, is smp_mb() sufficient to cause two different reading processes to agree on the order of a pair of writes, where each write is to a different - variable by a different process? + variable by a different process? This litmus test is forbidden + by LKMM's propagation rule. IRIW+poonceonces+OnceOnce.litmus Test of independent reads from independent writes with nothing @@ -63,6 +64,16 @@ LB+poonceonces.litmus MP+onceassign+derefonce.litmus As below, but with rcu_assign_pointer() and an rcu_dereference(). +MP+polockmbonce+poacquiresilsil.litmus + Protect the access with a lock and an smp_mb__after_spinlock() + in one process, and use an acquire load followed by a pair of + spin_is_locked() calls in the other process. + +MP+polockonce+poacquiresilsil.litmus + Protect the access with a lock in one process, and use an + acquire load followed by a pair of spin_is_locked() calls + in the other process. + MP+polocks.litmus As below, but with the second access of the writer process and the first access of reader process protected by a lock. @@ -109,8 +120,10 @@ S+wmbonceonce+poacquireonce.litmus WRC+poonceonces+Once.litmus WRC+pooncerelease+rmbonceonce+Once.litmus - These two are members of an extension of the MP litmus-test class - in which the first write is moved to a separate process. + These two are members of an extension of the MP litmus-test + class in which the first write is moved to a separate process. + The second is forbidden because smp_store_release() is + A-cumulative in LKMM. Z6.0+pooncelock+pooncelock+pombonce.litmus Is the ordering provided by a spin_unlock() and a subsequent diff --git a/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus b/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus index 97fcbffde9a0..ad3448b941e6 100644 --- a/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus +++ b/tools/memory-model/litmus-tests/WRC+pooncerelease+rmbonceonce+Once.litmus @@ -5,7 +5,9 @@ C WRC+pooncerelease+rmbonceonce+Once * * This litmus test is an extension of the message-passing pattern, where * the first write is moved to a separate process. Because it features - * a release and a read memory barrier, it should be forbidden. + * a release and a read memory barrier, it should be forbidden. More + * specifically, this litmus test is forbidden because smp_store_release() + * is A-cumulative in LKMM. *) {} diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat index ba4a4ec6d313..305ded17e741 100644 --- a/tools/memory-model/lock.cat +++ b/tools/memory-model/lock.cat @@ -4,46 +4,72 @@ * Copyright (C) 2017 Alan Stern <stern@rowland.harvard.edu> *) -(* Generate coherence orders and handle lock operations *) +(* + * Generate coherence orders and handle lock operations + * + * Warning: spin_is_locked() crashes herd7 versions strictly before 7.48. + * spin_is_locked() is functional from herd7 version 7.49. + *) include "cross.cat" -(* From lock reads to their partner lock writes *) -let lk-rmw = ([LKR] ; po-loc ; [LKW]) \ (po ; po) -let rmw = rmw | lk-rmw - (* - * A paired LKR must always see an unlocked value; spin_lock() calls nested - * inside a critical section (for the same lock) always deadlock. + * The lock-related events generated by herd are as follows: + * + * LKR Lock-Read: the read part of a spin_lock() or successful + * spin_trylock() read-modify-write event pair + * LKW Lock-Write: the write part of a spin_lock() or successful + * spin_trylock() RMW event pair + * UL Unlock: a spin_unlock() event + * LF Lock-Fail: a failed spin_trylock() event + * RL Read-Locked: a spin_is_locked() event which returns True + * RU Read-Unlocked: a spin_is_locked() event which returns False + * + * LKR and LKW events always come paired, like all RMW event sequences. + * + * LKR, LF, RL, and RU are read events; LKR has Acquire ordering. + * LKW and UL are write events; UL has Release ordering. + * LKW, LF, RL, and RU have no ordering properties. *) -empty ([LKW] ; po-loc ; [domain(lk-rmw)]) \ (po-loc ; [UL] ; po-loc) - as lock-nest -(* The litmus test is invalid if an LKW event is not part of an RMW pair *) -flag ~empty LKW \ range(lk-rmw) as unpaired-LKW +(* Backward compatibility *) +let RL = try RL with emptyset +let RU = try RU with emptyset -(* This will be allowed if we implement spin_is_locked() *) -flag ~empty LKR \ domain(lk-rmw) as unpaired-LKR +(* Treat RL as a kind of LF: a read with no ordering properties *) +let LF = LF | RL -(* There should be no R or W accesses to spinlocks *) -let ALL-LOCKS = LKR | LKW | UL | LF +(* There should be no ordinary R or W accesses to spinlocks *) +let ALL-LOCKS = LKR | LKW | UL | LF | RU flag ~empty [M \ IW] ; loc ; [ALL-LOCKS] as mixed-lock-accesses +(* Link Lock-Reads to their RMW-partner Lock-Writes *) +let lk-rmw = ([LKR] ; po-loc ; [LKW]) \ (po ; po) +let rmw = rmw | lk-rmw + +(* The litmus test is invalid if an LKR/LKW event is not part of an RMW pair *) +flag ~empty LKW \ range(lk-rmw) as unpaired-LKW +flag ~empty LKR \ domain(lk-rmw) as unpaired-LKR + +(* + * An LKR must always see an unlocked value; spin_lock() calls nested + * inside a critical section (for the same lock) always deadlock. + *) +empty ([LKW] ; po-loc ; [LKR]) \ (po-loc ; [UL] ; po-loc) as lock-nest + (* The final value of a spinlock should not be tested *) flag ~empty [FW] ; loc ; [ALL-LOCKS] as lock-final - (* * Put lock operations in their appropriate classes, but leave UL out of W * until after the co relation has been generated. *) -let R = R | LKR | LF +let R = R | LKR | LF | RU let W = W | LKW let Release = Release | UL let Acquire = Acquire | LKR - (* Match LKW events to their corresponding UL events *) let critical = ([LKW] ; po-loc ; [UL]) \ (po-loc ; [LKW | UL] ; po-loc) @@ -53,27 +79,48 @@ flag ~empty UL \ range(critical) as unmatched-unlock let UNMATCHED-LKW = LKW \ domain(critical) empty ([UNMATCHED-LKW] ; loc ; [UNMATCHED-LKW]) \ id as unmatched-locks - (* rfi for LF events: link each LKW to the LF events in its critical section *) let rfi-lf = ([LKW] ; po-loc ; [LF]) \ ([LKW] ; po-loc ; [UL] ; po-loc) (* rfe for LF events *) let all-possible-rfe-lf = - (* - * Given an LF event r, compute the possible rfe edges for that event - * (all those starting from LKW events in other threads), - * and then convert that relation to a set of single-edge relations. - *) - let possible-rfe-lf r = - let pair-to-relation p = p ++ 0 - in map pair-to-relation ((LKW * {r}) & loc & ext) - (* Do this for each LF event r that isn't in rfi-lf *) - in map possible-rfe-lf (LF \ range(rfi-lf)) + (* + * Given an LF event r, compute the possible rfe edges for that event + * (all those starting from LKW events in other threads), + * and then convert that relation to a set of single-edge relations. + *) + let possible-rfe-lf r = + let pair-to-relation p = p ++ 0 + in map pair-to-relation ((LKW * {r}) & loc & ext) + (* Do this for each LF event r that isn't in rfi-lf *) + in map possible-rfe-lf (LF \ range(rfi-lf)) (* Generate all rf relations for LF events *) with rfe-lf from cross(all-possible-rfe-lf) -let rf = rf | rfi-lf | rfe-lf +let rf-lf = rfe-lf | rfi-lf + +(* + * RU, i.e., spin_is_locked() returning False, is slightly different. + * We rely on the memory model to rule out cases where spin_is_locked() + * within one of the lock's critical sections returns False. + *) + +(* rfi for RU events: an RU may read from the last po-previous UL *) +let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc) + +(* rfe for RU events: an RU may read from an external UL or the initial write *) +let all-possible-rfe-ru = + let possible-rfe-ru r = + let pair-to-relation p = p ++ 0 + in map pair-to-relation (((UL | IW) * {r}) & loc & ext) + in map possible-rfe-ru RU + +(* Generate all rf relations for RU events *) +with rfe-ru from cross(all-possible-rfe-ru) +let rf-ru = rfe-ru | rfi-ru +(* Final rf relation *) +let rf = rf | rf-lf | rf-ru (* Generate all co relations, including LKW events but not UL *) let co0 = co0 | ([IW] ; loc ; [LKW]) | diff --git a/tools/memory-model/scripts/checkalllitmus.sh b/tools/memory-model/scripts/checkalllitmus.sh new file mode 100644 index 000000000000..af0aa15ab84e --- /dev/null +++ b/tools/memory-model/scripts/checkalllitmus.sh @@ -0,0 +1,73 @@ +#!/bin/sh +# +# Run herd tests on all .litmus files in the specified directory (which +# defaults to litmus-tests) and check each file's result against a "Result:" +# comment within that litmus test. If the verification result does not +# match that specified in the litmus test, this script prints an error +# message prefixed with "^^^". It also outputs verification results to +# a file whose name is that of the specified litmus test, but with ".out" +# appended. +# +# Usage: +# sh checkalllitmus.sh [ directory ] +# +# The LINUX_HERD_OPTIONS environment variable may be used to specify +# arguments to herd, whose default is defined by the checklitmus.sh script. +# Thus, one would normally run this in the directory containing the memory +# model, specifying the pathname of the litmus test to check. +# +# This script makes no attempt to run the litmus tests concurrently. +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, you can access it online at +# http://www.gnu.org/licenses/gpl-2.0.html. +# +# Copyright IBM Corporation, 2018 +# +# Author: Paul E. McKenney <paulmck@linux.vnet.ibm.com> + +litmusdir=${1-litmus-tests} +if test -d "$litmusdir" -a -r "$litmusdir" -a -x "$litmusdir" +then + : +else + echo ' --- ' error: $litmusdir is not an accessible directory + exit 255 +fi + +# Find the checklitmus script. If it is not where we expect it, then +# assume that the caller has the PATH environment variable set +# appropriately. +if test -x scripts/checklitmus.sh +then + clscript=scripts/checklitmus.sh +else + clscript=checklitmus.sh +fi + +# Run the script on all the litmus tests in the specified directory +ret=0 +for i in litmus-tests/*.litmus +do + if ! $clscript $i + then + ret=1 + fi +done +if test "$ret" -ne 0 +then + echo " ^^^ VERIFICATION MISMATCHES" +else + echo All litmus tests verified as was expected. +fi +exit $ret diff --git a/tools/memory-model/scripts/checklitmus.sh b/tools/memory-model/scripts/checklitmus.sh new file mode 100644 index 000000000000..e2e477472844 --- /dev/null +++ b/tools/memory-model/scripts/checklitmus.sh @@ -0,0 +1,86 @@ +#!/bin/sh +# +# Run a herd test and check the result against a "Result:" comment within +# the litmus test. If the verification result does not match that specified +# in the litmus test, this script prints an error message prefixed with +# "^^^" and exits with a non-zero status. It also outputs verification +# results to a file whose name is that of the specified litmus test, but +# with ".out" appended. +# +# Usage: +# sh checklitmus.sh file.litmus +# +# The LINUX_HERD_OPTIONS environment variable may be used to specify +# arguments to herd, which default to "-conf linux-kernel.cfg". Thus, +# one would normally run this in the directory containing the memory model, +# specifying the pathname of the litmus test to check. +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, you can access it online at +# http://www.gnu.org/licenses/gpl-2.0.html. +# +# Copyright IBM Corporation, 2018 +# +# Author: Paul E. McKenney <paulmck@linux.vnet.ibm.com> + +litmus=$1 +herdoptions=${LINUX_HERD_OPTIONS--conf linux-kernel.cfg} + +if test -f "$litmus" -a -r "$litmus" +then + : +else + echo ' --- ' error: \"$litmus\" is not a readable file + exit 255 +fi +if grep -q '^ \* Result: ' $litmus +then + outcome=`grep -m 1 '^ \* Result: ' $litmus | awk '{ print $3 }'` +else + outcome=specified +fi + +echo Herd options: $herdoptions > $litmus.out +/usr/bin/time herd7 -o ~/tmp $herdoptions $litmus >> $litmus.out 2>&1 +grep "Herd options:" $litmus.out +grep '^Observation' $litmus.out +if grep -q '^Observation' $litmus.out +then + : +else + cat $litmus.out + echo ' ^^^ Verification error' + echo ' ^^^ Verification error' >> $litmus.out 2>&1 + exit 255 +fi +if test "$outcome" = DEADLOCK +then + echo grep 3 and 4 + if grep '^Observation' $litmus.out | grep -q 'Never 0 0$' + then + ret=0 + else + echo " ^^^ Unexpected non-$outcome verification" + echo " ^^^ Unexpected non-$outcome verification" >> $litmus.out 2>&1 + ret=1 + fi +elif grep '^Observation' $litmus.out | grep -q $outcome || test "$outcome" = Maybe +then + ret=0 +else + echo " ^^^ Unexpected non-$outcome verification" + echo " ^^^ Unexpected non-$outcome verification" >> $litmus.out 2>&1 + ret=1 +fi +tail -2 $litmus.out | head -1 +exit $ret diff --git a/tools/objtool/arch/x86/include/asm/insn.h b/tools/objtool/arch/x86/include/asm/insn.h index b3e32b010ab1..c2c01f84df75 100644 --- a/tools/objtool/arch/x86/include/asm/insn.h +++ b/tools/objtool/arch/x86/include/asm/insn.h @@ -208,4 +208,22 @@ static inline int insn_offset_immediate(struct insn *insn) return insn_offset_displacement(insn) + insn->displacement.nbytes; } +#define POP_SS_OPCODE 0x1f +#define MOV_SREG_OPCODE 0x8e + +/* + * Intel SDM Vol.3A 6.8.3 states; + * "Any single-step trap that would be delivered following the MOV to SS + * instruction or POP to SS instruction (because EFLAGS.TF is 1) is + * suppressed." + * This function returns true if @insn is MOV SS or POP SS. On these + * instructions, single stepping is suppressed. + */ +static inline int insn_masking_exception(struct insn *insn) +{ + return insn->opcode.bytes[0] == POP_SS_OPCODE || + (insn->opcode.bytes[0] == MOV_SREG_OPCODE && + X86_MODRM_REG(insn->modrm.bytes[0]) == 2); +} + #endif /* _ASM_X86_INSN_H */ diff --git a/tools/objtool/check.c b/tools/objtool/check.c index 5409f6f6c48d..3a31b238f885 100644 --- a/tools/objtool/check.c +++ b/tools/objtool/check.c @@ -59,6 +59,31 @@ static struct instruction *next_insn_same_sec(struct objtool_file *file, return next; } +static struct instruction *next_insn_same_func(struct objtool_file *file, + struct instruction *insn) +{ + struct instruction *next = list_next_entry(insn, list); + struct symbol *func = insn->func; + + if (!func) + return NULL; + + if (&next->list != &file->insn_list && next->func == func) + return next; + + /* Check if we're already in the subfunction: */ + if (func == func->cfunc) + return NULL; + + /* Move to the subfunction: */ + return find_insn(file, func->cfunc->sec, func->cfunc->offset); +} + +#define func_for_each_insn_all(file, func, insn) \ + for (insn = find_insn(file, func->sec, func->offset); \ + insn; \ + insn = next_insn_same_func(file, insn)) + #define func_for_each_insn(file, func, insn) \ for (insn = find_insn(file, func->sec, func->offset); \ insn && &insn->list != &file->insn_list && \ @@ -149,10 +174,14 @@ static int __dead_end_function(struct objtool_file *file, struct symbol *func, if (!strcmp(func->name, global_noreturns[i])) return 1; - if (!func->sec) + if (!func->len) return 0; - func_for_each_insn(file, func, insn) { + insn = find_insn(file, func->sec, func->offset); + if (!insn->func) + return 0; + + func_for_each_insn_all(file, func, insn) { empty = false; if (insn->type == INSN_RETURN) @@ -167,35 +196,28 @@ static int __dead_end_function(struct objtool_file *file, struct symbol *func, * case, the function's dead-end status depends on whether the target * of the sibling call returns. */ - func_for_each_insn(file, func, insn) { - if (insn->sec != func->sec || - insn->offset >= func->offset + func->len) - break; - + func_for_each_insn_all(file, func, insn) { if (insn->type == INSN_JUMP_UNCONDITIONAL) { struct instruction *dest = insn->jump_dest; - struct symbol *dest_func; if (!dest) /* sibling call to another file */ return 0; - if (dest->sec != func->sec || - dest->offset < func->offset || - dest->offset >= func->offset + func->len) { - /* local sibling call */ - dest_func = find_symbol_by_offset(dest->sec, - dest->offset); - if (!dest_func) - continue; + if (dest->func && dest->func->pfunc != insn->func->pfunc) { + /* local sibling call */ if (recursion == 5) { - WARN_FUNC("infinite recursion (objtool bug!)", - dest->sec, dest->offset); - return -1; + /* + * Infinite recursion: two functions + * have sibling calls to each other. + * This is a very rare case. It means + * they aren't dead ends. + */ + return 0; } - return __dead_end_function(file, dest_func, + return __dead_end_function(file, dest->func, recursion + 1); } } @@ -422,7 +444,7 @@ static void add_ignores(struct objtool_file *file) if (!ignore_func(file, func)) continue; - func_for_each_insn(file, func, insn) + func_for_each_insn_all(file, func, insn) insn->ignore = true; } } @@ -782,30 +804,35 @@ out: return ret; } -static int add_switch_table(struct objtool_file *file, struct symbol *func, - struct instruction *insn, struct rela *table, - struct rela *next_table) +static int add_switch_table(struct objtool_file *file, struct instruction *insn, + struct rela *table, struct rela *next_table) { struct rela *rela = table; struct instruction *alt_insn; struct alternative *alt; + struct symbol *pfunc = insn->func->pfunc; + unsigned int prev_offset = 0; list_for_each_entry_from(rela, &file->rodata->rela->rela_list, list) { if (rela == next_table) break; - if (rela->sym->sec != insn->sec || - rela->addend <= func->offset || - rela->addend >= func->offset + func->len) + /* Make sure the switch table entries are consecutive: */ + if (prev_offset && rela->offset != prev_offset + 8) break; - alt_insn = find_insn(file, insn->sec, rela->addend); - if (!alt_insn) { - WARN("%s: can't find instruction at %s+0x%x", - file->rodata->rela->name, insn->sec->name, - rela->addend); - return -1; - } + /* Detect function pointers from contiguous objects: */ + if (rela->sym->sec == pfunc->sec && + rela->addend == pfunc->offset) + break; + + alt_insn = find_insn(file, rela->sym->sec, rela->addend); + if (!alt_insn) + break; + + /* Make sure the jmp dest is in the function or subfunction: */ + if (alt_insn->func->pfunc != pfunc) + break; alt = malloc(sizeof(*alt)); if (!alt) { @@ -815,6 +842,13 @@ static int add_switch_table(struct objtool_file *file, struct symbol *func, alt->insn = alt_insn; list_add_tail(&alt->list, &insn->alts); + prev_offset = rela->offset; + } + + if (!prev_offset) { + WARN_FUNC("can't find switch jump table", + insn->sec, insn->offset); + return -1; } return 0; @@ -869,40 +903,21 @@ static struct rela *find_switch_table(struct objtool_file *file, { struct rela *text_rela, *rodata_rela; struct instruction *orig_insn = insn; + unsigned long table_offset; - text_rela = find_rela_by_dest_range(insn->sec, insn->offset, insn->len); - if (text_rela && text_rela->sym == file->rodata->sym) { - /* case 1 */ - rodata_rela = find_rela_by_dest(file->rodata, - text_rela->addend); - if (rodata_rela) - return rodata_rela; - - /* case 2 */ - rodata_rela = find_rela_by_dest(file->rodata, - text_rela->addend + 4); - if (!rodata_rela) - return NULL; - - file->ignore_unreachables = true; - return rodata_rela; - } - - /* case 3 */ /* * Backward search using the @first_jump_src links, these help avoid * much of the 'in between' code. Which avoids us getting confused by * it. */ - for (insn = list_prev_entry(insn, list); - + for (; &insn->list != &file->insn_list && insn->sec == func->sec && insn->offset >= func->offset; insn = insn->first_jump_src ?: list_prev_entry(insn, list)) { - if (insn->type == INSN_JUMP_DYNAMIC) + if (insn != orig_insn && insn->type == INSN_JUMP_DYNAMIC) break; /* allow small jumps within the range */ @@ -918,18 +933,29 @@ static struct rela *find_switch_table(struct objtool_file *file, if (!text_rela || text_rela->sym != file->rodata->sym) continue; + table_offset = text_rela->addend; + if (text_rela->type == R_X86_64_PC32) + table_offset += 4; + /* * Make sure the .rodata address isn't associated with a * symbol. gcc jump tables are anonymous data. */ - if (find_symbol_containing(file->rodata, text_rela->addend)) + if (find_symbol_containing(file->rodata, table_offset)) continue; - rodata_rela = find_rela_by_dest(file->rodata, text_rela->addend); - if (!rodata_rela) - continue; + rodata_rela = find_rela_by_dest(file->rodata, table_offset); + if (rodata_rela) { + /* + * Use of RIP-relative switch jumps is quite rare, and + * indicates a rare GCC quirk/bug which can leave dead + * code behind. + */ + if (text_rela->type == R_X86_64_PC32) + file->ignore_unreachables = true; - return rodata_rela; + return rodata_rela; + } } return NULL; @@ -943,7 +969,7 @@ static int add_func_switch_tables(struct objtool_file *file, struct rela *rela, *prev_rela = NULL; int ret; - func_for_each_insn(file, func, insn) { + func_for_each_insn_all(file, func, insn) { if (!last) last = insn; @@ -974,8 +1000,7 @@ static int add_func_switch_tables(struct objtool_file *file, * the beginning of another switch table in the same function. */ if (prev_jump) { - ret = add_switch_table(file, func, prev_jump, prev_rela, - rela); + ret = add_switch_table(file, prev_jump, prev_rela, rela); if (ret) return ret; } @@ -985,7 +1010,7 @@ static int add_func_switch_tables(struct objtool_file *file, } if (prev_jump) { - ret = add_switch_table(file, func, prev_jump, prev_rela, NULL); + ret = add_switch_table(file, prev_jump, prev_rela, NULL); if (ret) return ret; } @@ -1749,15 +1774,13 @@ static int validate_branch(struct objtool_file *file, struct instruction *first, while (1) { next_insn = next_insn_same_sec(file, insn); - - if (file->c_file && func && insn->func && func != insn->func) { + if (file->c_file && func && insn->func && func != insn->func->pfunc) { WARN("%s() falls through to next function %s()", func->name, insn->func->name); return 1; } - if (insn->func) - func = insn->func; + func = insn->func ? insn->func->pfunc : NULL; if (func && insn->ignore) { WARN_FUNC("BUG: why am I validating an ignored function?", @@ -1778,7 +1801,7 @@ static int validate_branch(struct objtool_file *file, struct instruction *first, i = insn; save_insn = NULL; - func_for_each_insn_continue_reverse(file, func, i) { + func_for_each_insn_continue_reverse(file, insn->func, i) { if (i->save) { save_insn = i; break; @@ -1865,7 +1888,7 @@ static int validate_branch(struct objtool_file *file, struct instruction *first, case INSN_JUMP_UNCONDITIONAL: if (insn->jump_dest && (!func || !insn->jump_dest->func || - func == insn->jump_dest->func)) { + insn->jump_dest->func->pfunc == func)) { ret = validate_branch(file, insn->jump_dest, state); if (ret) @@ -2060,7 +2083,7 @@ static int validate_functions(struct objtool_file *file) for_each_sec(file, sec) { list_for_each_entry(func, &sec->symbol_list, list) { - if (func->type != STT_FUNC) + if (func->type != STT_FUNC || func->pfunc != func) continue; insn = find_insn(file, sec, func->offset); diff --git a/tools/objtool/elf.c b/tools/objtool/elf.c index c1c338661699..4e60e105583e 100644 --- a/tools/objtool/elf.c +++ b/tools/objtool/elf.c @@ -79,6 +79,19 @@ struct symbol *find_symbol_by_offset(struct section *sec, unsigned long offset) return NULL; } +struct symbol *find_symbol_by_name(struct elf *elf, const char *name) +{ + struct section *sec; + struct symbol *sym; + + list_for_each_entry(sec, &elf->sections, list) + list_for_each_entry(sym, &sec->symbol_list, list) + if (!strcmp(sym->name, name)) + return sym; + + return NULL; +} + struct symbol *find_symbol_containing(struct section *sec, unsigned long offset) { struct symbol *sym; @@ -203,10 +216,11 @@ static int read_sections(struct elf *elf) static int read_symbols(struct elf *elf) { - struct section *symtab; - struct symbol *sym; + struct section *symtab, *sec; + struct symbol *sym, *pfunc; struct list_head *entry, *tmp; int symbols_nr, i; + char *coldstr; symtab = find_section_by_name(elf, ".symtab"); if (!symtab) { @@ -281,6 +295,30 @@ static int read_symbols(struct elf *elf) hash_add(sym->sec->symbol_hash, &sym->hash, sym->idx); } + /* Create parent/child links for any cold subfunctions */ + list_for_each_entry(sec, &elf->sections, list) { + list_for_each_entry(sym, &sec->symbol_list, list) { + if (sym->type != STT_FUNC) + continue; + sym->pfunc = sym->cfunc = sym; + coldstr = strstr(sym->name, ".cold."); + if (coldstr) { + coldstr[0] = '\0'; + pfunc = find_symbol_by_name(elf, sym->name); + coldstr[0] = '.'; + + if (!pfunc) { + WARN("%s(): can't find parent function", + sym->name); + goto err; + } + + sym->pfunc = pfunc; + pfunc->cfunc = sym; + } + } + } + return 0; err: diff --git a/tools/objtool/elf.h b/tools/objtool/elf.h index d86e2ff14466..de5cd2ddded9 100644 --- a/tools/objtool/elf.h +++ b/tools/objtool/elf.h @@ -61,6 +61,7 @@ struct symbol { unsigned char bind, type; unsigned long offset; unsigned int len; + struct symbol *pfunc, *cfunc; }; struct rela { @@ -86,6 +87,7 @@ struct elf { struct elf *elf_open(const char *name, int flags); struct section *find_section_by_name(struct elf *elf, const char *name); struct symbol *find_symbol_by_offset(struct section *sec, unsigned long offset); +struct symbol *find_symbol_by_name(struct elf *elf, const char *name); struct symbol *find_symbol_containing(struct section *sec, unsigned long offset); struct rela *find_rela_by_dest(struct section *sec, unsigned long offset); struct rela *find_rela_by_dest_range(struct section *sec, unsigned long offset, diff --git a/tools/perf/Documentation/Makefile b/tools/perf/Documentation/Makefile index db11478e30b4..42261a9b280e 100644 --- a/tools/perf/Documentation/Makefile +++ b/tools/perf/Documentation/Makefile @@ -47,7 +47,8 @@ man5dir=$(mandir)/man5 man7dir=$(mandir)/man7 ASCIIDOC=asciidoc -ASCIIDOC_EXTRA = --unsafe +ASCIIDOC_EXTRA = --unsafe -f asciidoc.conf +ASCIIDOC_HTML = xhtml11 MANPAGE_XSL = manpage-normal.xsl XMLTO_EXTRA = INSTALL?=install @@ -55,6 +56,14 @@ RM ?= rm -f DOC_REF = origin/man HTML_REF = origin/html +ifdef USE_ASCIIDOCTOR +ASCIIDOC = asciidoctor +ASCIIDOC_EXTRA = -a compat-mode +ASCIIDOC_EXTRA += -I. -rasciidoctor-extensions +ASCIIDOC_EXTRA += -a mansource="perf" -a manmanual="perf Manual" +ASCIIDOC_HTML = xhtml5 +endif + infodir?=$(prefix)/share/info MAKEINFO=makeinfo INSTALL_INFO=install-info @@ -73,10 +82,12 @@ ifeq ($(_tmp_tool_path),) missing_tools = $(ASCIIDOC) endif +ifndef USE_ASCIIDOCTOR _tmp_tool_path := $(call get-executable,$(XMLTO)) ifeq ($(_tmp_tool_path),) missing_tools += $(XMLTO) endif +endif # # For asciidoc ... @@ -264,9 +275,17 @@ clean: $(MAN_HTML): $(OUTPUT)%.html : %.txt $(QUIET_ASCIIDOC)$(RM) $@+ $@ && \ - $(ASCIIDOC) -b xhtml11 -d manpage -f asciidoc.conf \ + $(ASCIIDOC) -b $(ASCIIDOC_HTML) -d manpage \ + $(ASCIIDOC_EXTRA) -aperf_version=$(PERF_VERSION) -o $@+ $< && \ + mv $@+ $@ + +ifdef USE_ASCIIDOCTOR +$(OUTPUT)%.1 $(OUTPUT)%.5 $(OUTPUT)%.7 : $(OUTPUT)%.txt + $(QUIET_ASCIIDOC)$(RM) $@+ $@ && \ + $(ASCIIDOC) -b manpage -d manpage \ $(ASCIIDOC_EXTRA) -aperf_version=$(PERF_VERSION) -o $@+ $< && \ mv $@+ $@ +endif $(OUTPUT)%.1 $(OUTPUT)%.5 $(OUTPUT)%.7 : $(OUTPUT)%.xml $(QUIET_XMLTO)$(RM) $@ && \ @@ -274,7 +293,7 @@ $(OUTPUT)%.1 $(OUTPUT)%.5 $(OUTPUT)%.7 : $(OUTPUT)%.xml $(OUTPUT)%.xml : %.txt $(QUIET_ASCIIDOC)$(RM) $@+ $@ && \ - $(ASCIIDOC) -b docbook -d manpage -f asciidoc.conf \ + $(ASCIIDOC) -b docbook -d manpage \ $(ASCIIDOC_EXTRA) -aperf_version=$(PERF_VERSION) -o $@+ $< && \ mv $@+ $@ @@ -321,13 +340,13 @@ howto-index.txt: howto-index.sh $(wildcard howto/*.txt) mv $@+ $@ $(patsubst %,%.html,$(ARTICLES)) : %.html : %.txt - $(QUIET_ASCIIDOC)$(ASCIIDOC) -b xhtml11 $*.txt + $(QUIET_ASCIIDOC)$(ASCIIDOC) -b $(ASCIIDOC_HTML) $*.txt WEBDOC_DEST = /pub/software/tools/perf/docs $(patsubst %.txt,%.html,$(wildcard howto/*.txt)): %.html : %.txt $(QUIET_ASCIIDOC)$(RM) $@+ $@ && \ - sed -e '1,/^$$/d' $< | $(ASCIIDOC) -b xhtml11 - >$@+ && \ + sed -e '1,/^$$/d' $< | $(ASCIIDOC) -b $(ASCIIDOC_HTML) - >$@+ && \ mv $@+ $@ # UNIMPLEMENTED diff --git a/tools/perf/Documentation/asciidoctor-extensions.rb b/tools/perf/Documentation/asciidoctor-extensions.rb new file mode 100644 index 000000000000..d148fe95c0c4 --- /dev/null +++ b/tools/perf/Documentation/asciidoctor-extensions.rb @@ -0,0 +1,29 @@ +require 'asciidoctor' +require 'asciidoctor/extensions' + +module Perf + module Documentation + class LinkPerfProcessor < Asciidoctor::Extensions::InlineMacroProcessor + use_dsl + + named :chrome + + def process(parent, target, attrs) + if parent.document.basebackend? 'html' + %(<a href="#{target}.html">#{target}(#{attrs[1]})</a>\n) + elsif parent.document.basebackend? 'manpage' + "#{target}(#{attrs[1]})" + elsif parent.document.basebackend? 'docbook' + "<citerefentry>\n" \ + "<refentrytitle>#{target}</refentrytitle>" \ + "<manvolnum>#{attrs[1]}</manvolnum>\n" \ + "</citerefentry>\n" + end + end + end + end +end + +Asciidoctor::Extensions.register do + inline_macro Perf::Documentation::LinkPerfProcessor, :linkperf +end diff --git a/tools/perf/Documentation/perf-buildid-cache.txt b/tools/perf/Documentation/perf-buildid-cache.txt index 73c2650bd0db..f6de0952ff3c 100644 --- a/tools/perf/Documentation/perf-buildid-cache.txt +++ b/tools/perf/Documentation/perf-buildid-cache.txt @@ -48,6 +48,9 @@ OPTIONS --purge=:: Purge all cached binaries including older caches which have specified path from the cache. +-P:: +--purge-all:: + Purge all cached binaries. This will flush out entire cache. -M:: --missing=:: List missing build ids in the cache for the specified file. @@ -59,7 +62,9 @@ OPTIONS exactly same build-id, that is replaced by new one. It can be used to update kallsyms and kernel dso to vmlinux in order to support annotation. - +-l:: +--list:: + List all valid binaries from cache. -v:: --verbose:: Be more verbose. diff --git a/tools/perf/Documentation/perf-stat.txt b/tools/perf/Documentation/perf-stat.txt index e6c3b4e555c2..3a822f308e6d 100644 --- a/tools/perf/Documentation/perf-stat.txt +++ b/tools/perf/Documentation/perf-stat.txt @@ -116,6 +116,22 @@ Do not aggregate counts across all monitored CPUs. print counts using a CSV-style output to make it easy to import directly into spreadsheets. Columns are separated by the string specified in SEP. +--table:: Display time for each run (-r option), in a table format, e.g.: + + $ perf stat --null -r 5 --table perf bench sched pipe + + Performance counter stats for 'perf bench sched pipe' (5 runs): + + # Table of individual measurements: + 5.189 (-0.293) # + 5.189 (-0.294) # + 5.186 (-0.296) # + 5.663 (+0.181) ## + 6.186 (+0.703) #### + + # Final result: + 5.483 +- 0.198 seconds time elapsed ( +- 3.62% ) + -G name:: --cgroup name:: monitor only in the container (cgroup) called "name". This option is available only diff --git a/tools/perf/Documentation/perf.data-file-format.txt b/tools/perf/Documentation/perf.data-file-format.txt index d00f0d51cab8..dfb218feaad9 100644 --- a/tools/perf/Documentation/perf.data-file-format.txt +++ b/tools/perf/Documentation/perf.data-file-format.txt @@ -111,8 +111,8 @@ A perf_header_string with the CPU architecture (uname -m) A structure defining the number of CPUs. struct nr_cpus { - uint32_t nr_cpus_online; uint32_t nr_cpus_available; /* CPUs not yet onlined */ + uint32_t nr_cpus_online; }; HEADER_CPUDESC = 8, @@ -153,10 +153,18 @@ struct { HEADER_CPU_TOPOLOGY = 13, String lists defining the core and CPU threads topology. +The string lists are followed by a variable length array +which contains core_id and socket_id of each cpu. +The number of entries can be determined by the size of the +section minus the sizes of both string lists. struct { struct perf_header_string_list cores; /* Variable length */ struct perf_header_string_list threads; /* Variable length */ + struct { + uint32_t core_id; + uint32_t socket_id; + } cpus[nr]; /* Variable length records */ }; Example: diff --git a/tools/perf/Makefile.config b/tools/perf/Makefile.config index ae7dc46e8f8a..b5ac356ba323 100644 --- a/tools/perf/Makefile.config +++ b/tools/perf/Makefile.config @@ -885,6 +885,8 @@ endif # Among the variables below, these: # perfexecdir +# perf_include_dir +# perf_examples_dir # template_dir # mandir # infodir @@ -904,6 +906,8 @@ bindir = $(abspath $(prefix)/$(bindir_relative)) mandir = share/man infodir = share/info perfexecdir = libexec/perf-core +perf_include_dir = lib/include/perf +perf_examples_dir = lib/examples/perf sharedir = $(prefix)/share template_dir = share/perf-core/templates STRACE_GROUPS_DIR = share/perf-core/strace/groups @@ -934,6 +938,8 @@ bindir_SQ = $(subst ','\'',$(bindir)) mandir_SQ = $(subst ','\'',$(mandir)) infodir_SQ = $(subst ','\'',$(infodir)) perfexecdir_SQ = $(subst ','\'',$(perfexecdir)) +perf_include_dir_SQ = $(subst ','\'',$(perf_include_dir)) +perf_examples_dir_SQ = $(subst ','\'',$(perf_examples_dir)) template_dir_SQ = $(subst ','\'',$(template_dir)) htmldir_SQ = $(subst ','\'',$(htmldir)) tipdir_SQ = $(subst ','\'',$(tipdir)) @@ -944,14 +950,20 @@ srcdir_SQ = $(subst ','\'',$(srcdir)) ifneq ($(filter /%,$(firstword $(perfexecdir))),) perfexec_instdir = $(perfexecdir) +perf_include_instdir = $(perf_include_dir) +perf_examples_instdir = $(perf_examples_dir) STRACE_GROUPS_INSTDIR = $(STRACE_GROUPS_DIR) tip_instdir = $(tipdir) else perfexec_instdir = $(prefix)/$(perfexecdir) +perf_include_instdir = $(prefix)/$(perf_include_dir) +perf_examples_instdir = $(prefix)/$(perf_examples_dir) STRACE_GROUPS_INSTDIR = $(prefix)/$(STRACE_GROUPS_DIR) tip_instdir = $(prefix)/$(tipdir) endif perfexec_instdir_SQ = $(subst ','\'',$(perfexec_instdir)) +perf_include_instdir_SQ = $(subst ','\'',$(perf_include_instdir)) +perf_examples_instdir_SQ = $(subst ','\'',$(perf_examples_instdir)) STRACE_GROUPS_INSTDIR_SQ = $(subst ','\'',$(STRACE_GROUPS_INSTDIR)) tip_instdir_SQ = $(subst ','\'',$(tip_instdir)) @@ -999,6 +1011,8 @@ $(call detected_var,ETC_PERFCONFIG_SQ) $(call detected_var,STRACE_GROUPS_DIR_SQ) $(call detected_var,prefix_SQ) $(call detected_var,perfexecdir_SQ) +$(call detected_var,perf_include_dir_SQ) +$(call detected_var,perf_examples_dir_SQ) $(call detected_var,tipdir_SQ) $(call detected_var,srcdir_SQ) $(call detected_var,LIBDIR) diff --git a/tools/perf/Makefile.perf b/tools/perf/Makefile.perf index 83e453de36f8..ecc9fc952655 100644 --- a/tools/perf/Makefile.perf +++ b/tools/perf/Makefile.perf @@ -767,6 +767,16 @@ ifndef NO_JVMTI endif $(call QUIET_INSTALL, libexec) \ $(INSTALL) -d -m 755 '$(DESTDIR_SQ)$(perfexec_instdir_SQ)' +ifndef NO_LIBBPF + $(call QUIET_INSTALL, lib) \ + $(INSTALL) -d -m 755 '$(DESTDIR_SQ)$(perf_include_instdir_SQ)/bpf' + $(call QUIET_INSTALL, include/bpf) \ + $(INSTALL) include/bpf/*.h '$(DESTDIR_SQ)$(perf_include_instdir_SQ)/bpf' + $(call QUIET_INSTALL, lib) \ + $(INSTALL) -d -m 755 '$(DESTDIR_SQ)$(perf_examples_instdir_SQ)/bpf' + $(call QUIET_INSTALL, examples/bpf) \ + $(INSTALL) examples/bpf/*.c '$(DESTDIR_SQ)$(perf_examples_instdir_SQ)/bpf' +endif $(call QUIET_INSTALL, perf-archive) \ $(INSTALL) $(OUTPUT)perf-archive -t '$(DESTDIR_SQ)$(perfexec_instdir_SQ)' $(call QUIET_INSTALL, perf-with-kcore) \ diff --git a/tools/perf/arch/arm/tests/dwarf-unwind.c b/tools/perf/arch/arm/tests/dwarf-unwind.c index 8cb347760233..9a0242e74cfc 100644 --- a/tools/perf/arch/arm/tests/dwarf-unwind.c +++ b/tools/perf/arch/arm/tests/dwarf-unwind.c @@ -25,7 +25,7 @@ static int sample_ustack(struct perf_sample *sample, sp = (unsigned long) regs[PERF_REG_ARM_SP]; - map = map_groups__find(thread->mg, MAP__VARIABLE, (u64) sp); + map = map_groups__find(thread->mg, (u64)sp); if (!map) { pr_debug("failed to get stack map\n"); free(buf); diff --git a/tools/perf/arch/arm64/tests/dwarf-unwind.c b/tools/perf/arch/arm64/tests/dwarf-unwind.c index e907f0f4c20c..5522ce384723 100644 --- a/tools/perf/arch/arm64/tests/dwarf-unwind.c +++ b/tools/perf/arch/arm64/tests/dwarf-unwind.c @@ -25,7 +25,7 @@ static int sample_ustack(struct perf_sample *sample, sp = (unsigned long) regs[PERF_REG_ARM64_SP]; - map = map_groups__find(thread->mg, MAP__VARIABLE, (u64) sp); + map = map_groups__find(thread->mg, (u64)sp); if (!map) { pr_debug("failed to get stack map\n"); free(buf); diff --git a/tools/perf/arch/powerpc/tests/dwarf-unwind.c b/tools/perf/arch/powerpc/tests/dwarf-unwind.c index 30cbbd6d5be0..5f39efef0856 100644 --- a/tools/perf/arch/powerpc/tests/dwarf-unwind.c +++ b/tools/perf/arch/powerpc/tests/dwarf-unwind.c @@ -26,7 +26,7 @@ static int sample_ustack(struct perf_sample *sample, sp = (unsigned long) regs[PERF_REG_POWERPC_R1]; - map = map_groups__find(thread->mg, MAP__VARIABLE, (u64) sp); + map = map_groups__find(thread->mg, (u64)sp); if (!map) { pr_debug("failed to get stack map\n"); free(buf); diff --git a/tools/perf/arch/powerpc/util/skip-callchain-idx.c b/tools/perf/arch/powerpc/util/skip-callchain-idx.c index 0c370f81e002..3598b8b75d27 100644 --- a/tools/perf/arch/powerpc/util/skip-callchain-idx.c +++ b/tools/perf/arch/powerpc/util/skip-callchain-idx.c @@ -248,8 +248,7 @@ int arch_skip_callchain_idx(struct thread *thread, struct ip_callchain *chain) ip = chain->ips[2]; - thread__find_addr_location(thread, PERF_RECORD_MISC_USER, - MAP__FUNCTION, ip, &al); + thread__find_symbol(thread, PERF_RECORD_MISC_USER, ip, &al); if (al.map) dso = al.map->dso; diff --git a/tools/perf/arch/x86/tests/dwarf-unwind.c b/tools/perf/arch/x86/tests/dwarf-unwind.c index 95036c7a59e8..7879df34569a 100644 --- a/tools/perf/arch/x86/tests/dwarf-unwind.c +++ b/tools/perf/arch/x86/tests/dwarf-unwind.c @@ -26,7 +26,7 @@ static int sample_ustack(struct perf_sample *sample, sp = (unsigned long) regs[PERF_REG_X86_SP]; - map = map_groups__find(thread->mg, MAP__VARIABLE, (u64) sp); + map = map_groups__find(thread->mg, (u64)sp); if (!map) { pr_debug("failed to get stack map\n"); free(buf); diff --git a/tools/perf/arch/x86/util/Build b/tools/perf/arch/x86/util/Build index f95e6f46ef0d..844b8f335532 100644 --- a/tools/perf/arch/x86/util/Build +++ b/tools/perf/arch/x86/util/Build @@ -4,6 +4,8 @@ libperf-y += pmu.o libperf-y += kvm-stat.o libperf-y += perf_regs.o libperf-y += group.o +libperf-y += machine.o +libperf-y += event.o libperf-$(CONFIG_DWARF) += dwarf-regs.o libperf-$(CONFIG_BPF_PROLOGUE) += dwarf-regs.o diff --git a/tools/perf/arch/x86/util/event.c b/tools/perf/arch/x86/util/event.c new file mode 100644 index 000000000000..675a0213044d --- /dev/null +++ b/tools/perf/arch/x86/util/event.c @@ -0,0 +1,76 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <linux/types.h> +#include <linux/string.h> + +#include "../../util/machine.h" +#include "../../util/tool.h" +#include "../../util/map.h" +#include "../../util/util.h" +#include "../../util/debug.h" + +#if defined(__x86_64__) + +int perf_event__synthesize_extra_kmaps(struct perf_tool *tool, + perf_event__handler_t process, + struct machine *machine) +{ + int rc = 0; + struct map *pos; + struct map_groups *kmaps = &machine->kmaps; + struct maps *maps = &kmaps->maps; + union perf_event *event = zalloc(sizeof(event->mmap) + + machine->id_hdr_size); + + if (!event) { + pr_debug("Not enough memory synthesizing mmap event " + "for extra kernel maps\n"); + return -1; + } + + for (pos = maps__first(maps); pos; pos = map__next(pos)) { + struct kmap *kmap; + size_t size; + + if (!__map__is_extra_kernel_map(pos)) + continue; + + kmap = map__kmap(pos); + + size = sizeof(event->mmap) - sizeof(event->mmap.filename) + + PERF_ALIGN(strlen(kmap->name) + 1, sizeof(u64)) + + machine->id_hdr_size; + + memset(event, 0, size); + + event->mmap.header.type = PERF_RECORD_MMAP; + + /* + * kernel uses 0 for user space maps, see kernel/perf_event.c + * __perf_event_mmap + */ + if (machine__is_host(machine)) + event->header.misc = PERF_RECORD_MISC_KERNEL; + else + event->header.misc = PERF_RECORD_MISC_GUEST_KERNEL; + + event->mmap.header.size = size; + + event->mmap.start = pos->start; + event->mmap.len = pos->end - pos->start; + event->mmap.pgoff = pos->pgoff; + event->mmap.pid = machine->pid; + + strlcpy(event->mmap.filename, kmap->name, PATH_MAX); + + if (perf_tool__process_synth_event(tool, event, machine, + process) != 0) { + rc = -1; + break; + } + } + + free(event); + return rc; +} + +#endif diff --git a/tools/perf/arch/x86/util/machine.c b/tools/perf/arch/x86/util/machine.c new file mode 100644 index 000000000000..4520ac53caa9 --- /dev/null +++ b/tools/perf/arch/x86/util/machine.c @@ -0,0 +1,103 @@ +// SPDX-License-Identifier: GPL-2.0 +#include <linux/types.h> +#include <linux/string.h> +#include <stdlib.h> + +#include "../../util/machine.h" +#include "../../util/map.h" +#include "../../util/symbol.h" +#include "../../util/sane_ctype.h" + +#include <symbol/kallsyms.h> + +#if defined(__x86_64__) + +struct extra_kernel_map_info { + int cnt; + int max_cnt; + struct extra_kernel_map *maps; + bool get_entry_trampolines; + u64 entry_trampoline; +}; + +static int add_extra_kernel_map(struct extra_kernel_map_info *mi, u64 start, + u64 end, u64 pgoff, const char *name) +{ + if (mi->cnt >= mi->max_cnt) { + void *buf; + size_t sz; + + mi->max_cnt = mi->max_cnt ? mi->max_cnt * 2 : 32; + sz = sizeof(struct extra_kernel_map) * mi->max_cnt; + buf = realloc(mi->maps, sz); + if (!buf) + return -1; + mi->maps = buf; + } + + mi->maps[mi->cnt].start = start; + mi->maps[mi->cnt].end = end; + mi->maps[mi->cnt].pgoff = pgoff; + strlcpy(mi->maps[mi->cnt].name, name, KMAP_NAME_LEN); + + mi->cnt += 1; + + return 0; +} + +static int find_extra_kernel_maps(void *arg, const char *name, char type, + u64 start) +{ + struct extra_kernel_map_info *mi = arg; + + if (!mi->entry_trampoline && kallsyms2elf_binding(type) == STB_GLOBAL && + !strcmp(name, "_entry_trampoline")) { + mi->entry_trampoline = start; + return 0; + } + + if (is_entry_trampoline(name)) { + u64 end = start + page_size; + + return add_extra_kernel_map(mi, start, end, 0, name); + } + + return 0; +} + +int machine__create_extra_kernel_maps(struct machine *machine, + struct dso *kernel) +{ + struct extra_kernel_map_info mi = { .cnt = 0, }; + char filename[PATH_MAX]; + int ret; + int i; + + machine__get_kallsyms_filename(machine, filename, PATH_MAX); + + if (symbol__restricted_filename(filename, "/proc/kallsyms")) + return 0; + + ret = kallsyms__parse(filename, &mi, find_extra_kernel_maps); + if (ret) + goto out_free; + + if (!mi.entry_trampoline) + goto out_free; + + for (i = 0; i < mi.cnt; i++) { + struct extra_kernel_map *xm = &mi.maps[i]; + + xm->pgoff = mi.entry_trampoline; + ret = machine__create_extra_kernel_map(machine, kernel, xm); + if (ret) + goto out_free; + } + + machine->trampolines_mapped = mi.cnt; +out_free: + free(mi.maps); + return ret; +} + +#endif diff --git a/tools/perf/builtin-annotate.c b/tools/perf/builtin-annotate.c index 51709a961496..da5704240239 100644 --- a/tools/perf/builtin-annotate.c +++ b/tools/perf/builtin-annotate.c @@ -45,6 +45,7 @@ struct perf_annotate { bool print_line; bool skip_missing; bool has_br_stack; + bool group_set; const char *sym_hist_filter; const char *cpu_list; DECLARE_BITMAP(cpu_bitmap, MAX_NR_CPUS); @@ -228,7 +229,7 @@ static int perf_evsel__add_sample(struct perf_evsel *evsel, */ if (al->sym != NULL) { rb_erase(&al->sym->rb_node, - &al->map->dso->symbols[al->map->type]); + &al->map->dso->symbols); symbol__delete(al->sym); dso__reset_find_symbol_cache(al->map->dso); } @@ -508,6 +509,9 @@ int cmd_annotate(int argc, const char **argv) "Don't shorten the displayed pathnames"), OPT_BOOLEAN(0, "skip-missing", &annotate.skip_missing, "Skip symbols that cannot be annotated"), + OPT_BOOLEAN_SET(0, "group", &symbol_conf.event_group, + &annotate.group_set, + "Show event group information together"), OPT_STRING('C', "cpu", &annotate.cpu_list, "cpu", "list of cpus to profile"), OPT_CALLBACK(0, "symfs", NULL, "directory", "Look for files with symbols relative to this directory", @@ -570,6 +574,9 @@ int cmd_annotate(int argc, const char **argv) annotate.has_br_stack = perf_header__has_feat(&annotate.session->header, HEADER_BRANCH_STACK); + if (annotate.group_set) + perf_evlist__force_leader(annotate.session->evlist); + ret = symbol__annotation_init(); if (ret < 0) goto out_delete; diff --git a/tools/perf/builtin-buildid-cache.c b/tools/perf/builtin-buildid-cache.c index 41db2cba77eb..115110a4796a 100644 --- a/tools/perf/builtin-buildid-cache.c +++ b/tools/perf/builtin-buildid-cache.c @@ -25,6 +25,7 @@ #include "util/session.h" #include "util/symbol.h" #include "util/time-utils.h" +#include "util/probe-file.h" static int build_id_cache__kcore_buildid(const char *proc_dir, char *sbuildid) { @@ -239,6 +240,34 @@ out: return err; } +static int build_id_cache__purge_all(void) +{ + struct strlist *list; + struct str_node *pos; + int err = 0; + char *buf; + + list = build_id_cache__list_all(false); + if (!list) { + pr_debug("Failed to get buildids: -%d\n", errno); + return -EINVAL; + } + + strlist__for_each_entry(pos, list) { + buf = build_id_cache__origname(pos->s); + err = build_id_cache__remove_s(pos->s); + pr_debug("Removing %s (%s): %s\n", buf, pos->s, + err ? "FAIL" : "Ok"); + free(buf); + if (err) + break; + } + strlist__delete(list); + + pr_debug("Purged all: %s\n", err ? "FAIL" : "Ok"); + return err; +} + static bool dso__missing_buildid_cache(struct dso *dso, int parm __maybe_unused) { char filename[PATH_MAX]; @@ -297,6 +326,26 @@ static int build_id_cache__update_file(const char *filename, struct nsinfo *nsi) return err; } +static int build_id_cache__show_all(void) +{ + struct strlist *bidlist; + struct str_node *nd; + char *buf; + + bidlist = build_id_cache__list_all(true); + if (!bidlist) { + pr_debug("Failed to get buildids: -%d\n", errno); + return -1; + } + strlist__for_each_entry(nd, bidlist) { + buf = build_id_cache__origname(nd->s); + fprintf(stdout, "%s %s\n", nd->s, buf); + free(buf); + } + strlist__delete(bidlist); + return 0; +} + int cmd_buildid_cache(int argc, const char **argv) { struct strlist *list; @@ -304,6 +353,9 @@ int cmd_buildid_cache(int argc, const char **argv) int ret = 0; int ns_id = -1; bool force = false; + bool list_files = false; + bool opts_flag = false; + bool purge_all = false; char const *add_name_list_str = NULL, *remove_name_list_str = NULL, *purge_name_list_str = NULL, @@ -327,6 +379,8 @@ int cmd_buildid_cache(int argc, const char **argv) "file(s) to remove"), OPT_STRING('p', "purge", &purge_name_list_str, "file list", "file(s) to remove (remove old caches too)"), + OPT_BOOLEAN('P', "purge-all", &purge_all, "purge all cached files"), + OPT_BOOLEAN('l', "list", &list_files, "list all cached files"), OPT_STRING('M', "missing", &missing_filename, "file", "to find missing build ids in the cache"), OPT_BOOLEAN('f', "force", &force, "don't complain, do it"), @@ -344,11 +398,20 @@ int cmd_buildid_cache(int argc, const char **argv) argc = parse_options(argc, argv, buildid_cache_options, buildid_cache_usage, 0); - if (argc || (!add_name_list_str && !kcore_filename && - !remove_name_list_str && !purge_name_list_str && - !missing_filename && !update_name_list_str)) + opts_flag = add_name_list_str || kcore_filename || + remove_name_list_str || purge_name_list_str || + missing_filename || update_name_list_str || + purge_all; + + if (argc || !(list_files || opts_flag)) usage_with_options(buildid_cache_usage, buildid_cache_options); + /* -l is exclusive. It can not be used with other options. */ + if (list_files && opts_flag) { + usage_with_options_msg(buildid_cache_usage, + buildid_cache_options, "-l is exclusive.\n"); + } + if (ns_id > 0) nsi = nsinfo__new(ns_id); @@ -366,6 +429,11 @@ int cmd_buildid_cache(int argc, const char **argv) setup_pager(); + if (list_files) { + ret = build_id_cache__show_all(); + goto out; + } + if (add_name_list_str) { list = strlist__new(add_name_list_str, NULL); if (list) { @@ -420,6 +488,13 @@ int cmd_buildid_cache(int argc, const char **argv) } } + if (purge_all) { + if (build_id_cache__purge_all()) { + pr_warning("Couldn't remove some caches. Error: %s.\n", + str_error_r(errno, sbuf, sizeof(sbuf))); + } + } + if (missing_filename) ret = build_id_cache__fprintf_missing(session, stdout); diff --git a/tools/perf/builtin-inject.c b/tools/perf/builtin-inject.c index 40fe919bbcf3..a3b346359ba0 100644 --- a/tools/perf/builtin-inject.c +++ b/tools/perf/builtin-inject.c @@ -440,9 +440,7 @@ static int perf_event__inject_buildid(struct perf_tool *tool, goto repipe; } - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, sample->ip, &al); - - if (al.map != NULL) { + if (thread__find_map(thread, sample->cpumode, sample->ip, &al)) { if (!al.map->dso->hit) { al.map->dso->hit = 1; if (map__load(al.map) >= 0) { diff --git a/tools/perf/builtin-kallsyms.c b/tools/perf/builtin-kallsyms.c index bcfb363112d3..90d1a2305b72 100644 --- a/tools/perf/builtin-kallsyms.c +++ b/tools/perf/builtin-kallsyms.c @@ -27,7 +27,7 @@ static int __cmd_kallsyms(int argc, const char **argv) for (i = 0; i < argc; ++i) { struct map *map; - struct symbol *symbol = machine__find_kernel_function_by_name(machine, argv[i], &map); + struct symbol *symbol = machine__find_kernel_symbol_by_name(machine, argv[i], &map); if (symbol == NULL) { printf("%s: not found\n", argv[i]); diff --git a/tools/perf/builtin-kmem.c b/tools/perf/builtin-kmem.c index ae11e4c3516a..54d3f21b0e62 100644 --- a/tools/perf/builtin-kmem.c +++ b/tools/perf/builtin-kmem.c @@ -1004,7 +1004,7 @@ static void __print_slab_result(struct rb_root *root, if (is_caller) { addr = data->call_site; if (!raw_ip) - sym = machine__find_kernel_function(machine, addr, &map); + sym = machine__find_kernel_symbol(machine, addr, &map); } else addr = data->ptr; @@ -1068,7 +1068,7 @@ static void __print_page_alloc_result(struct perf_session *session, int n_lines) char *caller = buf; data = rb_entry(next, struct page_stat, node); - sym = machine__find_kernel_function(machine, data->callsite, &map); + sym = machine__find_kernel_symbol(machine, data->callsite, &map); if (sym) caller = sym->name; else @@ -1110,7 +1110,7 @@ static void __print_page_caller_result(struct perf_session *session, int n_lines char *caller = buf; data = rb_entry(next, struct page_stat, node); - sym = machine__find_kernel_function(machine, data->callsite, &map); + sym = machine__find_kernel_symbol(machine, data->callsite, &map); if (sym) caller = sym->name; else diff --git a/tools/perf/builtin-report.c b/tools/perf/builtin-report.c index 0f198f6d9b77..ad978e3ee2b8 100644 --- a/tools/perf/builtin-report.c +++ b/tools/perf/builtin-report.c @@ -194,20 +194,11 @@ out: return err; } -/* - * Events in data file are not collect in groups, but we still want - * the group display. Set the artificial group and set the leader's - * forced_leader flag to notify the display code. - */ static void setup_forced_leader(struct report *report, struct perf_evlist *evlist) { - if (report->group_set && !evlist->nr_groups) { - struct perf_evsel *leader = perf_evlist__first(evlist); - - perf_evlist__set_leader(evlist); - leader->forced_leader = true; - } + if (report->group_set) + perf_evlist__force_leader(evlist); } static int process_feature_event(struct perf_tool *tool, @@ -523,12 +514,9 @@ static void report__warn_kptr_restrict(const struct report *rep) "As no suitable kallsyms nor vmlinux was found, kernel samples\n" "can't be resolved."; - if (kernel_map) { - const struct dso *kdso = kernel_map->dso; - if (!RB_EMPTY_ROOT(&kdso->symbols[MAP__FUNCTION])) { - desc = "If some relocation was applied (e.g. " - "kexec) symbols may be misresolved."; - } + if (kernel_map && map__has_symbols(kernel_map)) { + desc = "If some relocation was applied (e.g. " + "kexec) symbols may be misresolved."; } ui__warning( @@ -718,10 +706,7 @@ static size_t maps__fprintf_task(struct maps *maps, int indent, FILE *fp) static int map_groups__fprintf_task(struct map_groups *mg, int indent, FILE *fp) { - int printed = 0, i; - for (i = 0; i < MAP__NR_TYPES; ++i) - printed += maps__fprintf_task(&mg->maps[i], indent, fp); - return printed; + return maps__fprintf_task(&mg->maps, indent, fp); } static void task__print_level(struct task *task, FILE *fp, int level) diff --git a/tools/perf/builtin-script.c b/tools/perf/builtin-script.c index e0a9845b6cbc..cefc8813e91e 100644 --- a/tools/perf/builtin-script.c +++ b/tools/perf/builtin-script.c @@ -153,8 +153,8 @@ static struct { .fields = PERF_OUTPUT_COMM | PERF_OUTPUT_TID | PERF_OUTPUT_CPU | PERF_OUTPUT_TIME | PERF_OUTPUT_EVNAME | PERF_OUTPUT_IP | - PERF_OUTPUT_SYM | PERF_OUTPUT_DSO | - PERF_OUTPUT_PERIOD, + PERF_OUTPUT_SYM | PERF_OUTPUT_SYMOFFSET | + PERF_OUTPUT_DSO | PERF_OUTPUT_PERIOD, .invalid_fields = PERF_OUTPUT_TRACE | PERF_OUTPUT_BPF_OUTPUT, }, @@ -165,8 +165,9 @@ static struct { .fields = PERF_OUTPUT_COMM | PERF_OUTPUT_TID | PERF_OUTPUT_CPU | PERF_OUTPUT_TIME | PERF_OUTPUT_EVNAME | PERF_OUTPUT_IP | - PERF_OUTPUT_SYM | PERF_OUTPUT_DSO | - PERF_OUTPUT_PERIOD | PERF_OUTPUT_BPF_OUTPUT, + PERF_OUTPUT_SYM | PERF_OUTPUT_SYMOFFSET | + PERF_OUTPUT_DSO | PERF_OUTPUT_PERIOD | + PERF_OUTPUT_BPF_OUTPUT, .invalid_fields = PERF_OUTPUT_TRACE, }, @@ -185,10 +186,10 @@ static struct { .fields = PERF_OUTPUT_COMM | PERF_OUTPUT_TID | PERF_OUTPUT_CPU | PERF_OUTPUT_TIME | PERF_OUTPUT_EVNAME | PERF_OUTPUT_IP | - PERF_OUTPUT_SYM | PERF_OUTPUT_DSO | - PERF_OUTPUT_PERIOD | PERF_OUTPUT_ADDR | - PERF_OUTPUT_DATA_SRC | PERF_OUTPUT_WEIGHT | - PERF_OUTPUT_PHYS_ADDR, + PERF_OUTPUT_SYM | PERF_OUTPUT_SYMOFFSET | + PERF_OUTPUT_DSO | PERF_OUTPUT_PERIOD | + PERF_OUTPUT_ADDR | PERF_OUTPUT_DATA_SRC | + PERF_OUTPUT_WEIGHT | PERF_OUTPUT_PHYS_ADDR, .invalid_fields = PERF_OUTPUT_TRACE | PERF_OUTPUT_BPF_OUTPUT, }, @@ -199,8 +200,8 @@ static struct { .fields = PERF_OUTPUT_COMM | PERF_OUTPUT_TID | PERF_OUTPUT_CPU | PERF_OUTPUT_TIME | PERF_OUTPUT_EVNAME | PERF_OUTPUT_IP | - PERF_OUTPUT_SYM | PERF_OUTPUT_DSO | - PERF_OUTPUT_PERIOD, + PERF_OUTPUT_SYM | PERF_OUTPUT_SYMOFFSET | + PERF_OUTPUT_DSO | PERF_OUTPUT_PERIOD, .invalid_fields = PERF_OUTPUT_TRACE | PERF_OUTPUT_BPF_OUTPUT, }, @@ -211,8 +212,8 @@ static struct { .fields = PERF_OUTPUT_COMM | PERF_OUTPUT_TID | PERF_OUTPUT_CPU | PERF_OUTPUT_TIME | PERF_OUTPUT_EVNAME | PERF_OUTPUT_IP | - PERF_OUTPUT_SYM | PERF_OUTPUT_DSO | - PERF_OUTPUT_SYNTH, + PERF_OUTPUT_SYM | PERF_OUTPUT_SYMOFFSET | + PERF_OUTPUT_DSO | PERF_OUTPUT_SYNTH, .invalid_fields = PERF_OUTPUT_TRACE | PERF_OUTPUT_BPF_OUTPUT, }, @@ -544,6 +545,7 @@ static int perf_session__check_output_opt(struct perf_session *session) if (attr->sample_type & PERF_SAMPLE_CALLCHAIN) { output[j].fields |= PERF_OUTPUT_IP; output[j].fields |= PERF_OUTPUT_SYM; + output[j].fields |= PERF_OUTPUT_SYMOFFSET; output[j].fields |= PERF_OUTPUT_DSO; set_print_ip_opts(attr); goto out; @@ -717,8 +719,8 @@ static int perf_sample__fprintf_brstack(struct perf_sample *sample, if (PRINT_FIELD(DSO)) { memset(&alf, 0, sizeof(alf)); memset(&alt, 0, sizeof(alt)); - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, from, &alf); - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, to, &alt); + thread__find_map(thread, sample->cpumode, from, &alf); + thread__find_map(thread, sample->cpumode, to, &alt); } printed += fprintf(fp, " 0x%"PRIx64, from); @@ -764,13 +766,8 @@ static int perf_sample__fprintf_brstacksym(struct perf_sample *sample, from = br->entries[i].from; to = br->entries[i].to; - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, from, &alf); - if (alf.map) - alf.sym = map__find_symbol(alf.map, alf.addr); - - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, to, &alt); - if (alt.map) - alt.sym = map__find_symbol(alt.map, alt.addr); + thread__find_symbol(thread, sample->cpumode, from, &alf); + thread__find_symbol(thread, sample->cpumode, to, &alt); printed += symbol__fprintf_symname_offs(alf.sym, &alf, fp); if (PRINT_FIELD(DSO)) { @@ -814,12 +811,12 @@ static int perf_sample__fprintf_brstackoff(struct perf_sample *sample, from = br->entries[i].from; to = br->entries[i].to; - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, from, &alf); - if (alf.map && !alf.map->dso->adjust_symbols) + if (thread__find_map(thread, sample->cpumode, from, &alf) && + !alf.map->dso->adjust_symbols) from = map__map_ip(alf.map, from); - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, to, &alt); - if (alt.map && !alt.map->dso->adjust_symbols) + if (thread__find_map(thread, sample->cpumode, to, &alt) && + !alt.map->dso->adjust_symbols) to = map__map_ip(alt.map, to); printed += fprintf(fp, " 0x%"PRIx64, from); @@ -882,8 +879,7 @@ static int grab_bb(u8 *buffer, u64 start, u64 end, return 0; } - thread__find_addr_map(thread, *cpumode, MAP__FUNCTION, start, &al); - if (!al.map || !al.map->dso) { + if (!thread__find_map(thread, *cpumode, start, &al) || !al.map->dso) { pr_debug("\tcannot resolve %" PRIx64 "-%" PRIx64 "\n", start, end); return 0; } @@ -933,10 +929,8 @@ static int ip__fprintf_sym(uint64_t addr, struct thread *thread, memset(&al, 0, sizeof(al)); - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, addr, &al); - if (!al.map) - thread__find_addr_map(thread, cpumode, MAP__VARIABLE, - addr, &al); + thread__find_map(thread, cpumode, addr, &al); + if ((*lastsym) && al.addr >= (*lastsym)->start && al.addr < (*lastsym)->end) return 0; diff --git a/tools/perf/builtin-stat.c b/tools/perf/builtin-stat.c index f17dc601b0f3..a4f662a462c6 100644 --- a/tools/perf/builtin-stat.c +++ b/tools/perf/builtin-stat.c @@ -164,6 +164,7 @@ static bool forever = false; static bool metric_only = false; static bool force_metric_only = false; static bool no_merge = false; +static bool walltime_run_table = false; static struct timespec ref_time; static struct cpu_map *aggr_map; static aggr_get_id_t aggr_get_id; @@ -173,6 +174,7 @@ static const char *output_name; static int output_fd; static int print_free_counters_hint; static int print_mixed_hw_group_error; +static u64 *walltime_run; struct perf_stat { bool record; @@ -569,7 +571,7 @@ static struct perf_evsel *perf_evsel__reset_weak_group(struct perf_evsel *evsel) return leader; } -static int __run_perf_stat(int argc, const char **argv) +static int __run_perf_stat(int argc, const char **argv, int run_idx) { int interval = stat_config.interval; int times = stat_config.times; @@ -752,6 +754,9 @@ try_again: t1 = rdclock(); + if (walltime_run_table) + walltime_run[run_idx] = t1 - t0; + update_stats(&walltime_nsecs_stats, t1 - t0); /* @@ -766,7 +771,7 @@ try_again: return WEXITSTATUS(status); } -static int run_perf_stat(int argc, const char **argv) +static int run_perf_stat(int argc, const char **argv, int run_idx) { int ret; @@ -779,7 +784,7 @@ static int run_perf_stat(int argc, const char **argv) if (sync_run) sync(); - ret = __run_perf_stat(argc, argv); + ret = __run_perf_stat(argc, argv, run_idx); if (ret) return ret; @@ -1764,19 +1769,67 @@ static void print_header(int argc, const char **argv) } } +static int get_precision(double num) +{ + if (num > 1) + return 0; + + return lround(ceil(-log10(num))); +} + +static void print_table(FILE *output, int precision, double avg) +{ + char tmp[64]; + int idx, indent = 0; + + scnprintf(tmp, 64, " %17.*f", precision, avg); + while (tmp[indent] == ' ') + indent++; + + fprintf(output, "%*s# Table of individual measurements:\n", indent, ""); + + for (idx = 0; idx < run_count; idx++) { + double run = (double) walltime_run[idx] / NSEC_PER_SEC; + int h, n = 1 + abs((int) (100.0 * (run - avg)/run) / 5); + + fprintf(output, " %17.*f (%+.*f) ", + precision, run, precision, run - avg); + + for (h = 0; h < n; h++) + fprintf(output, "#"); + + fprintf(output, "\n"); + } + + fprintf(output, "\n%*s# Final result:\n", indent, ""); +} + static void print_footer(void) { + double avg = avg_stats(&walltime_nsecs_stats) / NSEC_PER_SEC; FILE *output = stat_config.output; int n; if (!null_run) fprintf(output, "\n"); - fprintf(output, " %17.9f seconds time elapsed", - avg_stats(&walltime_nsecs_stats) / NSEC_PER_SEC); - if (run_count > 1) { - fprintf(output, " "); - print_noise_pct(stddev_stats(&walltime_nsecs_stats), - avg_stats(&walltime_nsecs_stats)); + + if (run_count == 1) { + fprintf(output, " %17.9f seconds time elapsed", avg); + } else { + double sd = stddev_stats(&walltime_nsecs_stats) / NSEC_PER_SEC; + /* + * Display at most 2 more significant + * digits than the stddev inaccuracy. + */ + int precision = get_precision(sd) + 2; + + if (walltime_run_table) + print_table(output, precision, avg); + + fprintf(output, " %17.*f +- %.*f seconds time elapsed", + precision, avg, precision, sd); + + print_noise_pct(sd, avg); } fprintf(output, "\n\n"); @@ -1952,6 +2005,8 @@ static const struct option stat_options[] = { "be more verbose (show counter open errors, etc)"), OPT_INTEGER('r', "repeat", &run_count, "repeat command and print average + stddev (max: 100, forever: 0)"), + OPT_BOOLEAN(0, "table", &walltime_run_table, + "display details about each run (only with -r option)"), OPT_BOOLEAN('n', "null", &null_run, "null run - dont start any counters"), OPT_INCR('d', "detailed", &detailed_run, @@ -2843,6 +2898,13 @@ int cmd_stat(int argc, const char **argv) goto out; } + if (walltime_run_table && run_count <= 1) { + fprintf(stderr, "--table is only supported with -r\n"); + parse_options_usage(stat_usage, stat_options, "r", 1); + parse_options_usage(NULL, stat_options, "table", 0); + goto out; + } + if (output_fd < 0) { fprintf(stderr, "argument to --log-fd must be a > 0\n"); parse_options_usage(stat_usage, stat_options, "log-fd", 0); @@ -2897,6 +2959,14 @@ int cmd_stat(int argc, const char **argv) run_count = 1; } + if (walltime_run_table) { + walltime_run = zalloc(run_count * sizeof(walltime_run[0])); + if (!walltime_run) { + pr_err("failed to setup -r option"); + goto out; + } + } + if ((stat_config.aggr_mode == AGGR_THREAD) && !target__has_task(&target)) { if (!target.system_wide || target.cpu_list) { @@ -3012,7 +3082,7 @@ int cmd_stat(int argc, const char **argv) fprintf(output, "[ perf stat: executing run #%d ... ]\n", run_idx + 1); - status = run_perf_stat(argc, argv); + status = run_perf_stat(argc, argv, run_idx); if (forever && status != -1) { print_counters(NULL, argc, argv); perf_stat__reset_stats(); @@ -3060,6 +3130,8 @@ int cmd_stat(int argc, const char **argv) perf_stat__exit_aggr_mode(); perf_evlist__free_stats(evsel_list); out: + free(walltime_run); + if (smi_cost && smi_reset) sysfs__write_int(FREEZE_ON_SMI_PATH, 0); diff --git a/tools/perf/builtin-timechart.c b/tools/perf/builtin-timechart.c index 813698a9b8c7..a827919c6263 100644 --- a/tools/perf/builtin-timechart.c +++ b/tools/perf/builtin-timechart.c @@ -533,12 +533,8 @@ static const char *cat_backtrace(union perf_event *event, } tal.filtered = 0; - thread__find_addr_location(al.thread, cpumode, - MAP__FUNCTION, ip, &tal); - - if (tal.sym) - fprintf(f, "..... %016" PRIx64 " %s\n", ip, - tal.sym->name); + if (thread__find_symbol(al.thread, cpumode, ip, &tal)) + fprintf(f, "..... %016" PRIx64 " %s\n", ip, tal.sym->name); else fprintf(f, "..... %016" PRIx64 "\n", ip); } diff --git a/tools/perf/builtin-top.c b/tools/perf/builtin-top.c index f39bd60d2708..7a349fcd3864 100644 --- a/tools/perf/builtin-top.c +++ b/tools/perf/builtin-top.c @@ -742,7 +742,7 @@ static void perf_event__process_sample(struct perf_tool *tool, "Kernel address maps (/proc/{kallsyms,modules}) are restricted.\n\n" "Check /proc/sys/kernel/kptr_restrict.\n\n" "Kernel%s samples will not be resolved.\n", - al.map && !RB_EMPTY_ROOT(&al.map->dso->symbols[MAP__FUNCTION]) ? + al.map && map__has_symbols(al.map) ? " modules" : ""); if (use_browser <= 0) sleep(5); @@ -750,7 +750,7 @@ static void perf_event__process_sample(struct perf_tool *tool, machine->kptr_restrict_warned = true; } - if (al.sym == NULL) { + if (al.sym == NULL && al.map != NULL) { const char *msg = "Kernel samples will not be resolved.\n"; /* * As we do lazy loading of symtabs we only will know if the @@ -764,8 +764,7 @@ static void perf_event__process_sample(struct perf_tool *tool, * invalid --vmlinux ;-) */ if (!machine->kptr_restrict_warned && !top->vmlinux_warned && - al.map == machine->vmlinux_maps[MAP__FUNCTION] && - RB_EMPTY_ROOT(&al.map->dso->symbols[MAP__FUNCTION])) { + __map__is_kernel(al.map) && map__has_symbols(al.map)) { if (symbol_conf.vmlinux_name) { char serr[256]; dso__strerror_load(al.map->dso, serr, sizeof(serr)); @@ -1265,7 +1264,7 @@ int cmd_top(int argc, const char **argv) .proc_map_timeout = 500, .overwrite = 1, }, - .max_stack = sysctl_perf_event_max_stack, + .max_stack = sysctl__max_stack(), .sym_pcnt_filter = 5, .nr_threads_synthesize = UINT_MAX, }; diff --git a/tools/perf/builtin-trace.c b/tools/perf/builtin-trace.c index 3ad17ee89403..560aed7da36a 100644 --- a/tools/perf/builtin-trace.c +++ b/tools/perf/builtin-trace.c @@ -2024,8 +2024,7 @@ static int trace__pgfault(struct trace *trace, if (trace->summary_only) goto out; - thread__find_addr_location(thread, sample->cpumode, MAP__FUNCTION, - sample->ip, &al); + thread__find_symbol(thread, sample->cpumode, sample->ip, &al); trace__fprintf_entry_head(trace, thread, 0, true, sample->time, trace->output); @@ -2037,12 +2036,10 @@ static int trace__pgfault(struct trace *trace, fprintf(trace->output, "] => "); - thread__find_addr_location(thread, sample->cpumode, MAP__VARIABLE, - sample->addr, &al); + thread__find_symbol(thread, sample->cpumode, sample->addr, &al); if (!al.map) { - thread__find_addr_location(thread, sample->cpumode, - MAP__FUNCTION, sample->addr, &al); + thread__find_symbol(thread, sample->cpumode, sample->addr, &al); if (al.map) map_type = 'x'; @@ -3165,7 +3162,7 @@ int cmd_trace(int argc, const char **argv) mmap_pages_user_set = false; if (trace.max_stack == UINT_MAX) { - trace.max_stack = input_name ? PERF_MAX_STACK_DEPTH : sysctl_perf_event_max_stack; + trace.max_stack = input_name ? PERF_MAX_STACK_DEPTH : sysctl__max_stack(); max_stack_user_set = false; } diff --git a/tools/perf/check-headers.sh b/tools/perf/check-headers.sh index 9aff89bc7535..10f333e2e825 100755 --- a/tools/perf/check-headers.sh +++ b/tools/perf/check-headers.sh @@ -55,22 +55,26 @@ include/uapi/asm-generic/ioctls.h include/uapi/asm-generic/mman-common.h ' -check () { - file=$1 +check_2 () { + file1=$1 + file2=$2 shift - opts= - while [ -n "$*" ]; do - opts="$opts \"$1\"" - shift - done + shift - cmd="diff $opts ../$file ../../$file > /dev/null" + cmd="diff $* $file1 $file2 > /dev/null" - test -f ../../$file && + test -f $file2 && eval $cmd || echo "Warning: Kernel ABI header at 'tools/$file' differs from latest version at '$file'" >&2 } +check () { + file=$1 + + shift + + check_2 ../$file ../../$file $* +} # Check if we have the kernel headers (tools/perf/../../include), else # we're probably on a detached tarball, so no point in trying to check @@ -83,7 +87,7 @@ for i in $HEADERS; do done # diff with extra ignore lines -check arch/x86/lib/memcpy_64.S -I "^EXPORT_SYMBOL" -I "^#include <asm/export.h>" -check arch/x86/lib/memset_64.S -I "^EXPORT_SYMBOL" -I "^#include <asm/export.h>" -check include/uapi/asm-generic/mman.h -I "^#include <\(uapi/\)*asm-generic/mman-common.h>" -check include/uapi/linux/mman.h -I "^#include <\(uapi/\)*asm/mman.h>" +check arch/x86/lib/memcpy_64.S '-I "^EXPORT_SYMBOL" -I "^#include <asm/export.h>"' +check arch/x86/lib/memset_64.S '-I "^EXPORT_SYMBOL" -I "^#include <asm/export.h>"' +check include/uapi/asm-generic/mman.h '-I "^#include <\(uapi/\)*asm-generic/mman-common.h>"' +check include/uapi/linux/mman.h '-I "^#include <\(uapi/\)*asm/mman.h>"' diff --git a/tools/perf/examples/bpf/5sec.c b/tools/perf/examples/bpf/5sec.c new file mode 100644 index 000000000000..b9c203219691 --- /dev/null +++ b/tools/perf/examples/bpf/5sec.c @@ -0,0 +1,49 @@ +// SPDX-License-Identifier: GPL-2.0 +/* + Description: + + . Disable strace like syscall tracing (--no-syscalls), or try tracing + just some (-e *sleep). + + . Attach a filter function to a kernel function, returning when it should + be considered, i.e. appear on the output. + + . Run it system wide, so that any sleep of >= 5 seconds and < than 6 + seconds gets caught. + + . Ask for callgraphs using DWARF info, so that userspace can be unwound + + . While this is running, run something like "sleep 5s". + + . If we decide to add tv_nsec as well, then it becomes: + + int probe(hrtimer_nanosleep, rqtp->tv_sec rqtp->tv_nsec)(void *ctx, int err, long sec, long nsec) + + I.e. add where it comes from (rqtp->tv_nsec) and where it will be + accessible in the function body (nsec) + + # perf trace --no-syscalls -e tools/perf/examples/bpf/5sec.c/call-graph=dwarf/ + 0.000 perf_bpf_probe:func:(ffffffff9811b5f0) tv_sec=5 + hrtimer_nanosleep ([kernel.kallsyms]) + __x64_sys_nanosleep ([kernel.kallsyms]) + do_syscall_64 ([kernel.kallsyms]) + entry_SYSCALL_64 ([kernel.kallsyms]) + __GI___nanosleep (/usr/lib64/libc-2.26.so) + rpl_nanosleep (/usr/bin/sleep) + xnanosleep (/usr/bin/sleep) + main (/usr/bin/sleep) + __libc_start_main (/usr/lib64/libc-2.26.so) + _start (/usr/bin/sleep) + ^C# + + Copyright (C) 2018 Red Hat, Inc., Arnaldo Carvalho de Melo <acme@redhat.com> +*/ + +#include <bpf.h> + +int probe(hrtimer_nanosleep, rqtp->tv_sec)(void *ctx, int err, long sec) +{ + return sec == 5; +} + +license(GPL); diff --git a/tools/perf/examples/bpf/empty.c b/tools/perf/examples/bpf/empty.c new file mode 100644 index 000000000000..3776d26db9e7 --- /dev/null +++ b/tools/perf/examples/bpf/empty.c @@ -0,0 +1,3 @@ +#include <bpf.h> + +license(GPL); diff --git a/tools/perf/include/bpf/bpf.h b/tools/perf/include/bpf/bpf.h new file mode 100644 index 000000000000..dd764ad5efdf --- /dev/null +++ b/tools/perf/include/bpf/bpf.h @@ -0,0 +1,13 @@ +// SPDX-License-Identifier: GPL-2.0 +#ifndef _PERF_BPF_H +#define _PERF_BPF_H +#define SEC(NAME) __attribute__((section(NAME), used)) + +#define probe(function, vars) \ + SEC(#function "=" #function " " #vars) function + +#define license(name) \ +char _license[] SEC("license") = #name; \ +int _version SEC("version") = LINUX_VERSION_CODE; + +#endif /* _PERF_BPF_H */ diff --git a/tools/perf/perf.c b/tools/perf/perf.c index 20a08cb32332..51c81509a315 100644 --- a/tools/perf/perf.c +++ b/tools/perf/perf.c @@ -238,7 +238,7 @@ static int handle_options(const char ***argv, int *argc, int *envchanged) (*argc)--; } else if (strstarts(cmd, CMD_DEBUGFS_DIR)) { tracing_path_set(cmd + strlen(CMD_DEBUGFS_DIR)); - fprintf(stderr, "dir: %s\n", tracing_path); + fprintf(stderr, "dir: %s\n", tracing_path_mount()); if (envchanged) *envchanged = 1; } else if (!strcmp(cmd, "--list-cmds")) { @@ -421,22 +421,11 @@ void pthread__unblock_sigwinch(void) pthread_sigmask(SIG_UNBLOCK, &set, NULL); } -#ifdef _SC_LEVEL1_DCACHE_LINESIZE -#define cache_line_size(cacheline_sizep) *cacheline_sizep = sysconf(_SC_LEVEL1_DCACHE_LINESIZE) -#else -static void cache_line_size(int *cacheline_sizep) -{ - if (sysfs__read_int("devices/system/cpu/cpu0/cache/index0/coherency_line_size", cacheline_sizep)) - pr_debug("cannot determine cache line size"); -} -#endif - int main(int argc, const char **argv) { int err; const char *cmd; char sbuf[STRERR_BUFSIZE]; - int value; /* libsubcmd init */ exec_cmd_init("perf", PREFIX, PERF_EXEC_PATH, EXEC_PATH_ENVIRONMENT); @@ -444,13 +433,6 @@ int main(int argc, const char **argv) /* The page_size is placed in util object. */ page_size = sysconf(_SC_PAGE_SIZE); - cache_line_size(&cacheline_size); - - if (sysctl__read_int("kernel/perf_event_max_stack", &value) == 0) - sysctl_perf_event_max_stack = value; - - if (sysctl__read_int("kernel/perf_event_max_contexts_per_stack", &value) == 0) - sysctl_perf_event_max_contexts_per_stack = value; cmd = extract_argv0_path(argv[0]); if (!cmd) @@ -458,15 +440,11 @@ int main(int argc, const char **argv) srandom(time(NULL)); - perf_config__init(); err = perf_config(perf_default_config, NULL); if (err) return err; set_buildid_dir(NULL); - /* get debugfs/tracefs mount point from /proc/mounts */ - tracing_path_mount(); - /* * "perf-xxxx" is the same as "perf xxxx", but we obviously: * diff --git a/tools/perf/tests/builtin-test.c b/tools/perf/tests/builtin-test.c index cac8f8889bc3..2bde505e2e7e 100644 --- a/tools/perf/tests/builtin-test.c +++ b/tools/perf/tests/builtin-test.c @@ -654,6 +654,15 @@ static int perf_test__list(int argc, const char **argv) continue; pr_info("%2d: %s\n", i, t->desc); + + if (t->subtest.get_nr) { + int subn = t->subtest.get_nr(); + int subi; + + for (subi = 0; subi < subn; subi++) + pr_info("%2d:%1d: %s\n", i, subi + 1, + t->subtest.get_desc(subi)); + } } perf_test__list_shell(argc, argv, i); diff --git a/tools/perf/tests/code-reading.c b/tools/perf/tests/code-reading.c index 99936352df4f..afa4ce21ba7c 100644 --- a/tools/perf/tests/code-reading.c +++ b/tools/perf/tests/code-reading.c @@ -236,14 +236,13 @@ static int read_object_code(u64 addr, size_t len, u8 cpumode, pr_debug("Reading object code for memory address: %#"PRIx64"\n", addr); - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, addr, &al); - if (!al.map || !al.map->dso) { + if (!thread__find_map(thread, cpumode, addr, &al) || !al.map->dso) { if (cpumode == PERF_RECORD_MISC_HYPERVISOR) { pr_debug("Hypervisor address can not be resolved - skipping\n"); return 0; } - pr_debug("thread__find_addr_map failed\n"); + pr_debug("thread__find_map failed\n"); return -1; } diff --git a/tools/perf/tests/hists_common.c b/tools/perf/tests/hists_common.c index f7c5b613d667..b889a28fd80b 100644 --- a/tools/perf/tests/hists_common.c +++ b/tools/perf/tests/hists_common.c @@ -131,20 +131,20 @@ struct machine *setup_fake_machine(struct machines *machines) goto out; /* emulate dso__load() */ - dso__set_loaded(dso, MAP__FUNCTION); + dso__set_loaded(dso); for (k = 0; k < fake_symbols[i].nr_syms; k++) { struct symbol *sym; struct fake_sym *fsym = &fake_symbols[i].syms[k]; sym = symbol__new(fsym->start, fsym->length, - STB_GLOBAL, fsym->name); + STB_GLOBAL, STT_FUNC, fsym->name); if (sym == NULL) { dso__put(dso); goto out; } - symbols__insert(&dso->symbols[MAP__FUNCTION], sym); + symbols__insert(&dso->symbols, sym); } dso__put(dso); diff --git a/tools/perf/tests/mmap-thread-lookup.c b/tools/perf/tests/mmap-thread-lookup.c index 868d82b501f4..b1af2499a3c9 100644 --- a/tools/perf/tests/mmap-thread-lookup.c +++ b/tools/perf/tests/mmap-thread-lookup.c @@ -188,9 +188,8 @@ static int mmap_events(synth_cb synth) pr_debug("looking for map %p\n", td->map); - thread__find_addr_map(thread, - PERF_RECORD_MISC_USER, MAP__FUNCTION, - (unsigned long) (td->map + 1), &al); + thread__find_map(thread, PERF_RECORD_MISC_USER, + (unsigned long) (td->map + 1), &al); thread__put(thread); @@ -218,7 +217,7 @@ static int mmap_events(synth_cb synth) * perf_event__synthesize_threads (global) * * We test we can find all memory maps via: - * thread__find_addr_map + * thread__find_map * * by using all thread objects. */ diff --git a/tools/perf/tests/parse-events.c b/tools/perf/tests/parse-events.c index 18b06444f230..b9ebe15afb13 100644 --- a/tools/perf/tests/parse-events.c +++ b/tools/perf/tests/parse-events.c @@ -1309,18 +1309,26 @@ static int test__checkevent_config_cache(struct perf_evlist *evlist) return 0; } +static int test__intel_pt(struct perf_evlist *evlist) +{ + struct perf_evsel *evsel = perf_evlist__first(evlist); + + TEST_ASSERT_VAL("wrong name setting", strcmp(evsel->name, "intel_pt//u") == 0); + return 0; +} + static int count_tracepoints(void) { struct dirent *events_ent; DIR *events_dir; int cnt = 0; - events_dir = opendir(tracing_events_path); + events_dir = tracing_events__opendir(); TEST_ASSERT_VAL("Can't open events dir", events_dir); while ((events_ent = readdir(events_dir))) { - char sys_path[PATH_MAX]; + char *sys_path; struct dirent *sys_ent; DIR *sys_dir; @@ -1331,8 +1339,8 @@ static int count_tracepoints(void) || !strcmp(events_ent->d_name, "header_page")) continue; - scnprintf(sys_path, PATH_MAX, "%s/%s", - tracing_events_path, events_ent->d_name); + sys_path = get_events_file(events_ent->d_name); + TEST_ASSERT_VAL("Can't get sys path", sys_path); sys_dir = opendir(sys_path); TEST_ASSERT_VAL("Can't open sys dir", sys_dir); @@ -1348,6 +1356,7 @@ static int count_tracepoints(void) } closedir(sys_dir); + put_events_file(sys_path); } closedir(events_dir); @@ -1637,6 +1646,11 @@ static struct evlist_test test__events[] = { .check = test__checkevent_config_cache, .id = 51, }, + { + .name = "intel_pt//u", + .check = test__intel_pt, + .id = 52, + }, }; static struct evlist_test test__events_pmu[] = { diff --git a/tools/perf/tests/shell/record+probe_libc_inet_pton.sh b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh index 016882dbbc16..650b208f700f 100755 --- a/tools/perf/tests/shell/record+probe_libc_inet_pton.sh +++ b/tools/perf/tests/shell/record+probe_libc_inet_pton.sh @@ -16,18 +16,18 @@ nm -g $libc 2>/dev/null | fgrep -q inet_pton || exit 254 trace_libc_inet_pton_backtrace() { idx=0 expected[0]="ping[][0-9 \.:]+probe_libc:inet_pton: \([[:xdigit:]]+\)" - expected[1]=".*inet_pton[[:space:]]\($libc\)$" + expected[1]=".*inet_pton\+0x[[:xdigit:]]+[[:space:]]\($libc|inlined\)$" case "$(uname -m)" in s390x) eventattr='call-graph=dwarf,max-stack=4' - expected[2]="gaih_inet.*[[:space:]]\($libc|inlined\)$" - expected[3]="(__GI_)?getaddrinfo[[:space:]]\($libc|inlined\)$" - expected[4]="main[[:space:]]\(.*/bin/ping.*\)$" + expected[2]="gaih_inet.*\+0x[[:xdigit:]]+[[:space:]]\($libc|inlined\)$" + expected[3]="(__GI_)?getaddrinfo\+0x[[:xdigit:]]+[[:space:]]\($libc|inlined\)$" + expected[4]="main\+0x[[:xdigit:]]+[[:space:]]\(.*/bin/ping.*\)$" ;; *) eventattr='max-stack=3' - expected[2]="getaddrinfo[[:space:]]\($libc\)$" - expected[3]=".*\(.*/bin/ping.*\)$" + expected[2]="getaddrinfo\+0x[[:xdigit:]]+[[:space:]]\($libc\)$" + expected[3]=".*\+0x[[:xdigit:]]+[[:space:]]\(.*/bin/ping.*\)$" ;; esac diff --git a/tools/perf/tests/topology.c b/tools/perf/tests/topology.c index 17cb1bb3448c..40e30a26b23c 100644 --- a/tools/perf/tests/topology.c +++ b/tools/perf/tests/topology.c @@ -70,6 +70,27 @@ static int check_cpu_topology(char *path, struct cpu_map *map) session = perf_session__new(&data, false, NULL); TEST_ASSERT_VAL("can't get session", session); + /* On platforms with large numbers of CPUs process_cpu_topology() + * might issue an error while reading the perf.data file section + * HEADER_CPU_TOPOLOGY and the cpu_topology_map pointed to by member + * cpu is a NULL pointer. + * Example: On s390 + * CPU 0 is on core_id 0 and physical_package_id 6 + * CPU 1 is on core_id 1 and physical_package_id 3 + * + * Core_id and physical_package_id are platform and architecture + * dependend and might have higher numbers than the CPU id. + * This actually depends on the configuration. + * + * In this case process_cpu_topology() prints error message: + * "socket_id number is too big. You may need to upgrade the + * perf tool." + * + * This is the reason why this test might be skipped. + */ + if (!session->header.env.cpu) + return TEST_SKIP; + for (i = 0; i < session->header.env.nr_cpus_avail; i++) { if (!cpu_map__has(map, i)) continue; @@ -95,7 +116,7 @@ int test__session_topology(struct test *test __maybe_unused, int subtest __maybe { char path[PATH_MAX]; struct cpu_map *map; - int ret = -1; + int ret = TEST_FAIL; TEST_ASSERT_VAL("can't get templ file", !get_temp(path)); @@ -110,12 +131,9 @@ int test__session_topology(struct test *test __maybe_unused, int subtest __maybe goto free_path; } - if (check_cpu_topology(path, map)) - goto free_map; - ret = 0; - -free_map: + ret = check_cpu_topology(path, map); cpu_map__put(map); + free_path: unlink(path); return ret; diff --git a/tools/perf/tests/vmlinux-kallsyms.c b/tools/perf/tests/vmlinux-kallsyms.c index 1e5adb65632a..7691980b7df1 100644 --- a/tools/perf/tests/vmlinux-kallsyms.c +++ b/tools/perf/tests/vmlinux-kallsyms.c @@ -19,8 +19,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest struct symbol *sym; struct map *kallsyms_map, *vmlinux_map, *map; struct machine kallsyms, vmlinux; - enum map_type type = MAP__FUNCTION; - struct maps *maps = &vmlinux.kmaps.maps[type]; + struct maps *maps = machine__kernel_maps(&vmlinux); u64 mem_start, mem_end; bool header_printed; @@ -56,7 +55,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest * be compacted against the list of modules found in the "vmlinux" * code and with the one got from /proc/modules from the "kallsyms" code. */ - if (machine__load_kallsyms(&kallsyms, "/proc/kallsyms", type) <= 0) { + if (machine__load_kallsyms(&kallsyms, "/proc/kallsyms") <= 0) { pr_debug("dso__load_kallsyms "); goto out; } @@ -94,7 +93,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest * maps__reloc_vmlinux will notice and set proper ->[un]map_ip routines * to fixup the symbols. */ - if (machine__load_vmlinux_path(&vmlinux, type) <= 0) { + if (machine__load_vmlinux_path(&vmlinux) <= 0) { pr_debug("Couldn't find a vmlinux that matches the kernel running on this machine, skipping test\n"); err = TEST_SKIP; goto out; @@ -108,7 +107,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest * in the kallsyms dso. For the ones that are in both, check its names and * end addresses too. */ - for (nd = rb_first(&vmlinux_map->dso->symbols[type]); nd; nd = rb_next(nd)) { + map__for_each_symbol(vmlinux_map, sym, nd) { struct symbol *pair, *first_pair; sym = rb_entry(nd, struct symbol, rb_node); @@ -119,8 +118,7 @@ int test__vmlinux_matches_kallsyms(struct test *test __maybe_unused, int subtest mem_start = vmlinux_map->unmap_ip(vmlinux_map, sym->start); mem_end = vmlinux_map->unmap_ip(vmlinux_map, sym->end); - first_pair = machine__find_kernel_symbol(&kallsyms, type, - mem_start, NULL); + first_pair = machine__find_kernel_symbol(&kallsyms, mem_start, NULL); pair = first_pair; if (pair && UM(pair->start) == mem_start) { @@ -149,7 +147,7 @@ next_pair: */ continue; } else { - pair = machine__find_kernel_symbol_by_name(&kallsyms, type, sym->name, NULL); + pair = machine__find_kernel_symbol_by_name(&kallsyms, sym->name, NULL); if (pair) { if (UM(pair->start) == mem_start) goto next_pair; @@ -183,7 +181,7 @@ next_pair: * so use the short name, less descriptive but the same ("[kernel]" in * both cases. */ - pair = map_groups__find_by_name(&kallsyms.kmaps, type, + pair = map_groups__find_by_name(&kallsyms.kmaps, (map->dso->kernel ? map->dso->short_name : map->dso->name)); @@ -206,7 +204,7 @@ next_pair: mem_start = vmlinux_map->unmap_ip(vmlinux_map, map->start); mem_end = vmlinux_map->unmap_ip(vmlinux_map, map->end); - pair = map_groups__find(&kallsyms.kmaps, type, mem_start); + pair = map_groups__find(&kallsyms.kmaps, mem_start); if (pair == NULL || pair->priv) continue; @@ -228,7 +226,7 @@ next_pair: header_printed = false; - maps = &kallsyms.kmaps.maps[type]; + maps = machine__kernel_maps(&kallsyms); for (map = maps__first(maps); map; map = map__next(map)) { if (!map->priv) { diff --git a/tools/perf/trace/beauty/prctl_option.sh b/tools/perf/trace/beauty/prctl_option.sh index 0be4138fbe71..f24722146ebe 100755 --- a/tools/perf/trace/beauty/prctl_option.sh +++ b/tools/perf/trace/beauty/prctl_option.sh @@ -1,6 +1,6 @@ #!/bin/sh -header_dir=$1 +[ $# -eq 1 ] && header_dir=$1 || header_dir=tools/include/uapi/linux/ printf "static const char *prctl_options[] = {\n" regex='^#define[[:space:]]+PR_([GS]ET\w+)[[:space:]]*([[:xdigit:]]+).*' diff --git a/tools/perf/ui/browsers/annotate.c b/tools/perf/ui/browsers/annotate.c index 3781d74088a7..8be40fa903aa 100644 --- a/tools/perf/ui/browsers/annotate.c +++ b/tools/perf/ui/browsers/annotate.c @@ -695,6 +695,7 @@ static int annotate_browser__run(struct annotate_browser *browser, "O Bump offset level (jump targets -> +call -> all -> cycle thru)\n" "s Toggle source code view\n" "t Circulate percent, total period, samples view\n" + "c Show min/max cycle\n" "/ Search string\n" "k Toggle line numbers\n" "P Print to [symbol_name].annotation file.\n" @@ -791,6 +792,13 @@ show_sup_ins: notes->options->show_total_period = true; annotation__update_column_widths(notes); continue; + case 'c': + if (notes->options->show_minmax_cycle) + notes->options->show_minmax_cycle = false; + else + notes->options->show_minmax_cycle = true; + annotation__update_column_widths(notes); + continue; case K_LEFT: case K_ESC: case 'q': diff --git a/tools/perf/ui/browsers/map.c b/tools/perf/ui/browsers/map.c index e03fa75f108a..5b8b8c637686 100644 --- a/tools/perf/ui/browsers/map.c +++ b/tools/perf/ui/browsers/map.c @@ -104,7 +104,7 @@ int map__browse(struct map *map) { struct map_browser mb = { .b = { - .entries = &map->dso->symbols[map->type], + .entries = &map->dso->symbols, .refresh = ui_browser__rb_tree_refresh, .seek = ui_browser__rb_tree_seek, .write = map_browser__write, diff --git a/tools/perf/ui/stdio/hist.c b/tools/perf/ui/stdio/hist.c index 6832fcb2e6ff..c1eb476da91b 100644 --- a/tools/perf/ui/stdio/hist.c +++ b/tools/perf/ui/stdio/hist.c @@ -819,8 +819,7 @@ size_t hists__fprintf(struct hists *hists, bool show_header, int max_rows, } if (h->ms.map == NULL && verbose > 1) { - __map_groups__fprintf_maps(h->thread->mg, - MAP__FUNCTION, fp); + map_groups__fprintf(h->thread->mg, fp); fprintf(fp, "%.10s end\n", graph_dotted_line); } } diff --git a/tools/perf/util/Build b/tools/perf/util/Build index 8052373bcd6a..5d4c45b76895 100644 --- a/tools/perf/util/Build +++ b/tools/perf/util/Build @@ -152,6 +152,8 @@ libperf-y += perf-hooks.o libperf-$(CONFIG_CXX) += c++/ CFLAGS_config.o += -DETC_PERFCONFIG="BUILD_STR($(ETC_PERFCONFIG_SQ))" +CFLAGS_llvm-utils.o += -DPERF_INCLUDE_DIR="BUILD_STR($(perf_include_dir_SQ))" + # avoid compiler warnings in 32-bit mode CFLAGS_genelf_debug.o += -Wno-packed diff --git a/tools/perf/util/annotate.c b/tools/perf/util/annotate.c index 536ee148bff8..71897689dacf 100644 --- a/tools/perf/util/annotate.c +++ b/tools/perf/util/annotate.c @@ -760,6 +760,15 @@ static int __symbol__account_cycles(struct annotation *notes, ch[offset].num_aggr++; ch[offset].cycles_aggr += cycles; + if (cycles > ch[offset].cycles_max) + ch[offset].cycles_max = cycles; + + if (ch[offset].cycles_min) { + if (cycles && cycles < ch[offset].cycles_min) + ch[offset].cycles_min = cycles; + } else + ch[offset].cycles_min = cycles; + if (!have_start && ch[offset].have_start) return 0; if (ch[offset].num) { @@ -953,8 +962,11 @@ void annotation__compute_ipc(struct annotation *notes, size_t size) if (ch->have_start) annotation__count_and_fill(notes, ch->start, offset, ch); al = notes->offsets[offset]; - if (al && ch->num_aggr) + if (al && ch->num_aggr) { al->cycles = ch->cycles_aggr / ch->num_aggr; + al->cycles_max = ch->cycles_max; + al->cycles_min = ch->cycles_min; + } notes->have_cycles = true; } } @@ -1263,6 +1275,9 @@ annotation_line__print(struct annotation_line *al, struct symbol *sym, u64 start max_percent = sample->percent; } + if (al->samples_nr > nr_percent) + nr_percent = al->samples_nr; + if (max_percent < min_pcnt) return -1; @@ -1950,6 +1965,7 @@ int symbol__annotate_printf(struct symbol *sym, struct map *map, u64 len; int width = symbol_conf.show_total_period ? 12 : 8; int graph_dotted_len; + char buf[512]; filename = strdup(dso->long_name); if (!filename) @@ -1962,8 +1978,11 @@ int symbol__annotate_printf(struct symbol *sym, struct map *map, len = symbol__size(sym); - if (perf_evsel__is_group_event(evsel)) + if (perf_evsel__is_group_event(evsel)) { width *= evsel->nr_members; + perf_evsel__group_desc(evsel, buf, sizeof(buf)); + evsel_name = buf; + } graph_dotted_len = printf(" %-*.*s| Source code & Disassembly of %s for %s (%" PRIu64 " samples)\n", width, width, symbol_conf.show_total_period ? "Period" : @@ -2483,13 +2502,38 @@ static void __annotation_line__write(struct annotation_line *al, struct annotati else obj__printf(obj, "%*s ", ANNOTATION__IPC_WIDTH - 1, "IPC"); - if (al->cycles) - obj__printf(obj, "%*" PRIu64 " ", + if (!notes->options->show_minmax_cycle) { + if (al->cycles) + obj__printf(obj, "%*" PRIu64 " ", ANNOTATION__CYCLES_WIDTH - 1, al->cycles); - else if (!show_title) - obj__printf(obj, "%*s", ANNOTATION__CYCLES_WIDTH, " "); - else - obj__printf(obj, "%*s ", ANNOTATION__CYCLES_WIDTH - 1, "Cycle"); + else if (!show_title) + obj__printf(obj, "%*s", + ANNOTATION__CYCLES_WIDTH, " "); + else + obj__printf(obj, "%*s ", + ANNOTATION__CYCLES_WIDTH - 1, + "Cycle"); + } else { + if (al->cycles) { + char str[32]; + + scnprintf(str, sizeof(str), + "%" PRIu64 "(%" PRIu64 "/%" PRIu64 ")", + al->cycles, al->cycles_min, + al->cycles_max); + + obj__printf(obj, "%*s ", + ANNOTATION__MINMAX_CYCLES_WIDTH - 1, + str); + } else if (!show_title) + obj__printf(obj, "%*s", + ANNOTATION__MINMAX_CYCLES_WIDTH, + " "); + else + obj__printf(obj, "%*s ", + ANNOTATION__MINMAX_CYCLES_WIDTH - 1, + "Cycle(min/max)"); + } } obj__printf(obj, " "); diff --git a/tools/perf/util/annotate.h b/tools/perf/util/annotate.h index f28a9e43421d..5080b6dd98b8 100644 --- a/tools/perf/util/annotate.h +++ b/tools/perf/util/annotate.h @@ -61,6 +61,7 @@ bool ins__is_fused(struct arch *arch, const char *ins1, const char *ins2); #define ANNOTATION__IPC_WIDTH 6 #define ANNOTATION__CYCLES_WIDTH 6 +#define ANNOTATION__MINMAX_CYCLES_WIDTH 19 struct annotation_options { bool hide_src_code, @@ -69,7 +70,8 @@ struct annotation_options { show_linenr, show_nr_jumps, show_nr_samples, - show_total_period; + show_total_period, + show_minmax_cycle; u8 offset_level; }; @@ -105,6 +107,8 @@ struct annotation_line { int jump_sources; float ipc; u64 cycles; + u64 cycles_max; + u64 cycles_min; size_t privsize; char *path; u32 idx; @@ -186,6 +190,8 @@ struct cyc_hist { u64 start; u64 cycles; u64 cycles_aggr; + u64 cycles_max; + u64 cycles_min; u32 num; u32 num_aggr; u8 have_start; @@ -239,6 +245,9 @@ struct annotation { static inline int annotation__cycles_width(struct annotation *notes) { + if (notes->have_cycles && notes->options->show_minmax_cycle) + return ANNOTATION__IPC_WIDTH + ANNOTATION__MINMAX_CYCLES_WIDTH; + return notes->have_cycles ? ANNOTATION__IPC_WIDTH + ANNOTATION__CYCLES_WIDTH : 0; } diff --git a/tools/perf/util/auxtrace.c b/tools/perf/util/auxtrace.c index 857de69a5361..d056447520a2 100644 --- a/tools/perf/util/auxtrace.c +++ b/tools/perf/util/auxtrace.c @@ -1679,7 +1679,7 @@ struct sym_args { static bool kern_sym_match(struct sym_args *args, const char *name, char type) { /* A function with the same name, and global or the n'th found or any */ - return symbol_type__is_a(type, MAP__FUNCTION) && + return kallsyms__is_function(type) && !strcmp(name, args->name) && ((args->global && isupper(type)) || (args->selected && ++(args->cnt) == args->idx) || @@ -1784,7 +1784,7 @@ static int find_entire_kern_cb(void *arg, const char *name __maybe_unused, { struct sym_args *args = arg; - if (!symbol_type__is_a(type, MAP__FUNCTION)) + if (!kallsyms__is_function(type)) return 0; if (!args->started) { @@ -1915,7 +1915,7 @@ static void print_duplicate_syms(struct dso *dso, const char *sym_name) pr_err("Multiple symbols with name '%s'\n", sym_name); - sym = dso__first_symbol(dso, MAP__FUNCTION); + sym = dso__first_symbol(dso); while (sym) { if (dso_sym_match(sym, sym_name, &cnt, -1)) { pr_err("#%d\t0x%"PRIx64"\t%c\t%s\n", @@ -1945,7 +1945,7 @@ static int find_dso_sym(struct dso *dso, const char *sym_name, u64 *start, *start = 0; *size = 0; - sym = dso__first_symbol(dso, MAP__FUNCTION); + sym = dso__first_symbol(dso); while (sym) { if (*start) { if (!*size) @@ -1972,8 +1972,8 @@ static int find_dso_sym(struct dso *dso, const char *sym_name, u64 *start, static int addr_filter__entire_dso(struct addr_filter *filt, struct dso *dso) { - struct symbol *first_sym = dso__first_symbol(dso, MAP__FUNCTION); - struct symbol *last_sym = dso__last_symbol(dso, MAP__FUNCTION); + struct symbol *first_sym = dso__first_symbol(dso); + struct symbol *last_sym = dso__last_symbol(dso); if (!first_sym || !last_sym) { pr_err("Failed to determine filter for %s\nNo symbols found.\n", diff --git a/tools/perf/util/bpf-loader.c b/tools/perf/util/bpf-loader.c index af7ad814b2c3..cee658733e2c 100644 --- a/tools/perf/util/bpf-loader.c +++ b/tools/perf/util/bpf-loader.c @@ -66,7 +66,7 @@ bpf__prepare_load_buffer(void *obj_buf, size_t obj_buf_sz, const char *name) } obj = bpf_object__open_buffer(obj_buf, obj_buf_sz, name); - if (IS_ERR(obj)) { + if (IS_ERR_OR_NULL(obj)) { pr_debug("bpf: failed to load buffer\n"); return ERR_PTR(-EINVAL); } @@ -102,14 +102,14 @@ struct bpf_object *bpf__prepare_load(const char *filename, bool source) pr_debug("bpf: successfull builtin compilation\n"); obj = bpf_object__open_buffer(obj_buf, obj_buf_sz, filename); - if (!IS_ERR(obj) && llvm_param.dump_obj) + if (!IS_ERR_OR_NULL(obj) && llvm_param.dump_obj) llvm__dump_obj(filename, obj_buf, obj_buf_sz); free(obj_buf); } else obj = bpf_object__open(filename); - if (IS_ERR(obj)) { + if (IS_ERR_OR_NULL(obj)) { pr_debug("bpf: failed to load %s\n", filename); return obj; } diff --git a/tools/perf/util/build-id.c b/tools/perf/util/build-id.c index 537eadd81914..04b1d53e4bf9 100644 --- a/tools/perf/util/build-id.c +++ b/tools/perf/util/build-id.c @@ -47,9 +47,7 @@ int build_id__mark_dso_hit(struct perf_tool *tool __maybe_unused, return -1; } - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, sample->ip, &al); - - if (al.map != NULL) + if (thread__find_map(thread, sample->cpumode, sample->ip, &al)) al.map->dso->hit = 1; thread__put(thread); diff --git a/tools/perf/util/config.c b/tools/perf/util/config.c index 84eb9393c7db..5ac157056cdf 100644 --- a/tools/perf/util/config.c +++ b/tools/perf/util/config.c @@ -707,6 +707,14 @@ struct perf_config_set *perf_config_set__new(void) return set; } +static int perf_config__init(void) +{ + if (config_set == NULL) + config_set = perf_config_set__new(); + + return config_set == NULL; +} + int perf_config(config_fn_t fn, void *data) { int ret = 0; @@ -714,7 +722,7 @@ int perf_config(config_fn_t fn, void *data) struct perf_config_section *section; struct perf_config_item *item; - if (config_set == NULL) + if (config_set == NULL && perf_config__init()) return -1; perf_config_set__for_each_entry(config_set, section, item) { @@ -735,12 +743,6 @@ int perf_config(config_fn_t fn, void *data) return ret; } -void perf_config__init(void) -{ - if (config_set == NULL) - config_set = perf_config_set__new(); -} - void perf_config__exit(void) { perf_config_set__delete(config_set); diff --git a/tools/perf/util/config.h b/tools/perf/util/config.h index baf82bf227ac..bd0a5897c76a 100644 --- a/tools/perf/util/config.h +++ b/tools/perf/util/config.h @@ -38,7 +38,6 @@ struct perf_config_set *perf_config_set__new(void); void perf_config_set__delete(struct perf_config_set *set); int perf_config_set__collect(struct perf_config_set *set, const char *file_name, const char *var, const char *value); -void perf_config__init(void); void perf_config__exit(void); void perf_config__refresh(void); diff --git a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c index c8b98fa22997..4d5fc374e730 100644 --- a/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c +++ b/tools/perf/util/cs-etm-decoder/cs-etm-decoder.c @@ -96,11 +96,19 @@ int cs_etm_decoder__get_packet(struct cs_etm_decoder *decoder, /* Nothing to do, might as well just return */ if (decoder->packet_count == 0) return 0; + /* + * The queueing process in function cs_etm_decoder__buffer_packet() + * increments the tail *before* using it. This is somewhat counter + * intuitive but it has the advantage of centralizing tail management + * at a single location. Because of that we need to follow the same + * heuristic with the head, i.e we increment it before using its + * value. Otherwise the first element of the packet queue is not + * used. + */ + decoder->head = (decoder->head + 1) & (MAX_BUFFER - 1); *packet = decoder->packet_buffer[decoder->head]; - decoder->head = (decoder->head + 1) & (MAX_BUFFER - 1); - decoder->packet_count--; return 1; diff --git a/tools/perf/util/cs-etm.c b/tools/perf/util/cs-etm.c index 40020b1ca54f..822ba915d144 100644 --- a/tools/perf/util/cs-etm.c +++ b/tools/perf/util/cs-etm.c @@ -239,6 +239,7 @@ static void cs_etm__free(struct perf_session *session) for (i = 0; i < aux->num_cpu; i++) zfree(&aux->metadata[i]); + thread__zput(aux->unknown_thread); zfree(&aux->metadata); zfree(&aux); } @@ -269,9 +270,7 @@ static u32 cs_etm__mem_access(struct cs_etm_queue *etmq, u64 address, thread = etmq->etm->unknown_thread; } - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, address, &al); - - if (!al.map || !al.map->dso) + if (!thread__find_map(thread, cpumode, address, &al) || !al.map->dso) return 0; if (al.map->dso->data.status == DSO_DATA_STATUS_ERROR && @@ -612,8 +611,8 @@ cs_etm__get_trace(struct cs_etm_buffer *buff, struct cs_etm_queue *etmq) return buff->len; } -static void cs_etm__set_pid_tid_cpu(struct cs_etm_auxtrace *etm, - struct auxtrace_queue *queue) +static void cs_etm__set_pid_tid_cpu(struct cs_etm_auxtrace *etm, + struct auxtrace_queue *queue) { struct cs_etm_queue *etmq = queue->priv; @@ -1357,6 +1356,23 @@ int cs_etm__process_auxtrace_info(union perf_event *event, etm->auxtrace.free = cs_etm__free; session->auxtrace = &etm->auxtrace; + etm->unknown_thread = thread__new(999999999, 999999999); + if (!etm->unknown_thread) + goto err_free_queues; + + /* + * Initialize list node so that at thread__zput() we can avoid + * segmentation fault at list_del_init(). + */ + INIT_LIST_HEAD(&etm->unknown_thread->node); + + err = thread__set_comm(etm->unknown_thread, "unknown", 0); + if (err) + goto err_delete_thread; + + if (thread__init_map_groups(etm->unknown_thread, etm->machine)) + goto err_delete_thread; + if (dump_trace) { cs_etm__print_auxtrace_info(auxtrace_info->priv, num_cpu); return 0; @@ -1371,16 +1387,18 @@ int cs_etm__process_auxtrace_info(union perf_event *event, err = cs_etm__synth_events(etm, session); if (err) - goto err_free_queues; + goto err_delete_thread; err = auxtrace_queues__process_index(&etm->queues, session); if (err) - goto err_free_queues; + goto err_delete_thread; etm->data_queued = etm->queues.populated; return 0; +err_delete_thread: + thread__zput(etm->unknown_thread); err_free_queues: auxtrace_queues__free(&etm->queues); session->auxtrace = NULL; diff --git a/tools/perf/util/db-export.c b/tools/perf/util/db-export.c index b0c2b5c5d337..7123746edcf4 100644 --- a/tools/perf/util/db-export.c +++ b/tools/perf/util/db-export.c @@ -247,9 +247,9 @@ static int db_ids_from_al(struct db_export *dbe, struct addr_location *al, *dso_db_id = dso->db_id; if (!al->sym) { - al->sym = symbol__new(al->addr, 0, 0, "unknown"); + al->sym = symbol__new(al->addr, 0, 0, 0, "unknown"); if (al->sym) - dso__insert_symbol(dso, al->map->type, al->sym); + dso__insert_symbol(dso, al->sym); } if (al->sym) { @@ -315,8 +315,7 @@ static struct call_path *call_path_from_sample(struct db_export *dbe, al.addr = node->ip; if (al.map && !al.sym) - al.sym = dso__find_symbol(al.map->dso, MAP__FUNCTION, - al.addr); + al.sym = dso__find_symbol(al.map->dso, al.addr); db_ids_from_al(dbe, &al, &dso_db_id, &sym_db_id, &offset); diff --git a/tools/perf/util/dso.c b/tools/perf/util/dso.c index 36ef45b2e89d..cdfc2e5f55f5 100644 --- a/tools/perf/util/dso.c +++ b/tools/perf/util/dso.c @@ -1014,7 +1014,7 @@ struct map *dso__new_map(const char *name) struct dso *dso = dso__new(name); if (dso) - map = map__new2(0, dso, MAP__FUNCTION); + map = map__new2(0, dso); return map; } @@ -1176,19 +1176,19 @@ int dso__name_len(const struct dso *dso) return dso->short_name_len; } -bool dso__loaded(const struct dso *dso, enum map_type type) +bool dso__loaded(const struct dso *dso) { - return dso->loaded & (1 << type); + return dso->loaded; } -bool dso__sorted_by_name(const struct dso *dso, enum map_type type) +bool dso__sorted_by_name(const struct dso *dso) { - return dso->sorted_by_name & (1 << type); + return dso->sorted_by_name; } -void dso__set_sorted_by_name(struct dso *dso, enum map_type type) +void dso__set_sorted_by_name(struct dso *dso) { - dso->sorted_by_name |= (1 << type); + dso->sorted_by_name = true; } struct dso *dso__new(const char *name) @@ -1196,12 +1196,10 @@ struct dso *dso__new(const char *name) struct dso *dso = calloc(1, sizeof(*dso) + strlen(name) + 1); if (dso != NULL) { - int i; strcpy(dso->name, name); dso__set_long_name(dso, dso->name, false); dso__set_short_name(dso, dso->name, false); - for (i = 0; i < MAP__NR_TYPES; ++i) - dso->symbols[i] = dso->symbol_names[i] = RB_ROOT; + dso->symbols = dso->symbol_names = RB_ROOT; dso->data.cache = RB_ROOT; dso->inlined_nodes = RB_ROOT; dso->srclines = RB_ROOT; @@ -1231,8 +1229,6 @@ struct dso *dso__new(const char *name) void dso__delete(struct dso *dso) { - int i; - if (!RB_EMPTY_NODE(&dso->rb_node)) pr_err("DSO %s is still in rbtree when being deleted!\n", dso->long_name); @@ -1240,8 +1236,7 @@ void dso__delete(struct dso *dso) /* free inlines first, as they reference symbols */ inlines__tree_delete(&dso->inlined_nodes); srcline__tree_delete(&dso->srclines); - for (i = 0; i < MAP__NR_TYPES; ++i) - symbols__delete(&dso->symbols[i]); + symbols__delete(&dso->symbols); if (dso->short_name_allocated) { zfree((char **)&dso->short_name); @@ -1451,9 +1446,7 @@ size_t __dsos__fprintf(struct list_head *head, FILE *fp) size_t ret = 0; list_for_each_entry(pos, head, node) { - int i; - for (i = 0; i < MAP__NR_TYPES; ++i) - ret += dso__fprintf(pos, i, fp); + ret += dso__fprintf(pos, fp); } return ret; @@ -1467,18 +1460,17 @@ size_t dso__fprintf_buildid(struct dso *dso, FILE *fp) return fprintf(fp, "%s", sbuild_id); } -size_t dso__fprintf(struct dso *dso, enum map_type type, FILE *fp) +size_t dso__fprintf(struct dso *dso, FILE *fp) { struct rb_node *nd; size_t ret = fprintf(fp, "dso: %s (", dso->short_name); if (dso->short_name != dso->long_name) ret += fprintf(fp, "%s, ", dso->long_name); - ret += fprintf(fp, "%s, %sloaded, ", map_type__name[type], - dso__loaded(dso, type) ? "" : "NOT "); + ret += fprintf(fp, "%sloaded, ", dso__loaded(dso) ? "" : "NOT "); ret += dso__fprintf_buildid(dso, fp); ret += fprintf(fp, ")\n"); - for (nd = rb_first(&dso->symbols[type]); nd; nd = rb_next(nd)) { + for (nd = rb_first(&dso->symbols); nd; nd = rb_next(nd)) { struct symbol *pos = rb_entry(nd, struct symbol, rb_node); ret += symbol__fprintf(pos, fp); } diff --git a/tools/perf/util/dso.h b/tools/perf/util/dso.h index c229dbe0277a..ef69de2e69ea 100644 --- a/tools/perf/util/dso.h +++ b/tools/perf/util/dso.h @@ -140,14 +140,14 @@ struct dso { struct list_head node; struct rb_node rb_node; /* rbtree node sorted by long name */ struct rb_root *root; /* root of rbtree that rb_node is in */ - struct rb_root symbols[MAP__NR_TYPES]; - struct rb_root symbol_names[MAP__NR_TYPES]; + struct rb_root symbols; + struct rb_root symbol_names; struct rb_root inlined_nodes; struct rb_root srclines; struct { u64 addr; struct symbol *symbol; - } last_find_result[MAP__NR_TYPES]; + } last_find_result; void *a2l; char *symsrc_filename; unsigned int a2l_fails; @@ -164,8 +164,8 @@ struct dso { u8 short_name_allocated:1; u8 long_name_allocated:1; u8 is_64_bit:1; - u8 sorted_by_name; - u8 loaded; + bool sorted_by_name; + bool loaded; u8 rel; u8 build_id[BUILD_ID_SIZE]; u64 text_offset; @@ -202,14 +202,13 @@ struct dso { * @dso: the 'struct dso *' in which symbols itereated * @pos: the 'struct symbol *' to use as a loop cursor * @n: the 'struct rb_node *' to use as a temporary storage - * @type: the 'enum map_type' type of symbols */ -#define dso__for_each_symbol(dso, pos, n, type) \ - symbols__for_each_entry(&(dso)->symbols[(type)], pos, n) +#define dso__for_each_symbol(dso, pos, n) \ + symbols__for_each_entry(&(dso)->symbols, pos, n) -static inline void dso__set_loaded(struct dso *dso, enum map_type type) +static inline void dso__set_loaded(struct dso *dso) { - dso->loaded |= (1 << type); + dso->loaded = true; } struct dso *dso__new(const char *name); @@ -231,11 +230,16 @@ static inline void __dso__zput(struct dso **dso) #define dso__zput(dso) __dso__zput(&dso) -bool dso__loaded(const struct dso *dso, enum map_type type); +bool dso__loaded(const struct dso *dso); -bool dso__sorted_by_name(const struct dso *dso, enum map_type type); -void dso__set_sorted_by_name(struct dso *dso, enum map_type type); -void dso__sort_by_name(struct dso *dso, enum map_type type); +static inline bool dso__has_symbols(const struct dso *dso) +{ + return !RB_EMPTY_ROOT(&dso->symbols); +} + +bool dso__sorted_by_name(const struct dso *dso); +void dso__set_sorted_by_name(struct dso *dso); +void dso__sort_by_name(struct dso *dso); void dso__set_build_id(struct dso *dso, void *build_id); bool dso__build_id_equal(const struct dso *dso, u8 *build_id); @@ -349,9 +353,8 @@ size_t __dsos__fprintf_buildid(struct list_head *head, FILE *fp, size_t __dsos__fprintf(struct list_head *head, FILE *fp); size_t dso__fprintf_buildid(struct dso *dso, FILE *fp); -size_t dso__fprintf_symbols_by_name(struct dso *dso, - enum map_type type, FILE *fp); -size_t dso__fprintf(struct dso *dso, enum map_type type, FILE *fp); +size_t dso__fprintf_symbols_by_name(struct dso *dso, FILE *fp); +size_t dso__fprintf(struct dso *dso, FILE *fp); static inline bool dso__is_vmlinux(struct dso *dso) { diff --git a/tools/perf/util/env.c b/tools/perf/util/env.c index 4c842762e3f2..59f38c7693f8 100644 --- a/tools/perf/util/env.c +++ b/tools/perf/util/env.c @@ -93,6 +93,37 @@ int perf_env__read_cpu_topology_map(struct perf_env *env) return 0; } +static int perf_env__read_arch(struct perf_env *env) +{ + struct utsname uts; + + if (env->arch) + return 0; + + if (!uname(&uts)) + env->arch = strdup(uts.machine); + + return env->arch ? 0 : -ENOMEM; +} + +static int perf_env__read_nr_cpus_avail(struct perf_env *env) +{ + if (env->nr_cpus_avail == 0) + env->nr_cpus_avail = cpu__max_present_cpu(); + + return env->nr_cpus_avail ? 0 : -ENOENT; +} + +const char *perf_env__raw_arch(struct perf_env *env) +{ + return env && !perf_env__read_arch(env) ? env->arch : "unknown"; +} + +int perf_env__nr_cpus_avail(struct perf_env *env) +{ + return env && !perf_env__read_nr_cpus_avail(env) ? env->nr_cpus_avail : 0; +} + void cpu_cache_level__free(struct cpu_cache_level *cache) { free(cache->type); diff --git a/tools/perf/util/env.h b/tools/perf/util/env.h index c4ef2e523367..1f3ccc368530 100644 --- a/tools/perf/util/env.h +++ b/tools/perf/util/env.h @@ -76,4 +76,7 @@ int perf_env__read_cpu_topology_map(struct perf_env *env); void cpu_cache_level__free(struct cpu_cache_level *cache); const char *perf_env__arch(struct perf_env *env); +const char *perf_env__raw_arch(struct perf_env *env); +int perf_env__nr_cpus_avail(struct perf_env *env); + #endif /* __PERF_ENV_H */ diff --git a/tools/perf/util/event.c b/tools/perf/util/event.c index 98ff3a6a3d50..0c8ecf0c78a4 100644 --- a/tools/perf/util/event.c +++ b/tools/perf/util/event.c @@ -88,10 +88,10 @@ static const char *perf_ns__name(unsigned int id) return perf_ns__names[id]; } -static int perf_tool__process_synth_event(struct perf_tool *tool, - union perf_event *event, - struct machine *machine, - perf_event__handler_t process) +int perf_tool__process_synth_event(struct perf_tool *tool, + union perf_event *event, + struct machine *machine, + perf_event__handler_t process) { struct perf_sample synth_sample = { .pid = -1, @@ -464,8 +464,7 @@ int perf_event__synthesize_modules(struct perf_tool *tool, { int rc = 0; struct map *pos; - struct map_groups *kmaps = &machine->kmaps; - struct maps *maps = &kmaps->maps[MAP__FUNCTION]; + struct maps *maps = machine__kernel_maps(machine); union perf_event *event = zalloc((sizeof(event->mmap) + machine->id_hdr_size)); if (event == NULL) { @@ -488,7 +487,7 @@ int perf_event__synthesize_modules(struct perf_tool *tool, for (pos = maps__first(maps); pos; pos = map__next(pos)) { size_t size; - if (__map__is_kernel(pos)) + if (!__map__is_kmodule(pos)) continue; size = PERF_ALIGN(pos->dso->long_name_len + 1, sizeof(u64)); @@ -869,7 +868,7 @@ static int find_symbol_cb(void *arg, const char *name, char type, * Must be a function or at least an alias, as in PARISC64, where "_text" is * an 'A' to the same address as "_stext". */ - if (!(symbol_type__is_a(type, MAP__FUNCTION) || + if (!(kallsyms__is_function(type) || type == 'A') || strcmp(name, args->name)) return 0; @@ -889,9 +888,16 @@ int kallsyms__get_function_start(const char *kallsyms_filename, return 0; } -int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, - perf_event__handler_t process, - struct machine *machine) +int __weak perf_event__synthesize_extra_kmaps(struct perf_tool *tool __maybe_unused, + perf_event__handler_t process __maybe_unused, + struct machine *machine __maybe_unused) +{ + return 0; +} + +static int __perf_event__synthesize_kernel_mmap(struct perf_tool *tool, + perf_event__handler_t process, + struct machine *machine) { size_t size; struct map *map = machine__kernel_map(machine); @@ -944,6 +950,19 @@ int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, return err; } +int perf_event__synthesize_kernel_mmap(struct perf_tool *tool, + perf_event__handler_t process, + struct machine *machine) +{ + int err; + + err = __perf_event__synthesize_kernel_mmap(tool, process, machine); + if (err < 0) + return err; + + return perf_event__synthesize_extra_kmaps(tool, process, machine); +} + int perf_event__synthesize_thread_map2(struct perf_tool *tool, struct thread_map *threads, perf_event__handler_t process, @@ -1489,9 +1508,8 @@ int perf_event__process(struct perf_tool *tool __maybe_unused, return machine__process_event(machine, event, sample); } -void thread__find_addr_map(struct thread *thread, u8 cpumode, - enum map_type type, u64 addr, - struct addr_location *al) +struct map *thread__find_map(struct thread *thread, u8 cpumode, u64 addr, + struct addr_location *al) { struct map_groups *mg = thread->mg; struct machine *machine = mg->machine; @@ -1505,7 +1523,7 @@ void thread__find_addr_map(struct thread *thread, u8 cpumode, if (machine == NULL) { al->map = NULL; - return; + return NULL; } if (cpumode == PERF_RECORD_MISC_KERNEL && perf_host) { @@ -1533,10 +1551,10 @@ void thread__find_addr_map(struct thread *thread, u8 cpumode, !perf_host) al->filtered |= (1 << HIST_FILTER__HOST); - return; + return NULL; } try_again: - al->map = map_groups__find(mg, type, al->addr); + al->map = map_groups__find(mg, al->addr); if (al->map == NULL) { /* * If this is outside of all known maps, and is a negative @@ -1563,17 +1581,17 @@ try_again: map__load(al->map); al->addr = al->map->map_ip(al->map, al->addr); } + + return al->map; } -void thread__find_addr_location(struct thread *thread, - u8 cpumode, enum map_type type, u64 addr, - struct addr_location *al) +struct symbol *thread__find_symbol(struct thread *thread, u8 cpumode, + u64 addr, struct addr_location *al) { - thread__find_addr_map(thread, cpumode, type, addr, al); - if (al->map != NULL) + al->sym = NULL; + if (thread__find_map(thread, cpumode, addr, al)) al->sym = map__find_symbol(al->map, al->addr); - else - al->sym = NULL; + return al->sym; } /* @@ -1590,7 +1608,7 @@ int machine__resolve(struct machine *machine, struct addr_location *al, return -1; dump_printf(" ... thread: %s:%d\n", thread__comm_str(thread), thread->tid); - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, sample->ip, al); + thread__find_map(thread, sample->cpumode, sample->ip, al); dump_printf(" ...... dso: %s\n", al->map ? al->map->dso->long_name : al->level == 'H' ? "[hypervisor]" : "<not found>"); @@ -1669,10 +1687,7 @@ bool sample_addr_correlates_sym(struct perf_event_attr *attr) void thread__resolve(struct thread *thread, struct addr_location *al, struct perf_sample *sample) { - thread__find_addr_map(thread, sample->cpumode, MAP__FUNCTION, sample->addr, al); - if (!al->map) - thread__find_addr_map(thread, sample->cpumode, MAP__VARIABLE, - sample->addr, al); + thread__find_map(thread, sample->cpumode, sample->addr, al); al->cpu = sample->cpu; al->sym = NULL; diff --git a/tools/perf/util/event.h b/tools/perf/util/event.h index 0f794744919c..bfa60bcafbde 100644 --- a/tools/perf/util/event.h +++ b/tools/perf/util/event.h @@ -750,6 +750,10 @@ int perf_event__process_exit(struct perf_tool *tool, union perf_event *event, struct perf_sample *sample, struct machine *machine); +int perf_tool__process_synth_event(struct perf_tool *tool, + union perf_event *event, + struct machine *machine, + perf_event__handler_t process); int perf_event__process(struct perf_tool *tool, union perf_event *event, struct perf_sample *sample, @@ -796,6 +800,10 @@ int perf_event__synthesize_mmap_events(struct perf_tool *tool, bool mmap_data, unsigned int proc_map_timeout); +int perf_event__synthesize_extra_kmaps(struct perf_tool *tool, + perf_event__handler_t process, + struct machine *machine); + size_t perf_event__fprintf_comm(union perf_event *event, FILE *fp); size_t perf_event__fprintf_mmap(union perf_event *event, FILE *fp); size_t perf_event__fprintf_mmap2(union perf_event *event, FILE *fp); diff --git a/tools/perf/util/evlist.c b/tools/perf/util/evlist.c index a59281d64368..e7a4b31a84fb 100644 --- a/tools/perf/util/evlist.c +++ b/tools/perf/util/evlist.c @@ -1795,3 +1795,18 @@ bool perf_evlist__exclude_kernel(struct perf_evlist *evlist) return true; } + +/* + * Events in data file are not collect in groups, but we still want + * the group display. Set the artificial group and set the leader's + * forced_leader flag to notify the display code. + */ +void perf_evlist__force_leader(struct perf_evlist *evlist) +{ + if (!evlist->nr_groups) { + struct perf_evsel *leader = perf_evlist__first(evlist); + + perf_evlist__set_leader(evlist); + leader->forced_leader = true; + } +} diff --git a/tools/perf/util/evlist.h b/tools/perf/util/evlist.h index 6c41b2f78713..dc66436add98 100644 --- a/tools/perf/util/evlist.h +++ b/tools/perf/util/evlist.h @@ -309,4 +309,7 @@ struct perf_evsel *perf_evlist__event2evsel(struct perf_evlist *evlist, union perf_event *event); bool perf_evlist__exclude_kernel(struct perf_evlist *evlist); + +void perf_evlist__force_leader(struct perf_evlist *evlist); + #endif /* __PERF_EVLIST_H */ diff --git a/tools/perf/util/evsel.c b/tools/perf/util/evsel.c index 4cd2cf93f726..150db5ed7400 100644 --- a/tools/perf/util/evsel.c +++ b/tools/perf/util/evsel.c @@ -2862,7 +2862,7 @@ int perf_evsel__open_strerror(struct perf_evsel *evsel, struct target *target, return scnprintf(msg, size, "Not enough memory to setup event with callchain.\n" "Hint: Try tweaking /proc/sys/kernel/perf_event_max_stack\n" - "Hint: Current value: %d", sysctl_perf_event_max_stack); + "Hint: Current value: %d", sysctl__max_stack()); break; case ENODEV: if (target->cpu_list) diff --git a/tools/perf/util/evsel.h b/tools/perf/util/evsel.h index 92ec009a292d..b13f5f234c8f 100644 --- a/tools/perf/util/evsel.h +++ b/tools/perf/util/evsel.h @@ -127,6 +127,7 @@ struct perf_evsel { bool precise_max; bool ignore_missing_thread; bool forced_leader; + bool use_uncore_alias; /* parse modifier helper */ int exclude_GH; int nr_members; diff --git a/tools/perf/util/genelf.c b/tools/perf/util/genelf.c index c540d47583e7..aafbe54fd3fa 100644 --- a/tools/perf/util/genelf.c +++ b/tools/perf/util/genelf.c @@ -114,7 +114,7 @@ gen_build_id(struct buildid_note *note, fd = open("/dev/urandom", O_RDONLY); if (fd == -1) - err(1, "cannot access /dev/urandom for builid"); + err(1, "cannot access /dev/urandom for buildid"); sret = read(fd, note->build_id, sz); diff --git a/tools/perf/util/intel-bts.c b/tools/perf/util/intel-bts.c index 72db2744876d..7f0c83b6332b 100644 --- a/tools/perf/util/intel-bts.c +++ b/tools/perf/util/intel-bts.c @@ -335,8 +335,7 @@ static int intel_bts_get_next_insn(struct intel_bts_queue *btsq, u64 ip) if (!thread) return -1; - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, ip, &al); - if (!al.map || !al.map->dso) + if (!thread__find_map(thread, cpumode, ip, &al) || !al.map->dso) goto out_put; len = dso__data_read_addr(al.map->dso, al.map, machine, ip, buf, diff --git a/tools/perf/util/intel-pt-decoder/insn.h b/tools/perf/util/intel-pt-decoder/insn.h index e23578c7b1be..2669c9f748e4 100644 --- a/tools/perf/util/intel-pt-decoder/insn.h +++ b/tools/perf/util/intel-pt-decoder/insn.h @@ -208,4 +208,22 @@ static inline int insn_offset_immediate(struct insn *insn) return insn_offset_displacement(insn) + insn->displacement.nbytes; } +#define POP_SS_OPCODE 0x1f +#define MOV_SREG_OPCODE 0x8e + +/* + * Intel SDM Vol.3A 6.8.3 states; + * "Any single-step trap that would be delivered following the MOV to SS + * instruction or POP to SS instruction (because EFLAGS.TF is 1) is + * suppressed." + * This function returns true if @insn is MOV SS or POP SS. On these + * instructions, single stepping is suppressed. + */ +static inline int insn_masking_exception(struct insn *insn) +{ + return insn->opcode.bytes[0] == POP_SS_OPCODE || + (insn->opcode.bytes[0] == MOV_SREG_OPCODE && + X86_MODRM_REG(insn->modrm.bytes[0]) == 2); +} + #endif /* _ASM_X86_INSN_H */ diff --git a/tools/perf/util/intel-pt.c b/tools/perf/util/intel-pt.c index 0effaff57020..492986a25ef6 100644 --- a/tools/perf/util/intel-pt.c +++ b/tools/perf/util/intel-pt.c @@ -442,8 +442,7 @@ static int intel_pt_walk_next_insn(struct intel_pt_insn *intel_pt_insn, } while (1) { - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, *ip, &al); - if (!al.map || !al.map->dso) + if (!thread__find_map(thread, cpumode, *ip, &al) || !al.map->dso) return -EINVAL; if (al.map->dso->data.status == DSO_DATA_STATUS_ERROR && @@ -596,8 +595,7 @@ static int __intel_pt_pgd_ip(uint64_t ip, void *data) if (!thread) return -EINVAL; - thread__find_addr_map(thread, cpumode, MAP__FUNCTION, ip, &al); - if (!al.map || !al.map->dso) + if (!thread__find_map(thread, cpumode, ip, &al) || !al.map->dso) return -EINVAL; offset = al.map->map_ip(al.map, ip); @@ -1565,7 +1563,7 @@ static u64 intel_pt_switch_ip(struct intel_pt *pt, u64 *ptss_ip) if (map__load(map)) return 0; - start = dso__first_symbol(map->dso, MAP__FUNCTION); + start = dso__first_symbol(map->dso); for (sym = start; sym; sym = dso__next_symbol(sym)) { if (sym->binding == STB_GLOBAL && diff --git a/tools/perf/util/llvm-utils.c b/tools/perf/util/llvm-utils.c index 1cca0a2fa641..976e658e38dc 100644 --- a/tools/perf/util/llvm-utils.c +++ b/tools/perf/util/llvm-utils.c @@ -14,11 +14,12 @@ #include "config.h" #include "util.h" #include <sys/wait.h> +#include <subcmd/exec-cmd.h> #define CLANG_BPF_CMD_DEFAULT_TEMPLATE \ "$CLANG_EXEC -D__KERNEL__ -D__NR_CPUS__=$NR_CPUS "\ "-DLINUX_VERSION_CODE=$LINUX_VERSION_CODE " \ - "$CLANG_OPTIONS $KERNEL_INC_OPTIONS " \ + "$CLANG_OPTIONS $KERNEL_INC_OPTIONS $PERF_BPF_INC_OPTIONS " \ "-Wno-unused-value -Wno-pointer-sign " \ "-working-directory $WORKING_DIR " \ "-c \"$CLANG_SOURCE\" -target bpf -O2 -o -" @@ -212,7 +213,7 @@ version_notice(void) " \t\thttp://llvm.org/apt\n\n" " \tIf you are using old version of clang, change 'clang-bpf-cmd-template'\n" " \toption in [llvm] section of ~/.perfconfig to:\n\n" -" \t \"$CLANG_EXEC $CLANG_OPTIONS $KERNEL_INC_OPTIONS \\\n" +" \t \"$CLANG_EXEC $CLANG_OPTIONS $KERNEL_INC_OPTIONS $PERF_BPF_INC_OPTIONS \\\n" " \t -working-directory $WORKING_DIR -c $CLANG_SOURCE \\\n" " \t -emit-llvm -o - | /path/to/llc -march=bpf -filetype=obj -o -\"\n" " \t(Replace /path/to/llc with path to your llc)\n\n" @@ -431,9 +432,11 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, const char *clang_opt = llvm_param.clang_opt; char clang_path[PATH_MAX], abspath[PATH_MAX], nr_cpus_avail_str[64]; char serr[STRERR_BUFSIZE]; - char *kbuild_dir = NULL, *kbuild_include_opts = NULL; + char *kbuild_dir = NULL, *kbuild_include_opts = NULL, + *perf_bpf_include_opts = NULL; const char *template = llvm_param.clang_bpf_cmd_template; - char *command_echo, *command_out; + char *command_echo = NULL, *command_out; + char *perf_include_dir = system_path(PERF_INCLUDE_DIR); if (path[0] != '-' && realpath(path, abspath) == NULL) { err = errno; @@ -471,12 +474,14 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, snprintf(linux_version_code_str, sizeof(linux_version_code_str), "0x%x", kernel_version); - + if (asprintf(&perf_bpf_include_opts, "-I%s/bpf", perf_include_dir) < 0) + goto errout; force_set_env("NR_CPUS", nr_cpus_avail_str); force_set_env("LINUX_VERSION_CODE", linux_version_code_str); force_set_env("CLANG_EXEC", clang_path); force_set_env("CLANG_OPTIONS", clang_opt); force_set_env("KERNEL_INC_OPTIONS", kbuild_include_opts); + force_set_env("PERF_BPF_INC_OPTIONS", perf_bpf_include_opts); force_set_env("WORKING_DIR", kbuild_dir ? : "."); /* @@ -512,6 +517,8 @@ int llvm__compile_bpf(const char *path, void **p_obj_buf, free(command_out); free(kbuild_dir); free(kbuild_include_opts); + free(perf_bpf_include_opts); + free(perf_include_dir); if (!p_obj_buf) free(obj_buf); @@ -526,6 +533,8 @@ errout: free(kbuild_dir); free(kbuild_include_opts); free(obj_buf); + free(perf_bpf_include_opts); + free(perf_include_dir); if (p_obj_buf) *p_obj_buf = NULL; if (p_obj_buf_sz) diff --git a/tools/perf/util/machine.c b/tools/perf/util/machine.c index 32d50492505d..e7b4a8b513f2 100644 --- a/tools/perf/util/machine.c +++ b/tools/perf/util/machine.c @@ -24,6 +24,7 @@ #include "sane_ctype.h" #include <symbol/kallsyms.h> +#include <linux/mman.h> static void __machine__remove_thread(struct machine *machine, struct thread *th, bool lock); @@ -81,8 +82,7 @@ int machine__init(struct machine *machine, const char *root_dir, pid_t pid) machine->kptr_restrict_warned = false; machine->comm_exec = false; machine->kernel_start = 0; - - memset(machine->vmlinux_maps, 0, sizeof(machine->vmlinux_maps)); + machine->vmlinux_map = NULL; machine->root_dir = strdup(root_dir); if (machine->root_dir == NULL) @@ -137,13 +137,11 @@ struct machine *machine__new_kallsyms(void) struct machine *machine = machine__new_host(); /* * FIXME: - * 1) MAP__FUNCTION will go away when we stop loading separate maps for - * functions and data objects. - * 2) We should switch to machine__load_kallsyms(), i.e. not explicitely + * 1) We should switch to machine__load_kallsyms(), i.e. not explicitely * ask for not using the kcore parsing code, once this one is fixed * to create a map per module. */ - if (machine && machine__load_kallsyms(machine, "/proc/kallsyms", MAP__FUNCTION) <= 0) { + if (machine && machine__load_kallsyms(machine, "/proc/kallsyms") <= 0) { machine__delete(machine); machine = NULL; } @@ -673,8 +671,7 @@ struct map *machine__findnew_module_map(struct machine *machine, u64 start, if (kmod_path__parse_name(&m, filename)) return NULL; - map = map_groups__find_by_name(&machine->kmaps, MAP__FUNCTION, - m.name); + map = map_groups__find_by_name(&machine->kmaps, m.name); if (map) { /* * If the map's dso is an offline module, give dso__load() @@ -689,7 +686,7 @@ struct map *machine__findnew_module_map(struct machine *machine, u64 start, if (dso == NULL) goto out; - map = map__new2(start, dso, MAP__FUNCTION); + map = map__new2(start, dso); if (map == NULL) goto out; @@ -810,8 +807,8 @@ struct process_args { u64 start; }; -static void machine__get_kallsyms_filename(struct machine *machine, char *buf, - size_t bufsz) +void machine__get_kallsyms_filename(struct machine *machine, char *buf, + size_t bufsz) { if (machine__is_default_guest(machine)) scnprintf(buf, bufsz, "%s", symbol_conf.default_guest_kallsyms); @@ -854,65 +851,171 @@ static int machine__get_running_kernel_start(struct machine *machine, return 0; } +int machine__create_extra_kernel_map(struct machine *machine, + struct dso *kernel, + struct extra_kernel_map *xm) +{ + struct kmap *kmap; + struct map *map; + + map = map__new2(xm->start, kernel); + if (!map) + return -1; + + map->end = xm->end; + map->pgoff = xm->pgoff; + + kmap = map__kmap(map); + + kmap->kmaps = &machine->kmaps; + strlcpy(kmap->name, xm->name, KMAP_NAME_LEN); + + map_groups__insert(&machine->kmaps, map); + + pr_debug2("Added extra kernel map %s %" PRIx64 "-%" PRIx64 "\n", + kmap->name, map->start, map->end); + + map__put(map); + + return 0; +} + +static u64 find_entry_trampoline(struct dso *dso) +{ + /* Duplicates are removed so lookup all aliases */ + const char *syms[] = { + "_entry_trampoline", + "__entry_trampoline_start", + "entry_SYSCALL_64_trampoline", + }; + struct symbol *sym = dso__first_symbol(dso); + unsigned int i; + + for (; sym; sym = dso__next_symbol(sym)) { + if (sym->binding != STB_GLOBAL) + continue; + for (i = 0; i < ARRAY_SIZE(syms); i++) { + if (!strcmp(sym->name, syms[i])) + return sym->start; + } + } + + return 0; +} + +/* + * These values can be used for kernels that do not have symbols for the entry + * trampolines in kallsyms. + */ +#define X86_64_CPU_ENTRY_AREA_PER_CPU 0xfffffe0000000000ULL +#define X86_64_CPU_ENTRY_AREA_SIZE 0x2c000 +#define X86_64_ENTRY_TRAMPOLINE 0x6000 + +/* Map x86_64 PTI entry trampolines */ +int machine__map_x86_64_entry_trampolines(struct machine *machine, + struct dso *kernel) +{ + struct map_groups *kmaps = &machine->kmaps; + struct maps *maps = &kmaps->maps; + int nr_cpus_avail, cpu; + bool found = false; + struct map *map; + u64 pgoff; + + /* + * In the vmlinux case, pgoff is a virtual address which must now be + * mapped to a vmlinux offset. + */ + for (map = maps__first(maps); map; map = map__next(map)) { + struct kmap *kmap = __map__kmap(map); + struct map *dest_map; + + if (!kmap || !is_entry_trampoline(kmap->name)) + continue; + + dest_map = map_groups__find(kmaps, map->pgoff); + if (dest_map != map) + map->pgoff = dest_map->map_ip(dest_map, map->pgoff); + found = true; + } + if (found || machine->trampolines_mapped) + return 0; + + pgoff = find_entry_trampoline(kernel); + if (!pgoff) + return 0; + + nr_cpus_avail = machine__nr_cpus_avail(machine); + + /* Add a 1 page map for each CPU's entry trampoline */ + for (cpu = 0; cpu < nr_cpus_avail; cpu++) { + u64 va = X86_64_CPU_ENTRY_AREA_PER_CPU + + cpu * X86_64_CPU_ENTRY_AREA_SIZE + + X86_64_ENTRY_TRAMPOLINE; + struct extra_kernel_map xm = { + .start = va, + .end = va + page_size, + .pgoff = pgoff, + }; + + strlcpy(xm.name, ENTRY_TRAMPOLINE_NAME, KMAP_NAME_LEN); + + if (machine__create_extra_kernel_map(machine, kernel, &xm) < 0) + return -1; + } + + machine->trampolines_mapped = nr_cpus_avail; + + return 0; +} + +int __weak machine__create_extra_kernel_maps(struct machine *machine __maybe_unused, + struct dso *kernel __maybe_unused) +{ + return 0; +} + static int __machine__create_kernel_maps(struct machine *machine, struct dso *kernel) { - int type; + struct kmap *kmap; + struct map *map; /* In case of renewal the kernel map, destroy previous one */ machine__destroy_kernel_maps(machine); - for (type = 0; type < MAP__NR_TYPES; ++type) { - struct kmap *kmap; - struct map *map; - - machine->vmlinux_maps[type] = map__new2(0, kernel, type); - if (machine->vmlinux_maps[type] == NULL) - return -1; + machine->vmlinux_map = map__new2(0, kernel); + if (machine->vmlinux_map == NULL) + return -1; - machine->vmlinux_maps[type]->map_ip = - machine->vmlinux_maps[type]->unmap_ip = - identity__map_ip; - map = __machine__kernel_map(machine, type); - kmap = map__kmap(map); - if (!kmap) - return -1; + machine->vmlinux_map->map_ip = machine->vmlinux_map->unmap_ip = identity__map_ip; + map = machine__kernel_map(machine); + kmap = map__kmap(map); + if (!kmap) + return -1; - kmap->kmaps = &machine->kmaps; - map_groups__insert(&machine->kmaps, map); - } + kmap->kmaps = &machine->kmaps; + map_groups__insert(&machine->kmaps, map); return 0; } void machine__destroy_kernel_maps(struct machine *machine) { - int type; - - for (type = 0; type < MAP__NR_TYPES; ++type) { - struct kmap *kmap; - struct map *map = __machine__kernel_map(machine, type); - - if (map == NULL) - continue; + struct kmap *kmap; + struct map *map = machine__kernel_map(machine); - kmap = map__kmap(map); - map_groups__remove(&machine->kmaps, map); - if (kmap && kmap->ref_reloc_sym) { - /* - * ref_reloc_sym is shared among all maps, so free just - * on one of them. - */ - if (type == MAP__FUNCTION) { - zfree((char **)&kmap->ref_reloc_sym->name); - zfree(&kmap->ref_reloc_sym); - } else - kmap->ref_reloc_sym = NULL; - } + if (map == NULL) + return; - map__put(machine->vmlinux_maps[type]); - machine->vmlinux_maps[type] = NULL; + kmap = map__kmap(map); + map_groups__remove(&machine->kmaps, map); + if (kmap && kmap->ref_reloc_sym) { + zfree((char **)&kmap->ref_reloc_sym->name); + zfree(&kmap->ref_reloc_sym); } + + map__zput(machine->vmlinux_map); } int machines__create_guest_kernel_maps(struct machines *machines) @@ -989,32 +1092,31 @@ int machines__create_kernel_maps(struct machines *machines, pid_t pid) return machine__create_kernel_maps(machine); } -int machine__load_kallsyms(struct machine *machine, const char *filename, - enum map_type type) +int machine__load_kallsyms(struct machine *machine, const char *filename) { struct map *map = machine__kernel_map(machine); int ret = __dso__load_kallsyms(map->dso, filename, map, true); if (ret > 0) { - dso__set_loaded(map->dso, type); + dso__set_loaded(map->dso); /* * Since /proc/kallsyms will have multiple sessions for the * kernel, with modules between them, fixup the end of all * sections. */ - __map_groups__fixup_end(&machine->kmaps, type); + map_groups__fixup_end(&machine->kmaps); } return ret; } -int machine__load_vmlinux_path(struct machine *machine, enum map_type type) +int machine__load_vmlinux_path(struct machine *machine) { struct map *map = machine__kernel_map(machine); int ret = dso__load_vmlinux_path(map->dso, map); if (ret > 0) - dso__set_loaded(map->dso, type); + dso__set_loaded(map->dso); return ret; } @@ -1055,10 +1157,9 @@ static bool is_kmod_dso(struct dso *dso) static int map_groups__set_module_path(struct map_groups *mg, const char *path, struct kmod_path *m) { - struct map *map; char *long_name; + struct map *map = map_groups__find_by_name(mg, m->name); - map = map_groups__find_by_name(mg, MAP__FUNCTION, m->name); if (map == NULL) return 0; @@ -1207,19 +1308,14 @@ static int machine__create_modules(struct machine *machine) static void machine__set_kernel_mmap(struct machine *machine, u64 start, u64 end) { - int i; - - for (i = 0; i < MAP__NR_TYPES; i++) { - machine->vmlinux_maps[i]->start = start; - machine->vmlinux_maps[i]->end = end; - - /* - * Be a bit paranoid here, some perf.data file came with - * a zero sized synthesized MMAP event for the kernel. - */ - if (start == 0 && end == 0) - machine->vmlinux_maps[i]->end = ~0ULL; - } + machine->vmlinux_map->start = start; + machine->vmlinux_map->end = end; + /* + * Be a bit paranoid here, some perf.data file came with + * a zero sized synthesized MMAP event for the kernel. + */ + if (start == 0 && end == 0) + machine->vmlinux_map->end = ~0ULL; } int machine__create_kernel_maps(struct machine *machine) @@ -1234,9 +1330,8 @@ int machine__create_kernel_maps(struct machine *machine) return -1; ret = __machine__create_kernel_maps(machine, kernel); - dso__put(kernel); if (ret < 0) - return -1; + goto out_put; if (symbol_conf.use_modules && machine__create_modules(machine) < 0) { if (machine__is_host(machine)) @@ -1249,9 +1344,10 @@ int machine__create_kernel_maps(struct machine *machine) if (!machine__get_running_kernel_start(machine, &name, &addr)) { if (name && - maps__set_kallsyms_ref_reloc_sym(machine->vmlinux_maps, name, addr)) { + map__set_kallsyms_ref_reloc_sym(machine->vmlinux_map, name, addr)) { machine__destroy_kernel_maps(machine); - return -1; + ret = -1; + goto out_put; } /* we have a real start address now, so re-order the kmaps */ @@ -1267,12 +1363,16 @@ int machine__create_kernel_maps(struct machine *machine) map__put(map); } + if (machine__create_extra_kernel_maps(machine, kernel)) + pr_debug("Problems creating extra kernel maps, continuing anyway...\n"); + /* update end address of the kernel map using adjacent module address */ map = map__next(machine__kernel_map(machine)); if (map) machine__set_kernel_mmap(machine, addr, map->start); - - return 0; +out_put: + dso__put(kernel); + return ret; } static bool machine__uses_kcore(struct machine *machine) @@ -1287,6 +1387,32 @@ static bool machine__uses_kcore(struct machine *machine) return false; } +static bool perf_event__is_extra_kernel_mmap(struct machine *machine, + union perf_event *event) +{ + return machine__is(machine, "x86_64") && + is_entry_trampoline(event->mmap.filename); +} + +static int machine__process_extra_kernel_map(struct machine *machine, + union perf_event *event) +{ + struct map *kernel_map = machine__kernel_map(machine); + struct dso *kernel = kernel_map ? kernel_map->dso : NULL; + struct extra_kernel_map xm = { + .start = event->mmap.start, + .end = event->mmap.start + event->mmap.len, + .pgoff = event->mmap.pgoff, + }; + + if (kernel == NULL) + return -1; + + strlcpy(xm.name, event->mmap.filename, KMAP_NAME_LEN); + + return machine__create_extra_kernel_map(machine, kernel, &xm); +} + static int machine__process_kernel_mmap_event(struct machine *machine, union perf_event *event) { @@ -1379,9 +1505,9 @@ static int machine__process_kernel_mmap_event(struct machine *machine, * time /proc/sys/kernel/kptr_restrict was non zero. */ if (event->mmap.pgoff != 0) { - maps__set_kallsyms_ref_reloc_sym(machine->vmlinux_maps, - symbol_name, - event->mmap.pgoff); + map__set_kallsyms_ref_reloc_sym(machine->vmlinux_map, + symbol_name, + event->mmap.pgoff); } if (machine__is_default_guest(machine)) { @@ -1390,6 +1516,8 @@ static int machine__process_kernel_mmap_event(struct machine *machine, */ dso__load(kernel, machine__kernel_map(machine)); } + } else if (perf_event__is_extra_kernel_mmap(machine, event)) { + return machine__process_extra_kernel_map(machine, event); } return 0; out_problem: @@ -1402,7 +1530,6 @@ int machine__process_mmap2_event(struct machine *machine, { struct thread *thread; struct map *map; - enum map_type type; int ret = 0; if (dump_trace) @@ -1421,11 +1548,6 @@ int machine__process_mmap2_event(struct machine *machine, if (thread == NULL) goto out_problem; - if (event->header.misc & PERF_RECORD_MISC_MMAP_DATA) - type = MAP__VARIABLE; - else - type = MAP__FUNCTION; - map = map__new(machine, event->mmap2.start, event->mmap2.len, event->mmap2.pgoff, event->mmap2.maj, @@ -1433,7 +1555,7 @@ int machine__process_mmap2_event(struct machine *machine, event->mmap2.ino_generation, event->mmap2.prot, event->mmap2.flags, - event->mmap2.filename, type, thread); + event->mmap2.filename, thread); if (map == NULL) goto out_problem_map; @@ -1460,7 +1582,7 @@ int machine__process_mmap_event(struct machine *machine, union perf_event *event { struct thread *thread; struct map *map; - enum map_type type; + u32 prot = 0; int ret = 0; if (dump_trace) @@ -1479,16 +1601,14 @@ int machine__process_mmap_event(struct machine *machine, union perf_event *event if (thread == NULL) goto out_problem; - if (event->header.misc & PERF_RECORD_MISC_MMAP_DATA) - type = MAP__VARIABLE; - else - type = MAP__FUNCTION; + if (!(event->header.misc & PERF_RECORD_MISC_MMAP_DATA)) + prot = PROT_EXEC; map = map__new(machine, event->mmap.start, event->mmap.len, event->mmap.pgoff, - 0, 0, 0, 0, 0, 0, + 0, 0, 0, 0, prot, 0, event->mmap.filename, - type, thread); + thread); if (map == NULL) goto out_problem_map; @@ -1664,7 +1784,7 @@ static void ip__resolve_ams(struct thread *thread, * Thus, we have to try consecutively until we find a match * or else, the symbol is unknown */ - thread__find_cpumode_addr_location(thread, MAP__FUNCTION, ip, &al); + thread__find_cpumode_addr_location(thread, ip, &al); ams->addr = ip; ams->al_addr = al.addr; @@ -1681,15 +1801,7 @@ static void ip__resolve_data(struct thread *thread, memset(&al, 0, sizeof(al)); - thread__find_addr_location(thread, m, MAP__VARIABLE, addr, &al); - if (al.map == NULL) { - /* - * some shared data regions have execute bit set which puts - * their mapping in the MAP__FUNCTION type array. - * Check there as a fallback option before dropping the sample. - */ - thread__find_addr_location(thread, m, MAP__FUNCTION, addr, &al); - } + thread__find_symbol(thread, m, addr, &al); ams->addr = addr; ams->al_addr = al.addr; @@ -1758,8 +1870,7 @@ static int add_callchain_ip(struct thread *thread, al.filtered = 0; al.sym = NULL; if (!cpumode) { - thread__find_cpumode_addr_location(thread, MAP__FUNCTION, - ip, &al); + thread__find_cpumode_addr_location(thread, ip, &al); } else { if (ip >= PERF_CONTEXT_MAX) { switch (ip) { @@ -1784,8 +1895,7 @@ static int add_callchain_ip(struct thread *thread, } return 0; } - thread__find_addr_location(thread, *cpumode, MAP__FUNCTION, - ip, &al); + thread__find_symbol(thread, *cpumode, ip, &al); } if (al.sym != NULL) { @@ -1810,7 +1920,7 @@ static int add_callchain_ip(struct thread *thread, } srcline = callchain_srcline(al.map, al.sym, al.addr); - return callchain_cursor_append(cursor, al.addr, al.map, al.sym, + return callchain_cursor_append(cursor, ip, al.map, al.sym, branch, flags, nr_loop_iter, iter_cycles, branch_from, srcline); } @@ -2342,6 +2452,20 @@ int machine__set_current_tid(struct machine *machine, int cpu, pid_t pid, return 0; } +/* + * Compares the raw arch string. N.B. see instead perf_env__arch() if a + * normalized arch is needed. + */ +bool machine__is(struct machine *machine, const char *arch) +{ + return machine && !strcmp(perf_env__raw_arch(machine->env), arch); +} + +int machine__nr_cpus_avail(struct machine *machine) +{ + return machine ? perf_env__nr_cpus_avail(machine->env) : 0; +} + int machine__get_kernel_start(struct machine *machine) { struct map *map = machine__kernel_map(machine); @@ -2358,7 +2482,12 @@ int machine__get_kernel_start(struct machine *machine) machine->kernel_start = 1ULL << 63; if (map) { err = map__load(map); - if (!err) + /* + * On x86_64, PTI entry trampolines are less than the + * start of kernel text, but still above 2^63. So leave + * kernel_start = 1ULL << 63 for x86_64. + */ + if (!err && !machine__is(machine, "x86_64")) machine->kernel_start = map->start; } return err; @@ -2373,7 +2502,7 @@ char *machine__resolve_kernel_addr(void *vmachine, unsigned long long *addrp, ch { struct machine *machine = vmachine; struct map *map; - struct symbol *sym = map_groups__find_symbol(&machine->kmaps, MAP__FUNCTION, *addrp, &map); + struct symbol *sym = machine__find_kernel_symbol(machine, *addrp, &map); if (sym == NULL) return NULL; diff --git a/tools/perf/util/machine.h b/tools/perf/util/machine.h index 66cc200ef86f..1de7660d93e9 100644 --- a/tools/perf/util/machine.h +++ b/tools/perf/util/machine.h @@ -49,13 +49,14 @@ struct machine { struct perf_env *env; struct dsos dsos; struct map_groups kmaps; - struct map *vmlinux_maps[MAP__NR_TYPES]; + struct map *vmlinux_map; u64 kernel_start; pid_t *current_tid; union { /* Tool specific area */ void *priv; u64 db_id; }; + bool trampolines_mapped; }; static inline struct threads *machine__threads(struct machine *machine, pid_t tid) @@ -64,16 +65,22 @@ static inline struct threads *machine__threads(struct machine *machine, pid_t ti return &machine->threads[(unsigned int)tid % THREADS__TABLE_SIZE]; } +/* + * The main kernel (vmlinux) map + */ static inline -struct map *__machine__kernel_map(struct machine *machine, enum map_type type) +struct map *machine__kernel_map(struct machine *machine) { - return machine->vmlinux_maps[type]; + return machine->vmlinux_map; } +/* + * kernel (the one returned by machine__kernel_map()) plus kernel modules maps + */ static inline -struct map *machine__kernel_map(struct machine *machine) +struct maps *machine__kernel_maps(struct machine *machine) { - return __machine__kernel_map(machine, MAP__FUNCTION); + return &machine->kmaps.maps; } int machine__get_kernel_start(struct machine *machine); @@ -182,6 +189,9 @@ static inline bool machine__is_host(struct machine *machine) return machine ? machine->pid == HOST_KERNEL_ID : false; } +bool machine__is(struct machine *machine, const char *arch); +int machine__nr_cpus_avail(struct machine *machine); + struct thread *__machine__findnew_thread(struct machine *machine, pid_t pid, pid_t tid); struct thread *machine__findnew_thread(struct machine *machine, pid_t pid, pid_t tid); @@ -190,44 +200,27 @@ struct dso *machine__findnew_dso(struct machine *machine, const char *filename); size_t machine__fprintf(struct machine *machine, FILE *fp); static inline -struct symbol *machine__find_kernel_symbol(struct machine *machine, - enum map_type type, u64 addr, +struct symbol *machine__find_kernel_symbol(struct machine *machine, u64 addr, struct map **mapp) { - return map_groups__find_symbol(&machine->kmaps, type, addr, mapp); + return map_groups__find_symbol(&machine->kmaps, addr, mapp); } static inline struct symbol *machine__find_kernel_symbol_by_name(struct machine *machine, - enum map_type type, const char *name, + const char *name, struct map **mapp) { - return map_groups__find_symbol_by_name(&machine->kmaps, type, name, mapp); -} - -static inline -struct symbol *machine__find_kernel_function(struct machine *machine, u64 addr, - struct map **mapp) -{ - return machine__find_kernel_symbol(machine, MAP__FUNCTION, addr, - mapp); -} - -static inline -struct symbol *machine__find_kernel_function_by_name(struct machine *machine, - const char *name, - struct map **mapp) -{ - return map_groups__find_function_by_name(&machine->kmaps, name, mapp); + return map_groups__find_symbol_by_name(&machine->kmaps, name, mapp); } struct map *machine__findnew_module_map(struct machine *machine, u64 start, const char *filename); int arch__fix_module_text_start(u64 *start, const char *name); -int machine__load_kallsyms(struct machine *machine, const char *filename, - enum map_type type); -int machine__load_vmlinux_path(struct machine *machine, enum map_type type); +int machine__load_kallsyms(struct machine *machine, const char *filename); + +int machine__load_vmlinux_path(struct machine *machine); size_t machine__fprintf_dsos_buildid(struct machine *machine, FILE *fp, bool (skip)(struct dso *dso, int parm), int parm); @@ -276,4 +269,25 @@ int machine__set_current_tid(struct machine *machine, int cpu, pid_t pid, */ char *machine__resolve_kernel_addr(void *vmachine, unsigned long long *addrp, char **modp); +void machine__get_kallsyms_filename(struct machine *machine, char *buf, + size_t bufsz); + +int machine__create_extra_kernel_maps(struct machine *machine, + struct dso *kernel); + +/* Kernel-space maps for symbols that are outside the main kernel map and module maps */ +struct extra_kernel_map { + u64 start; + u64 end; + u64 pgoff; + char name[KMAP_NAME_LEN]; +}; + +int machine__create_extra_kernel_map(struct machine *machine, + struct dso *kernel, + struct extra_kernel_map *xm); + +int machine__map_x86_64_entry_trampolines(struct machine *machine, + struct dso *kernel); + #endif /* __PERF_MACHINE_H */ diff --git a/tools/perf/util/map.c b/tools/perf/util/map.c index 8fe57031e1a8..6ae97eda370b 100644 --- a/tools/perf/util/map.c +++ b/tools/perf/util/map.c @@ -22,11 +22,6 @@ static void __maps__insert(struct maps *maps, struct map *map); -const char *map_type__name[MAP__NR_TYPES] = { - [MAP__FUNCTION] = "Functions", - [MAP__VARIABLE] = "Variables", -}; - static inline int is_anon_memory(const char *filename, u32 flags) { return flags & MAP_HUGETLB || @@ -129,10 +124,8 @@ static inline bool replace_android_lib(const char *filename, char *newfilename) return false; } -void map__init(struct map *map, enum map_type type, - u64 start, u64 end, u64 pgoff, struct dso *dso) +void map__init(struct map *map, u64 start, u64 end, u64 pgoff, struct dso *dso) { - map->type = type; map->start = start; map->end = end; map->pgoff = pgoff; @@ -149,7 +142,7 @@ void map__init(struct map *map, enum map_type type, struct map *map__new(struct machine *machine, u64 start, u64 len, u64 pgoff, u32 d_maj, u32 d_min, u64 ino, u64 ino_gen, u32 prot, u32 flags, char *filename, - enum map_type type, struct thread *thread) + struct thread *thread) { struct map *map = malloc(sizeof(*map)); struct nsinfo *nsi = NULL; @@ -173,7 +166,7 @@ struct map *map__new(struct machine *machine, u64 start, u64 len, map->flags = flags; nsi = nsinfo__get(thread->nsinfo); - if ((anon || no_dso) && nsi && type == MAP__FUNCTION) { + if ((anon || no_dso) && nsi && (prot & PROT_EXEC)) { snprintf(newfilename, sizeof(newfilename), "/tmp/perf-%d.map", nsi->pid); filename = newfilename; @@ -203,7 +196,7 @@ struct map *map__new(struct machine *machine, u64 start, u64 len, if (dso == NULL) goto out_delete; - map__init(map, type, start, start + len, pgoff, dso); + map__init(map, start, start + len, pgoff, dso); if (anon || no_dso) { map->map_ip = map->unmap_ip = identity__map_ip; @@ -213,8 +206,8 @@ struct map *map__new(struct machine *machine, u64 start, u64 len, * functions still return NULL, and we avoid the * unnecessary map__load warning. */ - if (type != MAP__FUNCTION) - dso__set_loaded(dso, map->type); + if (!(prot & PROT_EXEC)) + dso__set_loaded(dso); } dso->nsinfo = nsi; dso__put(dso); @@ -231,7 +224,7 @@ out_delete: * they are loaded) and for vmlinux, where only after we load all the * symbols we'll know where it starts and ends. */ -struct map *map__new2(u64 start, struct dso *dso, enum map_type type) +struct map *map__new2(u64 start, struct dso *dso) { struct map *map = calloc(1, (sizeof(*map) + (dso->kernel ? sizeof(struct kmap) : 0))); @@ -239,7 +232,7 @@ struct map *map__new2(u64 start, struct dso *dso, enum map_type type) /* * ->end will be filled after we load all the symbols */ - map__init(map, type, start, 0, 0, dso); + map__init(map, start, 0, 0, dso); } return map; @@ -256,7 +249,19 @@ struct map *map__new2(u64 start, struct dso *dso, enum map_type type) */ bool __map__is_kernel(const struct map *map) { - return __machine__kernel_map(map->groups->machine, map->type) == map; + return machine__kernel_map(map->groups->machine) == map; +} + +bool __map__is_extra_kernel_map(const struct map *map) +{ + struct kmap *kmap = __map__kmap((struct map *)map); + + return kmap && kmap->name[0]; +} + +bool map__has_symbols(const struct map *map) +{ + return dso__has_symbols(map->dso); } static void map__exit(struct map *map) @@ -279,7 +284,7 @@ void map__put(struct map *map) void map__fixup_start(struct map *map) { - struct rb_root *symbols = &map->dso->symbols[map->type]; + struct rb_root *symbols = &map->dso->symbols; struct rb_node *nd = rb_first(symbols); if (nd != NULL) { struct symbol *sym = rb_entry(nd, struct symbol, rb_node); @@ -289,7 +294,7 @@ void map__fixup_start(struct map *map) void map__fixup_end(struct map *map) { - struct rb_root *symbols = &map->dso->symbols[map->type]; + struct rb_root *symbols = &map->dso->symbols; struct rb_node *nd = rb_last(symbols); if (nd != NULL) { struct symbol *sym = rb_entry(nd, struct symbol, rb_node); @@ -304,7 +309,7 @@ int map__load(struct map *map) const char *name = map->dso->long_name; int nr; - if (dso__loaded(map->dso, map->type)) + if (dso__loaded(map->dso)) return 0; nr = dso__load(map->dso, map); @@ -348,7 +353,7 @@ struct symbol *map__find_symbol(struct map *map, u64 addr) if (map__load(map) < 0) return NULL; - return dso__find_symbol(map->dso, map->type, addr); + return dso__find_symbol(map->dso, addr); } struct symbol *map__find_symbol_by_name(struct map *map, const char *name) @@ -356,10 +361,10 @@ struct symbol *map__find_symbol_by_name(struct map *map, const char *name) if (map__load(map) < 0) return NULL; - if (!dso__sorted_by_name(map->dso, map->type)) - dso__sort_by_name(map->dso, map->type); + if (!dso__sorted_by_name(map->dso)) + dso__sort_by_name(map->dso); - return dso__find_symbol_by_name(map->dso, map->type, name); + return dso__find_symbol_by_name(map->dso, name); } struct map *map__clone(struct map *from) @@ -494,10 +499,7 @@ static void maps__init(struct maps *maps) void map_groups__init(struct map_groups *mg, struct machine *machine) { - int i; - for (i = 0; i < MAP__NR_TYPES; ++i) { - maps__init(&mg->maps[i]); - } + maps__init(&mg->maps); mg->machine = machine; refcount_set(&mg->refcnt, 1); } @@ -525,22 +527,12 @@ static void maps__exit(struct maps *maps) void map_groups__exit(struct map_groups *mg) { - int i; - - for (i = 0; i < MAP__NR_TYPES; ++i) - maps__exit(&mg->maps[i]); + maps__exit(&mg->maps); } bool map_groups__empty(struct map_groups *mg) { - int i; - - for (i = 0; i < MAP__NR_TYPES; ++i) { - if (maps__first(&mg->maps[i])) - return false; - } - - return true; + return !maps__first(&mg->maps); } struct map_groups *map_groups__new(struct machine *machine) @@ -566,10 +558,9 @@ void map_groups__put(struct map_groups *mg) } struct symbol *map_groups__find_symbol(struct map_groups *mg, - enum map_type type, u64 addr, - struct map **mapp) + u64 addr, struct map **mapp) { - struct map *map = map_groups__find(mg, type, addr); + struct map *map = map_groups__find(mg, addr); /* Ensure map is loaded before using map->map_ip */ if (map != NULL && map__load(map) >= 0) { @@ -608,13 +599,10 @@ out: } struct symbol *map_groups__find_symbol_by_name(struct map_groups *mg, - enum map_type type, const char *name, struct map **mapp) { - struct symbol *sym = maps__find_symbol_by_name(&mg->maps[type], name, mapp); - - return sym; + return maps__find_symbol_by_name(&mg->maps, name, mapp); } int map_groups__find_ams(struct addr_map_symbol *ams) @@ -622,8 +610,7 @@ int map_groups__find_ams(struct addr_map_symbol *ams) if (ams->addr < ams->map->start || ams->addr >= ams->map->end) { if (ams->map->groups == NULL) return -1; - ams->map = map_groups__find(ams->map->groups, ams->map->type, - ams->addr); + ams->map = map_groups__find(ams->map->groups, ams->addr); if (ams->map == NULL) return -1; } @@ -646,7 +633,7 @@ static size_t maps__fprintf(struct maps *maps, FILE *fp) printed += fprintf(fp, "Map:"); printed += map__fprintf(pos, fp); if (verbose > 2) { - printed += dso__fprintf(pos->dso, pos->type, fp); + printed += dso__fprintf(pos->dso, fp); printed += fprintf(fp, "--\n"); } } @@ -656,24 +643,14 @@ static size_t maps__fprintf(struct maps *maps, FILE *fp) return printed; } -size_t __map_groups__fprintf_maps(struct map_groups *mg, enum map_type type, - FILE *fp) -{ - size_t printed = fprintf(fp, "%s:\n", map_type__name[type]); - return printed += maps__fprintf(&mg->maps[type], fp); -} - size_t map_groups__fprintf(struct map_groups *mg, FILE *fp) { - size_t printed = 0, i; - for (i = 0; i < MAP__NR_TYPES; ++i) - printed += __map_groups__fprintf_maps(mg, i, fp); - return printed; + return maps__fprintf(&mg->maps, fp); } static void __map_groups__insert(struct map_groups *mg, struct map *map) { - __maps__insert(&mg->maps[map->type], map); + __maps__insert(&mg->maps, map); map->groups = mg; } @@ -758,19 +735,18 @@ out: int map_groups__fixup_overlappings(struct map_groups *mg, struct map *map, FILE *fp) { - return maps__fixup_overlappings(&mg->maps[map->type], map, fp); + return maps__fixup_overlappings(&mg->maps, map, fp); } /* * XXX This should not really _copy_ te maps, but refcount them. */ -int map_groups__clone(struct thread *thread, - struct map_groups *parent, enum map_type type) +int map_groups__clone(struct thread *thread, struct map_groups *parent) { struct map_groups *mg = thread->mg; int err = -ENOMEM; struct map *map; - struct maps *maps = &parent->maps[type]; + struct maps *maps = &parent->maps; down_read(&maps->lock); @@ -877,15 +853,22 @@ struct map *map__next(struct map *map) return NULL; } -struct kmap *map__kmap(struct map *map) +struct kmap *__map__kmap(struct map *map) { - if (!map->dso || !map->dso->kernel) { - pr_err("Internal error: map__kmap with a non-kernel map\n"); + if (!map->dso || !map->dso->kernel) return NULL; - } return (struct kmap *)(map + 1); } +struct kmap *map__kmap(struct map *map) +{ + struct kmap *kmap = __map__kmap(map); + + if (!kmap) + pr_err("Internal error: map__kmap with a non-kernel map\n"); + return kmap; +} + struct map_groups *map__kmaps(struct map *map) { struct kmap *kmap = map__kmap(map); diff --git a/tools/perf/util/map.h b/tools/perf/util/map.h index 0e9bbe01b0ab..97e2a063bd65 100644 --- a/tools/perf/util/map.h +++ b/tools/perf/util/map.h @@ -8,19 +8,11 @@ #include <linux/rbtree.h> #include <pthread.h> #include <stdio.h> +#include <string.h> #include <stdbool.h> #include <linux/types.h> #include "rwsem.h" -enum map_type { - MAP__FUNCTION = 0, - MAP__VARIABLE, -}; - -#define MAP__NR_TYPES (MAP__VARIABLE + 1) - -extern const char *map_type__name[MAP__NR_TYPES]; - struct dso; struct ip_callchain; struct ref_reloc_sym; @@ -35,7 +27,6 @@ struct map { }; u64 start; u64 end; - u8 /* enum map_type */ type; bool erange_warned; u32 priv; u32 prot; @@ -56,9 +47,12 @@ struct map { refcount_t refcnt; }; +#define KMAP_NAME_LEN 256 + struct kmap { struct ref_reloc_sym *ref_reloc_sym; struct map_groups *kmaps; + char name[KMAP_NAME_LEN]; }; struct maps { @@ -67,7 +61,7 @@ struct maps { }; struct map_groups { - struct maps maps[MAP__NR_TYPES]; + struct maps maps; struct machine *machine; refcount_t refcnt; }; @@ -85,6 +79,7 @@ static inline struct map_groups *map_groups__get(struct map_groups *mg) void map_groups__put(struct map_groups *mg); +struct kmap *__map__kmap(struct map *map); struct kmap *map__kmap(struct map *map); struct map_groups *map__kmaps(struct map *map); @@ -125,7 +120,7 @@ struct thread; * Note: caller must ensure map->dso is not NULL (map is loaded). */ #define map__for_each_symbol(map, pos, n) \ - dso__for_each_symbol(map->dso, pos, n, map->type) + dso__for_each_symbol(map->dso, pos, n) /* map__for_each_symbol_with_name - iterate over the symbols in the given map * that have the given name @@ -144,13 +139,13 @@ struct thread; #define map__for_each_symbol_by_name(map, sym_name, pos) \ __map__for_each_symbol_by_name(map, sym_name, (pos)) -void map__init(struct map *map, enum map_type type, +void map__init(struct map *map, u64 start, u64 end, u64 pgoff, struct dso *dso); struct map *map__new(struct machine *machine, u64 start, u64 len, u64 pgoff, u32 d_maj, u32 d_min, u64 ino, u64 ino_gen, u32 prot, u32 flags, - char *filename, enum map_type type, struct thread *thread); -struct map *map__new2(u64 start, struct dso *dso, enum map_type type); + char *filename, struct thread *thread); +struct map *map__new2(u64 start, struct dso *dso); void map__delete(struct map *map); struct map *map__clone(struct map *map); @@ -185,8 +180,6 @@ void map__fixup_end(struct map *map); void map__reloc_vmlinux(struct map *map); -size_t __map_groups__fprintf_maps(struct map_groups *mg, enum map_type type, - FILE *fp); void maps__insert(struct maps *maps, struct map *map); void maps__remove(struct maps *maps, struct map *map); struct map *maps__find(struct maps *maps, u64 addr); @@ -197,34 +190,29 @@ struct symbol *maps__find_symbol_by_name(struct maps *maps, const char *name, void map_groups__init(struct map_groups *mg, struct machine *machine); void map_groups__exit(struct map_groups *mg); int map_groups__clone(struct thread *thread, - struct map_groups *parent, enum map_type type); + struct map_groups *parent); size_t map_groups__fprintf(struct map_groups *mg, FILE *fp); -int maps__set_kallsyms_ref_reloc_sym(struct map **maps, const char *symbol_name, - u64 addr); +int map__set_kallsyms_ref_reloc_sym(struct map *map, const char *symbol_name, + u64 addr); static inline void map_groups__insert(struct map_groups *mg, struct map *map) { - maps__insert(&mg->maps[map->type], map); + maps__insert(&mg->maps, map); map->groups = mg; } static inline void map_groups__remove(struct map_groups *mg, struct map *map) { - maps__remove(&mg->maps[map->type], map); + maps__remove(&mg->maps, map); } -static inline struct map *map_groups__find(struct map_groups *mg, - enum map_type type, u64 addr) +static inline struct map *map_groups__find(struct map_groups *mg, u64 addr) { - return maps__find(&mg->maps[type], addr); + return maps__find(&mg->maps, addr); } -static inline struct map *map_groups__first(struct map_groups *mg, - enum map_type type) -{ - return maps__first(&mg->maps[type]); -} +struct map *map_groups__first(struct map_groups *mg); static inline struct map *map_groups__next(struct map *map) { @@ -232,11 +220,9 @@ static inline struct map *map_groups__next(struct map *map) } struct symbol *map_groups__find_symbol(struct map_groups *mg, - enum map_type type, u64 addr, - struct map **mapp); + u64 addr, struct map **mapp); struct symbol *map_groups__find_symbol_by_name(struct map_groups *mg, - enum map_type type, const char *name, struct map **mapp); @@ -244,24 +230,26 @@ struct addr_map_symbol; int map_groups__find_ams(struct addr_map_symbol *ams); -static inline -struct symbol *map_groups__find_function_by_name(struct map_groups *mg, - const char *name, struct map **mapp) -{ - return map_groups__find_symbol_by_name(mg, MAP__FUNCTION, name, mapp); -} - int map_groups__fixup_overlappings(struct map_groups *mg, struct map *map, FILE *fp); -struct map *map_groups__find_by_name(struct map_groups *mg, - enum map_type type, const char *name); +struct map *map_groups__find_by_name(struct map_groups *mg, const char *name); bool __map__is_kernel(const struct map *map); +bool __map__is_extra_kernel_map(const struct map *map); static inline bool __map__is_kmodule(const struct map *map) { - return !__map__is_kernel(map); + return !__map__is_kernel(map) && !__map__is_extra_kernel_map(map); +} + +bool map__has_symbols(const struct map *map); + +#define ENTRY_TRAMPOLINE_NAME "__entry_SYSCALL_64_trampoline" + +static inline bool is_entry_trampoline(const char *name) +{ + return !strcmp(name, ENTRY_TRAMPOLINE_NAME); } #endif /* __PERF_MAP_H */ diff --git a/tools/perf/util/parse-events.c b/tools/perf/util/parse-events.c index 2fb0272146d8..15eec49e71a1 100644 --- a/tools/perf/util/parse-events.c +++ b/tools/perf/util/parse-events.c @@ -156,13 +156,12 @@ struct event_symbol event_symbols_sw[PERF_COUNT_SW_MAX] = { (strcmp(sys_dirent->d_name, ".")) && \ (strcmp(sys_dirent->d_name, ".."))) -static int tp_event_has_id(struct dirent *sys_dir, struct dirent *evt_dir) +static int tp_event_has_id(const char *dir_path, struct dirent *evt_dir) { char evt_path[MAXPATHLEN]; int fd; - snprintf(evt_path, MAXPATHLEN, "%s/%s/%s/id", tracing_events_path, - sys_dir->d_name, evt_dir->d_name); + snprintf(evt_path, MAXPATHLEN, "%s/%s/id", dir_path, evt_dir->d_name); fd = open(evt_path, O_RDONLY); if (fd < 0) return -EINVAL; @@ -171,12 +170,12 @@ static int tp_event_has_id(struct dirent *sys_dir, struct dirent *evt_dir) return 0; } -#define for_each_event(sys_dirent, evt_dir, evt_dirent) \ +#define for_each_event(dir_path, evt_dir, evt_dirent) \ while ((evt_dirent = readdir(evt_dir)) != NULL) \ if (evt_dirent->d_type == DT_DIR && \ (strcmp(evt_dirent->d_name, ".")) && \ (strcmp(evt_dirent->d_name, "..")) && \ - (!tp_event_has_id(sys_dirent, evt_dirent))) + (!tp_event_has_id(dir_path, evt_dirent))) #define MAX_EVENT_LENGTH 512 @@ -190,21 +189,21 @@ struct tracepoint_path *tracepoint_id_to_path(u64 config) int fd; u64 id; char evt_path[MAXPATHLEN]; - char dir_path[MAXPATHLEN]; + char *dir_path; - sys_dir = opendir(tracing_events_path); + sys_dir = tracing_events__opendir(); if (!sys_dir) return NULL; for_each_subsystem(sys_dir, sys_dirent) { - - snprintf(dir_path, MAXPATHLEN, "%s/%s", tracing_events_path, - sys_dirent->d_name); + dir_path = get_events_file(sys_dirent->d_name); + if (!dir_path) + continue; evt_dir = opendir(dir_path); if (!evt_dir) - continue; + goto next; - for_each_event(sys_dirent, evt_dir, evt_dirent) { + for_each_event(dir_path, evt_dir, evt_dirent) { scnprintf(evt_path, MAXPATHLEN, "%s/%s/id", dir_path, evt_dirent->d_name); @@ -218,6 +217,7 @@ struct tracepoint_path *tracepoint_id_to_path(u64 config) close(fd); id = atoll(id_buf); if (id == config) { + put_events_file(dir_path); closedir(evt_dir); closedir(sys_dir); path = zalloc(sizeof(*path)); @@ -242,6 +242,8 @@ struct tracepoint_path *tracepoint_id_to_path(u64 config) } } closedir(evt_dir); +next: + put_events_file(dir_path); } closedir(sys_dir); @@ -512,14 +514,19 @@ static int add_tracepoint_multi_event(struct list_head *list, int *idx, struct parse_events_error *err, struct list_head *head_config) { - char evt_path[MAXPATHLEN]; + char *evt_path; struct dirent *evt_ent; DIR *evt_dir; int ret = 0, found = 0; - snprintf(evt_path, MAXPATHLEN, "%s/%s", tracing_events_path, sys_name); + evt_path = get_events_file(sys_name); + if (!evt_path) { + tracepoint_error(err, errno, sys_name, evt_name); + return -1; + } evt_dir = opendir(evt_path); if (!evt_dir) { + put_events_file(evt_path); tracepoint_error(err, errno, sys_name, evt_name); return -1; } @@ -545,6 +552,7 @@ static int add_tracepoint_multi_event(struct list_head *list, int *idx, ret = -1; } + put_events_file(evt_path); closedir(evt_dir); return ret; } @@ -570,7 +578,7 @@ static int add_tracepoint_multi_sys(struct list_head *list, int *idx, DIR *events_dir; int ret = 0; - events_dir = opendir(tracing_events_path); + events_dir = tracing_events__opendir(); if (!events_dir) { tracepoint_error(err, errno, sys_name, evt_name); return -1; @@ -1219,13 +1227,16 @@ int parse_events_add_numeric(struct parse_events_state *parse_state, int parse_events_add_pmu(struct parse_events_state *parse_state, struct list_head *list, char *name, - struct list_head *head_config, bool auto_merge_stats) + struct list_head *head_config, + bool auto_merge_stats, + bool use_alias) { struct perf_event_attr attr; struct perf_pmu_info info; struct perf_pmu *pmu; struct perf_evsel *evsel; struct parse_events_error *err = parse_state->error; + bool use_uncore_alias; LIST_HEAD(config_terms); pmu = perf_pmu__find(name); @@ -1244,11 +1255,14 @@ int parse_events_add_pmu(struct parse_events_state *parse_state, memset(&attr, 0, sizeof(attr)); } + use_uncore_alias = (pmu->is_uncore && use_alias); + if (!head_config) { attr.type = pmu->type; evsel = __add_event(list, &parse_state->idx, &attr, NULL, pmu, NULL, auto_merge_stats); if (evsel) { evsel->pmu_name = name; + evsel->use_uncore_alias = use_uncore_alias; return 0; } else { return -ENOMEM; @@ -1282,6 +1296,7 @@ int parse_events_add_pmu(struct parse_events_state *parse_state, evsel->metric_expr = info.metric_expr; evsel->metric_name = info.metric_name; evsel->pmu_name = name; + evsel->use_uncore_alias = use_uncore_alias; } return evsel ? 0 : -ENOMEM; @@ -1317,7 +1332,8 @@ int parse_events_multi_pmu_add(struct parse_events_state *parse_state, list_add_tail(&term->list, head); if (!parse_events_add_pmu(parse_state, list, - pmu->name, head, true)) { + pmu->name, head, + true, true)) { pr_debug("%s -> %s/%s/\n", str, pmu->name, alias->str); ok++; @@ -1339,7 +1355,120 @@ int parse_events__modifier_group(struct list_head *list, return parse_events__modifier_event(list, event_mod, true); } -void parse_events__set_leader(char *name, struct list_head *list) +/* + * Check if the two uncore PMUs are from the same uncore block + * The format of the uncore PMU name is uncore_#blockname_#pmuidx + */ +static bool is_same_uncore_block(const char *pmu_name_a, const char *pmu_name_b) +{ + char *end_a, *end_b; + + end_a = strrchr(pmu_name_a, '_'); + end_b = strrchr(pmu_name_b, '_'); + + if (!end_a || !end_b) + return false; + + if ((end_a - pmu_name_a) != (end_b - pmu_name_b)) + return false; + + return (strncmp(pmu_name_a, pmu_name_b, end_a - pmu_name_a) == 0); +} + +static int +parse_events__set_leader_for_uncore_aliase(char *name, struct list_head *list, + struct parse_events_state *parse_state) +{ + struct perf_evsel *evsel, *leader; + uintptr_t *leaders; + bool is_leader = true; + int i, nr_pmu = 0, total_members, ret = 0; + + leader = list_first_entry(list, struct perf_evsel, node); + evsel = list_last_entry(list, struct perf_evsel, node); + total_members = evsel->idx - leader->idx + 1; + + leaders = calloc(total_members, sizeof(uintptr_t)); + if (WARN_ON(!leaders)) + return 0; + + /* + * Going through the whole group and doing sanity check. + * All members must use alias, and be from the same uncore block. + * Also, storing the leader events in an array. + */ + __evlist__for_each_entry(list, evsel) { + + /* Only split the uncore group which members use alias */ + if (!evsel->use_uncore_alias) + goto out; + + /* The events must be from the same uncore block */ + if (!is_same_uncore_block(leader->pmu_name, evsel->pmu_name)) + goto out; + + if (!is_leader) + continue; + /* + * If the event's PMU name starts to repeat, it must be a new + * event. That can be used to distinguish the leader from + * other members, even they have the same event name. + */ + if ((leader != evsel) && (leader->pmu_name == evsel->pmu_name)) { + is_leader = false; + continue; + } + /* The name is always alias name */ + WARN_ON(strcmp(leader->name, evsel->name)); + + /* Store the leader event for each PMU */ + leaders[nr_pmu++] = (uintptr_t) evsel; + } + + /* only one event alias */ + if (nr_pmu == total_members) { + parse_state->nr_groups--; + goto handled; + } + + /* + * An uncore event alias is a joint name which means the same event + * runs on all PMUs of a block. + * Perf doesn't support mixed events from different PMUs in the same + * group. The big group has to be split into multiple small groups + * which only include the events from the same PMU. + * + * Here the uncore event aliases must be from the same uncore block. + * The number of PMUs must be same for each alias. The number of new + * small groups equals to the number of PMUs. + * Setting the leader event for corresponding members in each group. + */ + i = 0; + __evlist__for_each_entry(list, evsel) { + if (i >= nr_pmu) + i = 0; + evsel->leader = (struct perf_evsel *) leaders[i++]; + } + + /* The number of members and group name are same for each group */ + for (i = 0; i < nr_pmu; i++) { + evsel = (struct perf_evsel *) leaders[i]; + evsel->nr_members = total_members / nr_pmu; + evsel->group_name = name ? strdup(name) : NULL; + } + + /* Take the new small groups into account */ + parse_state->nr_groups += nr_pmu - 1; + +handled: + ret = 1; +out: + free(leaders); + return ret; +} + +void parse_events__set_leader(char *name, struct list_head *list, + struct parse_events_state *parse_state) { struct perf_evsel *leader; @@ -1348,6 +1477,9 @@ void parse_events__set_leader(char *name, struct list_head *list) return; } + if (parse_events__set_leader_for_uncore_aliase(name, list, parse_state)) + return; + __perf_evlist__set_leader(list); leader = list_entry(list->next, struct perf_evsel, node); leader->group_name = name ? strdup(name) : NULL; @@ -1715,7 +1847,7 @@ int parse_events(struct perf_evlist *evlist, const char *str, struct perf_evsel *last; if (list_empty(&parse_state.list)) { - WARN_ONCE(true, "WARNING: event parser found nothing"); + WARN_ONCE(true, "WARNING: event parser found nothing\n"); return -1; } @@ -1968,13 +2100,13 @@ void print_tracepoint_events(const char *subsys_glob, const char *event_glob, DIR *sys_dir, *evt_dir; struct dirent *sys_dirent, *evt_dirent; char evt_path[MAXPATHLEN]; - char dir_path[MAXPATHLEN]; + char *dir_path; char **evt_list = NULL; unsigned int evt_i = 0, evt_num = 0; bool evt_num_known = false; restart: - sys_dir = opendir(tracing_events_path); + sys_dir = tracing_events__opendir(); if (!sys_dir) return; @@ -1989,13 +2121,14 @@ restart: !strglobmatch(sys_dirent->d_name, subsys_glob)) continue; - snprintf(dir_path, MAXPATHLEN, "%s/%s", tracing_events_path, - sys_dirent->d_name); + dir_path = get_events_file(sys_dirent->d_name); + if (!dir_path) + continue; evt_dir = opendir(dir_path); if (!evt_dir) - continue; + goto next; - for_each_event(sys_dirent, evt_dir, evt_dirent) { + for_each_event(dir_path, evt_dir, evt_dirent) { if (event_glob != NULL && !strglobmatch(evt_dirent->d_name, event_glob)) continue; @@ -2009,11 +2142,15 @@ restart: sys_dirent->d_name, evt_dirent->d_name); evt_list[evt_i] = strdup(evt_path); - if (evt_list[evt_i] == NULL) + if (evt_list[evt_i] == NULL) { + put_events_file(dir_path); goto out_close_evt_dir; + } evt_i++; } closedir(evt_dir); +next: + put_events_file(dir_path); } closedir(sys_dir); @@ -2061,21 +2198,21 @@ int is_valid_tracepoint(const char *event_string) DIR *sys_dir, *evt_dir; struct dirent *sys_dirent, *evt_dirent; char evt_path[MAXPATHLEN]; - char dir_path[MAXPATHLEN]; + char *dir_path; - sys_dir = opendir(tracing_events_path); + sys_dir = tracing_events__opendir(); if (!sys_dir) return 0; for_each_subsystem(sys_dir, sys_dirent) { - - snprintf(dir_path, MAXPATHLEN, "%s/%s", tracing_events_path, - sys_dirent->d_name); + dir_path = get_events_file(sys_dirent->d_name); + if (!dir_path) + continue; evt_dir = opendir(dir_path); if (!evt_dir) - continue; + goto next; - for_each_event(sys_dirent, evt_dir, evt_dirent) { + for_each_event(dir_path, evt_dir, evt_dirent) { snprintf(evt_path, MAXPATHLEN, "%s:%s", sys_dirent->d_name, evt_dirent->d_name); if (!strcmp(evt_path, event_string)) { @@ -2085,6 +2222,8 @@ int is_valid_tracepoint(const char *event_string) } } closedir(evt_dir); +next: + put_events_file(dir_path); } closedir(sys_dir); return 0; diff --git a/tools/perf/util/parse-events.h b/tools/perf/util/parse-events.h index 5015cfd58277..4473dac27aee 100644 --- a/tools/perf/util/parse-events.h +++ b/tools/perf/util/parse-events.h @@ -167,7 +167,9 @@ int parse_events_add_breakpoint(struct list_head *list, int *idx, void *ptr, char *type, u64 len); int parse_events_add_pmu(struct parse_events_state *parse_state, struct list_head *list, char *name, - struct list_head *head_config, bool auto_merge_stats); + struct list_head *head_config, + bool auto_merge_stats, + bool use_alias); int parse_events_multi_pmu_add(struct parse_events_state *parse_state, char *str, @@ -178,7 +180,8 @@ int parse_events_copy_term_list(struct list_head *old, enum perf_pmu_event_symbol_type perf_pmu__parse_check(const char *name); -void parse_events__set_leader(char *name, struct list_head *list); +void parse_events__set_leader(char *name, struct list_head *list, + struct parse_events_state *parse_state); void parse_events_update_lists(struct list_head *list_event, struct list_head *list_all); void parse_events_evlist_error(struct parse_events_state *parse_state, diff --git a/tools/perf/util/parse-events.y b/tools/perf/util/parse-events.y index 7afeb80cc39e..e37608a87dba 100644 --- a/tools/perf/util/parse-events.y +++ b/tools/perf/util/parse-events.y @@ -161,7 +161,7 @@ PE_NAME '{' events '}' struct list_head *list = $3; inc_group_count(list, _parse_state); - parse_events__set_leader($1, list); + parse_events__set_leader($1, list, _parse_state); $$ = list; } | @@ -170,7 +170,7 @@ PE_NAME '{' events '}' struct list_head *list = $2; inc_group_count(list, _parse_state); - parse_events__set_leader(NULL, list); + parse_events__set_leader(NULL, list, _parse_state); $$ = list; } @@ -232,7 +232,7 @@ PE_NAME opt_event_config YYABORT; ALLOC_LIST(list); - if (parse_events_add_pmu(_parse_state, list, $1, $2, false)) { + if (parse_events_add_pmu(_parse_state, list, $1, $2, false, false)) { struct perf_pmu *pmu = NULL; int ok = 0; char *pattern; @@ -251,7 +251,7 @@ PE_NAME opt_event_config free(pattern); YYABORT; } - if (!parse_events_add_pmu(_parse_state, list, pmu->name, terms, true)) + if (!parse_events_add_pmu(_parse_state, list, pmu->name, terms, true, false)) ok++; parse_events_terms__delete(terms); } diff --git a/tools/perf/util/probe-event.c b/tools/perf/util/probe-event.c index e1dbc9821617..3094f11e7d81 100644 --- a/tools/perf/util/probe-event.c +++ b/tools/perf/util/probe-event.c @@ -111,17 +111,6 @@ void exit_probe_symbol_maps(void) symbol__exit(); } -static struct symbol *__find_kernel_function_by_name(const char *name, - struct map **mapp) -{ - return machine__find_kernel_function_by_name(host_machine, name, mapp); -} - -static struct symbol *__find_kernel_function(u64 addr, struct map **mapp) -{ - return machine__find_kernel_function(host_machine, addr, mapp); -} - static struct ref_reloc_sym *kernel_get_ref_reloc_sym(void) { /* kmap->ref_reloc_sym should be set if host_machine is initialized */ @@ -149,7 +138,7 @@ static int kernel_get_symbol_address_by_name(const char *name, u64 *addr, if (reloc_sym && strcmp(name, reloc_sym->name) == 0) *addr = (reloc) ? reloc_sym->addr : reloc_sym->unrelocated_addr; else { - sym = __find_kernel_function_by_name(name, &map); + sym = machine__find_kernel_symbol_by_name(host_machine, name, &map); if (!sym) return -ENOENT; *addr = map->unmap_ip(map, sym->start) - @@ -161,8 +150,7 @@ static int kernel_get_symbol_address_by_name(const char *name, u64 *addr, static struct map *kernel_get_module_map(const char *module) { - struct map_groups *grp = &host_machine->kmaps; - struct maps *maps = &grp->maps[MAP__FUNCTION]; + struct maps *maps = machine__kernel_maps(host_machine); struct map *pos; /* A file path -- this is an offline module */ @@ -341,7 +329,7 @@ static int kernel_get_module_dso(const char *module, struct dso **pdso) char module_name[128]; snprintf(module_name, sizeof(module_name), "[%s]", module); - map = map_groups__find_by_name(&host_machine->kmaps, MAP__FUNCTION, module_name); + map = map_groups__find_by_name(&host_machine->kmaps, module_name); if (map) { dso = map->dso; goto found; @@ -2098,7 +2086,7 @@ static int find_perf_probe_point_from_map(struct probe_trace_point *tp, } if (addr) { addr += tp->offset; - sym = __find_kernel_function(addr, &map); + sym = machine__find_kernel_symbol(host_machine, addr, &map); } } @@ -3504,19 +3492,18 @@ int show_available_funcs(const char *target, struct nsinfo *nsi, (target) ? : "kernel"); goto end; } - if (!dso__sorted_by_name(map->dso, map->type)) - dso__sort_by_name(map->dso, map->type); + if (!dso__sorted_by_name(map->dso)) + dso__sort_by_name(map->dso); /* Show all (filtered) symbols */ setup_pager(); - for (nd = rb_first(&map->dso->symbol_names[map->type]); nd; nd = rb_next(nd)) { + for (nd = rb_first(&map->dso->symbol_names); nd; nd = rb_next(nd)) { struct symbol_name_rb_node *pos = rb_entry(nd, struct symbol_name_rb_node, rb_node); if (strfilter__compare(_filter, pos->sym.name)) printf("%s\n", pos->sym.name); - } - + } end: map__put(map); exit_probe_symbol_maps(); diff --git a/tools/perf/util/probe-file.c b/tools/perf/util/probe-file.c index 4ae1123c6794..b76088fadf3d 100644 --- a/tools/perf/util/probe-file.c +++ b/tools/perf/util/probe-file.c @@ -84,8 +84,7 @@ int open_trace_file(const char *trace_file, bool readwrite) char buf[PATH_MAX]; int ret; - ret = e_snprintf(buf, PATH_MAX, "%s/%s", - tracing_path, trace_file); + ret = e_snprintf(buf, PATH_MAX, "%s/%s", tracing_path_mount(), trace_file); if (ret >= 0) { pr_debug("Opening %s write=%d\n", buf, readwrite); if (readwrite && !probe_event_dry_run) diff --git a/tools/perf/util/scripting-engines/trace-event-python.c b/tools/perf/util/scripting-engines/trace-event-python.c index 10dd5fce082b..7f8afacd08ee 100644 --- a/tools/perf/util/scripting-engines/trace-event-python.c +++ b/tools/perf/util/scripting-engines/trace-event-python.c @@ -531,6 +531,8 @@ static PyObject *get_perf_sample_dict(struct perf_sample *sample, PyLong_FromUnsignedLongLong(sample->period)); pydict_set_item_string_decref(dict_sample, "phys_addr", PyLong_FromUnsignedLongLong(sample->phys_addr)); + pydict_set_item_string_decref(dict_sample, "addr", + PyLong_FromUnsignedLongLong(sample->addr)); set_sample_read_in_dict(dict_sample, sample, evsel); pydict_set_item_string_decref(dict, "sample", dict_sample); diff --git a/tools/perf/util/session.c b/tools/perf/util/session.c index f4a7a437ee87..b998bb475589 100644 --- a/tools/perf/util/session.c +++ b/tools/perf/util/session.c @@ -1973,12 +1973,11 @@ bool perf_session__has_traces(struct perf_session *session, const char *msg) return false; } -int maps__set_kallsyms_ref_reloc_sym(struct map **maps, - const char *symbol_name, u64 addr) +int map__set_kallsyms_ref_reloc_sym(struct map *map, const char *symbol_name, u64 addr) { char *bracket; - int i; struct ref_reloc_sym *ref; + struct kmap *kmap; ref = zalloc(sizeof(struct ref_reloc_sym)); if (ref == NULL) @@ -1996,13 +1995,9 @@ int maps__set_kallsyms_ref_reloc_sym(struct map **maps, ref->addr = addr; - for (i = 0; i < MAP__NR_TYPES; ++i) { - struct kmap *kmap = map__kmap(maps[i]); - - if (!kmap) - continue; + kmap = map__kmap(map); + if (kmap) kmap->ref_reloc_sym = ref; - } return 0; } diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c index 26a68dfd8a4f..4058ade352a5 100644 --- a/tools/perf/util/sort.c +++ b/tools/perf/util/sort.c @@ -2,7 +2,7 @@ #include <errno.h> #include <inttypes.h> #include <regex.h> -#include <sys/mman.h> +#include <linux/mman.h> #include "sort.h" #include "hist.h" #include "comm.h" @@ -282,7 +282,7 @@ static int _hist_entry__sym_snprintf(struct map *map, struct symbol *sym, ret += repsep_snprintf(bf + ret, size - ret, "[%c] ", level); if (sym && map) { - if (map->type == MAP__VARIABLE) { + if (sym->type == STT_OBJECT) { ret += repsep_snprintf(bf + ret, size - ret, "%s", sym->name); ret += repsep_snprintf(bf + ret, size - ret, "+0x%llx", ip - map->unmap_ip(map, sym->start)); @@ -1211,7 +1211,7 @@ static int hist_entry__dcacheline_snprintf(struct hist_entry *he, char *bf, /* print [s] for shared data mmaps */ if ((he->cpumode != PERF_RECORD_MISC_KERNEL) && - map && (map->type == MAP__VARIABLE) && + map && !(map->prot & PROT_EXEC) && (map->flags & MAP_SHARED) && (map->maj || map->min || map->ino || map->ino_generation)) @@ -2582,7 +2582,7 @@ int sort_dimension__add(struct perf_hpp_list *list, const char *tok, if (sort__mode != SORT_MODE__MEMORY) return -EINVAL; - if (sd->entry == &sort_mem_dcacheline && cacheline_size == 0) + if (sd->entry == &sort_mem_dcacheline && cacheline_size() == 0) return -EINVAL; if (sd->entry == &sort_mem_daddr_sym) @@ -2628,7 +2628,7 @@ static int setup_sort_list(struct perf_hpp_list *list, char *str, if (*tok) { ret = sort_dimension__add(list, tok, evlist, level); if (ret == -EINVAL) { - if (!cacheline_size && !strncasecmp(tok, "dcacheline", strlen(tok))) + if (!cacheline_size() && !strncasecmp(tok, "dcacheline", strlen(tok))) pr_err("The \"dcacheline\" --sort key needs to know the cacheline size and it couldn't be determined on this system"); else pr_err("Invalid --sort key: `%s'", tok); diff --git a/tools/perf/util/sort.h b/tools/perf/util/sort.h index 035b62e2c60b..9e6896293bbd 100644 --- a/tools/perf/util/sort.h +++ b/tools/perf/util/sort.h @@ -186,13 +186,13 @@ static inline float hist_entry__get_percent_limit(struct hist_entry *he) static inline u64 cl_address(u64 address) { /* return the cacheline of the address */ - return (address & ~(cacheline_size - 1)); + return (address & ~(cacheline_size() - 1)); } static inline u64 cl_offset(u64 address) { /* return the cacheline of the address */ - return (address & (cacheline_size - 1)); + return (address & (cacheline_size() - 1)); } enum sort_mode { diff --git a/tools/perf/util/srcline.c b/tools/perf/util/srcline.c index 3c21fd059b64..09d6746e6ec8 100644 --- a/tools/perf/util/srcline.c +++ b/tools/perf/util/srcline.c @@ -103,6 +103,7 @@ static struct symbol *new_inline_sym(struct dso *dso, inline_sym = symbol__new(base_sym ? base_sym->start : 0, base_sym ? base_sym->end : 0, base_sym ? base_sym->binding : 0, + base_sym ? base_sym->type : 0, funcname); if (inline_sym) inline_sym->inlined = 1; diff --git a/tools/perf/util/stat.h b/tools/perf/util/stat.h index 8f56ba4fd258..36efb986f7fc 100644 --- a/tools/perf/util/stat.h +++ b/tools/perf/util/stat.h @@ -7,8 +7,7 @@ #include "xyarray.h" #include "rblist.h" -struct stats -{ +struct stats { double n, mean, M2; u64 max, min; }; diff --git a/tools/perf/util/symbol-elf.c b/tools/perf/util/symbol-elf.c index 2de770511e70..29770ea61768 100644 --- a/tools/perf/util/symbol-elf.c +++ b/tools/perf/util/symbol-elf.c @@ -114,16 +114,9 @@ static inline int elf_sym__is_label(const GElf_Sym *sym) sym->st_shndx != SHN_ABS; } -static bool elf_sym__is_a(GElf_Sym *sym, enum map_type type) +static bool elf_sym__filter(GElf_Sym *sym) { - switch (type) { - case MAP__FUNCTION: - return elf_sym__is_function(sym); - case MAP__VARIABLE: - return elf_sym__is_object(sym); - default: - return false; - } + return elf_sym__is_function(sym) || elf_sym__is_object(sym); } static inline const char *elf_sym__name(const GElf_Sym *sym, @@ -150,17 +143,10 @@ static inline bool elf_sec__is_data(const GElf_Shdr *shdr, return strstr(elf_sec__name(shdr, secstrs), "data") != NULL; } -static bool elf_sec__is_a(GElf_Shdr *shdr, Elf_Data *secstrs, - enum map_type type) +static bool elf_sec__filter(GElf_Shdr *shdr, Elf_Data *secstrs) { - switch (type) { - case MAP__FUNCTION: - return elf_sec__is_text(shdr, secstrs); - case MAP__VARIABLE: - return elf_sec__is_data(shdr, secstrs); - default: - return false; - } + return elf_sec__is_text(shdr, secstrs) || + elf_sec__is_data(shdr, secstrs); } static size_t elf_addr_to_index(Elf *elf, GElf_Addr addr) @@ -256,7 +242,7 @@ static char *demangle_sym(struct dso *dso, int kmodule, const char *elf_name) * And always look at the original dso, not at debuginfo packages, that * have the PLT data stripped out (shdr_rel_plt.sh_type == SHT_NOBITS). */ -int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss, struct map *map) +int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss) { uint32_t nr_rel_entries, idx; GElf_Sym sym; @@ -364,12 +350,12 @@ int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss, struct map * free(demangled); f = symbol__new(plt_offset, plt_entry_size, - STB_GLOBAL, sympltname); + STB_GLOBAL, STT_FUNC, sympltname); if (!f) goto out_elf_end; plt_offset += plt_entry_size; - symbols__insert(&dso->symbols[map->type], f); + symbols__insert(&dso->symbols, f); ++nr; } } else if (shdr_rel_plt.sh_type == SHT_REL) { @@ -390,12 +376,12 @@ int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss, struct map * free(demangled); f = symbol__new(plt_offset, plt_entry_size, - STB_GLOBAL, sympltname); + STB_GLOBAL, STT_FUNC, sympltname); if (!f) goto out_elf_end; plt_offset += plt_entry_size; - symbols__insert(&dso->symbols[map->type], f); + symbols__insert(&dso->symbols, f); ++nr; } } @@ -811,6 +797,110 @@ static u64 ref_reloc(struct kmap *kmap) void __weak arch__sym_update(struct symbol *s __maybe_unused, GElf_Sym *sym __maybe_unused) { } +static int dso__process_kernel_symbol(struct dso *dso, struct map *map, + GElf_Sym *sym, GElf_Shdr *shdr, + struct map_groups *kmaps, struct kmap *kmap, + struct dso **curr_dsop, struct map **curr_mapp, + const char *section_name, + bool adjust_kernel_syms, bool kmodule, bool *remap_kernel) +{ + struct dso *curr_dso = *curr_dsop; + struct map *curr_map; + char dso_name[PATH_MAX]; + + /* Adjust symbol to map to file offset */ + if (adjust_kernel_syms) + sym->st_value -= shdr->sh_addr - shdr->sh_offset; + + if (strcmp(section_name, (curr_dso->short_name + dso->short_name_len)) == 0) + return 0; + + if (strcmp(section_name, ".text") == 0) { + /* + * The initial kernel mapping is based on + * kallsyms and identity maps. Overwrite it to + * map to the kernel dso. + */ + if (*remap_kernel && dso->kernel) { + *remap_kernel = false; + map->start = shdr->sh_addr + ref_reloc(kmap); + map->end = map->start + shdr->sh_size; + map->pgoff = shdr->sh_offset; + map->map_ip = map__map_ip; + map->unmap_ip = map__unmap_ip; + /* Ensure maps are correctly ordered */ + if (kmaps) { + map__get(map); + map_groups__remove(kmaps, map); + map_groups__insert(kmaps, map); + map__put(map); + } + } + + /* + * The initial module mapping is based on + * /proc/modules mapped to offset zero. + * Overwrite it to map to the module dso. + */ + if (*remap_kernel && kmodule) { + *remap_kernel = false; + map->pgoff = shdr->sh_offset; + } + + *curr_mapp = map; + *curr_dsop = dso; + return 0; + } + + if (!kmap) + return 0; + + snprintf(dso_name, sizeof(dso_name), "%s%s", dso->short_name, section_name); + + curr_map = map_groups__find_by_name(kmaps, dso_name); + if (curr_map == NULL) { + u64 start = sym->st_value; + + if (kmodule) + start += map->start + shdr->sh_offset; + + curr_dso = dso__new(dso_name); + if (curr_dso == NULL) + return -1; + curr_dso->kernel = dso->kernel; + curr_dso->long_name = dso->long_name; + curr_dso->long_name_len = dso->long_name_len; + curr_map = map__new2(start, curr_dso); + dso__put(curr_dso); + if (curr_map == NULL) + return -1; + + if (adjust_kernel_syms) { + curr_map->start = shdr->sh_addr + ref_reloc(kmap); + curr_map->end = curr_map->start + shdr->sh_size; + curr_map->pgoff = shdr->sh_offset; + } else { + curr_map->map_ip = curr_map->unmap_ip = identity__map_ip; + } + curr_dso->symtab_type = dso->symtab_type; + map_groups__insert(kmaps, curr_map); + /* + * Add it before we drop the referece to curr_map, i.e. while + * we still are sure to have a reference to this DSO via + * *curr_map->dso. + */ + dsos__add(&map->groups->machine->dsos, curr_dso); + /* kmaps already got it */ + map__put(curr_map); + dso__set_loaded(curr_dso); + *curr_mapp = curr_map; + *curr_dsop = curr_dso; + } else + *curr_dsop = curr_map->dso; + + return 0; +} + int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, struct symsrc *runtime_ss, int kmodule) { @@ -844,7 +934,7 @@ int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, * have the wrong values for the dso maps, so remove them. */ if (kmodule && syms_ss->symtab) - symbols__delete(&dso->symbols[map->type]); + symbols__delete(&dso->symbols); if (!syms_ss->symtab) { /* @@ -921,10 +1011,10 @@ int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, dso->adjust_symbols = runtime_ss->adjust_symbols || ref_reloc(kmap); /* - * Initial kernel and module mappings do not map to the dso. For - * function mappings, flag the fixups. + * Initial kernel and module mappings do not map to the dso. + * Flag the fixups. */ - if (map->type == MAP__FUNCTION && (dso->kernel || kmodule)) { + if (dso->kernel || kmodule) { remap_kernel = true; adjust_kernel_syms = dso->adjust_symbols; } @@ -936,7 +1026,7 @@ int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, const char *section_name; bool used_opd = false; - if (!is_label && !elf_sym__is_a(&sym, map->type)) + if (!is_label && !elf_sym__filter(&sym)) continue; /* Reject ARM ELF "mapping symbols": these aren't unique and @@ -974,7 +1064,7 @@ int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, gelf_getshdr(sec, &shdr); - if (is_label && !elf_sec__is_a(&shdr, secstrs, map->type)) + if (is_label && !elf_sec__filter(&shdr, secstrs)) continue; section_name = elf_sec__name(&shdr, secstrs); @@ -982,134 +1072,37 @@ int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, /* On ARM, symbols for thumb functions have 1 added to * the symbol address as a flag - remove it */ if ((ehdr.e_machine == EM_ARM) && - (map->type == MAP__FUNCTION) && + (GELF_ST_TYPE(sym.st_info) == STT_FUNC) && (sym.st_value & 1)) --sym.st_value; if (dso->kernel || kmodule) { - char dso_name[PATH_MAX]; - - /* Adjust symbol to map to file offset */ - if (adjust_kernel_syms) - sym.st_value -= shdr.sh_addr - shdr.sh_offset; - - if (strcmp(section_name, - (curr_dso->short_name + - dso->short_name_len)) == 0) - goto new_symbol; - - if (strcmp(section_name, ".text") == 0) { - /* - * The initial kernel mapping is based on - * kallsyms and identity maps. Overwrite it to - * map to the kernel dso. - */ - if (remap_kernel && dso->kernel) { - remap_kernel = false; - map->start = shdr.sh_addr + - ref_reloc(kmap); - map->end = map->start + shdr.sh_size; - map->pgoff = shdr.sh_offset; - map->map_ip = map__map_ip; - map->unmap_ip = map__unmap_ip; - /* Ensure maps are correctly ordered */ - if (kmaps) { - map__get(map); - map_groups__remove(kmaps, map); - map_groups__insert(kmaps, map); - map__put(map); - } - } - - /* - * The initial module mapping is based on - * /proc/modules mapped to offset zero. - * Overwrite it to map to the module dso. - */ - if (remap_kernel && kmodule) { - remap_kernel = false; - map->pgoff = shdr.sh_offset; - } - - curr_map = map; - curr_dso = dso; - goto new_symbol; - } - - if (!kmap) - goto new_symbol; - - snprintf(dso_name, sizeof(dso_name), - "%s%s", dso->short_name, section_name); - - curr_map = map_groups__find_by_name(kmaps, map->type, dso_name); - if (curr_map == NULL) { - u64 start = sym.st_value; - - if (kmodule) - start += map->start + shdr.sh_offset; - - curr_dso = dso__new(dso_name); - if (curr_dso == NULL) - goto out_elf_end; - curr_dso->kernel = dso->kernel; - curr_dso->long_name = dso->long_name; - curr_dso->long_name_len = dso->long_name_len; - curr_map = map__new2(start, curr_dso, - map->type); - dso__put(curr_dso); - if (curr_map == NULL) { - goto out_elf_end; - } - if (adjust_kernel_syms) { - curr_map->start = shdr.sh_addr + - ref_reloc(kmap); - curr_map->end = curr_map->start + - shdr.sh_size; - curr_map->pgoff = shdr.sh_offset; - } else { - curr_map->map_ip = identity__map_ip; - curr_map->unmap_ip = identity__map_ip; - } - curr_dso->symtab_type = dso->symtab_type; - map_groups__insert(kmaps, curr_map); - /* - * Add it before we drop the referece to curr_map, - * i.e. while we still are sure to have a reference - * to this DSO via curr_map->dso. - */ - dsos__add(&map->groups->machine->dsos, curr_dso); - /* kmaps already got it */ - map__put(curr_map); - dso__set_loaded(curr_dso, map->type); - } else - curr_dso = curr_map->dso; - - goto new_symbol; - } - - if ((used_opd && runtime_ss->adjust_symbols) - || (!used_opd && syms_ss->adjust_symbols)) { + if (dso__process_kernel_symbol(dso, map, &sym, &shdr, kmaps, kmap, &curr_dso, &curr_map, + section_name, adjust_kernel_syms, kmodule, &remap_kernel)) + goto out_elf_end; + } else if ((used_opd && runtime_ss->adjust_symbols) || + (!used_opd && syms_ss->adjust_symbols)) { pr_debug4("%s: adjusting symbol: st_value: %#" PRIx64 " " "sh_addr: %#" PRIx64 " sh_offset: %#" PRIx64 "\n", __func__, (u64)sym.st_value, (u64)shdr.sh_addr, (u64)shdr.sh_offset); sym.st_value -= shdr.sh_addr - shdr.sh_offset; } -new_symbol: + demangled = demangle_sym(dso, kmodule, elf_name); if (demangled != NULL) elf_name = demangled; f = symbol__new(sym.st_value, sym.st_size, - GELF_ST_BIND(sym.st_info), elf_name); + GELF_ST_BIND(sym.st_info), + GELF_ST_TYPE(sym.st_info), elf_name); free(demangled); if (!f) goto out_elf_end; arch__sym_update(f, &sym); - __symbols__insert(&curr_dso->symbols[curr_map->type], f, dso->kernel); + __symbols__insert(&curr_dso->symbols, f, dso->kernel); nr++; } @@ -1117,14 +1110,14 @@ new_symbol: * For misannotated, zeroed, ASM function sizes. */ if (nr > 0) { - symbols__fixup_end(&dso->symbols[map->type]); - symbols__fixup_duplicate(&dso->symbols[map->type]); + symbols__fixup_end(&dso->symbols); + symbols__fixup_duplicate(&dso->symbols); if (kmap) { /* * We need to fixup this here too because we create new * maps here, for things like vsyscall sections. */ - __map_groups__fixup_end(kmaps, map->type); + map_groups__fixup_end(kmaps); } } err = nr; @@ -1393,8 +1386,16 @@ static off_t kcore__write(struct kcore *kcore) struct phdr_data { off_t offset; + off_t rel; u64 addr; u64 len; + struct list_head node; + struct phdr_data *remaps; +}; + +struct sym_data { + u64 addr; + struct list_head node; }; struct kcore_copy_info { @@ -1404,16 +1405,78 @@ struct kcore_copy_info { u64 last_symbol; u64 first_module; u64 last_module_symbol; - struct phdr_data kernel_map; - struct phdr_data modules_map; + size_t phnum; + struct list_head phdrs; + struct list_head syms; }; +#define kcore_copy__for_each_phdr(k, p) \ + list_for_each_entry((p), &(k)->phdrs, node) + +static struct phdr_data *phdr_data__new(u64 addr, u64 len, off_t offset) +{ + struct phdr_data *p = zalloc(sizeof(*p)); + + if (p) { + p->addr = addr; + p->len = len; + p->offset = offset; + } + + return p; +} + +static struct phdr_data *kcore_copy_info__addnew(struct kcore_copy_info *kci, + u64 addr, u64 len, + off_t offset) +{ + struct phdr_data *p = phdr_data__new(addr, len, offset); + + if (p) + list_add_tail(&p->node, &kci->phdrs); + + return p; +} + +static void kcore_copy__free_phdrs(struct kcore_copy_info *kci) +{ + struct phdr_data *p, *tmp; + + list_for_each_entry_safe(p, tmp, &kci->phdrs, node) { + list_del(&p->node); + free(p); + } +} + +static struct sym_data *kcore_copy__new_sym(struct kcore_copy_info *kci, + u64 addr) +{ + struct sym_data *s = zalloc(sizeof(*s)); + + if (s) { + s->addr = addr; + list_add_tail(&s->node, &kci->syms); + } + + return s; +} + +static void kcore_copy__free_syms(struct kcore_copy_info *kci) +{ + struct sym_data *s, *tmp; + + list_for_each_entry_safe(s, tmp, &kci->syms, node) { + list_del(&s->node); + free(s); + } +} + static int kcore_copy__process_kallsyms(void *arg, const char *name, char type, u64 start) { struct kcore_copy_info *kci = arg; - if (!symbol_type__is_a(type, MAP__FUNCTION)) + if (!kallsyms__is_function(type)) return 0; if (strchr(name, '[')) { @@ -1438,6 +1501,9 @@ static int kcore_copy__process_kallsyms(void *arg, const char *name, char type, return 0; } + if (is_entry_trampoline(name) && !kcore_copy__new_sym(kci, start)) + return -1; + return 0; } @@ -1487,27 +1553,39 @@ static int kcore_copy__parse_modules(struct kcore_copy_info *kci, return 0; } -static void kcore_copy__map(struct phdr_data *p, u64 start, u64 end, u64 pgoff, - u64 s, u64 e) +static int kcore_copy__map(struct kcore_copy_info *kci, u64 start, u64 end, + u64 pgoff, u64 s, u64 e) { - if (p->addr || s < start || s >= end) - return; + u64 len, offset; + + if (s < start || s >= end) + return 0; - p->addr = s; - p->offset = (s - start) + pgoff; - p->len = e < end ? e - s : end - s; + offset = (s - start) + pgoff; + len = e < end ? e - s : end - s; + + return kcore_copy_info__addnew(kci, s, len, offset) ? 0 : -1; } static int kcore_copy__read_map(u64 start, u64 len, u64 pgoff, void *data) { struct kcore_copy_info *kci = data; u64 end = start + len; + struct sym_data *sdat; - kcore_copy__map(&kci->kernel_map, start, end, pgoff, kci->stext, - kci->etext); + if (kcore_copy__map(kci, start, end, pgoff, kci->stext, kci->etext)) + return -1; - kcore_copy__map(&kci->modules_map, start, end, pgoff, kci->first_module, - kci->last_module_symbol); + if (kcore_copy__map(kci, start, end, pgoff, kci->first_module, + kci->last_module_symbol)) + return -1; + + list_for_each_entry(sdat, &kci->syms, node) { + u64 s = round_down(sdat->addr, page_size); + + if (kcore_copy__map(kci, start, end, pgoff, s, s + len)) + return -1; + } return 0; } @@ -1520,6 +1598,64 @@ static int kcore_copy__read_maps(struct kcore_copy_info *kci, Elf *elf) return 0; } +static void kcore_copy__find_remaps(struct kcore_copy_info *kci) +{ + struct phdr_data *p, *k = NULL; + u64 kend; + + if (!kci->stext) + return; + + /* Find phdr that corresponds to the kernel map (contains stext) */ + kcore_copy__for_each_phdr(kci, p) { + u64 pend = p->addr + p->len - 1; + + if (p->addr <= kci->stext && pend >= kci->stext) { + k = p; + break; + } + } + + if (!k) + return; + + kend = k->offset + k->len; + + /* Find phdrs that remap the kernel */ + kcore_copy__for_each_phdr(kci, p) { + u64 pend = p->offset + p->len; + + if (p == k) + continue; + + if (p->offset >= k->offset && pend <= kend) + p->remaps = k; + } +} + +static void kcore_copy__layout(struct kcore_copy_info *kci) +{ + struct phdr_data *p; + off_t rel = 0; + + kcore_copy__find_remaps(kci); + + kcore_copy__for_each_phdr(kci, p) { + if (!p->remaps) { + p->rel = rel; + rel += p->len; + } + kci->phnum += 1; + } + + kcore_copy__for_each_phdr(kci, p) { + struct phdr_data *k = p->remaps; + + if (k) + p->rel = p->offset - k->offset + k->rel; + } +} + static int kcore_copy__calc_maps(struct kcore_copy_info *kci, const char *dir, Elf *elf) { @@ -1555,7 +1691,12 @@ static int kcore_copy__calc_maps(struct kcore_copy_info *kci, const char *dir, if (kci->first_module && !kci->last_module_symbol) return -1; - return kcore_copy__read_maps(kci, elf); + if (kcore_copy__read_maps(kci, elf)) + return -1; + + kcore_copy__layout(kci); + + return 0; } static int kcore_copy__copy_file(const char *from_dir, const char *to_dir, @@ -1678,12 +1819,15 @@ int kcore_copy(const char *from_dir, const char *to_dir) { struct kcore kcore; struct kcore extract; - size_t count = 2; int idx = 0, err = -1; - off_t offset = page_size, sz, modules_offset = 0; + off_t offset, sz; struct kcore_copy_info kci = { .stext = 0, }; char kcore_filename[PATH_MAX]; char extract_filename[PATH_MAX]; + struct phdr_data *p; + + INIT_LIST_HEAD(&kci.phdrs); + INIT_LIST_HEAD(&kci.syms); if (kcore_copy__copy_file(from_dir, to_dir, "kallsyms")) return -1; @@ -1703,20 +1847,17 @@ int kcore_copy(const char *from_dir, const char *to_dir) if (kcore__init(&extract, extract_filename, kcore.elfclass, false)) goto out_kcore_close; - if (!kci.modules_map.addr) - count -= 1; - - if (kcore__copy_hdr(&kcore, &extract, count)) + if (kcore__copy_hdr(&kcore, &extract, kci.phnum)) goto out_extract_close; - if (kcore__add_phdr(&extract, idx++, offset, kci.kernel_map.addr, - kci.kernel_map.len)) - goto out_extract_close; + offset = gelf_fsize(extract.elf, ELF_T_EHDR, 1, EV_CURRENT) + + gelf_fsize(extract.elf, ELF_T_PHDR, kci.phnum, EV_CURRENT); + offset = round_up(offset, page_size); + + kcore_copy__for_each_phdr(&kci, p) { + off_t offs = p->rel + offset; - if (kci.modules_map.addr) { - modules_offset = offset + kci.kernel_map.len; - if (kcore__add_phdr(&extract, idx, modules_offset, - kci.modules_map.addr, kci.modules_map.len)) + if (kcore__add_phdr(&extract, idx++, offs, p->addr, p->len)) goto out_extract_close; } @@ -1724,14 +1865,14 @@ int kcore_copy(const char *from_dir, const char *to_dir) if (sz < 0 || sz > offset) goto out_extract_close; - if (copy_bytes(kcore.fd, kci.kernel_map.offset, extract.fd, offset, - kci.kernel_map.len)) - goto out_extract_close; + kcore_copy__for_each_phdr(&kci, p) { + off_t offs = p->rel + offset; - if (modules_offset && copy_bytes(kcore.fd, kci.modules_map.offset, - extract.fd, modules_offset, - kci.modules_map.len)) - goto out_extract_close; + if (p->remaps) + continue; + if (copy_bytes(kcore.fd, p->offset, extract.fd, offs, p->len)) + goto out_extract_close; + } if (kcore_copy__compare_file(from_dir, to_dir, "modules")) goto out_extract_close; @@ -1754,6 +1895,9 @@ out_unlink_kallsyms: if (err) kcore_copy__unlink(to_dir, "kallsyms"); + kcore_copy__free_phdrs(&kci); + kcore_copy__free_syms(&kci); + return err; } diff --git a/tools/perf/util/symbol-minimal.c b/tools/perf/util/symbol-minimal.c index ff48d0d49584..7119df77dc0b 100644 --- a/tools/perf/util/symbol-minimal.c +++ b/tools/perf/util/symbol-minimal.c @@ -288,8 +288,7 @@ void symsrc__destroy(struct symsrc *ss) } int dso__synthesize_plt_symbols(struct dso *dso __maybe_unused, - struct symsrc *ss __maybe_unused, - struct map *map __maybe_unused) + struct symsrc *ss __maybe_unused) { return 0; } diff --git a/tools/perf/util/symbol.c b/tools/perf/util/symbol.c index 1466814ebada..8c84437f2a10 100644 --- a/tools/perf/util/symbol.c +++ b/tools/perf/util/symbol.c @@ -5,6 +5,7 @@ #include <stdio.h> #include <string.h> #include <linux/kernel.h> +#include <linux/mman.h> #include <sys/types.h> #include <sys/stat.h> #include <sys/param.h> @@ -70,18 +71,10 @@ static enum dso_binary_type binary_type_symtab[] = { #define DSO_BINARY_TYPE__SYMTAB_CNT ARRAY_SIZE(binary_type_symtab) -bool symbol_type__is_a(char symbol_type, enum map_type map_type) +static bool symbol_type__filter(char symbol_type) { symbol_type = toupper(symbol_type); - - switch (map_type) { - case MAP__FUNCTION: - return symbol_type == 'T' || symbol_type == 'W'; - case MAP__VARIABLE: - return symbol_type == 'D'; - default: - return false; - } + return symbol_type == 'T' || symbol_type == 'W' || symbol_type == 'D'; } static int prefix_underscores_count(const char *str) @@ -228,9 +221,9 @@ void symbols__fixup_end(struct rb_root *symbols) curr->end = roundup(curr->start, 4096) + 4096; } -void __map_groups__fixup_end(struct map_groups *mg, enum map_type type) +void map_groups__fixup_end(struct map_groups *mg) { - struct maps *maps = &mg->maps[type]; + struct maps *maps = &mg->maps; struct map *next, *curr; down_write(&maps->lock); @@ -256,7 +249,7 @@ out_unlock: up_write(&maps->lock); } -struct symbol *symbol__new(u64 start, u64 len, u8 binding, const char *name) +struct symbol *symbol__new(u64 start, u64 len, u8 binding, u8 type, const char *name) { size_t namelen = strlen(name) + 1; struct symbol *sym = calloc(1, (symbol_conf.priv_size + @@ -274,6 +267,7 @@ struct symbol *symbol__new(u64 start, u64 len, u8 binding, const char *name) sym->start = start; sym->end = len ? start + len : start; + sym->type = type; sym->binding = binding; sym->namelen = namelen - 1; @@ -484,45 +478,40 @@ static struct symbol *symbols__find_by_name(struct rb_root *symbols, void dso__reset_find_symbol_cache(struct dso *dso) { - enum map_type type; - - for (type = MAP__FUNCTION; type <= MAP__VARIABLE; ++type) { - dso->last_find_result[type].addr = 0; - dso->last_find_result[type].symbol = NULL; - } + dso->last_find_result.addr = 0; + dso->last_find_result.symbol = NULL; } -void dso__insert_symbol(struct dso *dso, enum map_type type, struct symbol *sym) +void dso__insert_symbol(struct dso *dso, struct symbol *sym) { - __symbols__insert(&dso->symbols[type], sym, dso->kernel); + __symbols__insert(&dso->symbols, sym, dso->kernel); /* update the symbol cache if necessary */ - if (dso->last_find_result[type].addr >= sym->start && - (dso->last_find_result[type].addr < sym->end || + if (dso->last_find_result.addr >= sym->start && + (dso->last_find_result.addr < sym->end || sym->start == sym->end)) { - dso->last_find_result[type].symbol = sym; + dso->last_find_result.symbol = sym; } } -struct symbol *dso__find_symbol(struct dso *dso, - enum map_type type, u64 addr) +struct symbol *dso__find_symbol(struct dso *dso, u64 addr) { - if (dso->last_find_result[type].addr != addr || dso->last_find_result[type].symbol == NULL) { - dso->last_find_result[type].addr = addr; - dso->last_find_result[type].symbol = symbols__find(&dso->symbols[type], addr); + if (dso->last_find_result.addr != addr || dso->last_find_result.symbol == NULL) { + dso->last_find_result.addr = addr; + dso->last_find_result.symbol = symbols__find(&dso->symbols, addr); } - return dso->last_find_result[type].symbol; + return dso->last_find_result.symbol; } -struct symbol *dso__first_symbol(struct dso *dso, enum map_type type) +struct symbol *dso__first_symbol(struct dso *dso) { - return symbols__first(&dso->symbols[type]); + return symbols__first(&dso->symbols); } -struct symbol *dso__last_symbol(struct dso *dso, enum map_type type) +struct symbol *dso__last_symbol(struct dso *dso) { - return symbols__last(&dso->symbols[type]); + return symbols__last(&dso->symbols); } struct symbol *dso__next_symbol(struct symbol *sym) @@ -539,24 +528,22 @@ struct symbol *symbol__next_by_name(struct symbol *sym) } /* - * Teturns first symbol that matched with @name. + * Returns first symbol that matched with @name. */ -struct symbol *dso__find_symbol_by_name(struct dso *dso, enum map_type type, - const char *name) +struct symbol *dso__find_symbol_by_name(struct dso *dso, const char *name) { - struct symbol *s = symbols__find_by_name(&dso->symbol_names[type], name, + struct symbol *s = symbols__find_by_name(&dso->symbol_names, name, SYMBOL_TAG_INCLUDE__NONE); if (!s) - s = symbols__find_by_name(&dso->symbol_names[type], name, + s = symbols__find_by_name(&dso->symbol_names, name, SYMBOL_TAG_INCLUDE__DEFAULT_ONLY); return s; } -void dso__sort_by_name(struct dso *dso, enum map_type type) +void dso__sort_by_name(struct dso *dso) { - dso__set_sorted_by_name(dso, type); - return symbols__sort_by_name(&dso->symbol_names[type], - &dso->symbols[type]); + dso__set_sorted_by_name(dso); + return symbols__sort_by_name(&dso->symbol_names, &dso->symbols); } int modules__parse(const char *filename, void *arg, @@ -621,11 +608,6 @@ out: return err; } -struct process_kallsyms_args { - struct map *map; - struct dso *dso; -}; - /* * These are symbols in the kernel image, so make sure that * sym is from a kernel DSO. @@ -661,10 +643,10 @@ static int map__process_kallsym_symbol(void *arg, const char *name, char type, u64 start) { struct symbol *sym; - struct process_kallsyms_args *a = arg; - struct rb_root *root = &a->dso->symbols[a->map->type]; + struct dso *dso = arg; + struct rb_root *root = &dso->symbols; - if (!symbol_type__is_a(type, a->map->type)) + if (!symbol_type__filter(type)) return 0; /* @@ -672,7 +654,7 @@ static int map__process_kallsym_symbol(void *arg, const char *name, * symbols, setting length to 0, and rely on * symbols__fixup_end() to fix it up. */ - sym = symbol__new(start, 0, kallsyms2elf_binding(type), name); + sym = symbol__new(start, 0, kallsyms2elf_binding(type), kallsyms2elf_type(type), name); if (sym == NULL) return -ENOMEM; /* @@ -689,21 +671,18 @@ static int map__process_kallsym_symbol(void *arg, const char *name, * so that we can in the next step set the symbol ->end address and then * call kernel_maps__split_kallsyms. */ -static int dso__load_all_kallsyms(struct dso *dso, const char *filename, - struct map *map) +static int dso__load_all_kallsyms(struct dso *dso, const char *filename) { - struct process_kallsyms_args args = { .map = map, .dso = dso, }; - return kallsyms__parse(filename, &args, map__process_kallsym_symbol); + return kallsyms__parse(filename, dso, map__process_kallsym_symbol); } -static int dso__split_kallsyms_for_kcore(struct dso *dso, struct map *map) +static int map_groups__split_kallsyms_for_kcore(struct map_groups *kmaps, struct dso *dso) { - struct map_groups *kmaps = map__kmaps(map); struct map *curr_map; struct symbol *pos; int count = 0; - struct rb_root old_root = dso->symbols[map->type]; - struct rb_root *root = &dso->symbols[map->type]; + struct rb_root old_root = dso->symbols; + struct rb_root *root = &dso->symbols; struct rb_node *next = rb_first(root); if (!kmaps) @@ -723,7 +702,7 @@ static int dso__split_kallsyms_for_kcore(struct dso *dso, struct map *map) if (module) *module = '\0'; - curr_map = map_groups__find(kmaps, map->type, pos->start); + curr_map = map_groups__find(kmaps, pos->start); if (!curr_map) { symbol__delete(pos); @@ -733,7 +712,7 @@ static int dso__split_kallsyms_for_kcore(struct dso *dso, struct map *map) pos->start -= curr_map->start - curr_map->pgoff; if (pos->end) pos->end -= curr_map->start - curr_map->pgoff; - symbols__insert(&curr_map->dso->symbols[curr_map->type], pos); + symbols__insert(&curr_map->dso->symbols, pos); ++count; } @@ -748,22 +727,25 @@ static int dso__split_kallsyms_for_kcore(struct dso *dso, struct map *map) * kernel range is broken in several maps, named [kernel].N, as we don't have * the original ELF section names vmlinux have. */ -static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) +static int map_groups__split_kallsyms(struct map_groups *kmaps, struct dso *dso, u64 delta, + struct map *initial_map) { - struct map_groups *kmaps = map__kmaps(map); struct machine *machine; - struct map *curr_map = map; + struct map *curr_map = initial_map; struct symbol *pos; int count = 0, moved = 0; - struct rb_root *root = &dso->symbols[map->type]; + struct rb_root *root = &dso->symbols; struct rb_node *next = rb_first(root); int kernel_range = 0; + bool x86_64; if (!kmaps) return -1; machine = kmaps->machine; + x86_64 = machine__is(machine, "x86_64"); + while (next) { char *module; @@ -778,7 +760,7 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) *module++ = '\0'; if (strcmp(curr_map->dso->short_name, module)) { - if (curr_map != map && + if (curr_map != initial_map && dso->kernel == DSO_TYPE_GUEST_KERNEL && machine__is_default_guest(machine)) { /* @@ -788,18 +770,16 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) * symbols are in its kmap. Mark it as * loaded. */ - dso__set_loaded(curr_map->dso, - curr_map->type); + dso__set_loaded(curr_map->dso); } - curr_map = map_groups__find_by_name(kmaps, - map->type, module); + curr_map = map_groups__find_by_name(kmaps, module); if (curr_map == NULL) { pr_debug("%s/proc/{kallsyms,modules} " "inconsistency while looking " "for \"%s\" module!\n", machine->root_dir, module); - curr_map = map; + curr_map = initial_map; goto discard_symbol; } @@ -809,11 +789,21 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) } /* * So that we look just like we get from .ko files, - * i.e. not prelinked, relative to map->start. + * i.e. not prelinked, relative to initial_map->start. */ pos->start = curr_map->map_ip(curr_map, pos->start); pos->end = curr_map->map_ip(curr_map, pos->end); - } else if (curr_map != map) { + } else if (x86_64 && is_entry_trampoline(pos->name)) { + /* + * These symbols are not needed anymore since the + * trampoline maps refer to the text section and it's + * symbols instead. Avoid having to deal with + * relocations, and the assumption that the first symbol + * is the start of kernel text, by simply removing the + * symbols at this point. + */ + goto discard_symbol; + } else if (curr_map != initial_map) { char dso_name[PATH_MAX]; struct dso *ndso; @@ -824,7 +814,7 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) } if (count == 0) { - curr_map = map; + curr_map = initial_map; goto add_symbol; } @@ -843,7 +833,7 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) ndso->kernel = dso->kernel; - curr_map = map__new2(pos->start, ndso, map->type); + curr_map = map__new2(pos->start, ndso); if (curr_map == NULL) { dso__put(ndso); return -1; @@ -858,9 +848,9 @@ static int dso__split_kallsyms(struct dso *dso, struct map *map, u64 delta) pos->end -= delta; } add_symbol: - if (curr_map != map) { + if (curr_map != initial_map) { rb_erase(&pos->rb_node, root); - symbols__insert(&curr_map->dso->symbols[curr_map->type], pos); + symbols__insert(&curr_map->dso->symbols, pos); ++moved; } else ++count; @@ -871,10 +861,10 @@ discard_symbol: symbol__delete(pos); } - if (curr_map != map && + if (curr_map != initial_map && dso->kernel == DSO_TYPE_GUEST_KERNEL && machine__is_default_guest(kmaps->machine)) { - dso__set_loaded(curr_map->dso, curr_map->type); + dso__set_loaded(curr_map->dso); } return count + moved; @@ -1035,7 +1025,12 @@ out_delete_from: return ret; } -static int do_validate_kcore_modules(const char *filename, struct map *map, +struct map *map_groups__first(struct map_groups *mg) +{ + return maps__first(&mg->maps); +} + +static int do_validate_kcore_modules(const char *filename, struct map_groups *kmaps) { struct rb_root modules = RB_ROOT; @@ -1046,13 +1041,12 @@ static int do_validate_kcore_modules(const char *filename, struct map *map, if (err) return err; - old_map = map_groups__first(kmaps, map->type); + old_map = map_groups__first(kmaps); while (old_map) { struct map *next = map_groups__next(old_map); struct module_info *mi; - if (old_map == map || old_map->start == map->start) { - /* The kernel map */ + if (!__map__is_kmodule(old_map)) { old_map = next; continue; } @@ -1109,7 +1103,7 @@ static int validate_kcore_modules(const char *kallsyms_filename, kallsyms_filename)) return -EINVAL; - if (do_validate_kcore_modules(modules_filename, map, kmaps)) + if (do_validate_kcore_modules(modules_filename, kmaps)) return -EINVAL; return 0; @@ -1138,7 +1132,6 @@ static int validate_kcore_addresses(const char *kallsyms_filename, struct kcore_mapfn_data { struct dso *dso; - enum map_type type; struct list_head maps; }; @@ -1147,7 +1140,7 @@ static int kcore_mapfn(u64 start, u64 len, u64 pgoff, void *data) struct kcore_mapfn_data *md = data; struct map *map; - map = map__new2(start, md->dso, md->type); + map = map__new2(start, md->dso); if (map == NULL) return -ENOMEM; @@ -1163,13 +1156,13 @@ static int dso__load_kcore(struct dso *dso, struct map *map, const char *kallsyms_filename) { struct map_groups *kmaps = map__kmaps(map); - struct machine *machine; struct kcore_mapfn_data md; struct map *old_map, *new_map, *replacement_map = NULL; + struct machine *machine; bool is_64_bit; int err, fd; char kcore_filename[PATH_MAX]; - struct symbol *sym; + u64 stext; if (!kmaps) return -EINVAL; @@ -1177,7 +1170,7 @@ static int dso__load_kcore(struct dso *dso, struct map *map, machine = kmaps->machine; /* This function requires that the map is the kernel map */ - if (map != machine->vmlinux_maps[map->type]) + if (!__map__is_kernel(map)) return -EINVAL; if (!filename_from_kallsyms_filename(kcore_filename, "kcore", @@ -1189,7 +1182,6 @@ static int dso__load_kcore(struct dso *dso, struct map *map, return -EINVAL; md.dso = dso; - md.type = map->type; INIT_LIST_HEAD(&md.maps); fd = open(kcore_filename, O_RDONLY); @@ -1200,7 +1192,7 @@ static int dso__load_kcore(struct dso *dso, struct map *map, } /* Read new maps into temporary lists */ - err = file__read_maps(fd, md.type == MAP__FUNCTION, kcore_mapfn, &md, + err = file__read_maps(fd, map->prot & PROT_EXEC, kcore_mapfn, &md, &is_64_bit); if (err) goto out_err; @@ -1212,7 +1204,7 @@ static int dso__load_kcore(struct dso *dso, struct map *map, } /* Remove old maps */ - old_map = map_groups__first(kmaps, map->type); + old_map = map_groups__first(kmaps); while (old_map) { struct map *next = map_groups__next(old_map); @@ -1220,14 +1212,15 @@ static int dso__load_kcore(struct dso *dso, struct map *map, map_groups__remove(kmaps, old_map); old_map = next; } + machine->trampolines_mapped = false; - /* Find the kernel map using the first symbol */ - sym = dso__first_symbol(dso, map->type); - list_for_each_entry(new_map, &md.maps, node) { - if (sym && sym->start >= new_map->start && - sym->start < new_map->end) { - replacement_map = new_map; - break; + /* Find the kernel map using the '_stext' symbol */ + if (!kallsyms__get_function_start(kallsyms_filename, "_stext", &stext)) { + list_for_each_entry(new_map, &md.maps, node) { + if (stext >= new_map->start && stext < new_map->end) { + replacement_map = new_map; + break; + } } } @@ -1256,6 +1249,19 @@ static int dso__load_kcore(struct dso *dso, struct map *map, map__put(new_map); } + if (machine__is(machine, "x86_64")) { + u64 addr; + + /* + * If one of the corresponding symbols is there, assume the + * entry trampoline maps are too. + */ + if (!kallsyms__get_function_start(kallsyms_filename, + ENTRY_TRAMPOLINE_NAME, + &addr)) + machine->trampolines_mapped = true; + } + /* * Set the data type and long name so that kcore can be read via * dso__data_read_addr(). @@ -1268,7 +1274,7 @@ static int dso__load_kcore(struct dso *dso, struct map *map, close(fd); - if (map->type == MAP__FUNCTION) + if (map->prot & PROT_EXEC) pr_debug("Using %s for kernel object code\n", kcore_filename); else pr_debug("Using %s for kernel data\n", kcore_filename); @@ -1289,14 +1295,10 @@ out_err: * If the kernel is relocated at boot time, kallsyms won't match. Compute the * delta based on the relocation reference symbol. */ -static int kallsyms__delta(struct map *map, const char *filename, u64 *delta) +static int kallsyms__delta(struct kmap *kmap, const char *filename, u64 *delta) { - struct kmap *kmap = map__kmap(map); u64 addr; - if (!kmap) - return -1; - if (!kmap->ref_reloc_sym || !kmap->ref_reloc_sym->name) return 0; @@ -1310,19 +1312,23 @@ static int kallsyms__delta(struct map *map, const char *filename, u64 *delta) int __dso__load_kallsyms(struct dso *dso, const char *filename, struct map *map, bool no_kcore) { + struct kmap *kmap = map__kmap(map); u64 delta = 0; if (symbol__restricted_filename(filename, "/proc/kallsyms")) return -1; - if (dso__load_all_kallsyms(dso, filename, map) < 0) + if (!kmap || !kmap->kmaps) return -1; - if (kallsyms__delta(map, filename, &delta)) + if (dso__load_all_kallsyms(dso, filename) < 0) return -1; - symbols__fixup_end(&dso->symbols[map->type]); - symbols__fixup_duplicate(&dso->symbols[map->type]); + if (kallsyms__delta(kmap, filename, &delta)) + return -1; + + symbols__fixup_end(&dso->symbols); + symbols__fixup_duplicate(&dso->symbols); if (dso->kernel == DSO_TYPE_GUEST_KERNEL) dso->symtab_type = DSO_BINARY_TYPE__GUEST_KALLSYMS; @@ -1330,9 +1336,9 @@ int __dso__load_kallsyms(struct dso *dso, const char *filename, dso->symtab_type = DSO_BINARY_TYPE__KALLSYMS; if (!no_kcore && !dso__load_kcore(dso, map, filename)) - return dso__split_kallsyms_for_kcore(dso, map); + return map_groups__split_kallsyms_for_kcore(kmap->kmaps, dso); else - return dso__split_kallsyms(dso, map, delta); + return map_groups__split_kallsyms(kmap->kmaps, dso, delta, map); } int dso__load_kallsyms(struct dso *dso, const char *filename, @@ -1341,8 +1347,7 @@ int dso__load_kallsyms(struct dso *dso, const char *filename, return __dso__load_kallsyms(dso, filename, map, false); } -static int dso__load_perf_map(const char *map_path, struct dso *dso, - struct map *map) +static int dso__load_perf_map(const char *map_path, struct dso *dso) { char *line = NULL; size_t n; @@ -1379,12 +1384,12 @@ static int dso__load_perf_map(const char *map_path, struct dso *dso, if (len + 2 >= line_len) continue; - sym = symbol__new(start, size, STB_GLOBAL, line + len); + sym = symbol__new(start, size, STB_GLOBAL, STT_FUNC, line + len); if (sym == NULL) goto out_delete_line; - symbols__insert(&dso->symbols[map->type], sym); + symbols__insert(&dso->symbols, sym); nr_syms++; } @@ -1509,25 +1514,27 @@ int dso__load(struct dso *dso, struct map *map) pthread_mutex_lock(&dso->lock); /* check again under the dso->lock */ - if (dso__loaded(dso, map->type)) { + if (dso__loaded(dso)) { ret = 1; goto out; } + if (map->groups && map->groups->machine) + machine = map->groups->machine; + else + machine = NULL; + if (dso->kernel) { if (dso->kernel == DSO_TYPE_KERNEL) ret = dso__load_kernel_sym(dso, map); else if (dso->kernel == DSO_TYPE_GUEST_KERNEL) ret = dso__load_guest_kernel_sym(dso, map); + if (machine__is(machine, "x86_64")) + machine__map_x86_64_entry_trampolines(machine, dso); goto out; } - if (map->groups && map->groups->machine) - machine = map->groups->machine; - else - machine = NULL; - dso->adjust_symbols = 0; if (perfmap) { @@ -1542,7 +1549,7 @@ int dso__load(struct dso *dso, struct map *map) goto out; } - ret = dso__load_perf_map(map_path, dso, map); + ret = dso__load_perf_map(map_path, dso); dso->symtab_type = ret > 0 ? DSO_BINARY_TYPE__JAVA_JIT : DSO_BINARY_TYPE__NOT_FOUND; goto out; @@ -1651,7 +1658,7 @@ int dso__load(struct dso *dso, struct map *map) if (ret > 0) { int nr_plt; - nr_plt = dso__synthesize_plt_symbols(dso, runtime_ss, map); + nr_plt = dso__synthesize_plt_symbols(dso, runtime_ss); if (nr_plt > 0) ret += nr_plt; } @@ -1663,17 +1670,16 @@ out_free: if (ret < 0 && strstr(dso->name, " (deleted)") != NULL) ret = 0; out: - dso__set_loaded(dso, map->type); + dso__set_loaded(dso); pthread_mutex_unlock(&dso->lock); nsinfo__mountns_exit(&nsc); return ret; } -struct map *map_groups__find_by_name(struct map_groups *mg, - enum map_type type, const char *name) +struct map *map_groups__find_by_name(struct map_groups *mg, const char *name) { - struct maps *maps = &mg->maps[type]; + struct maps *maps = &mg->maps; struct map *map; down_read(&maps->lock); @@ -1720,7 +1726,7 @@ int dso__load_vmlinux(struct dso *dso, struct map *map, else dso->binary_type = DSO_BINARY_TYPE__VMLINUX; dso__set_long_name(dso, vmlinux, vmlinux_allocated); - dso__set_loaded(dso, map->type); + dso__set_loaded(dso); pr_debug("Using %s for symbols\n", symfs_vmlinux); } diff --git a/tools/perf/util/symbol.h b/tools/perf/util/symbol.h index 70c16741f50a..1a16438eb3ce 100644 --- a/tools/perf/util/symbol.h +++ b/tools/perf/util/symbol.h @@ -57,7 +57,8 @@ struct symbol { u64 start; u64 end; u16 namelen; - u8 binding; + u8 type:4; + u8 binding:4; u8 idle:1; u8 ignore:1; u8 inlined:1; @@ -259,17 +260,16 @@ int __dso__load_kallsyms(struct dso *dso, const char *filename, struct map *map, bool no_kcore); int dso__load_kallsyms(struct dso *dso, const char *filename, struct map *map); -void dso__insert_symbol(struct dso *dso, enum map_type type, +void dso__insert_symbol(struct dso *dso, struct symbol *sym); -struct symbol *dso__find_symbol(struct dso *dso, enum map_type type, - u64 addr); -struct symbol *dso__find_symbol_by_name(struct dso *dso, enum map_type type, - const char *name); +struct symbol *dso__find_symbol(struct dso *dso, u64 addr); +struct symbol *dso__find_symbol_by_name(struct dso *dso, const char *name); + struct symbol *symbol__next_by_name(struct symbol *sym); -struct symbol *dso__first_symbol(struct dso *dso, enum map_type type); -struct symbol *dso__last_symbol(struct dso *dso, enum map_type type); +struct symbol *dso__first_symbol(struct dso *dso); +struct symbol *dso__last_symbol(struct dso *dso); struct symbol *dso__next_symbol(struct symbol *sym); enum dso_type dso__type_fd(int fd); @@ -288,7 +288,7 @@ void symbol__exit(void); void symbol__elf_init(void); int symbol__annotation_init(void); -struct symbol *symbol__new(u64 start, u64 len, u8 binding, const char *name); +struct symbol *symbol__new(u64 start, u64 len, u8 binding, u8 type, const char *name); size_t __symbol__fprintf_symname_offs(const struct symbol *sym, const struct addr_location *al, bool unknown_as_addr, @@ -300,7 +300,6 @@ size_t __symbol__fprintf_symname(const struct symbol *sym, bool unknown_as_addr, FILE *fp); size_t symbol__fprintf_symname(const struct symbol *sym, FILE *fp); size_t symbol__fprintf(struct symbol *sym, FILE *fp); -bool symbol_type__is_a(char symbol_type, enum map_type map_type); bool symbol__restricted_filename(const char *filename, const char *restricted_filename); int symbol__config_symfs(const struct option *opt __maybe_unused, @@ -308,8 +307,7 @@ int symbol__config_symfs(const struct option *opt __maybe_unused, int dso__load_sym(struct dso *dso, struct map *map, struct symsrc *syms_ss, struct symsrc *runtime_ss, int kmodule); -int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss, - struct map *map); +int dso__synthesize_plt_symbols(struct dso *dso, struct symsrc *ss); char *dso__demangle_sym(struct dso *dso, int kmodule, const char *elf_name); @@ -317,7 +315,7 @@ void __symbols__insert(struct rb_root *symbols, struct symbol *sym, bool kernel) void symbols__insert(struct rb_root *symbols, struct symbol *sym); void symbols__fixup_duplicate(struct rb_root *symbols); void symbols__fixup_end(struct rb_root *symbols); -void __map_groups__fixup_end(struct map_groups *mg, enum map_type type); +void map_groups__fixup_end(struct map_groups *mg); typedef int (*mapfn_t)(u64 start, u64 len, u64 pgoff, void *data); int file__read_maps(int fd, bool exe, mapfn_t mapfn, void *data, diff --git a/tools/perf/util/symbol_fprintf.c b/tools/perf/util/symbol_fprintf.c index 6dd2cb88ccbe..ed0205cc7942 100644 --- a/tools/perf/util/symbol_fprintf.c +++ b/tools/perf/util/symbol_fprintf.c @@ -58,13 +58,13 @@ size_t symbol__fprintf_symname(const struct symbol *sym, FILE *fp) } size_t dso__fprintf_symbols_by_name(struct dso *dso, - enum map_type type, FILE *fp) + FILE *fp) { size_t ret = 0; struct rb_node *nd; struct symbol_name_rb_node *pos; - for (nd = rb_first(&dso->symbol_names[type]); nd; nd = rb_next(nd)) { + for (nd = rb_first(&dso->symbol_names); nd; nd = rb_next(nd)) { pos = rb_entry(nd, struct symbol_name_rb_node, rb_node); fprintf(fp, "%s\n", pos->sym.name); } diff --git a/tools/perf/util/thread.c b/tools/perf/util/thread.c index 68b65b10579b..2048d393ece6 100644 --- a/tools/perf/util/thread.c +++ b/tools/perf/util/thread.c @@ -302,23 +302,20 @@ int thread__insert_map(struct thread *thread, struct map *map) static int __thread__prepare_access(struct thread *thread) { bool initialized = false; - int i, err = 0; - - for (i = 0; i < MAP__NR_TYPES; ++i) { - struct maps *maps = &thread->mg->maps[i]; - struct map *map; + int err = 0; + struct maps *maps = &thread->mg->maps; + struct map *map; - down_read(&maps->lock); + down_read(&maps->lock); - for (map = maps__first(maps); map; map = map__next(map)) { - err = unwind__prepare_access(thread, map, &initialized); - if (err || initialized) - break; - } - - up_read(&maps->lock); + for (map = maps__first(maps); map; map = map__next(map)) { + err = unwind__prepare_access(thread, map, &initialized); + if (err || initialized) + break; } + up_read(&maps->lock); + return err; } @@ -335,8 +332,6 @@ static int thread__prepare_access(struct thread *thread) static int thread__clone_map_groups(struct thread *thread, struct thread *parent) { - int i; - /* This is new thread, we share map groups for process. */ if (thread->pid_ == parent->pid_) return thread__prepare_access(thread); @@ -348,9 +343,8 @@ static int thread__clone_map_groups(struct thread *thread, } /* But this one is new process, copy maps. */ - for (i = 0; i < MAP__NR_TYPES; ++i) - if (map_groups__clone(thread, parent->mg, i) < 0) - return -ENOMEM; + if (map_groups__clone(thread, parent->mg) < 0) + return -ENOMEM; return 0; } @@ -371,8 +365,7 @@ int thread__fork(struct thread *thread, struct thread *parent, u64 timestamp) return thread__clone_map_groups(thread, parent); } -void thread__find_cpumode_addr_location(struct thread *thread, - enum map_type type, u64 addr, +void thread__find_cpumode_addr_location(struct thread *thread, u64 addr, struct addr_location *al) { size_t i; @@ -384,7 +377,7 @@ void thread__find_cpumode_addr_location(struct thread *thread, }; for (i = 0; i < ARRAY_SIZE(cpumodes); i++) { - thread__find_addr_location(thread, cpumodes[i], type, addr, al); + thread__find_symbol(thread, cpumodes[i], addr, al); if (al->map) break; } diff --git a/tools/perf/util/thread.h b/tools/perf/util/thread.h index 14d44c3235b8..07606aa6998d 100644 --- a/tools/perf/util/thread.h +++ b/tools/perf/util/thread.h @@ -92,16 +92,13 @@ size_t thread__fprintf(struct thread *thread, FILE *fp); struct thread *thread__main_thread(struct machine *machine, struct thread *thread); -void thread__find_addr_map(struct thread *thread, - u8 cpumode, enum map_type type, u64 addr, - struct addr_location *al); +struct map *thread__find_map(struct thread *thread, u8 cpumode, u64 addr, + struct addr_location *al); -void thread__find_addr_location(struct thread *thread, - u8 cpumode, enum map_type type, u64 addr, - struct addr_location *al); +struct symbol *thread__find_symbol(struct thread *thread, u8 cpumode, + u64 addr, struct addr_location *al); -void thread__find_cpumode_addr_location(struct thread *thread, - enum map_type type, u64 addr, +void thread__find_cpumode_addr_location(struct thread *thread, u64 addr, struct addr_location *al); static inline void *thread__priv(struct thread *thread) diff --git a/tools/perf/util/trace-event-info.c b/tools/perf/util/trace-event-info.c index d7f2113462fb..c85d0d1a65ed 100644 --- a/tools/perf/util/trace-event-info.c +++ b/tools/perf/util/trace-event-info.c @@ -103,11 +103,10 @@ out: static int record_header_files(void) { - char *path; + char *path = get_events_file("header_page"); struct stat st; int err = -EIO; - path = get_tracing_file("events/header_page"); if (!path) { pr_debug("can't get tracing/events/header_page"); return -ENOMEM; @@ -128,9 +127,9 @@ static int record_header_files(void) goto out; } - put_tracing_file(path); + put_events_file(path); - path = get_tracing_file("events/header_event"); + path = get_events_file("header_event"); if (!path) { pr_debug("can't get tracing/events/header_event"); err = -ENOMEM; @@ -154,7 +153,7 @@ static int record_header_files(void) err = 0; out: - put_tracing_file(path); + put_events_file(path); return err; } @@ -243,7 +242,7 @@ static int record_ftrace_files(struct tracepoint_path *tps) char *path; int ret; - path = get_tracing_file("events/ftrace"); + path = get_events_file("ftrace"); if (!path) { pr_debug("can't get tracing/events/ftrace"); return -ENOMEM; diff --git a/tools/perf/util/trace-event.c b/tools/perf/util/trace-event.c index 16a776371d03..1aa368603268 100644 --- a/tools/perf/util/trace-event.c +++ b/tools/perf/util/trace-event.c @@ -75,6 +75,7 @@ void trace_event__cleanup(struct trace_event *t) static struct event_format* tp_format(const char *sys, const char *name) { + char *tp_dir = get_events_file(sys); struct pevent *pevent = tevent.pevent; struct event_format *event = NULL; char path[PATH_MAX]; @@ -82,8 +83,11 @@ tp_format(const char *sys, const char *name) char *data; int err; - scnprintf(path, PATH_MAX, "%s/%s/%s/format", - tracing_events_path, sys, name); + if (!tp_dir) + return ERR_PTR(-errno); + + scnprintf(path, PATH_MAX, "%s/%s/format", tp_dir, name); + put_events_file(tp_dir); err = filename__read_str(path, &data, &size); if (err) diff --git a/tools/perf/util/unwind-libdw.c b/tools/perf/util/unwind-libdw.c index 7bdd239c795c..538db4e5d1e6 100644 --- a/tools/perf/util/unwind-libdw.c +++ b/tools/perf/util/unwind-libdw.c @@ -28,10 +28,11 @@ static int __report_module(struct addr_location *al, u64 ip, { Dwfl_Module *mod; struct dso *dso = NULL; - - thread__find_addr_location(ui->thread, - PERF_RECORD_MISC_USER, - MAP__FUNCTION, ip, al); + /* + * Some callers will use al->sym, so we can't just use the + * cheaper thread__find_map() here. + */ + thread__find_symbol(ui->thread, PERF_RECORD_MISC_USER, ip, al); if (al->map) dso = al->map->dso; @@ -103,19 +104,7 @@ static int access_dso_mem(struct unwind_info *ui, Dwarf_Addr addr, struct addr_location al; ssize_t size; - thread__find_addr_map(ui->thread, PERF_RECORD_MISC_USER, - MAP__FUNCTION, addr, &al); - if (!al.map) { - /* - * We've seen cases (softice) where DWARF unwinder went - * through non executable mmaps, which we need to lookup - * in MAP__VARIABLE tree. - */ - thread__find_addr_map(ui->thread, PERF_RECORD_MISC_USER, - MAP__VARIABLE, addr, &al); - } - - if (!al.map) { + if (!thread__find_map(ui->thread, PERF_RECORD_MISC_USER, addr, &al)) { pr_debug("unwind: no map for %lx\n", (unsigned long)addr); return -1; } diff --git a/tools/perf/util/unwind-libunwind-local.c b/tools/perf/util/unwind-libunwind-local.c index af873044d33a..6a11bc7e6b27 100644 --- a/tools/perf/util/unwind-libunwind-local.c +++ b/tools/perf/util/unwind-libunwind-local.c @@ -366,19 +366,7 @@ static int read_unwind_spec_debug_frame(struct dso *dso, static struct map *find_map(unw_word_t ip, struct unwind_info *ui) { struct addr_location al; - - thread__find_addr_map(ui->thread, PERF_RECORD_MISC_USER, - MAP__FUNCTION, ip, &al); - if (!al.map) { - /* - * We've seen cases (softice) where DWARF unwinder went - * through non executable mmaps, which we need to lookup - * in MAP__VARIABLE tree. - */ - thread__find_addr_map(ui->thread, PERF_RECORD_MISC_USER, - MAP__VARIABLE, ip, &al); - } - return al.map; + return thread__find_map(ui->thread, PERF_RECORD_MISC_USER, ip, &al); } static int @@ -586,12 +574,9 @@ static int entry(u64 ip, struct thread *thread, struct unwind_entry e; struct addr_location al; - thread__find_addr_location(thread, PERF_RECORD_MISC_USER, - MAP__FUNCTION, ip, &al); - + e.sym = thread__find_symbol(thread, PERF_RECORD_MISC_USER, ip, &al); e.ip = al.addr; e.map = al.map; - e.sym = al.sym; pr_debug("unwind: %s:ip = 0x%" PRIx64 " (0x%" PRIx64 ")\n", al.sym ? al.sym->name : "''", diff --git a/tools/perf/util/util.c b/tools/perf/util/util.c index 1019bbc5dbd8..eac5b858a371 100644 --- a/tools/perf/util/util.c +++ b/tools/perf/util/util.c @@ -38,11 +38,43 @@ void perf_set_multithreaded(void) } unsigned int page_size; -int cacheline_size; + +#ifdef _SC_LEVEL1_DCACHE_LINESIZE +#define cache_line_size(cacheline_sizep) *cacheline_sizep = sysconf(_SC_LEVEL1_DCACHE_LINESIZE) +#else +static void cache_line_size(int *cacheline_sizep) +{ + if (sysfs__read_int("devices/system/cpu/cpu0/cache/index0/coherency_line_size", cacheline_sizep)) + pr_debug("cannot determine cache line size"); +} +#endif + +int cacheline_size(void) +{ + static int size; + + if (!size) + cache_line_size(&size); + + return size; +} int sysctl_perf_event_max_stack = PERF_MAX_STACK_DEPTH; int sysctl_perf_event_max_contexts_per_stack = PERF_MAX_CONTEXTS_PER_STACK; +int sysctl__max_stack(void) +{ + int value; + + if (sysctl__read_int("kernel/perf_event_max_stack", &value) == 0) + sysctl_perf_event_max_stack = value; + + if (sysctl__read_int("kernel/perf_event_max_contexts_per_stack", &value) == 0) + sysctl_perf_event_max_contexts_per_stack = value; + + return sysctl_perf_event_max_stack; +} + bool test_attr__enabled; bool perf_host = true; diff --git a/tools/perf/util/util.h b/tools/perf/util/util.h index c9626c206208..dc58254a2b69 100644 --- a/tools/perf/util/util.h +++ b/tools/perf/util/util.h @@ -43,7 +43,9 @@ size_t hex_width(u64 v); int hex2u64(const char *ptr, u64 *val); extern unsigned int page_size; -extern int cacheline_size; +int __pure cacheline_size(void); + +int sysctl__max_stack(void); int fetch_kernel_version(unsigned int *puint, char *str, size_t str_sz); diff --git a/tools/perf/util/vdso.c b/tools/perf/util/vdso.c index 0acb1ec0e2f0..741af209b19d 100644 --- a/tools/perf/util/vdso.c +++ b/tools/perf/util/vdso.c @@ -139,12 +139,10 @@ static enum dso_type machine__thread_dso_type(struct machine *machine, struct thread *thread) { enum dso_type dso_type = DSO__TYPE_UNKNOWN; - struct map *map; - struct dso *dso; + struct map *map = map_groups__first(thread->mg); - map = map_groups__first(thread->mg, MAP__FUNCTION); for (; map ; map = map_groups__next(map)) { - dso = map->dso; + struct dso *dso = map->dso; if (!dso || dso->long_name[0] != '/') continue; dso_type = dso__type(dso, machine); diff --git a/tools/power/pm-graph/bootgraph.py b/tools/power/pm-graph/bootgraph.py index abb4c38f029b..8ee626c0f6a5 100755 --- a/tools/power/pm-graph/bootgraph.py +++ b/tools/power/pm-graph/bootgraph.py @@ -1,4 +1,4 @@ -#!/usr/bin/python +#!/usr/bin/python2 # # Tool for analyzing boot timing # Copyright (c) 2013, Intel Corporation. diff --git a/tools/power/pm-graph/sleepgraph.8 b/tools/power/pm-graph/sleepgraph.8 index 18baaf6300c9..070be2cf7f74 100644 --- a/tools/power/pm-graph/sleepgraph.8 +++ b/tools/power/pm-graph/sleepgraph.8 @@ -168,6 +168,7 @@ Create a summary page of all tests in \fIindir\fR. Creates summary.html in the current folder. The output page is a table of tests with suspend and resume values sorted by suspend mode, host, and kernel. Includes test averages by mode and links to the test html files. +Use -genhtml to include tests with missing html. .TP \fB-modes\fR List available suspend modes. @@ -179,6 +180,9 @@ with any options you intend to use to see if they will work. \fB-fpdt\fR Print out the contents of the ACPI Firmware Performance Data Table. .TP +\fB-battery\fR +Print out battery status and current charge. +.TP \fB-sysinfo\fR Print out system info extracted from BIOS. Reads /dev/mem directly instead of going through dmidecode. .TP diff --git a/tools/power/pm-graph/sleepgraph.py b/tools/power/pm-graph/sleepgraph.py index 266409fb27ae..0c760478f7d7 100755 --- a/tools/power/pm-graph/sleepgraph.py +++ b/tools/power/pm-graph/sleepgraph.py @@ -1,4 +1,4 @@ -#!/usr/bin/python +#!/usr/bin/python2 # # Tool for analyzing suspend/resume timing # Copyright (c) 2013, Intel Corporation. @@ -69,7 +69,7 @@ from subprocess import call, Popen, PIPE # store system values and test parameters class SystemValues: title = 'SleepGraph' - version = '5.0' + version = '5.1' ansi = False rs = 0 display = 0 @@ -240,7 +240,7 @@ class SystemValues: kprobes = dict() timeformat = '%.3f' cmdline = '%s %s' % \ - (os.path.basename(sys.argv[0]), string.join(sys.argv[1:], ' ')) + (os.path.basename(sys.argv[0]), ' '.join(sys.argv[1:])) def __init__(self): self.archargs = 'args_'+platform.machine() self.hostname = platform.node() @@ -917,12 +917,18 @@ class Data: self.devicegroups.append([phase]) self.errorinfo = {'suspend':[],'resume':[]} def extractErrorInfo(self): + elist = { + 'HWERROR' : '.*\[ *Hardware Error *\].*', + 'FWBUG' : '.*\[ *Firmware Bug *\].*', + 'BUG' : '.*BUG.*', + 'ERROR' : '.*ERROR.*', + 'WARNING' : '.*WARNING.*', + 'IRQ' : '.*genirq: .*', + 'TASKFAIL': '.*Freezing of tasks failed.*', + } lf = sysvals.openlog(sysvals.dmesgfile, 'r') i = 0 list = [] - # sl = start line, et = error time, el = error line - type = 'ERROR' - sl = et = el = -1 for line in lf: i += 1 m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line) @@ -931,43 +937,13 @@ class Data: t = float(m.group('ktime')) if t < self.start or t > self.end: continue - if t < self.tSuspended: - dir = 'suspend' - else: - dir = 'resume' + dir = 'suspend' if t < self.tSuspended else 'resume' msg = m.group('msg') - if re.match('-*\[ *cut here *\]-*', msg): - type = 'WARNING' - sl = i - elif re.match('genirq: .*', msg): - type = 'IRQ' - sl = i - elif re.match('BUG: .*', msg) or re.match('kernel BUG .*', msg): - type = 'BUG' - sl = i - elif re.match('-*\[ *end trace .*\]-*', msg) or \ - re.match('R13: .*', msg): - if et >= 0 and sl >= 0: - list.append((type, dir, et, sl, i)) - self.kerror = True - sl = et = el = -1 - type = 'ERROR' - elif 'Call Trace:' in msg: - if el >= 0 and et >= 0: - list.append((type, dir, et, el, el)) + for err in elist: + if re.match(elist[err], msg): + list.append((err, dir, t, i, i)) self.kerror = True - et, el = t, i - if sl < 0 or type == 'BUG': - slval = i - if sl >= 0: - slval = sl - list.append((type, dir, et, slval, i)) - self.kerror = True - sl = et = el = -1 - type = 'ERROR' - if el >= 0 and et >= 0: - list.append((type, dir, et, el, el)) - self.kerror = True + break for e in list: type, dir, t, idx1, idx2 = e sysvals.vprint('kernel %s found in %s at %f' % (type, dir, t)) @@ -2331,12 +2307,14 @@ class TestProps: sv.suspendmode = data.stamp['mode'] if sv.suspendmode == 'command' and sv.ftracefile != '': modes = ['on', 'freeze', 'standby', 'mem', 'disk'] - out = Popen(['grep', 'machine_suspend', sv.ftracefile], - stderr=PIPE, stdout=PIPE).stdout.read() - m = re.match('.* machine_suspend\[(?P<mode>.*)\]', out) - if m and m.group('mode') in ['1', '2', '3', '4']: - sv.suspendmode = modes[int(m.group('mode'))] - data.stamp['mode'] = sv.suspendmode + fp = sysvals.openlog(sv.ftracefile, 'r') + for line in fp: + m = re.match('.* machine_suspend\[(?P<mode>.*)\]', line) + if m and m.group('mode') in ['1', '2', '3', '4']: + sv.suspendmode = modes[int(m.group('mode'))] + data.stamp['mode'] = sv.suspendmode + break + fp.close() m = re.match(self.cmdlinefmt, self.cmdline) if m: sv.cmdline = m.group('cmd') @@ -2413,7 +2391,7 @@ class ProcessMonitor: # markers, and/or kprobes required for primary parsing. def doesTraceLogHaveTraceEvents(): kpcheck = ['_cal: (', '_cpu_down()'] - techeck = sysvals.traceevents[:] + techeck = ['suspend_resume'] tmcheck = ['SUSPEND START', 'RESUME COMPLETE'] sysvals.usekprobes = False fp = sysvals.openlog(sysvals.ftracefile, 'r') @@ -2808,7 +2786,7 @@ def parseTraceLog(live=False): # -- phase changes -- # start of kernel suspend if(re.match('suspend_enter\[.*', t.name)): - if(isbegin): + if(isbegin and data.start == data.tKernSus): data.dmesg[phase]['start'] = t.time data.tKernSus = t.time continue @@ -3072,13 +3050,20 @@ def parseTraceLog(live=False): sysvals.vprint('Callgraph found for task %d: %.3fms, %s' % (cg.pid, (cg.end - cg.start)*1000, name)) cg.newActionFromFunction(data) if sysvals.suspendmode == 'command': - return testdata + return (testdata, '') # fill in any missing phases + error = [] for data in testdata: + tn = '' if len(testdata) == 1 else ('%d' % (data.testnumber + 1)) + terr = '' lp = data.phases[0] for p in data.phases: if(data.dmesg[p]['start'] < 0 and data.dmesg[p]['end'] < 0): + if not terr: + print 'TEST%s FAILED: %s failed in %s phase' % (tn, sysvals.suspendmode, lp) + terr = '%s%s failed in %s phase' % (sysvals.suspendmode, tn, lp) + error.append(terr) sysvals.vprint('WARNING: phase "%s" is missing!' % p) if(data.dmesg[p]['start'] < 0): data.dmesg[p]['start'] = data.dmesg[lp]['end'] @@ -3106,7 +3091,7 @@ def parseTraceLog(live=False): for j in range(i + 1, tc): testdata[j].mergeOverlapDevices(devlist) testdata[0].stitchTouchingThreads(testdata[1:]) - return testdata + return (testdata, ', '.join(error)) # Function: loadKernelLog # Description: @@ -3173,7 +3158,7 @@ def loadKernelLog(): if data: testruns.append(data) if len(testruns) < 1: - doError(' dmesg log has no suspend/resume data: %s' \ + print('ERROR: dmesg log has no suspend/resume data: %s' \ % sysvals.dmesgfile) # fix lines with same timestamp/function with the call and return swapped @@ -3521,68 +3506,144 @@ def createHTMLSummarySimple(testruns, htmlfile, folder): .summary {border:1px solid;}\n\ th {border: 1px solid black;background:#222;color:white;}\n\ td {font: 16px "Times New Roman";text-align: center;}\n\ - tr.alt td {background:#ddd;}\n\ - tr.avg td {background:#aaa;}\n\ + tr.head td {border: 1px solid black;background:#aaa;}\n\ + tr.alt {background-color:#ddd;}\n\ + tr.notice {color:red;}\n\ + .minval {background-color:#BBFFBB;}\n\ + .medval {background-color:#BBBBFF;}\n\ + .maxval {background-color:#FFBBBB;}\n\ + .head a {color:#000;text-decoration: none;}\n\ </style>\n</head>\n<body>\n' + # extract the test data into list + list = dict() + tAvg, tMin, tMax, tMed = [0.0, 0.0], [0.0, 0.0], [0.0, 0.0], [[], []] + iMin, iMed, iMax = [0, 0], [0, 0], [0, 0] + num = 0 + lastmode = '' + cnt = {'pass':0, 'fail':0, 'hang':0} + for data in sorted(testruns, key=lambda v:(v['mode'], v['host'], v['kernel'], v['time'])): + mode = data['mode'] + if mode not in list: + list[mode] = {'data': [], 'avg': [0,0], 'min': [0,0], 'max': [0,0], 'med': [0,0]} + if lastmode and lastmode != mode and num > 0: + for i in range(2): + s = sorted(tMed[i]) + list[lastmode]['med'][i] = s[int(len(s)/2)] + iMed[i] = tMed[i].index(list[lastmode]['med'][i]) + list[lastmode]['avg'] = [tAvg[0] / num, tAvg[1] / num] + list[lastmode]['min'] = tMin + list[lastmode]['max'] = tMax + list[lastmode]['idx'] = (iMin, iMed, iMax) + tAvg, tMin, tMax, tMed = [0.0, 0.0], [0.0, 0.0], [0.0, 0.0], [[], []] + iMin, iMed, iMax = [0, 0], [0, 0], [0, 0] + num = 0 + tVal = [float(data['suspend']), float(data['resume'])] + list[mode]['data'].append([data['host'], data['kernel'], + data['time'], tVal[0], tVal[1], data['url'], data['result'], + data['issues']]) + idx = len(list[mode]['data']) - 1 + if data['result'] == 'pass': + cnt['pass'] += 1 + for i in range(2): + tMed[i].append(tVal[i]) + tAvg[i] += tVal[i] + if tMin[i] == 0 or tVal[i] < tMin[i]: + iMin[i] = idx + tMin[i] = tVal[i] + if tMax[i] == 0 or tVal[i] > tMax[i]: + iMax[i] = idx + tMax[i] = tVal[i] + num += 1 + elif data['result'] == 'hang': + cnt['hang'] += 1 + elif data['result'] == 'fail': + cnt['fail'] += 1 + lastmode = mode + if lastmode and num > 0: + for i in range(2): + s = sorted(tMed[i]) + list[lastmode]['med'][i] = s[int(len(s)/2)] + iMed[i] = tMed[i].index(list[lastmode]['med'][i]) + list[lastmode]['avg'] = [tAvg[0] / num, tAvg[1] / num] + list[lastmode]['min'] = tMin + list[lastmode]['max'] = tMax + list[lastmode]['idx'] = (iMin, iMed, iMax) + # group test header - html += '<div class="stamp">%s (%d tests)</div>\n' % (folder, len(testruns)) + desc = [] + for ilk in sorted(cnt, reverse=True): + if cnt[ilk] > 0: + desc.append('%d %s' % (cnt[ilk], ilk)) + html += '<div class="stamp">%s (%d tests: %s)</div>\n' % (folder, len(testruns), ', '.join(desc)) th = '\t<th>{0}</th>\n' td = '\t<td>{0}</td>\n' + tdh = '\t<td{1}>{0}</td>\n' tdlink = '\t<td><a href="{0}">html</a></td>\n' # table header html += '<table class="summary">\n<tr>\n' + th.format('#') +\ th.format('Mode') + th.format('Host') + th.format('Kernel') +\ - th.format('Test Time') + th.format('Suspend') + th.format('Resume') +\ - th.format('Detail') + '</tr>\n' - - # test data, 1 row per test - avg = '<tr class="avg"><td></td><td></td><td></td><td></td>'+\ - '<td>Average of {0} {1} tests</td><td>{2}</td><td>{3}</td><td></td></tr>\n' - sTimeAvg = rTimeAvg = 0.0 - mode = '' - num = 0 - for data in sorted(testruns, key=lambda v:(v['mode'], v['host'], v['kernel'], v['time'])): - if mode != data['mode']: - # test average line - if(num > 0): - sTimeAvg /= (num - 1) - rTimeAvg /= (num - 1) - html += avg.format('%d' % (num - 1), mode, - '%3.3f ms' % sTimeAvg, '%3.3f ms' % rTimeAvg) - sTimeAvg = rTimeAvg = 0.0 - mode = data['mode'] - num = 1 - # alternate row color - if num % 2 == 1: - html += '<tr class="alt">\n' + th.format('Test Time') + th.format('Result') + th.format('Issues') +\ + th.format('Suspend') + th.format('Resume') + th.format('Detail') + '</tr>\n' + + # export list into html + head = '<tr class="head"><td>{0}</td><td>{1}</td>'+\ + '<td colspan=8 class="sus">Suspend Avg={2} '+\ + '<span class=minval><a href="#s{10}min">Min={3}</a></span> '+\ + '<span class=medval><a href="#s{10}med">Med={4}</a></span> '+\ + '<span class=maxval><a href="#s{10}max">Max={5}</a></span> '+\ + 'Resume Avg={6} '+\ + '<span class=minval><a href="#r{10}min">Min={7}</a></span> '+\ + '<span class=medval><a href="#r{10}med">Med={8}</a></span> '+\ + '<span class=maxval><a href="#r{10}max">Max={9}</a></span></td>'+\ + '</tr>\n' + headnone = '<tr class="head"><td>{0}</td><td>{1}</td><td colspan=8></td></tr>\n' + for mode in list: + # header line for each suspend mode + num = 0 + tAvg, tMin, tMax, tMed = list[mode]['avg'], list[mode]['min'],\ + list[mode]['max'], list[mode]['med'] + count = len(list[mode]['data']) + if 'idx' in list[mode]: + iMin, iMed, iMax = list[mode]['idx'] + html += head.format('%d' % count, mode.upper(), + '%.3f' % tAvg[0], '%.3f' % tMin[0], '%.3f' % tMed[0], '%.3f' % tMax[0], + '%.3f' % tAvg[1], '%.3f' % tMin[1], '%.3f' % tMed[1], '%.3f' % tMax[1], + mode.lower() + ) else: - html += '<tr>\n' - html += td.format("%d" % num) - num += 1 - # basic info - for item in ['mode', 'host', 'kernel', 'time']: - val = "unknown" - if(item in data): - val = data[item] - html += td.format(val) - # suspend time - sTime = float(data['suspend']) - sTimeAvg += sTime - html += td.format('%.3f ms' % sTime) - # resume time - rTime = float(data['resume']) - rTimeAvg += rTime - html += td.format('%.3f ms' % rTime) - # link to the output html - html += tdlink.format(data['url']) + '</tr>\n' - # last test average line - if(num > 0): - sTimeAvg /= (num - 1) - rTimeAvg /= (num - 1) - html += avg.format('%d' % (num - 1), mode, - '%3.3f ms' % sTimeAvg, '%3.3f ms' % rTimeAvg) + iMin = iMed = iMax = [-1, -1, -1] + html += headnone.format('%d' % count, mode.upper()) + for d in list[mode]['data']: + # row classes - alternate row color + rcls = ['alt'] if num % 2 == 1 else [] + if d[6] != 'pass': + rcls.append('notice') + html += '<tr class="'+(' '.join(rcls))+'">\n' if len(rcls) > 0 else '<tr>\n' + # figure out if the line has sus or res highlighted + idx = list[mode]['data'].index(d) + tHigh = ['', ''] + for i in range(2): + tag = 's%s' % mode if i == 0 else 'r%s' % mode + if idx == iMin[i]: + tHigh[i] = ' id="%smin" class=minval title="Minimum"' % tag + elif idx == iMax[i]: + tHigh[i] = ' id="%smax" class=maxval title="Maximum"' % tag + elif idx == iMed[i]: + tHigh[i] = ' id="%smed" class=medval title="Median"' % tag + html += td.format("%d" % (list[mode]['data'].index(d) + 1)) # row + html += td.format(mode) # mode + html += td.format(d[0]) # host + html += td.format(d[1]) # kernel + html += td.format(d[2]) # time + html += td.format(d[6]) # result + html += td.format(d[7]) # issues + html += tdh.format('%.3f ms' % d[3], tHigh[0]) if d[3] else td.format('') # suspend + html += tdh.format('%.3f ms' % d[4], tHigh[1]) if d[4] else td.format('') # resume + html += tdlink.format(d[5]) if d[5] else td.format('') # url + html += '</tr>\n' + num += 1 # flush the data to file hf = open(htmlfile, 'w') @@ -3607,7 +3668,7 @@ def ordinal(value): # testruns: array of Data objects from parseKernelLog or parseTraceLog # Output: # True if the html file was created, false if it failed -def createHTML(testruns): +def createHTML(testruns, testfail): if len(testruns) < 1: print('ERROR: Not enough test data to build a timeline') return @@ -3641,6 +3702,7 @@ def createHTML(testruns): '<td class="purple">{4}Firmware Resume: {2} ms</td>'\ '<td class="yellow" title="time from firmware mode to return from kernel enter_state({5}) [kernel time only]">{4}Kernel Resume: {3} ms</td>'\ '</tr>\n</table>\n' + html_fail = '<table class="testfail"><tr><td>{0}</td></tr></table>\n' # html format variables scaleH = 20 @@ -3708,6 +3770,9 @@ def createHTML(testruns): resume_time, testdesc, stitle, rtitle) devtl.html += thtml + if testfail: + devtl.html += html_fail.format(testfail) + # time scale for potentially multiple datasets t0 = testruns[0].start tMax = testruns[-1].end @@ -4006,6 +4071,7 @@ def addCSS(hf, sv, testcount=1, kerror=False, extra=''): .blue {background:rgba(169,208,245,0.4);}\n\ .time1 {font:22px Arial;border:1px solid;}\n\ .time2 {font:15px Arial;border-bottom:1px solid;border-left:1px solid;border-right:1px solid;}\n\ + .testfail {font:bold 22px Arial;color:red;border:1px dashed;}\n\ td {text-align:center;}\n\ r {color:#500000;font:15px Tahoma;}\n\ n {color:#505050;font:15px Tahoma;}\n\ @@ -4927,6 +4993,25 @@ def dmidecode(mempath, fatal=False): count += 1 return out +def getBattery(): + p = '/sys/class/power_supply' + bat = dict() + for d in os.listdir(p): + type = sysvals.getVal(os.path.join(p, d, 'type')).strip().lower() + if type != 'battery': + continue + for v in ['status', 'energy_now', 'capacity_now']: + bat[v] = sysvals.getVal(os.path.join(p, d, v)).strip().lower() + break + ac = True + if 'status' in bat and 'discharging' in bat['status']: + ac = False + charge = 0 + for v in ['energy_now', 'capacity_now']: + if v in bat and bat[v]: + charge = int(bat[v]) + return (ac, charge) + # Function: getFPDT # Description: # Read the acpi bios tables and pull out FPDT, the firmware data @@ -5202,8 +5287,9 @@ def getArgFloat(name, args, min, max, main=True): def processData(live=False): print('PROCESSING DATA') + error = '' if(sysvals.usetraceevents): - testruns = parseTraceLog(live) + testruns, error = parseTraceLog(live) if sysvals.dmesgfile: for data in testruns: data.extractErrorInfo() @@ -5220,15 +5306,18 @@ def processData(live=False): for data in testruns: data.debugPrint() sys.exit() - + if len(testruns) < 1: + return (testruns, {'error': 'timeline generation failed'}) sysvals.vprint('Creating the html timeline (%s)...' % sysvals.htmlfile) - createHTML(testruns) + createHTML(testruns, error) print('DONE') data = testruns[0] stamp = data.stamp stamp['suspend'], stamp['resume'] = data.getTimeValues() if data.fwValid: stamp['fwsuspend'], stamp['fwresume'] = data.fwSuspend, data.fwResume + if error: + stamp['error'] = error return (testruns, stamp) # Function: rerunTest @@ -5268,58 +5357,88 @@ def runTest(n=0): sysvals.sudouser(sysvals.testdir) sysvals.outputResult(stamp, n) -def find_in_html(html, strs, div=False): - for str in strs: - l = len(str) - i = html.find(str) - if i >= 0: +def find_in_html(html, start, end, firstonly=True): + n, out = 0, [] + while n < len(html): + m = re.search(start, html[n:]) + if not m: break - if i < 0: - return '' - if not div: - return re.search(r'[-+]?\d*\.\d+|\d+', html[i+l:i+l+50]).group() - n = html[i+l:].find('</div>') - if n < 0: + i = m.end() + m = re.search(end, html[n+i:]) + if not m: + break + j = m.start() + str = html[n+i:n+i+j] + if end == 'ms': + num = re.search(r'[-+]?\d*\.\d+|\d+', str) + str = num.group() if num else 'NaN' + if firstonly: + return str + out.append(str) + n += i+j + if firstonly: return '' - return html[i+l:i+l+n] + return out # Function: runSummary # Description: # create a summary of tests in a sub-directory -def runSummary(subdir, local=True): +def runSummary(subdir, local=True, genhtml=False): inpath = os.path.abspath(subdir) outpath = inpath if local: outpath = os.path.abspath('.') print('Generating a summary of folder "%s"' % inpath) + if genhtml: + for dirname, dirnames, filenames in os.walk(subdir): + sysvals.dmesgfile = sysvals.ftracefile = sysvals.htmlfile = '' + for filename in filenames: + if(re.match('.*_dmesg.txt', filename)): + sysvals.dmesgfile = os.path.join(dirname, filename) + elif(re.match('.*_ftrace.txt', filename)): + sysvals.ftracefile = os.path.join(dirname, filename) + sysvals.setOutputFile() + if sysvals.ftracefile and sysvals.htmlfile and \ + not os.path.exists(sysvals.htmlfile): + print('FTRACE: %s' % sysvals.ftracefile) + if sysvals.dmesgfile: + print('DMESG : %s' % sysvals.dmesgfile) + rerunTest() testruns = [] for dirname, dirnames, filenames in os.walk(subdir): for filename in filenames: if(not re.match('.*.html', filename)): continue file = os.path.join(dirname, filename) - html = open(file, 'r').read(10000) - suspend = find_in_html(html, - ['Kernel Suspend: ', 'Kernel Suspend Time: ']) - resume = find_in_html(html, - ['Kernel Resume: ', 'Kernel Resume Time: ']) - line = find_in_html(html, ['<div class="stamp">'], True) + html = open(file, 'r').read() + suspend = find_in_html(html, 'Kernel Suspend', 'ms') + resume = find_in_html(html, 'Kernel Resume', 'ms') + line = find_in_html(html, '<div class="stamp">', '</div>') stmp = line.split() - if not suspend or not resume or len(stmp) < 4: + if not suspend or not resume or len(stmp) != 8: continue + try: + dt = datetime.strptime(' '.join(stmp[3:]), '%B %d %Y, %I:%M:%S %p') + except: + continue + tstr = dt.strftime('%Y/%m/%d %H:%M:%S') + error = find_in_html(html, '<table class="testfail"><tr><td>', '</td>') + result = 'fail' if error else 'pass' + ilist = [] + e = find_in_html(html, 'class="err"[\w=":;\.%\- ]*>', '→</div>', False) + for i in list(set(e)): + ilist.append('%sx%d' % (i, e.count(i)) if e.count(i) > 1 else i) data = { + 'mode': stmp[2], 'host': stmp[0], 'kernel': stmp[1], - 'mode': stmp[2], - 'time': string.join(stmp[3:], ' '), + 'time': tstr, + 'result': result, + 'issues': ','.join(ilist), 'suspend': suspend, 'resume': resume, 'url': os.path.relpath(file, outpath), } - if len(stmp) == 7: - data['kernel'] = 'unknown' - data['mode'] = stmp[1] - data['time'] = string.join(stmp[2:], ' ') testruns.append(data) outfile = os.path.join(outpath, 'summary.html') print('Summary file: %s' % outfile) @@ -5609,11 +5728,12 @@ def printHelp(): print(' -modes List available suspend modes') print(' -status Test to see if the system is enabled to run this tool') print(' -fpdt Print out the contents of the ACPI Firmware Performance Data Table') + print(' -battery Print out battery info (if available)') print(' -sysinfo Print out system info extracted from BIOS') print(' -devinfo Print out the pm settings of all devices which support runtime suspend') print(' -flist Print the list of functions currently being captured in ftrace') print(' -flistall Print all functions capable of being captured in ftrace') - print(' -summary directory Create a summary of all test in this dir') + print(' -summary dir Create a summary of tests in this dir [-genhtml builds missing html]') print(' [redo]') print(' -ftrace ftracefile Create HTML output using ftrace input (used with -dmesg)') print(' -dmesg dmesgfile Create HTML output using dmesg (used with -ftrace)') @@ -5623,8 +5743,9 @@ def printHelp(): # ----------------- MAIN -------------------- # exec start (skipped if script is loaded as library) if __name__ == '__main__': + genhtml = False cmd = '' - simplecmds = ['-sysinfo', '-modes', '-fpdt', '-flist', '-flistall', '-devinfo', '-status'] + simplecmds = ['-sysinfo', '-modes', '-fpdt', '-flist', '-flistall', '-devinfo', '-status', '-battery'] if '-f' in sys.argv: sysvals.cgskip = sysvals.configFile('cgskip.txt') # loop through the command line arguments @@ -5660,6 +5781,8 @@ if __name__ == '__main__': sysvals.skiphtml = True elif(arg == '-cgdump'): sysvals.cgdump = True + elif(arg == '-genhtml'): + genhtml = True elif(arg == '-addlogs'): sysvals.dmesglog = sysvals.ftracelog = True elif(arg == '-verbose'): @@ -5856,6 +5979,8 @@ if __name__ == '__main__': statusCheck(True) elif(cmd == 'fpdt'): getFPDT(True) + elif(cmd == 'battery'): + print 'AC Connect: %s\nCharge: %d' % getBattery() elif(cmd == 'sysinfo'): sysvals.printSystemInfo(True) elif(cmd == 'devinfo'): @@ -5867,7 +5992,7 @@ if __name__ == '__main__': elif(cmd == 'flistall'): sysvals.getFtraceFilterFunctions(False) elif(cmd == 'summary'): - runSummary(sysvals.outdir, True) + runSummary(sysvals.outdir, True, genhtml) sys.exit() # if instructed, re-analyze existing data files @@ -5920,7 +6045,7 @@ if __name__ == '__main__': print('TEST (%d/%d) COMPLETE' % (i+1, sysvals.multitest['count'])) sysvals.logmsg = '' if not sysvals.skiphtml: - runSummary(sysvals.outdir, False) + runSummary(sysvals.outdir, False, False) sysvals.sudouser(sysvals.outdir) else: if sysvals.outdir: diff --git a/tools/power/x86/intel_pstate_tracer/intel_pstate_tracer.py b/tools/power/x86/intel_pstate_tracer/intel_pstate_tracer.py index 29f50d4cfea0..84e2b648e622 100755 --- a/tools/power/x86/intel_pstate_tracer/intel_pstate_tracer.py +++ b/tools/power/x86/intel_pstate_tracer/intel_pstate_tracer.py @@ -28,6 +28,7 @@ import subprocess import os import time import re +import signal import sys import getopt import Gnuplot @@ -78,11 +79,12 @@ def print_help(): print(' Or') print(' ./intel_pstate_tracer.py [--cpu cpus] ---trace_file <trace_file> --name <test_name>') print(' To generate trace file, parse and plot, use (sudo required):') - print(' sudo ./intel_pstate_tracer.py [-c cpus] -i <interval> -n <test_name>') + print(' sudo ./intel_pstate_tracer.py [-c cpus] -i <interval> -n <test_name> -m <kbytes>') print(' Or') - print(' sudo ./intel_pstate_tracer.py [--cpu cpus] --interval <interval> --name <test_name>') + print(' sudo ./intel_pstate_tracer.py [--cpu cpus] --interval <interval> --name <test_name> --memory <kbytes>') print(' Optional argument:') - print(' cpus: comma separated list of CPUs') + print(' cpus: comma separated list of CPUs') + print(' kbytes: Kilo bytes of memory per CPU to allocate to the trace buffer. Default: 10240') print(' Output:') print(' If not already present, creates a "results/test_name" folder in the current working directory with:') print(' cpu.csv - comma seperated values file with trace contents and some additional calculations.') @@ -379,7 +381,7 @@ def clear_trace_file(): f_handle.close() except: print('IO error clearing trace file ') - quit() + sys.exit(2) def enable_trace(): """ Enable trace """ @@ -389,7 +391,7 @@ def enable_trace(): , 'w').write("1") except: print('IO error enabling trace ') - quit() + sys.exit(2) def disable_trace(): """ Disable trace """ @@ -399,17 +401,17 @@ def disable_trace(): , 'w').write("0") except: print('IO error disabling trace ') - quit() + sys.exit(2) def set_trace_buffer_size(): """ Set trace buffer size """ try: - open('/sys/kernel/debug/tracing/buffer_size_kb' - , 'w').write("10240") + with open('/sys/kernel/debug/tracing/buffer_size_kb', 'w') as fp: + fp.write(memory) except: - print('IO error setting trace buffer size ') - quit() + print('IO error setting trace buffer size ') + sys.exit(2) def free_trace_buffer(): """ Free the trace buffer memory """ @@ -418,8 +420,8 @@ def free_trace_buffer(): open('/sys/kernel/debug/tracing/buffer_size_kb' , 'w').write("1") except: - print('IO error setting trace buffer size ') - quit() + print('IO error freeing trace buffer ') + sys.exit(2) def read_trace_data(filename): """ Read and parse trace data """ @@ -431,7 +433,7 @@ def read_trace_data(filename): data = open(filename, 'r').read() except: print('Error opening ', filename) - quit() + sys.exit(2) for line in data.splitlines(): search_obj = \ @@ -489,10 +491,22 @@ def read_trace_data(filename): # Now seperate the main overall csv file into per CPU csv files. split_csv() +def signal_handler(signal, frame): + print(' SIGINT: Forcing cleanup before exit.') + if interval: + disable_trace() + clear_trace_file() + # Free the memory + free_trace_buffer() + sys.exit(0) + +signal.signal(signal.SIGINT, signal_handler) + interval = "" filename = "" cpu_list = "" testname = "" +memory = "10240" graph_data_present = False; valid1 = False @@ -501,7 +515,7 @@ valid2 = False cpu_mask = zeros((MAX_CPUS,), dtype=int) try: - opts, args = getopt.getopt(sys.argv[1:],"ht:i:c:n:",["help","trace_file=","interval=","cpu=","name="]) + opts, args = getopt.getopt(sys.argv[1:],"ht:i:c:n:m:",["help","trace_file=","interval=","cpu=","name=","memory="]) except getopt.GetoptError: print_help() sys.exit(2) @@ -521,6 +535,8 @@ for opt, arg in opts: elif opt in ("-n", "--name"): valid2 = True testname = arg + elif opt in ("-m", "--memory"): + memory = arg if not (valid1 and valid2): print_help() @@ -569,6 +585,11 @@ current_max_cpu = 0 read_trace_data(filename) +clear_trace_file() +# Free the memory +if interval: + free_trace_buffer() + if graph_data_present == False: print('No valid data to plot') sys.exit(2) @@ -593,9 +614,4 @@ for root, dirs, files in os.walk('.'): for f in files: fix_ownership(f) -clear_trace_file() -# Free the memory -if interval: - free_trace_buffer() - os.chdir('../../') diff --git a/tools/power/x86/turbostat/Makefile b/tools/power/x86/turbostat/Makefile index a9bc914a8fe8..2ab25aa38263 100644 --- a/tools/power/x86/turbostat/Makefile +++ b/tools/power/x86/turbostat/Makefile @@ -25,4 +25,4 @@ install : turbostat install -d $(DESTDIR)$(PREFIX)/bin install $(BUILD_OUTPUT)/turbostat $(DESTDIR)$(PREFIX)/bin/turbostat install -d $(DESTDIR)$(PREFIX)/share/man/man8 - install turbostat.8 $(DESTDIR)$(PREFIX)/share/man/man8 + install -m 644 turbostat.8 $(DESTDIR)$(PREFIX)/share/man/man8 diff --git a/tools/power/x86/turbostat/turbostat.8 b/tools/power/x86/turbostat/turbostat.8 index ccf2a69365cc..ca9ef7017624 100644 --- a/tools/power/x86/turbostat/turbostat.8 +++ b/tools/power/x86/turbostat/turbostat.8 @@ -54,9 +54,12 @@ name as necessary to disambiguate it from others is necessary. Note that option .PP \fB--cpu cpu-set\fP limit output to system summary plus the specified cpu-set. If cpu-set is the string "core", then the system summary plus the first CPU in each core are printed -- eg. subsequent HT siblings are not printed. Or if cpu-set is the string "package", then the system summary plus the first CPU in each package is printed. Otherwise, the system summary plus the specified set of CPUs are printed. The cpu-set is ordered from low to high, comma delimited with ".." and "-" permitted to denote a range. eg. 1,2,8,14..17,21-44 .PP -\fB--hide column\fP do not show the specified columns. May be invoked multiple times, or with a comma-separated list of column names. Use "--hide sysfs" to hide the sysfs statistics columns as a group. +\fB--hide column\fP do not show the specified built-in columns. May be invoked multiple times, or with a comma-separated list of column names. Use "--hide sysfs" to hide the sysfs statistics columns as a group. .PP -\fB--show column\fP show only the specified columns. May be invoked multiple times, or with a comma-separated list of column names. Use "--show sysfs" to show the sysfs statistics columns as a group. +\fB--enable column\fP show the specified built-in columns, which are otherwise disabled, by default. Currently the only built-in counters disabled by default are "usec" and "Time_Of_Day_Seconds". +The column name "all" can be used to enable all disabled-by-default built-in counters. +.PP +\fB--show column\fP show only the specified built-in columns. May be invoked multiple times, or with a comma-separated list of column names. Use "--show sysfs" to show the sysfs statistics columns as a group. .PP \fB--Dump\fP displays the raw counter values. .PP @@ -64,6 +67,8 @@ name as necessary to disambiguate it from others is necessary. Note that option .PP \fB--interval seconds\fP overrides the default 5.0 second measurement interval. .PP +\fB--num_iterations num\fP number of the measurement iterations. +.PP \fB--out output_file\fP turbostat output is written to the specified output_file. The file is truncated if it already exists, and it is created if it does not exist. .PP @@ -86,6 +91,8 @@ displays the statistics gathered since it was forked. The system configuration dump (if --quiet is not used) is followed by statistics. The first row of the statistics labels the content of each column (below). The second row of statistics is the system summary line. The system summary line has a '-' in the columns for the Package, Core, and CPU. The contents of the system summary line depends on the type of column. Columns that count items (eg. IRQ) show the sum across all CPUs in the system. Columns that show a percentage show the average across all CPUs in the system. Columns that dump raw MSR values simply show 0 in the summary. After the system summary row, each row describes a specific Package/Core/CPU. Note that if the --cpu parameter is used to limit which specific CPUs are displayed, turbostat will still collect statistics for all CPUs in the system and will still show the system summary for all CPUs in the system. .SH COLUMN DESCRIPTIONS .nf +\fBusec\fP For each CPU, the number of microseconds elapsed during counter collection, including thread migration -- if any. This counter is disabled by default, and is enabled with "--enable usec", or --debug. On the summary row, usec refers to the total elapsed time to collect the counters on all cpus. +\fBTime_Of_Day_Seconds\fP For each CPU, the gettimeofday(2) value (seconds.subsec since Epoch) when the counters ending the measurement interval were collected. This column is disabled by default, and can be enabled with "--enable Time_Of_Day_Seconds" or "--debug". On the summary row, Time_Of_Day_Seconds refers to the timestamp following collection of counters on the last CPU. \fBCore\fP processor core number. Note that multiple CPUs per core indicate support for Intel(R) Hyper-Threading Technology (HT). \fBCPU\fP Linux CPU (logical processor) number. Yes, it is okay that on many systems the CPUs are not listed in numerical order -- for efficiency reasons, turbostat runs in topology order, so HT siblings appear together. \fBPackage\fP processor package number -- not present on systems with a single processor package. @@ -262,6 +269,21 @@ CPU PRF_CTRL .fi +.SH INPUT + +For interval-mode, turbostat will immediately end the current interval +when it sees a newline on standard input. +turbostat will then start the next interval. +Control-C will be send a SIGINT to turbostat, +which will immediately abort the program with no further processing. +.SH SIGNALS + +SIGINT will interrupt interval-mode. +The end-of-interval data will be collected and displayed before turbostat exits. + +SIGUSR1 will end current interval, +end-of-interval data will be collected and displayed before turbostat +starts a new interval. .SH NOTES .B "turbostat " diff --git a/tools/power/x86/turbostat/turbostat.c b/tools/power/x86/turbostat/turbostat.c index bd9c6b31a504..d6cff3070ebd 100644 --- a/tools/power/x86/turbostat/turbostat.c +++ b/tools/power/x86/turbostat/turbostat.c @@ -29,6 +29,7 @@ #include <sys/types.h> #include <sys/wait.h> #include <sys/stat.h> +#include <sys/select.h> #include <sys/resource.h> #include <fcntl.h> #include <signal.h> @@ -47,9 +48,13 @@ char *proc_stat = "/proc/stat"; FILE *outf; int *fd_percpu; +struct timeval interval_tv = {5, 0}; struct timespec interval_ts = {5, 0}; +struct timespec one_msec = {0, 1000000}; +unsigned int num_iterations; unsigned int debug; unsigned int quiet; +unsigned int shown; unsigned int sums_need_wide_columns; unsigned int rapl_joules; unsigned int summary_only; @@ -58,6 +63,7 @@ unsigned int dump_only; unsigned int do_snb_cstates; unsigned int do_knl_cstates; unsigned int do_slm_cstates; +unsigned int do_cnl_cstates; unsigned int use_c1_residency_msr; unsigned int has_aperf; unsigned int has_epb; @@ -80,6 +86,8 @@ unsigned int do_rapl; unsigned int do_dts; unsigned int do_ptm; unsigned long long gfx_cur_rc6_ms; +unsigned long long cpuidle_cur_cpu_lpi_us; +unsigned long long cpuidle_cur_sys_lpi_us; unsigned int gfx_cur_mhz; unsigned int tcc_activation_temp; unsigned int tcc_activation_temp_override; @@ -87,6 +95,7 @@ double rapl_power_units, rapl_time_units; double rapl_dram_energy_units, rapl_energy_units; double rapl_joule_counter_range; unsigned int do_core_perf_limit_reasons; +unsigned int has_automatic_cstate_conversion; unsigned int do_gfx_perf_limit_reasons; unsigned int do_ring_perf_limit_reasons; unsigned int crystal_hz; @@ -147,7 +156,9 @@ char *progname; #define CPU_SUBSET_MAXCPUS 1024 /* need to use before probe... */ cpu_set_t *cpu_present_set, *cpu_affinity_set, *cpu_subset; size_t cpu_present_setsize, cpu_affinity_setsize, cpu_subset_size; -#define MAX_ADDED_COUNTERS 16 +#define MAX_ADDED_COUNTERS 8 +#define MAX_ADDED_THREAD_COUNTERS 24 +#define BITMASK_SIZE 32 struct thread_data { struct timeval tv_begin; @@ -162,7 +173,7 @@ struct thread_data { unsigned int flags; #define CPU_IS_FIRST_THREAD_IN_CORE 0x2 #define CPU_IS_FIRST_CORE_IN_PACKAGE 0x4 - unsigned long long counter[MAX_ADDED_COUNTERS]; + unsigned long long counter[MAX_ADDED_THREAD_COUNTERS]; } *thread_even, *thread_odd; struct core_data { @@ -183,6 +194,8 @@ struct pkg_data { unsigned long long pc8; unsigned long long pc9; unsigned long long pc10; + unsigned long long cpu_lpi; + unsigned long long sys_lpi; unsigned long long pkg_wtd_core_c0; unsigned long long pkg_any_core_c0; unsigned long long pkg_any_gfxe_c0; @@ -203,12 +216,21 @@ struct pkg_data { #define ODD_COUNTERS thread_odd, core_odd, package_odd #define EVEN_COUNTERS thread_even, core_even, package_even -#define GET_THREAD(thread_base, thread_no, core_no, pkg_no) \ - (thread_base + (pkg_no) * topo.num_cores_per_pkg * \ - topo.num_threads_per_core + \ - (core_no) * topo.num_threads_per_core + (thread_no)) -#define GET_CORE(core_base, core_no, pkg_no) \ - (core_base + (pkg_no) * topo.num_cores_per_pkg + (core_no)) +#define GET_THREAD(thread_base, thread_no, core_no, node_no, pkg_no) \ + ((thread_base) + \ + ((pkg_no) * \ + topo.nodes_per_pkg * topo.cores_per_node * topo.threads_per_core) + \ + ((node_no) * topo.cores_per_node * topo.threads_per_core) + \ + ((core_no) * topo.threads_per_core) + \ + (thread_no)) + +#define GET_CORE(core_base, core_no, node_no, pkg_no) \ + ((core_base) + \ + ((pkg_no) * topo.nodes_per_pkg * topo.cores_per_node) + \ + ((node_no) * topo.cores_per_node) + \ + (core_no)) + + #define GET_PKG(pkg_base, pkg_no) (pkg_base + pkg_no) enum counter_scope {SCOPE_CPU, SCOPE_CORE, SCOPE_PACKAGE}; @@ -244,14 +266,25 @@ struct system_summary { struct pkg_data packages; } average; +struct cpu_topology { + int physical_package_id; + int logical_cpu_id; + int physical_node_id; + int logical_node_id; /* 0-based count within the package */ + int physical_core_id; + int thread_id; + cpu_set_t *put_ids; /* Processing Unit/Thread IDs */ +} *cpus; struct topo_params { int num_packages; int num_cpus; int num_cores; int max_cpu_num; - int num_cores_per_pkg; - int num_threads_per_core; + int max_node_num; + int nodes_per_pkg; + int cores_per_node; + int threads_per_core; } topo; struct timeval tv_even, tv_odd, tv_delta; @@ -273,27 +306,33 @@ int cpu_is_not_present(int cpu) int for_all_cpus(int (func)(struct thread_data *, struct core_data *, struct pkg_data *), struct thread_data *thread_base, struct core_data *core_base, struct pkg_data *pkg_base) { - int retval, pkg_no, core_no, thread_no; + int retval, pkg_no, core_no, thread_no, node_no; for (pkg_no = 0; pkg_no < topo.num_packages; ++pkg_no) { - for (core_no = 0; core_no < topo.num_cores_per_pkg; ++core_no) { - for (thread_no = 0; thread_no < - topo.num_threads_per_core; ++thread_no) { - struct thread_data *t; - struct core_data *c; - struct pkg_data *p; - - t = GET_THREAD(thread_base, thread_no, core_no, pkg_no); - - if (cpu_is_not_present(t->cpu_id)) - continue; - - c = GET_CORE(core_base, core_no, pkg_no); - p = GET_PKG(pkg_base, pkg_no); - - retval = func(t, c, p); - if (retval) - return retval; + for (core_no = 0; core_no < topo.cores_per_node; ++core_no) { + for (node_no = 0; node_no < topo.nodes_per_pkg; + node_no++) { + for (thread_no = 0; thread_no < + topo.threads_per_core; ++thread_no) { + struct thread_data *t; + struct core_data *c; + struct pkg_data *p; + + t = GET_THREAD(thread_base, thread_no, + core_no, node_no, + pkg_no); + + if (cpu_is_not_present(t->cpu_id)) + continue; + + c = GET_CORE(core_base, core_no, + node_no, pkg_no); + p = GET_PKG(pkg_base, pkg_no); + + retval = func(t, c, p); + if (retval) + return retval; + } } } } @@ -346,6 +385,8 @@ int get_msr(int cpu, off_t offset, unsigned long long *msr) * Thus, strings that are proper sub-sets must follow their more specific peers. */ struct msr_counter bic[] = { + { 0x0, "usec" }, + { 0x0, "Time_Of_Day_Seconds" }, { 0x0, "Package" }, { 0x0, "Avg_MHz" }, { 0x0, "Bzy_MHz" }, @@ -369,7 +410,9 @@ struct msr_counter bic[] = { { 0x0, "Pkg%pc7" }, { 0x0, "Pkg%pc8" }, { 0x0, "Pkg%pc9" }, - { 0x0, "Pkg%pc10" }, + { 0x0, "Pk%pc10" }, + { 0x0, "CPU%LPI" }, + { 0x0, "SYS%LPI" }, { 0x0, "PkgWatt" }, { 0x0, "CorWatt" }, { 0x0, "GFXWatt" }, @@ -389,62 +432,72 @@ struct msr_counter bic[] = { { 0x0, "Any%C0" }, { 0x0, "GFX%C0" }, { 0x0, "CPUGFX%" }, + { 0x0, "Node%" }, }; #define MAX_BIC (sizeof(bic) / sizeof(struct msr_counter)) -#define BIC_Package (1ULL << 0) -#define BIC_Avg_MHz (1ULL << 1) -#define BIC_Bzy_MHz (1ULL << 2) -#define BIC_TSC_MHz (1ULL << 3) -#define BIC_IRQ (1ULL << 4) -#define BIC_SMI (1ULL << 5) -#define BIC_Busy (1ULL << 6) -#define BIC_CPU_c1 (1ULL << 7) -#define BIC_CPU_c3 (1ULL << 8) -#define BIC_CPU_c6 (1ULL << 9) -#define BIC_CPU_c7 (1ULL << 10) -#define BIC_ThreadC (1ULL << 11) -#define BIC_CoreTmp (1ULL << 12) -#define BIC_CoreCnt (1ULL << 13) -#define BIC_PkgTmp (1ULL << 14) -#define BIC_GFX_rc6 (1ULL << 15) -#define BIC_GFXMHz (1ULL << 16) -#define BIC_Pkgpc2 (1ULL << 17) -#define BIC_Pkgpc3 (1ULL << 18) -#define BIC_Pkgpc6 (1ULL << 19) -#define BIC_Pkgpc7 (1ULL << 20) -#define BIC_Pkgpc8 (1ULL << 21) -#define BIC_Pkgpc9 (1ULL << 22) -#define BIC_Pkgpc10 (1ULL << 23) -#define BIC_PkgWatt (1ULL << 24) -#define BIC_CorWatt (1ULL << 25) -#define BIC_GFXWatt (1ULL << 26) -#define BIC_PkgCnt (1ULL << 27) -#define BIC_RAMWatt (1ULL << 28) -#define BIC_PKG__ (1ULL << 29) -#define BIC_RAM__ (1ULL << 30) -#define BIC_Pkg_J (1ULL << 31) -#define BIC_Cor_J (1ULL << 32) -#define BIC_GFX_J (1ULL << 33) -#define BIC_RAM_J (1ULL << 34) -#define BIC_Core (1ULL << 35) -#define BIC_CPU (1ULL << 36) -#define BIC_Mod_c6 (1ULL << 37) -#define BIC_sysfs (1ULL << 38) -#define BIC_Totl_c0 (1ULL << 39) -#define BIC_Any_c0 (1ULL << 40) -#define BIC_GFX_c0 (1ULL << 41) -#define BIC_CPUGFX (1ULL << 42) - -unsigned long long bic_enabled = 0xFFFFFFFFFFFFFFFFULL; -unsigned long long bic_present = BIC_sysfs; +#define BIC_USEC (1ULL << 0) +#define BIC_TOD (1ULL << 1) +#define BIC_Package (1ULL << 2) +#define BIC_Avg_MHz (1ULL << 3) +#define BIC_Bzy_MHz (1ULL << 4) +#define BIC_TSC_MHz (1ULL << 5) +#define BIC_IRQ (1ULL << 6) +#define BIC_SMI (1ULL << 7) +#define BIC_Busy (1ULL << 8) +#define BIC_CPU_c1 (1ULL << 9) +#define BIC_CPU_c3 (1ULL << 10) +#define BIC_CPU_c6 (1ULL << 11) +#define BIC_CPU_c7 (1ULL << 12) +#define BIC_ThreadC (1ULL << 13) +#define BIC_CoreTmp (1ULL << 14) +#define BIC_CoreCnt (1ULL << 15) +#define BIC_PkgTmp (1ULL << 16) +#define BIC_GFX_rc6 (1ULL << 17) +#define BIC_GFXMHz (1ULL << 18) +#define BIC_Pkgpc2 (1ULL << 19) +#define BIC_Pkgpc3 (1ULL << 20) +#define BIC_Pkgpc6 (1ULL << 21) +#define BIC_Pkgpc7 (1ULL << 22) +#define BIC_Pkgpc8 (1ULL << 23) +#define BIC_Pkgpc9 (1ULL << 24) +#define BIC_Pkgpc10 (1ULL << 25) +#define BIC_CPU_LPI (1ULL << 26) +#define BIC_SYS_LPI (1ULL << 27) +#define BIC_PkgWatt (1ULL << 26) +#define BIC_CorWatt (1ULL << 27) +#define BIC_GFXWatt (1ULL << 28) +#define BIC_PkgCnt (1ULL << 29) +#define BIC_RAMWatt (1ULL << 30) +#define BIC_PKG__ (1ULL << 31) +#define BIC_RAM__ (1ULL << 32) +#define BIC_Pkg_J (1ULL << 33) +#define BIC_Cor_J (1ULL << 34) +#define BIC_GFX_J (1ULL << 35) +#define BIC_RAM_J (1ULL << 36) +#define BIC_Core (1ULL << 37) +#define BIC_CPU (1ULL << 38) +#define BIC_Mod_c6 (1ULL << 39) +#define BIC_sysfs (1ULL << 40) +#define BIC_Totl_c0 (1ULL << 41) +#define BIC_Any_c0 (1ULL << 42) +#define BIC_GFX_c0 (1ULL << 43) +#define BIC_CPUGFX (1ULL << 44) +#define BIC_Node (1ULL << 45) + +#define BIC_DISABLED_BY_DEFAULT (BIC_USEC | BIC_TOD) + +unsigned long long bic_enabled = (0xFFFFFFFFFFFFFFFFULL & ~BIC_DISABLED_BY_DEFAULT); +unsigned long long bic_present = BIC_USEC | BIC_TOD | BIC_sysfs; #define DO_BIC(COUNTER_NAME) (bic_enabled & bic_present & COUNTER_NAME) +#define ENABLE_BIC(COUNTER_NAME) (bic_enabled |= COUNTER_NAME) #define BIC_PRESENT(COUNTER_BIT) (bic_present |= COUNTER_BIT) #define BIC_NOT_PRESENT(COUNTER_BIT) (bic_present &= ~COUNTER_BIT) + #define MAX_DEFERRED 16 char *deferred_skip_names[MAX_DEFERRED]; int deferred_skip_index; @@ -469,9 +522,10 @@ void help(void) "--cpu cpu-set limit output to summary plus cpu-set:\n" " {core | package | j,k,l..m,n-p }\n" "--quiet skip decoding system configuration header\n" - "--interval sec Override default 5-second measurement interval\n" + "--interval sec.subsec Override default 5-second measurement interval\n" "--help print this help message\n" "--list list column headers only\n" + "--num_iterations num number of the measurement iterations\n" "--out file create or truncate \"file\" for all output\n" "--version print version information\n" "\n" @@ -496,6 +550,9 @@ unsigned long long bic_lookup(char *name_list, enum show_hide_mode mode) if (comma) *comma = '\0'; + if (!strcmp(name_list, "all")) + return ~0; + for (i = 0; i < MAX_BIC; ++i) { if (!strcmp(name_list, bic[i].name)) { retval |= (1ULL << i); @@ -532,10 +589,14 @@ void print_header(char *delim) struct msr_counter *mp; int printed = 0; - if (debug) - outp += sprintf(outp, "usec %s", delim); + if (DO_BIC(BIC_USEC)) + outp += sprintf(outp, "%susec", (printed++ ? delim : "")); + if (DO_BIC(BIC_TOD)) + outp += sprintf(outp, "%sTime_Of_Day_Seconds", (printed++ ? delim : "")); if (DO_BIC(BIC_Package)) outp += sprintf(outp, "%sPackage", (printed++ ? delim : "")); + if (DO_BIC(BIC_Node)) + outp += sprintf(outp, "%sNode", (printed++ ? delim : "")); if (DO_BIC(BIC_Core)) outp += sprintf(outp, "%sCore", (printed++ ? delim : "")); if (DO_BIC(BIC_CPU)) @@ -576,7 +637,7 @@ void print_header(char *delim) if (DO_BIC(BIC_CPU_c1)) outp += sprintf(outp, "%sCPU%%c1", (printed++ ? delim : "")); - if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates) + if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates && !do_cnl_cstates) outp += sprintf(outp, "%sCPU%%c3", (printed++ ? delim : "")); if (DO_BIC(BIC_CPU_c6)) outp += sprintf(outp, "%sCPU%%c6", (printed++ ? delim : "")); @@ -635,6 +696,10 @@ void print_header(char *delim) outp += sprintf(outp, "%sPkg%%pc9", (printed++ ? delim : "")); if (DO_BIC(BIC_Pkgpc10)) outp += sprintf(outp, "%sPk%%pc10", (printed++ ? delim : "")); + if (DO_BIC(BIC_CPU_LPI)) + outp += sprintf(outp, "%sCPU%%LPI", (printed++ ? delim : "")); + if (DO_BIC(BIC_SYS_LPI)) + outp += sprintf(outp, "%sSYS%%LPI", (printed++ ? delim : "")); if (do_rapl && !rapl_joules) { if (DO_BIC(BIC_PkgWatt)) @@ -739,6 +804,9 @@ int dump_counters(struct thread_data *t, struct core_data *c, outp += sprintf(outp, "pc8: %016llX\n", p->pc8); outp += sprintf(outp, "pc9: %016llX\n", p->pc9); outp += sprintf(outp, "pc10: %016llX\n", p->pc10); + outp += sprintf(outp, "pc10: %016llX\n", p->pc10); + outp += sprintf(outp, "cpu_lpi: %016llX\n", p->cpu_lpi); + outp += sprintf(outp, "sys_lpi: %016llX\n", p->sys_lpi); outp += sprintf(outp, "Joules PKG: %0X\n", p->energy_pkg); outp += sprintf(outp, "Joules COR: %0X\n", p->energy_cores); outp += sprintf(outp, "Joules GFX: %0X\n", p->energy_gfx); @@ -786,7 +854,7 @@ int format_counters(struct thread_data *t, struct core_data *c, (cpu_subset && !CPU_ISSET_S(t->cpu_id, cpu_subset_size, cpu_subset))) return 0; - if (debug) { + if (DO_BIC(BIC_USEC)) { /* on each row, print how many usec each timestamp took to gather */ struct timeval tv; @@ -794,6 +862,10 @@ int format_counters(struct thread_data *t, struct core_data *c, outp += sprintf(outp, "%5ld\t", tv.tv_sec * 1000000 + tv.tv_usec); } + /* Time_Of_Day_Seconds: on each row, print sec.usec last timestamp taken */ + if (DO_BIC(BIC_TOD)) + outp += sprintf(outp, "%10ld.%06ld\t", t->tv_end.tv_sec, t->tv_end.tv_usec); + interval_float = tv_delta.tv_sec + tv_delta.tv_usec/1000000.0; tsc = t->tsc * tsc_tweak; @@ -802,6 +874,8 @@ int format_counters(struct thread_data *t, struct core_data *c, if (t == &average.threads) { if (DO_BIC(BIC_Package)) outp += sprintf(outp, "%s-", (printed++ ? delim : "")); + if (DO_BIC(BIC_Node)) + outp += sprintf(outp, "%s-", (printed++ ? delim : "")); if (DO_BIC(BIC_Core)) outp += sprintf(outp, "%s-", (printed++ ? delim : "")); if (DO_BIC(BIC_CPU)) @@ -813,6 +887,15 @@ int format_counters(struct thread_data *t, struct core_data *c, else outp += sprintf(outp, "%s-", (printed++ ? delim : "")); } + if (DO_BIC(BIC_Node)) { + if (t) + outp += sprintf(outp, "%s%d", + (printed++ ? delim : ""), + cpus[t->cpu_id].physical_node_id); + else + outp += sprintf(outp, "%s-", + (printed++ ? delim : "")); + } if (DO_BIC(BIC_Core)) { if (c) outp += sprintf(outp, "%s%d", (printed++ ? delim : ""), c->core_id); @@ -882,7 +965,7 @@ int format_counters(struct thread_data *t, struct core_data *c, if (!(t->flags & CPU_IS_FIRST_THREAD_IN_CORE)) goto done; - if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates) + if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates && !do_cnl_cstates) outp += sprintf(outp, "%s%.2f", (printed++ ? delim : ""), 100.0 * c->c3/tsc); if (DO_BIC(BIC_CPU_c6)) outp += sprintf(outp, "%s%.2f", (printed++ ? delim : ""), 100.0 * c->c6/tsc); @@ -959,6 +1042,11 @@ int format_counters(struct thread_data *t, struct core_data *c, if (DO_BIC(BIC_Pkgpc10)) outp += sprintf(outp, "%s%.2f", (printed++ ? delim : ""), 100.0 * p->pc10/tsc); + if (DO_BIC(BIC_CPU_LPI)) + outp += sprintf(outp, "%s%.2f", (printed++ ? delim : ""), 100.0 * p->cpu_lpi / 1000000.0 / interval_float); + if (DO_BIC(BIC_SYS_LPI)) + outp += sprintf(outp, "%s%.2f", (printed++ ? delim : ""), 100.0 * p->sys_lpi / 1000000.0 / interval_float); + /* * If measurement interval exceeds minimum RAPL Joule Counter range, * indicate that results are suspect by printing "**" in fraction place. @@ -1006,7 +1094,8 @@ int format_counters(struct thread_data *t, struct core_data *c, } done: - outp += sprintf(outp, "\n"); + if (*(outp - 1) != '\n') + outp += sprintf(outp, "\n"); return 0; } @@ -1083,6 +1172,8 @@ delta_package(struct pkg_data *new, struct pkg_data *old) old->pc8 = new->pc8 - old->pc8; old->pc9 = new->pc9 - old->pc9; old->pc10 = new->pc10 - old->pc10; + old->cpu_lpi = new->cpu_lpi - old->cpu_lpi; + old->sys_lpi = new->sys_lpi - old->sys_lpi; old->pkg_temp_c = new->pkg_temp_c; /* flag an error when rc6 counter resets/wraps */ @@ -1140,6 +1231,15 @@ delta_thread(struct thread_data *new, struct thread_data *old, int i; struct msr_counter *mp; + /* + * the timestamps from start of measurement interval are in "old" + * the timestamp from end of measurement interval are in "new" + * over-write old w/ new so we can print end of interval values + */ + + old->tv_begin = new->tv_begin; + old->tv_end = new->tv_end; + old->tsc = new->tsc - old->tsc; /* check for TSC < 1 Mcycles over interval */ @@ -1228,6 +1328,11 @@ void clear_counters(struct thread_data *t, struct core_data *c, struct pkg_data int i; struct msr_counter *mp; + t->tv_begin.tv_sec = 0; + t->tv_begin.tv_usec = 0; + t->tv_end.tv_sec = 0; + t->tv_end.tv_usec = 0; + t->tsc = 0; t->aperf = 0; t->mperf = 0; @@ -1260,6 +1365,8 @@ void clear_counters(struct thread_data *t, struct core_data *c, struct pkg_data p->pc8 = 0; p->pc9 = 0; p->pc10 = 0; + p->cpu_lpi = 0; + p->sys_lpi = 0; p->energy_pkg = 0; p->energy_dram = 0; @@ -1286,6 +1393,13 @@ int sum_counters(struct thread_data *t, struct core_data *c, int i; struct msr_counter *mp; + /* remember first tv_begin */ + if (average.threads.tv_begin.tv_sec == 0) + average.threads.tv_begin = t->tv_begin; + + /* remember last tv_end */ + average.threads.tv_end = t->tv_end; + average.threads.tsc += t->tsc; average.threads.aperf += t->aperf; average.threads.mperf += t->mperf; @@ -1341,6 +1455,9 @@ int sum_counters(struct thread_data *t, struct core_data *c, average.packages.pc9 += p->pc9; average.packages.pc10 += p->pc10; + average.packages.cpu_lpi = p->cpu_lpi; + average.packages.sys_lpi = p->sys_lpi; + average.packages.energy_pkg += p->energy_pkg; average.packages.energy_dram += p->energy_dram; average.packages.energy_cores += p->energy_cores; @@ -1487,7 +1604,7 @@ int get_mp(int cpu, struct msr_counter *mp, unsigned long long *counterp) if (get_msr(cpu, mp->msr_num, counterp)) return -1; } else { - char path[128]; + char path[128 + PATH_BYTES]; if (mp->flags & SYSFS_PERCPU) { sprintf(path, "/sys/devices/system/cpu/cpu%d/%s", @@ -1603,7 +1720,7 @@ retry: if (!(t->flags & CPU_IS_FIRST_THREAD_IN_CORE)) goto done; - if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates) { + if (DO_BIC(BIC_CPU_c3) && !do_slm_cstates && !do_knl_cstates && !do_cnl_cstates) { if (get_msr(cpu, MSR_CORE_C3_RESIDENCY, &c->c3)) return -6; } @@ -1684,6 +1801,11 @@ retry: if (get_msr(cpu, MSR_PKG_C10_RESIDENCY, &p->pc10)) return -13; + if (DO_BIC(BIC_CPU_LPI)) + p->cpu_lpi = cpuidle_cur_cpu_lpi_us; + if (DO_BIC(BIC_SYS_LPI)) + p->sys_lpi = cpuidle_cur_sys_lpi_us; + if (do_rapl & RAPL_PKG) { if (get_msr(cpu, MSR_PKG_ENERGY_STATUS, &msr)) return -13; @@ -1769,7 +1891,7 @@ int slv_pkg_cstate_limits[16] = {PCL__0, PCL__1, PCLRSV, PCLRSV, PCL__4, PCLRSV, int amt_pkg_cstate_limits[16] = {PCLUNL, PCL__1, PCL__2, PCLRSV, PCLRSV, PCLRSV, PCL__6, PCL__7, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV}; int phi_pkg_cstate_limits[16] = {PCL__0, PCL__2, PCL_6N, PCL_6R, PCLRSV, PCLRSV, PCLRSV, PCLUNL, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV}; int bxt_pkg_cstate_limits[16] = {PCL__0, PCL__2, PCLUNL, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV}; -int skx_pkg_cstate_limits[16] = {PCL__0, PCL__2, PCL_6N, PCL_6R, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLUNL, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV}; +int skx_pkg_cstate_limits[16] = {PCL__0, PCL__2, PCL_6N, PCL_6R, PCLRSV, PCLRSV, PCLRSV, PCLUNL, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV, PCLRSV}; static void @@ -2071,12 +2193,9 @@ dump_nhm_cst_cfg(void) get_msr(base_cpu, MSR_PKG_CST_CONFIG_CONTROL, &msr); -#define SNB_C1_AUTO_UNDEMOTE (1UL << 27) -#define SNB_C3_AUTO_UNDEMOTE (1UL << 28) - fprintf(outf, "cpu%d: MSR_PKG_CST_CONFIG_CONTROL: 0x%08llx", base_cpu, msr); - fprintf(outf, " (%s%s%s%s%slocked: pkg-cstate-limit=%d: %s)\n", + fprintf(outf, " (%s%s%s%s%slocked, pkg-cstate-limit=%d (%s)", (msr & SNB_C3_AUTO_UNDEMOTE) ? "UNdemote-C3, " : "", (msr & SNB_C1_AUTO_UNDEMOTE) ? "UNdemote-C1, " : "", (msr & NHM_C3_AUTO_DEMOTE) ? "demote-C3, " : "", @@ -2084,6 +2203,15 @@ dump_nhm_cst_cfg(void) (msr & (1 << 15)) ? "" : "UN", (unsigned int)msr & 0xF, pkg_cstate_limit_strings[pkg_cstate_limit]); + +#define AUTOMATIC_CSTATE_CONVERSION (1UL << 16) + if (has_automatic_cstate_conversion) { + fprintf(outf, ", automatic c-state conversion=%s", + (msr & AUTOMATIC_CSTATE_CONVERSION) ? "on" : "off"); + } + + fprintf(outf, ")\n"); + return; } @@ -2184,6 +2312,8 @@ void free_fd_percpu(void) void free_all_buffers(void) { + int i; + CPU_FREE(cpu_present_set); cpu_present_set = NULL; cpu_present_setsize = 0; @@ -2216,6 +2346,12 @@ void free_all_buffers(void) free(irq_column_2_cpu); free(irqs_per_cpu); + + for (i = 0; i <= topo.max_cpu_num; ++i) { + if (cpus[i].put_ids) + CPU_FREE(cpus[i].put_ids); + } + free(cpus); } @@ -2240,44 +2376,6 @@ int parse_int_file(const char *fmt, ...) } /* - * get_cpu_position_in_core(cpu) - * return the position of the CPU among its HT siblings in the core - * return -1 if the sibling is not in list - */ -int get_cpu_position_in_core(int cpu) -{ - char path[64]; - FILE *filep; - int this_cpu; - char character; - int i; - - sprintf(path, - "/sys/devices/system/cpu/cpu%d/topology/thread_siblings_list", - cpu); - filep = fopen(path, "r"); - if (filep == NULL) { - perror(path); - exit(1); - } - - for (i = 0; i < topo.num_threads_per_core; i++) { - fscanf(filep, "%d", &this_cpu); - if (this_cpu == cpu) { - fclose(filep); - return i; - } - - /* Account for no separator after last thread*/ - if (i != (topo.num_threads_per_core - 1)) - fscanf(filep, "%c", &character); - } - - fclose(filep); - return -1; -} - -/* * cpu_is_first_core_in_package(cpu) * return 1 if given CPU is 1st core in package */ @@ -2296,35 +2394,115 @@ int get_core_id(int cpu) return parse_int_file("/sys/devices/system/cpu/cpu%d/topology/core_id", cpu); } -int get_num_ht_siblings(int cpu) +void set_node_data(void) { char path[80]; FILE *filep; - int sib1; - int matches = 0; - char character; - char str[100]; - char *ch; + int pkg, node, cpu; - sprintf(path, "/sys/devices/system/cpu/cpu%d/topology/thread_siblings_list", cpu); - filep = fopen_or_die(path, "r"); + struct pkg_node_info { + int count; + int min; + } *pni; - /* - * file format: - * A ',' separated or '-' separated set of numbers - * (eg 1-2 or 1,3,4,5) - */ - fscanf(filep, "%d%c\n", &sib1, &character); - fseek(filep, 0, SEEK_SET); - fgets(str, 100, filep); - ch = strchr(str, character); - while (ch != NULL) { - matches++; - ch = strchr(ch+1, character); + pni = calloc(topo.num_packages, sizeof(struct pkg_node_info)); + if (!pni) + err(1, "calloc pkg_node_count"); + + for (pkg = 0; pkg < topo.num_packages; pkg++) + pni[pkg].min = topo.num_cpus; + + for (node = 0; node <= topo.max_node_num; node++) { + /* find the "first" cpu in the node */ + sprintf(path, "/sys/bus/node/devices/node%d/cpulist", node); + filep = fopen(path, "r"); + if (!filep) + continue; + fscanf(filep, "%d", &cpu); + fclose(filep); + + pkg = cpus[cpu].physical_package_id; + pni[pkg].count++; + + if (node < pni[pkg].min) + pni[pkg].min = node; } + for (pkg = 0; pkg < topo.num_packages; pkg++) + if (pni[pkg].count > topo.nodes_per_pkg) + topo.nodes_per_pkg = pni[0].count; + + for (cpu = 0; cpu < topo.num_cpus; cpu++) { + pkg = cpus[cpu].physical_package_id; + node = cpus[cpu].physical_node_id; + cpus[cpu].logical_node_id = node - pni[pkg].min; + } + free(pni); + +} + +int get_physical_node_id(struct cpu_topology *thiscpu) +{ + char path[80]; + FILE *filep; + int i; + int cpu = thiscpu->logical_cpu_id; + + for (i = 0; i <= topo.max_cpu_num; i++) { + sprintf(path, "/sys/devices/system/cpu/cpu%d/node%i/cpulist", + cpu, i); + filep = fopen(path, "r"); + if (!filep) + continue; + fclose(filep); + return i; + } + return -1; +} + +int get_thread_siblings(struct cpu_topology *thiscpu) +{ + char path[80], character; + FILE *filep; + unsigned long map; + int so, shift, sib_core; + int cpu = thiscpu->logical_cpu_id; + int offset = topo.max_cpu_num + 1; + size_t size; + int thread_id = 0; + + thiscpu->put_ids = CPU_ALLOC((topo.max_cpu_num + 1)); + if (thiscpu->thread_id < 0) + thiscpu->thread_id = thread_id++; + if (!thiscpu->put_ids) + return -1; + + size = CPU_ALLOC_SIZE((topo.max_cpu_num + 1)); + CPU_ZERO_S(size, thiscpu->put_ids); + + sprintf(path, + "/sys/devices/system/cpu/cpu%d/topology/thread_siblings", cpu); + filep = fopen_or_die(path, "r"); + do { + offset -= BITMASK_SIZE; + fscanf(filep, "%lx%c", &map, &character); + for (shift = 0; shift < BITMASK_SIZE; shift++) { + if ((map >> shift) & 0x1) { + so = shift + offset; + sib_core = get_core_id(so); + if (sib_core == thiscpu->physical_core_id) { + CPU_SET_S(so, size, thiscpu->put_ids); + if ((so != cpu) && + (cpus[so].thread_id < 0)) + cpus[so].thread_id = + thread_id++; + } + } + } + } while (!strncmp(&character, ",", 1)); fclose(filep); - return matches+1; + + return CPU_COUNT_S(size, thiscpu->put_ids); } /* @@ -2339,32 +2517,42 @@ int for_all_cpus_2(int (func)(struct thread_data *, struct core_data *, struct thread_data *thread_base2, struct core_data *core_base2, struct pkg_data *pkg_base2) { - int retval, pkg_no, core_no, thread_no; + int retval, pkg_no, node_no, core_no, thread_no; for (pkg_no = 0; pkg_no < topo.num_packages; ++pkg_no) { - for (core_no = 0; core_no < topo.num_cores_per_pkg; ++core_no) { - for (thread_no = 0; thread_no < - topo.num_threads_per_core; ++thread_no) { - struct thread_data *t, *t2; - struct core_data *c, *c2; - struct pkg_data *p, *p2; - - t = GET_THREAD(thread_base, thread_no, core_no, pkg_no); - - if (cpu_is_not_present(t->cpu_id)) - continue; - - t2 = GET_THREAD(thread_base2, thread_no, core_no, pkg_no); - - c = GET_CORE(core_base, core_no, pkg_no); - c2 = GET_CORE(core_base2, core_no, pkg_no); - - p = GET_PKG(pkg_base, pkg_no); - p2 = GET_PKG(pkg_base2, pkg_no); - - retval = func(t, c, p, t2, c2, p2); - if (retval) - return retval; + for (node_no = 0; node_no < topo.nodes_per_pkg; ++node_no) { + for (core_no = 0; core_no < topo.cores_per_node; + ++core_no) { + for (thread_no = 0; thread_no < + topo.threads_per_core; ++thread_no) { + struct thread_data *t, *t2; + struct core_data *c, *c2; + struct pkg_data *p, *p2; + + t = GET_THREAD(thread_base, thread_no, + core_no, node_no, + pkg_no); + + if (cpu_is_not_present(t->cpu_id)) + continue; + + t2 = GET_THREAD(thread_base2, thread_no, + core_no, node_no, + pkg_no); + + c = GET_CORE(core_base, core_no, + node_no, pkg_no); + c2 = GET_CORE(core_base2, core_no, + node_no, + pkg_no); + + p = GET_PKG(pkg_base, pkg_no); + p2 = GET_PKG(pkg_base2, pkg_no); + + retval = func(t, c, p, t2, c2, p2); + if (retval) + return retval; + } } } } @@ -2409,6 +2597,20 @@ void re_initialize(void) printf("turbostat: re-initialized with num_cpus %d\n", topo.num_cpus); } +void set_max_cpu_num(void) +{ + FILE *filep; + unsigned long dummy; + + topo.max_cpu_num = 0; + filep = fopen_or_die( + "/sys/devices/system/cpu/cpu0/topology/thread_siblings", + "r"); + while (fscanf(filep, "%lx,", &dummy) == 1) + topo.max_cpu_num += BITMASK_SIZE; + fclose(filep); + topo.max_cpu_num--; /* 0 based */ +} /* * count_cpus() @@ -2416,10 +2618,7 @@ void re_initialize(void) */ int count_cpus(int cpu) { - if (topo.max_cpu_num < cpu) - topo.max_cpu_num = cpu; - - topo.num_cpus += 1; + topo.num_cpus++; return 0; } int mark_cpu_present(int cpu) @@ -2428,6 +2627,12 @@ int mark_cpu_present(int cpu) return 0; } +int init_thread_id(int cpu) +{ + cpus[cpu].thread_id = -1; + return 0; +} + /* * snapshot_proc_interrupts() * @@ -2542,6 +2747,52 @@ int snapshot_gfx_mhz(void) } /* + * snapshot_cpu_lpi() + * + * record snapshot of + * /sys/devices/system/cpu/cpuidle/low_power_idle_cpu_residency_us + * + * return 1 if config change requires a restart, else return 0 + */ +int snapshot_cpu_lpi_us(void) +{ + FILE *fp; + int retval; + + fp = fopen_or_die("/sys/devices/system/cpu/cpuidle/low_power_idle_cpu_residency_us", "r"); + + retval = fscanf(fp, "%lld", &cpuidle_cur_cpu_lpi_us); + if (retval != 1) + err(1, "CPU LPI"); + + fclose(fp); + + return 0; +} +/* + * snapshot_sys_lpi() + * + * record snapshot of + * /sys/devices/system/cpu/cpuidle/low_power_idle_system_residency_us + * + * return 1 if config change requires a restart, else return 0 + */ +int snapshot_sys_lpi_us(void) +{ + FILE *fp; + int retval; + + fp = fopen_or_die("/sys/devices/system/cpu/cpuidle/low_power_idle_system_residency_us", "r"); + + retval = fscanf(fp, "%lld", &cpuidle_cur_sys_lpi_us); + if (retval != 1) + err(1, "SYS LPI"); + + fclose(fp); + + return 0; +} +/* * snapshot /proc and /sys files * * return 1 if configuration restart needed, else return 0 @@ -2558,13 +2809,83 @@ int snapshot_proc_sysfs_files(void) if (DO_BIC(BIC_GFXMHz)) snapshot_gfx_mhz(); + if (DO_BIC(BIC_CPU_LPI)) + snapshot_cpu_lpi_us(); + + if (DO_BIC(BIC_SYS_LPI)) + snapshot_sys_lpi_us(); + return 0; } +int exit_requested; + +static void signal_handler (int signal) +{ + switch (signal) { + case SIGINT: + exit_requested = 1; + if (debug) + fprintf(stderr, " SIGINT\n"); + break; + case SIGUSR1: + if (debug > 1) + fprintf(stderr, "SIGUSR1\n"); + break; + } + /* make sure this manually-invoked interval is at least 1ms long */ + nanosleep(&one_msec, NULL); +} + +void setup_signal_handler(void) +{ + struct sigaction sa; + + memset(&sa, 0, sizeof(sa)); + + sa.sa_handler = &signal_handler; + + if (sigaction(SIGINT, &sa, NULL) < 0) + err(1, "sigaction SIGINT"); + if (sigaction(SIGUSR1, &sa, NULL) < 0) + err(1, "sigaction SIGUSR1"); +} + +void do_sleep(void) +{ + struct timeval select_timeout; + fd_set readfds; + int retval; + + FD_ZERO(&readfds); + FD_SET(0, &readfds); + + if (!isatty(fileno(stdin))) { + nanosleep(&interval_ts, NULL); + return; + } + + select_timeout = interval_tv; + retval = select(1, &readfds, NULL, NULL, &select_timeout); + + if (retval == 1) { + switch (getc(stdin)) { + case 'q': + exit_requested = 1; + break; + } + /* make sure this manually-invoked interval is at least 1ms long */ + nanosleep(&one_msec, NULL); + } +} + void turbostat_loop() { int retval; int restarted = 0; + int done_iters = 0; + + setup_signal_handler(); restart: restarted++; @@ -2581,6 +2902,7 @@ restart: goto restart; } restarted = 0; + done_iters = 0; gettimeofday(&tv_even, (struct timezone *)NULL); while (1) { @@ -2588,7 +2910,7 @@ restart: re_initialize(); goto restart; } - nanosleep(&interval_ts, NULL); + do_sleep(); if (snapshot_proc_sysfs_files()) goto restart; retval = for_all_cpus(get_counters, ODD_COUNTERS); @@ -2607,7 +2929,11 @@ restart: compute_average(EVEN_COUNTERS); format_all_counters(EVEN_COUNTERS); flush_output_stdout(); - nanosleep(&interval_ts, NULL); + if (exit_requested) + break; + if (num_iterations && ++done_iters >= num_iterations) + break; + do_sleep(); if (snapshot_proc_sysfs_files()) goto restart; retval = for_all_cpus(get_counters, EVEN_COUNTERS); @@ -2626,6 +2952,10 @@ restart: compute_average(ODD_COUNTERS); format_all_counters(ODD_COUNTERS); flush_output_stdout(); + if (exit_requested) + break; + if (num_iterations && ++done_iters >= num_iterations) + break; } } @@ -2740,6 +3070,7 @@ int probe_nhm_msrs(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ pkg_cstate_limits = hsw_pkg_cstate_limits; has_misc_feature_control = 1; break; @@ -2945,6 +3276,7 @@ int has_config_tdp(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ case INTEL_FAM6_SKYLAKE_X: /* SKX */ case INTEL_FAM6_XEON_PHI_KNL: /* Knights Landing */ @@ -3399,6 +3731,7 @@ void rapl_probe(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ do_rapl = RAPL_PKG | RAPL_CORES | RAPL_CORE_POLICY | RAPL_DRAM | RAPL_DRAM_PERF_STATUS | RAPL_PKG_PERF_STATUS | RAPL_GFX | RAPL_PKG_POWER_INFO; BIC_PRESENT(BIC_PKG__); BIC_PRESENT(BIC_RAM__); @@ -3523,6 +3856,12 @@ void perf_limit_reasons_probe(unsigned int family, unsigned int model) } } +void automatic_cstate_conversion_probe(unsigned int family, unsigned int model) +{ + if (is_skx(family, model) || is_bdx(family, model)) + has_automatic_cstate_conversion = 1; +} + int print_thermal(struct thread_data *t, struct core_data *c, struct pkg_data *p) { unsigned long long msr; @@ -3728,6 +4067,7 @@ int has_snb_msrs(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ case INTEL_FAM6_SKYLAKE_X: /* SKX */ case INTEL_FAM6_ATOM_GOLDMONT: /* BXT */ case INTEL_FAM6_ATOM_GEMINI_LAKE: @@ -3761,6 +4101,7 @@ int has_hsw_msrs(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ case INTEL_FAM6_ATOM_GOLDMONT: /* BXT */ case INTEL_FAM6_ATOM_GEMINI_LAKE: return 1; @@ -3786,6 +4127,7 @@ int has_skl_msrs(unsigned int family, unsigned int model) case INTEL_FAM6_SKYLAKE_DESKTOP: /* SKL */ case INTEL_FAM6_KABYLAKE_MOBILE: /* KBL */ case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ return 1; } return 0; @@ -3815,6 +4157,19 @@ int is_knl(unsigned int family, unsigned int model) return 0; } +int is_cnl(unsigned int family, unsigned int model) +{ + if (!genuine_intel) + return 0; + + switch (model) { + case INTEL_FAM6_CANNONLAKE_MOBILE: /* CNL */ + return 1; + } + + return 0; +} + unsigned int get_aperf_mperf_multiplier(unsigned int family, unsigned int model) { if (is_knl(family, model)) @@ -3947,7 +4302,7 @@ void decode_misc_enable_msr(void) base_cpu, msr, msr & MSR_IA32_MISC_ENABLE_TM1 ? "" : "No-", msr & MSR_IA32_MISC_ENABLE_ENHANCED_SPEEDSTEP ? "" : "No-", - msr & MSR_IA32_MISC_ENABLE_MWAIT ? "No-" : "", + msr & MSR_IA32_MISC_ENABLE_MWAIT ? "" : "No-", msr & MSR_IA32_MISC_ENABLE_PREFETCH_DISABLE ? "No-" : "", msr & MSR_IA32_MISC_ENABLE_TURBO_DISABLE ? "No-" : ""); } @@ -4152,7 +4507,6 @@ void process_cpuid() case INTEL_FAM6_KABYLAKE_DESKTOP: /* KBL */ crystal_hz = 24000000; /* 24.0 MHz */ break; - case INTEL_FAM6_SKYLAKE_X: /* SKX */ case INTEL_FAM6_ATOM_DENVERTON: /* DNV */ crystal_hz = 25000000; /* 25.0 MHz */ break; @@ -4253,6 +4607,7 @@ void process_cpuid() } do_slm_cstates = is_slm(family, model); do_knl_cstates = is_knl(family, model); + do_cnl_cstates = is_cnl(family, model); if (!quiet) decode_misc_pwr_mgmt_msr(); @@ -4262,6 +4617,7 @@ void process_cpuid() rapl_probe(family, model); perf_limit_reasons_probe(family, model); + automatic_cstate_conversion_probe(family, model); if (!quiet) dump_cstate_pstate_config_info(family, model); @@ -4280,6 +4636,16 @@ void process_cpuid() if (!access("/sys/class/graphics/fb0/device/drm/card0/gt_cur_freq_mhz", R_OK)) BIC_PRESENT(BIC_GFXMHz); + if (!access("/sys/devices/system/cpu/cpuidle/low_power_idle_cpu_residency_us", R_OK)) + BIC_PRESENT(BIC_CPU_LPI); + else + BIC_NOT_PRESENT(BIC_CPU_LPI); + + if (!access("/sys/devices/system/cpu/cpuidle/low_power_idle_system_residency_us", R_OK)) + BIC_PRESENT(BIC_SYS_LPI); + else + BIC_NOT_PRESENT(BIC_SYS_LPI); + if (!quiet) decode_misc_feature_control(); @@ -4310,14 +4676,10 @@ void topology_probe() int max_core_id = 0; int max_package_id = 0; int max_siblings = 0; - struct cpu_topology { - int core_id; - int physical_package_id; - } *cpus; /* Initialize num_cpus, max_cpu_num */ + set_max_cpu_num(); topo.num_cpus = 0; - topo.max_cpu_num = 0; for_all_proc_cpus(count_cpus); if (!summary_only && topo.num_cpus > 1) BIC_PRESENT(BIC_CPU); @@ -4357,6 +4719,7 @@ void topology_probe() cpu_affinity_setsize = CPU_ALLOC_SIZE((topo.max_cpu_num + 1)); CPU_ZERO_S(cpu_affinity_setsize, cpu_affinity_set); + for_all_proc_cpus(init_thread_id); /* * For online cpus @@ -4370,26 +4733,45 @@ void topology_probe() fprintf(outf, "cpu%d NOT PRESENT\n", i); continue; } - cpus[i].core_id = get_core_id(i); - if (cpus[i].core_id > max_core_id) - max_core_id = cpus[i].core_id; + cpus[i].logical_cpu_id = i; + + /* get package information */ cpus[i].physical_package_id = get_physical_package_id(i); if (cpus[i].physical_package_id > max_package_id) max_package_id = cpus[i].physical_package_id; - siblings = get_num_ht_siblings(i); + /* get numa node information */ + cpus[i].physical_node_id = get_physical_node_id(&cpus[i]); + if (cpus[i].physical_node_id > topo.max_node_num) + topo.max_node_num = cpus[i].physical_node_id; + + /* get core information */ + cpus[i].physical_core_id = get_core_id(i); + if (cpus[i].physical_core_id > max_core_id) + max_core_id = cpus[i].physical_core_id; + + /* get thread information */ + siblings = get_thread_siblings(&cpus[i]); if (siblings > max_siblings) max_siblings = siblings; + if (cpus[i].thread_id != -1) + topo.num_cores++; + if (debug > 1) - fprintf(outf, "cpu %d pkg %d core %d\n", - i, cpus[i].physical_package_id, cpus[i].core_id); + fprintf(outf, + "cpu %d pkg %d node %d core %d thread %d\n", + i, cpus[i].physical_package_id, + cpus[i].physical_node_id, + cpus[i].physical_core_id, + cpus[i].thread_id); } - topo.num_cores_per_pkg = max_core_id + 1; + + topo.cores_per_node = max_core_id + 1; if (debug > 1) fprintf(outf, "max_core_id %d, sizing for %d cores per package\n", - max_core_id, topo.num_cores_per_pkg); - if (!summary_only && topo.num_cores_per_pkg > 1) + max_core_id, topo.cores_per_node); + if (!summary_only && topo.cores_per_node > 1) BIC_PRESENT(BIC_Core); topo.num_packages = max_package_id + 1; @@ -4399,33 +4781,38 @@ void topology_probe() if (!summary_only && topo.num_packages > 1) BIC_PRESENT(BIC_Package); - topo.num_threads_per_core = max_siblings; + set_node_data(); if (debug > 1) - fprintf(outf, "max_siblings %d\n", max_siblings); + fprintf(outf, "nodes_per_pkg %d\n", topo.nodes_per_pkg); + if (!summary_only && topo.nodes_per_pkg > 1) + BIC_PRESENT(BIC_Node); - free(cpus); + topo.threads_per_core = max_siblings; + if (debug > 1) + fprintf(outf, "max_siblings %d\n", max_siblings); } void -allocate_counters(struct thread_data **t, struct core_data **c, struct pkg_data **p) +allocate_counters(struct thread_data **t, struct core_data **c, + struct pkg_data **p) { int i; + int num_cores = topo.cores_per_node * topo.nodes_per_pkg * + topo.num_packages; + int num_threads = topo.threads_per_core * num_cores; - *t = calloc(topo.num_threads_per_core * topo.num_cores_per_pkg * - topo.num_packages, sizeof(struct thread_data)); + *t = calloc(num_threads, sizeof(struct thread_data)); if (*t == NULL) goto error; - for (i = 0; i < topo.num_threads_per_core * - topo.num_cores_per_pkg * topo.num_packages; i++) + for (i = 0; i < num_threads; i++) (*t)[i].cpu_id = -1; - *c = calloc(topo.num_cores_per_pkg * topo.num_packages, - sizeof(struct core_data)); + *c = calloc(num_cores, sizeof(struct core_data)); if (*c == NULL) goto error; - for (i = 0; i < topo.num_cores_per_pkg * topo.num_packages; i++) + for (i = 0; i < num_cores; i++) (*c)[i].core_id = -1; *p = calloc(topo.num_packages, sizeof(struct pkg_data)); @@ -4442,47 +4829,39 @@ error: /* * init_counter() * - * set cpu_id, core_num, pkg_num * set FIRST_THREAD_IN_CORE and FIRST_CORE_IN_PACKAGE - * - * increment topo.num_cores when 1st core in pkg seen */ void init_counter(struct thread_data *thread_base, struct core_data *core_base, - struct pkg_data *pkg_base, int thread_num, int core_num, - int pkg_num, int cpu_id) + struct pkg_data *pkg_base, int cpu_id) { + int pkg_id = cpus[cpu_id].physical_package_id; + int node_id = cpus[cpu_id].logical_node_id; + int core_id = cpus[cpu_id].physical_core_id; + int thread_id = cpus[cpu_id].thread_id; struct thread_data *t; struct core_data *c; struct pkg_data *p; - t = GET_THREAD(thread_base, thread_num, core_num, pkg_num); - c = GET_CORE(core_base, core_num, pkg_num); - p = GET_PKG(pkg_base, pkg_num); + t = GET_THREAD(thread_base, thread_id, core_id, node_id, pkg_id); + c = GET_CORE(core_base, core_id, node_id, pkg_id); + p = GET_PKG(pkg_base, pkg_id); t->cpu_id = cpu_id; - if (thread_num == 0) { + if (thread_id == 0) { t->flags |= CPU_IS_FIRST_THREAD_IN_CORE; if (cpu_is_first_core_in_package(cpu_id)) t->flags |= CPU_IS_FIRST_CORE_IN_PACKAGE; } - c->core_id = core_num; - p->package_id = pkg_num; + c->core_id = core_id; + p->package_id = pkg_id; } int initialize_counters(int cpu_id) { - int my_thread_id, my_core_id, my_package_id; - - my_package_id = get_physical_package_id(cpu_id); - my_core_id = get_core_id(cpu_id); - my_thread_id = get_cpu_position_in_core(cpu_id); - if (!my_thread_id) - topo.num_cores++; - - init_counter(EVEN_COUNTERS, my_thread_id, my_core_id, my_package_id, cpu_id); - init_counter(ODD_COUNTERS, my_thread_id, my_core_id, my_package_id, cpu_id); + init_counter(EVEN_COUNTERS, cpu_id); + init_counter(ODD_COUNTERS, cpu_id); return 0; } @@ -4630,7 +5009,7 @@ int get_and_dump_counters(void) } void print_version() { - fprintf(outf, "turbostat version 17.06.23" + fprintf(outf, "turbostat version 18.06.01" " - Len Brown <lenb@kernel.org>\n"); } @@ -4661,7 +5040,7 @@ int add_counter(unsigned int msr_num, char *path, char *name, msrp->next = sys.tp; sys.tp = msrp; sys.added_thread_counters++; - if (sys.added_thread_counters > MAX_ADDED_COUNTERS) { + if (sys.added_thread_counters > MAX_ADDED_THREAD_COUNTERS) { fprintf(stderr, "exceeded max %d added thread counters\n", MAX_ADDED_COUNTERS); exit(-1); @@ -4820,7 +5199,7 @@ void probe_sysfs(void) if (!DO_BIC(BIC_sysfs)) return; - for (state = 10; state > 0; --state) { + for (state = 10; state >= 0; --state) { sprintf(path, "/sys/devices/system/cpu/cpu%d/cpuidle/state%d/name", base_cpu, state); @@ -4847,7 +5226,7 @@ void probe_sysfs(void) FORMAT_PERCENT, SYSFS_PERCPU); } - for (state = 10; state > 0; --state) { + for (state = 10; state >= 0; --state) { sprintf(path, "/sys/devices/system/cpu/cpu%d/cpuidle/state%d/name", base_cpu, state); @@ -4960,34 +5339,6 @@ error: exit(-1); } -int shown; -/* - * parse_show_hide() - process cmdline to set default counter action - */ -void parse_show_hide(char *optarg, enum show_hide_mode new_mode) -{ - /* - * --show: show only those specified - * The 1st invocation will clear and replace the enabled mask - * subsequent invocations can add to it. - */ - if (new_mode == SHOW_LIST) { - if (shown == 0) - bic_enabled = bic_lookup(optarg, new_mode); - else - bic_enabled |= bic_lookup(optarg, new_mode); - shown = 1; - - return; - } - - /* - * --hide: do not show those specified - * multiple invocations simply clear more bits in enabled mask - */ - bic_enabled &= ~bic_lookup(optarg, new_mode); - -} void cmdline(int argc, char **argv) { @@ -4998,7 +5349,9 @@ void cmdline(int argc, char **argv) {"cpu", required_argument, 0, 'c'}, {"Dump", no_argument, 0, 'D'}, {"debug", no_argument, 0, 'd'}, /* internal, not documented */ + {"enable", required_argument, 0, 'e'}, {"interval", required_argument, 0, 'i'}, + {"num_iterations", required_argument, 0, 'n'}, {"help", no_argument, 0, 'h'}, {"hide", required_argument, 0, 'H'}, // meh, -h taken by --help {"Joules", no_argument, 0, 'J'}, @@ -5014,7 +5367,7 @@ void cmdline(int argc, char **argv) progname = argv[0]; - while ((opt = getopt_long_only(argc, argv, "+C:c:Ddhi:JM:m:o:qST:v", + while ((opt = getopt_long_only(argc, argv, "+C:c:Dde:hi:Jn:o:qST:v", long_options, &option_index)) != -1) { switch (opt) { case 'a': @@ -5026,11 +5379,20 @@ void cmdline(int argc, char **argv) case 'D': dump_only++; break; + case 'e': + /* --enable specified counter */ + bic_enabled |= bic_lookup(optarg, SHOW_LIST); + break; case 'd': debug++; + ENABLE_BIC(BIC_DISABLED_BY_DEFAULT); break; case 'H': - parse_show_hide(optarg, HIDE_LIST); + /* + * --hide: do not show those specified + * multiple invocations simply clear more bits in enabled mask + */ + bic_enabled &= ~bic_lookup(optarg, HIDE_LIST); break; case 'h': default: @@ -5046,7 +5408,8 @@ void cmdline(int argc, char **argv) exit(2); } - interval_ts.tv_sec = interval; + interval_tv.tv_sec = interval_ts.tv_sec = interval; + interval_tv.tv_usec = (interval - interval_tv.tv_sec) * 1000000; interval_ts.tv_nsec = (interval - interval_ts.tv_sec) * 1000000000; } break; @@ -5054,6 +5417,7 @@ void cmdline(int argc, char **argv) rapl_joules++; break; case 'l': + ENABLE_BIC(BIC_DISABLED_BY_DEFAULT); list_header_only++; quiet++; break; @@ -5063,8 +5427,26 @@ void cmdline(int argc, char **argv) case 'q': quiet = 1; break; + case 'n': + num_iterations = strtod(optarg, NULL); + + if (num_iterations <= 0) { + fprintf(outf, "iterations %d should be positive number\n", + num_iterations); + exit(2); + } + break; case 's': - parse_show_hide(optarg, SHOW_LIST); + /* + * --show: show only those specified + * The 1st invocation will clear and replace the enabled mask + * subsequent invocations can add to it. + */ + if (shown == 0) + bic_enabled = bic_lookup(optarg, SHOW_LIST); + else + bic_enabled |= bic_lookup(optarg, SHOW_LIST); + shown = 1; break; case 'S': summary_only++; diff --git a/tools/power/x86/x86_energy_perf_policy/Makefile b/tools/power/x86/x86_energy_perf_policy/Makefile index 2447b1bbaacf..f4534fb8b951 100644 --- a/tools/power/x86/x86_energy_perf_policy/Makefile +++ b/tools/power/x86/x86_energy_perf_policy/Makefile @@ -24,5 +24,5 @@ install : x86_energy_perf_policy install -d $(DESTDIR)$(PREFIX)/bin install $(BUILD_OUTPUT)/x86_energy_perf_policy $(DESTDIR)$(PREFIX)/bin/x86_energy_perf_policy install -d $(DESTDIR)$(PREFIX)/share/man/man8 - install x86_energy_perf_policy.8 $(DESTDIR)$(PREFIX)/share/man/man8 + install -m 644 x86_energy_perf_policy.8 $(DESTDIR)$(PREFIX)/share/man/man8 diff --git a/tools/testing/radix-tree/Makefile b/tools/testing/radix-tree/Makefile index fa7ee369b3c9..db66f8a0d4be 100644 --- a/tools/testing/radix-tree/Makefile +++ b/tools/testing/radix-tree/Makefile @@ -17,7 +17,7 @@ ifeq ($(BUILD), 32) LDFLAGS += -m32 endif -targets: mapshift $(TARGETS) +targets: generated/map-shift.h $(TARGETS) main: $(OFILES) @@ -42,9 +42,7 @@ radix-tree.c: ../../../lib/radix-tree.c idr.c: ../../../lib/idr.c sed -e 's/^static //' -e 's/__always_inline //' -e 's/inline //' < $< > $@ -.PHONY: mapshift - -mapshift: +generated/map-shift.h: @if ! grep -qws $(SHIFT) generated/map-shift.h; then \ echo "#define RADIX_TREE_MAP_SHIFT $(SHIFT)" > \ generated/map-shift.h; \ diff --git a/tools/testing/radix-tree/idr-test.c b/tools/testing/radix-tree/idr-test.c index 6c645eb77d42..ee820fcc29b0 100644 --- a/tools/testing/radix-tree/idr-test.c +++ b/tools/testing/radix-tree/idr-test.c @@ -252,6 +252,13 @@ void idr_checks(void) idr_remove(&idr, 3); idr_remove(&idr, 0); + assert(idr_alloc(&idr, DUMMY_PTR, 0, 0, GFP_KERNEL) == 0); + idr_remove(&idr, 1); + for (i = 1; i < RADIX_TREE_MAP_SIZE; i++) + assert(idr_alloc(&idr, DUMMY_PTR, 0, 0, GFP_KERNEL) == i); + idr_remove(&idr, 1 << 30); + idr_destroy(&idr); + for (i = INT_MAX - 3UL; i < INT_MAX + 1UL; i++) { struct item *item = item_create(i, 0); assert(idr_alloc(&idr, item, i, i + 10, GFP_KERNEL) == i); diff --git a/tools/testing/radix-tree/multiorder.c b/tools/testing/radix-tree/multiorder.c index 59245b3d587c..7bf405638b0b 100644 --- a/tools/testing/radix-tree/multiorder.c +++ b/tools/testing/radix-tree/multiorder.c @@ -16,6 +16,7 @@ #include <linux/radix-tree.h> #include <linux/slab.h> #include <linux/errno.h> +#include <pthread.h> #include "test.h" @@ -624,6 +625,67 @@ static void multiorder_account(void) item_kill_tree(&tree); } +bool stop_iteration = false; + +static void *creator_func(void *ptr) +{ + /* 'order' is set up to ensure we have sibling entries */ + unsigned int order = RADIX_TREE_MAP_SHIFT - 1; + struct radix_tree_root *tree = ptr; + int i; + + for (i = 0; i < 10000; i++) { + item_insert_order(tree, 0, order); + item_delete_rcu(tree, 0); + } + + stop_iteration = true; + return NULL; +} + +static void *iterator_func(void *ptr) +{ + struct radix_tree_root *tree = ptr; + struct radix_tree_iter iter; + struct item *item; + void **slot; + + while (!stop_iteration) { + rcu_read_lock(); + radix_tree_for_each_slot(slot, tree, &iter, 0) { + item = radix_tree_deref_slot(slot); + + if (!item) + continue; + if (radix_tree_deref_retry(item)) { + slot = radix_tree_iter_retry(&iter); + continue; + } + + item_sanity(item, iter.index); + } + rcu_read_unlock(); + } + return NULL; +} + +static void multiorder_iteration_race(void) +{ + const int num_threads = sysconf(_SC_NPROCESSORS_ONLN); + pthread_t worker_thread[num_threads]; + RADIX_TREE(tree, GFP_KERNEL); + int i; + + pthread_create(&worker_thread[0], NULL, &creator_func, &tree); + for (i = 1; i < num_threads; i++) + pthread_create(&worker_thread[i], NULL, &iterator_func, &tree); + + for (i = 0; i < num_threads; i++) + pthread_join(worker_thread[i], NULL); + + item_kill_tree(&tree); +} + void multiorder_checks(void) { int i; @@ -644,6 +706,7 @@ void multiorder_checks(void) multiorder_join(); multiorder_split(); multiorder_account(); + multiorder_iteration_race(); radix_tree_cpu_dead(0); } diff --git a/tools/testing/radix-tree/test.c b/tools/testing/radix-tree/test.c index 5978ab1f403d..def6015570b2 100644 --- a/tools/testing/radix-tree/test.c +++ b/tools/testing/radix-tree/test.c @@ -75,6 +75,25 @@ int item_delete(struct radix_tree_root *root, unsigned long index) return 0; } +static void item_free_rcu(struct rcu_head *head) +{ + struct item *item = container_of(head, struct item, rcu_head); + + free(item); +} + +int item_delete_rcu(struct radix_tree_root *root, unsigned long index) +{ + struct item *item = radix_tree_delete(root, index); + + if (item) { + item_sanity(item, index); + call_rcu(&item->rcu_head, item_free_rcu); + return 1; + } + return 0; +} + void item_check_present(struct radix_tree_root *root, unsigned long index) { struct item *item; diff --git a/tools/testing/radix-tree/test.h b/tools/testing/radix-tree/test.h index d9c031dbeb1a..31f1d9b6f506 100644 --- a/tools/testing/radix-tree/test.h +++ b/tools/testing/radix-tree/test.h @@ -5,6 +5,7 @@ #include <linux/rcupdate.h> struct item { + struct rcu_head rcu_head; unsigned long index; unsigned int order; }; @@ -12,9 +13,11 @@ struct item { struct item *item_create(unsigned long index, unsigned int order); int __item_insert(struct radix_tree_root *root, struct item *item); int item_insert(struct radix_tree_root *root, unsigned long index); +void item_sanity(struct item *item, unsigned long index); int item_insert_order(struct radix_tree_root *root, unsigned long index, unsigned order); int item_delete(struct radix_tree_root *root, unsigned long index); +int item_delete_rcu(struct radix_tree_root *root, unsigned long index); struct item *item_lookup(struct radix_tree_root *root, unsigned long index); void item_check_present(struct radix_tree_root *root, unsigned long index); diff --git a/tools/testing/selftests/bpf/config b/tools/testing/selftests/bpf/config index 983dd25d49f4..1eefe211a4a8 100644 --- a/tools/testing/selftests/bpf/config +++ b/tools/testing/selftests/bpf/config @@ -5,3 +5,5 @@ CONFIG_BPF_EVENTS=y CONFIG_TEST_BPF=m CONFIG_CGROUP_BPF=y CONFIG_NETDEVSIM=m +CONFIG_NET_CLS_ACT=y +CONFIG_NET_SCH_INGRESS=y diff --git a/tools/testing/selftests/bpf/test_verifier.c b/tools/testing/selftests/bpf/test_verifier.c index 3e7718b1a9ae..fd7de7eb329e 100644 --- a/tools/testing/selftests/bpf/test_verifier.c +++ b/tools/testing/selftests/bpf/test_verifier.c @@ -11713,6 +11713,11 @@ static void get_unpriv_disabled() FILE *fd; fd = fopen("/proc/sys/"UNPRIV_SYSCTL, "r"); + if (!fd) { + perror("fopen /proc/sys/"UNPRIV_SYSCTL); + unpriv_disabled = true; + return; + } if (fgets(buf, 2, fd) == buf && atoi(buf)) unpriv_disabled = true; fclose(fd); diff --git a/tools/testing/selftests/drivers/usb/usbip/usbip_test.sh b/tools/testing/selftests/drivers/usb/usbip/usbip_test.sh new file mode 100755 index 000000000000..1893d0f59ad7 --- /dev/null +++ b/tools/testing/selftests/drivers/usb/usbip/usbip_test.sh @@ -0,0 +1,198 @@ +#!/bin/bash +# SPDX-License-Identifier: GPL-2.0 + +# Kselftest framework requirement - SKIP code is 4. +ksft_skip=4 + +usage() { echo "usbip_test.sh -b <busid> -p <usbip tools path>"; exit 1; } + +while getopts "h:b:p:" arg; do + case "${arg}" in + h) + usage + ;; + b) + busid=${OPTARG} + ;; + p) + tools_path=${OPTARG} + ;; + *) + usage + ;; + esac +done +shift $((OPTIND-1)) + +if [ -z "${busid}" ]; then + usage +fi + +echo "Running USB over IP Testing on $busid"; + +test_end_msg="End of USB over IP Testing on $busid" + +if [ $UID != 0 ]; then + echo "Please run usbip_test as root [SKIP]" + echo $test_end_msg + exit $ksft_skip +fi + +echo "Load usbip_host module" +if ! /sbin/modprobe -q -n usbip_host; then + echo "usbip_test: module usbip_host is not found [SKIP]" + echo $test_end_msg + exit $ksft_skip +fi + +if /sbin/modprobe -q usbip_host; then + /sbin/modprobe -q -r test_bitmap + echo "usbip_test: module usbip_host is loaded [OK]" +else + echo "usbip_test: module usbip_host failed to load [FAIL]" + echo $test_end_msg + exit 1 +fi + +echo "Load vhci_hcd module" +if /sbin/modprobe -q vhci_hcd; then + /sbin/modprobe -q -r test_bitmap + echo "usbip_test: module vhci_hcd is loaded [OK]" +else + echo "usbip_test: module vhci_hcd failed to load [FAIL]" + echo $test_end_msg + exit 1 +fi +echo "==============================================================" + +cd $tools_path; + +if [ ! -f src/usbip ]; then + echo "Please build usbip tools" + echo $test_end_msg + exit $ksft_skip +fi + +echo "Expect to see export-able devices"; +src/usbip list -l; +echo "==============================================================" + +echo "Run lsusb to see all usb devices" +lsusb -t; +echo "==============================================================" + +src/usbipd -D; + +echo "Get exported devices from localhost - expect to see none"; +src/usbip list -r localhost; +echo "==============================================================" + +echo "bind devices"; +src/usbip bind -b $busid; +echo "==============================================================" + +echo "Run lsusb - bound devices should be under usbip_host control" +lsusb -t; +echo "==============================================================" + +echo "bind devices - expect already bound messages" +src/usbip bind -b $busid; +echo "==============================================================" + +echo "Get exported devices from localhost - expect to see exported devices"; +src/usbip list -r localhost; +echo "==============================================================" + +echo "unbind devices"; +src/usbip unbind -b $busid; +echo "==============================================================" + +echo "Run lsusb - bound devices should be rebound to original drivers" +lsusb -t; +echo "==============================================================" + +echo "unbind devices - expect no devices bound message"; +src/usbip unbind -b $busid; +echo "==============================================================" + +echo "Get exported devices from localhost - expect to see none"; +src/usbip list -r localhost; +echo "==============================================================" + +echo "List imported devices - expect to see none"; +src/usbip port; +echo "==============================================================" + +echo "Import devices from localhost - should fail with no devices" +src/usbip attach -r localhost -b $busid; +echo "==============================================================" + +echo "bind devices"; +src/usbip bind -b $busid; +echo "==============================================================" + +echo "List imported devices - expect to see exported devices"; +src/usbip list -r localhost; +echo "==============================================================" + +echo "List imported devices - expect to see none"; +src/usbip port; +echo "==============================================================" + +echo "Import devices from localhost - should work" +src/usbip attach -r localhost -b $busid; +echo "==============================================================" + +echo "List imported devices - expect to see imported devices"; +src/usbip port; +echo "==============================================================" + +echo "Import devices from localhost - expect already imported messages" +src/usbip attach -r localhost -b $busid; +echo "==============================================================" + +echo "Un-import devices"; +src/usbip detach -p 00; +src/usbip detach -p 01; +echo "==============================================================" + +echo "List imported devices - expect to see none"; +src/usbip port; +echo "==============================================================" + +echo "Un-import devices - expect no devices to detach messages"; +src/usbip detach -p 00; +src/usbip detach -p 01; +echo "==============================================================" + +echo "Detach invalid port tests - expect invalid port error message"; +src/usbip detach -p 100; +echo "==============================================================" + +echo "Expect to see export-able devices"; +src/usbip list -l; +echo "==============================================================" + +echo "Remove usbip_host module"; +rmmod usbip_host; + +echo "Run lsusb - bound devices should be rebound to original drivers" +lsusb -t; +echo "==============================================================" + +echo "Run bind without usbip_host - expect fail" +src/usbip bind -b $busid; +echo "==============================================================" + +echo "Run lsusb - devices that failed to bind aren't bound to any driver" +lsusb -t; +echo "==============================================================" + +echo "modprobe usbip_host - does it work?" +/sbin/modprobe usbip_host +echo "Should see -busid- is not in match_busid table... skip! dmesg" +echo "==============================================================" +dmesg | grep "is not in match_busid table" +echo "==============================================================" + +echo $test_end_msg diff --git a/tools/testing/selftests/kvm/Makefile b/tools/testing/selftests/kvm/Makefile index 2ddcc96ae456..d9d00319b07c 100644 --- a/tools/testing/selftests/kvm/Makefile +++ b/tools/testing/selftests/kvm/Makefile @@ -15,7 +15,7 @@ LIBKVM += $(LIBKVM_$(UNAME_M)) INSTALL_HDR_PATH = $(top_srcdir)/usr LINUX_HDR_PATH = $(INSTALL_HDR_PATH)/include/ -CFLAGS += -O2 -g -std=gnu99 -I$(LINUX_HDR_PATH) -Iinclude -I$(<D) +CFLAGS += -O2 -g -std=gnu99 -I$(LINUX_HDR_PATH) -Iinclude -I$(<D) -I.. # After inclusion, $(OUTPUT) is defined and # $(TEST_GEN_PROGS) starts with $(OUTPUT)/ diff --git a/tools/testing/selftests/kvm/include/test_util.h b/tools/testing/selftests/kvm/include/test_util.h index 7ab98e41324f..ac53730b30aa 100644 --- a/tools/testing/selftests/kvm/include/test_util.h +++ b/tools/testing/selftests/kvm/include/test_util.h @@ -19,6 +19,7 @@ #include <errno.h> #include <unistd.h> #include <fcntl.h> +#include "kselftest.h" ssize_t test_write(int fd, const void *buf, size_t count); ssize_t test_read(int fd, void *buf, size_t count); diff --git a/tools/testing/selftests/kvm/lib/kvm_util.c b/tools/testing/selftests/kvm/lib/kvm_util.c index 2cedfda181d4..37e2a787d2fc 100644 --- a/tools/testing/selftests/kvm/lib/kvm_util.c +++ b/tools/testing/selftests/kvm/lib/kvm_util.c @@ -50,8 +50,8 @@ int kvm_check_cap(long cap) int kvm_fd; kvm_fd = open(KVM_DEV_PATH, O_RDONLY); - TEST_ASSERT(kvm_fd >= 0, "open %s failed, rc: %i errno: %i", - KVM_DEV_PATH, kvm_fd, errno); + if (kvm_fd < 0) + exit(KSFT_SKIP); ret = ioctl(kvm_fd, KVM_CHECK_EXTENSION, cap); TEST_ASSERT(ret != -1, "KVM_CHECK_EXTENSION IOCTL failed,\n" @@ -91,8 +91,8 @@ struct kvm_vm *vm_create(enum vm_guest_mode mode, uint64_t phy_pages, int perm) vm->mode = mode; kvm_fd = open(KVM_DEV_PATH, perm); - TEST_ASSERT(kvm_fd >= 0, "open %s failed, rc: %i errno: %i", - KVM_DEV_PATH, kvm_fd, errno); + if (kvm_fd < 0) + exit(KSFT_SKIP); /* Create VM. */ vm->fd = ioctl(kvm_fd, KVM_CREATE_VM, NULL); @@ -418,8 +418,8 @@ struct kvm_cpuid2 *kvm_get_supported_cpuid(void) cpuid = allocate_kvm_cpuid2(); kvm_fd = open(KVM_DEV_PATH, O_RDONLY); - TEST_ASSERT(kvm_fd >= 0, "open %s failed, rc: %i errno: %i", - KVM_DEV_PATH, kvm_fd, errno); + if (kvm_fd < 0) + exit(KSFT_SKIP); ret = ioctl(kvm_fd, KVM_GET_SUPPORTED_CPUID, cpuid); TEST_ASSERT(ret == 0, "KVM_GET_SUPPORTED_CPUID failed %d %d\n", @@ -675,8 +675,8 @@ static int vcpu_mmap_sz(void) int dev_fd, ret; dev_fd = open(KVM_DEV_PATH, O_RDONLY); - TEST_ASSERT(dev_fd >= 0, "%s open %s failed, rc: %i errno: %i", - __func__, KVM_DEV_PATH, dev_fd, errno); + if (dev_fd < 0) + exit(KSFT_SKIP); ret = ioctl(dev_fd, KVM_GET_VCPU_MMAP_SIZE, NULL); TEST_ASSERT(ret >= sizeof(struct kvm_run), diff --git a/tools/testing/selftests/kvm/sync_regs_test.c b/tools/testing/selftests/kvm/sync_regs_test.c index 428e9473f5e2..eae1ece3c31b 100644 --- a/tools/testing/selftests/kvm/sync_regs_test.c +++ b/tools/testing/selftests/kvm/sync_regs_test.c @@ -85,6 +85,9 @@ static void compare_vcpu_events(struct kvm_vcpu_events *left, { } +#define TEST_SYNC_FIELDS (KVM_SYNC_X86_REGS|KVM_SYNC_X86_SREGS|KVM_SYNC_X86_EVENTS) +#define INVALID_SYNC_FIELD 0x80000000 + int main(int argc, char *argv[]) { struct kvm_vm *vm; @@ -98,9 +101,14 @@ int main(int argc, char *argv[]) setbuf(stdout, NULL); cap = kvm_check_cap(KVM_CAP_SYNC_REGS); - TEST_ASSERT((unsigned long)cap == KVM_SYNC_X86_VALID_FIELDS, - "KVM_CAP_SYNC_REGS (0x%x) != KVM_SYNC_X86_VALID_FIELDS (0x%lx)\n", - cap, KVM_SYNC_X86_VALID_FIELDS); + if ((cap & TEST_SYNC_FIELDS) != TEST_SYNC_FIELDS) { + fprintf(stderr, "KVM_CAP_SYNC_REGS not supported, skipping test\n"); + exit(KSFT_SKIP); + } + if ((cap & INVALID_SYNC_FIELD) != 0) { + fprintf(stderr, "The \"invalid\" field is not invalid, skipping test\n"); + exit(KSFT_SKIP); + } /* Create VM */ vm = vm_create_default(VCPU_ID, guest_code); @@ -108,7 +116,14 @@ int main(int argc, char *argv[]) run = vcpu_state(vm, VCPU_ID); /* Request reading invalid register set from VCPU. */ - run->kvm_valid_regs = KVM_SYNC_X86_VALID_FIELDS << 1; + run->kvm_valid_regs = INVALID_SYNC_FIELD; + rv = _vcpu_run(vm, VCPU_ID); + TEST_ASSERT(rv < 0 && errno == EINVAL, + "Invalid kvm_valid_regs did not cause expected KVM_RUN error: %d\n", + rv); + vcpu_state(vm, VCPU_ID)->kvm_valid_regs = 0; + + run->kvm_valid_regs = INVALID_SYNC_FIELD | TEST_SYNC_FIELDS; rv = _vcpu_run(vm, VCPU_ID); TEST_ASSERT(rv < 0 && errno == EINVAL, "Invalid kvm_valid_regs did not cause expected KVM_RUN error: %d\n", @@ -116,7 +131,14 @@ int main(int argc, char *argv[]) vcpu_state(vm, VCPU_ID)->kvm_valid_regs = 0; /* Request setting invalid register set into VCPU. */ - run->kvm_dirty_regs = KVM_SYNC_X86_VALID_FIELDS << 1; + run->kvm_dirty_regs = INVALID_SYNC_FIELD; + rv = _vcpu_run(vm, VCPU_ID); + TEST_ASSERT(rv < 0 && errno == EINVAL, + "Invalid kvm_dirty_regs did not cause expected KVM_RUN error: %d\n", + rv); + vcpu_state(vm, VCPU_ID)->kvm_dirty_regs = 0; + + run->kvm_dirty_regs = INVALID_SYNC_FIELD | TEST_SYNC_FIELDS; rv = _vcpu_run(vm, VCPU_ID); TEST_ASSERT(rv < 0 && errno == EINVAL, "Invalid kvm_dirty_regs did not cause expected KVM_RUN error: %d\n", @@ -125,7 +147,7 @@ int main(int argc, char *argv[]) /* Request and verify all valid register sets. */ /* TODO: BUILD TIME CHECK: TEST_ASSERT(KVM_SYNC_X86_NUM_FIELDS != 3); */ - run->kvm_valid_regs = KVM_SYNC_X86_VALID_FIELDS; + run->kvm_valid_regs = TEST_SYNC_FIELDS; rv = _vcpu_run(vm, VCPU_ID); TEST_ASSERT(run->exit_reason == KVM_EXIT_IO, "Unexpected exit reason: %u (%s),\n", @@ -146,7 +168,7 @@ int main(int argc, char *argv[]) run->s.regs.sregs.apic_base = 1 << 11; /* TODO run->s.regs.events.XYZ = ABC; */ - run->kvm_valid_regs = KVM_SYNC_X86_VALID_FIELDS; + run->kvm_valid_regs = TEST_SYNC_FIELDS; run->kvm_dirty_regs = KVM_SYNC_X86_REGS | KVM_SYNC_X86_SREGS; rv = _vcpu_run(vm, VCPU_ID); TEST_ASSERT(run->exit_reason == KVM_EXIT_IO, @@ -172,7 +194,7 @@ int main(int argc, char *argv[]) /* Clear kvm_dirty_regs bits, verify new s.regs values are * overwritten with existing guest values. */ - run->kvm_valid_regs = KVM_SYNC_X86_VALID_FIELDS; + run->kvm_valid_regs = TEST_SYNC_FIELDS; run->kvm_dirty_regs = 0; run->s.regs.regs.r11 = 0xDEADBEEF; rv = _vcpu_run(vm, VCPU_ID); @@ -211,7 +233,7 @@ int main(int argc, char *argv[]) * with kvm_sync_regs values. */ run->kvm_valid_regs = 0; - run->kvm_dirty_regs = KVM_SYNC_X86_VALID_FIELDS; + run->kvm_dirty_regs = TEST_SYNC_FIELDS; run->s.regs.regs.r11 = 0xBBBB; rv = _vcpu_run(vm, VCPU_ID); TEST_ASSERT(run->exit_reason == KVM_EXIT_IO, diff --git a/tools/testing/selftests/kvm/vmx_tsc_adjust_test.c b/tools/testing/selftests/kvm/vmx_tsc_adjust_test.c index 8f7f62093add..aaa633263b2c 100644 --- a/tools/testing/selftests/kvm/vmx_tsc_adjust_test.c +++ b/tools/testing/selftests/kvm/vmx_tsc_adjust_test.c @@ -189,8 +189,8 @@ int main(int argc, char *argv[]) struct kvm_cpuid_entry2 *entry = kvm_get_supported_cpuid_entry(1); if (!(entry->ecx & CPUID_VMX)) { - printf("nested VMX not enabled, skipping test"); - return 0; + fprintf(stderr, "nested VMX not enabled, skipping test\n"); + exit(KSFT_SKIP); } vm = vm_create_default_vmx(VCPU_ID, (void *) l1_guest_code); diff --git a/tools/testing/selftests/net/config b/tools/testing/selftests/net/config index 6a75a3ea44ad..7ba089b33e8b 100644 --- a/tools/testing/selftests/net/config +++ b/tools/testing/selftests/net/config @@ -7,3 +7,8 @@ CONFIG_NET_L3_MASTER_DEV=y CONFIG_IPV6=y CONFIG_IPV6_MULTIPLE_TABLES=y CONFIG_VETH=y +CONFIG_INET_XFRM_MODE_TUNNEL=y +CONFIG_NET_IPVTI=y +CONFIG_INET6_XFRM_MODE_TUNNEL=y +CONFIG_IPV6_VTI=y +CONFIG_DUMMY=y diff --git a/tools/testing/selftests/net/reuseport_bpf_numa.c b/tools/testing/selftests/net/reuseport_bpf_numa.c index 365c32e84189..c9f478b40996 100644 --- a/tools/testing/selftests/net/reuseport_bpf_numa.c +++ b/tools/testing/selftests/net/reuseport_bpf_numa.c @@ -23,6 +23,8 @@ #include <unistd.h> #include <numa.h> +#include "../kselftest.h" + static const int PORT = 8888; static void build_rcv_group(int *rcv_fd, size_t len, int family, int proto) @@ -229,7 +231,7 @@ int main(void) int *rcv_fd, nodes; if (numa_available() < 0) - error(1, errno, "no numa api support"); + ksft_exit_skip("no numa api support\n"); nodes = numa_max_node() + 1; diff --git a/tools/testing/selftests/rcutorture/bin/kvm-find-errors.sh b/tools/testing/selftests/rcutorture/bin/kvm-find-errors.sh new file mode 100755 index 000000000000..98f650c9bf54 --- /dev/null +++ b/tools/testing/selftests/rcutorture/bin/kvm-find-errors.sh @@ -0,0 +1,56 @@ +#!/bin/sh +# +# Invoke a text editor on all console.log files for all runs with diagnostics, +# that is, on all such files having a console.log.diags counterpart. +# Note that both console.log.diags and console.log are passed to the +# editor (currently defaulting to "vi"), allowing the user to get an +# idea of what to search for in the console.log file. +# +# Usage: kvm-find-errors.sh directory +# +# The "directory" above should end with the date/time directory, for example, +# "tools/testing/selftests/rcutorture/res/2018.02.25-14:27:27". + +rundir="${1}" +if test -z "$rundir" -o ! -d "$rundir" +then + echo Usage: $0 directory +fi +editor=${EDITOR-vi} + +# Find builds with errors +files= +for i in ${rundir}/*/Make.out +do + if egrep -q "error:|warning:" < $i + then + egrep "error:|warning:" < $i > $i.diags + files="$files $i.diags $i" + fi +done +if test -n "$files" +then + $editor $files +else + echo No build errors. +fi +if grep -q -e "--buildonly" < ${rundir}/log +then + echo Build-only run, no console logs to check. +fi + +# Find console logs with errors +files= +for i in ${rundir}/*/console.log +do + if test -r $i.diags + then + files="$files $i.diags $i" + fi +done +if test -n "$files" +then + $editor $files +else + echo No errors in console logs. +fi diff --git a/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcu.sh b/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcu.sh index c2e1bb6d0cba..477ecb1293ab 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcu.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-recheck-rcu.sh @@ -34,11 +34,15 @@ fi configfile=`echo $i | sed -e 's/^.*\///'` ngps=`grep ver: $i/console.log 2> /dev/null | tail -1 | sed -e 's/^.* ver: //' -e 's/ .*$//'` +stopstate="`grep 'End-test grace-period state: g' $i/console.log 2> /dev/null | + tail -1 | sed -e 's/^\[[ 0-9.]*] //' | + awk '{ print \"[\" $1 \" \" $5 \" \" $6 \" \" $7 \"]\"; }' | + tr -d '\012\015'`" if test -z "$ngps" then - echo "$configfile -------" + echo "$configfile ------- " $stopstate else - title="$configfile ------- $ngps grace periods" + title="$configfile ------- $ngps GPs" dur=`sed -e 's/^.* rcutorture.shutdown_secs=//' -e 's/ .*$//' < $i/qemu-cmd 2> /dev/null` if test -z "$dur" then @@ -46,9 +50,9 @@ else else ngpsps=`awk -v ngps=$ngps -v dur=$dur ' BEGIN { print ngps / dur }' < /dev/null` - title="$title ($ngpsps per second)" + title="$title ($ngpsps/s)" fi - echo $title + echo $title $stopstate nclosecalls=`grep --binary-files=text 'torture: Reader Batch' $i/console.log | tail -1 | awk '{for (i=NF-8;i<=NF;i++) sum+=$i; } END {print sum}'` if test -z "$nclosecalls" then diff --git a/tools/testing/selftests/rcutorture/bin/kvm-recheck.sh b/tools/testing/selftests/rcutorture/bin/kvm-recheck.sh index f7e988f369dd..c27e97824163 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-recheck.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-recheck.sh @@ -48,10 +48,6 @@ do cat $i/Make.oldconfig.err fi parse-build.sh $i/Make.out $configfile - if test "$TORTURE_SUITE" != rcuperf - then - parse-torture.sh $i/console.log $configfile - fi parse-console.sh $i/console.log $configfile if test -r $i/Warnings then diff --git a/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh b/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh index 5f8fbb0d7c17..c5b0f94341d9 100755 --- a/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh +++ b/tools/testing/selftests/rcutorture/bin/kvm-test-1-run.sh @@ -267,5 +267,4 @@ then echo Unknown PID, cannot kill qemu command fi -parse-torture.sh $resdir/console.log $title parse-console.sh $resdir/console.log $title diff --git a/tools/testing/selftests/rcutorture/bin/parse-console.sh b/tools/testing/selftests/rcutorture/bin/parse-console.sh index 08aa7d50ae0e..17293436f551 100755 --- a/tools/testing/selftests/rcutorture/bin/parse-console.sh +++ b/tools/testing/selftests/rcutorture/bin/parse-console.sh @@ -24,57 +24,146 @@ # # Authors: Paul E. McKenney <paulmck@linux.vnet.ibm.com> +T=${TMPDIR-/tmp}/parse-console.sh.$$ file="$1" title="$2" +trap 'rm -f $T.seq $T.diags' 0 + . functions.sh +# Check for presence and readability of console output file +if test -f "$file" -a -r "$file" +then + : +else + echo $title unreadable console output file: $file + exit 1 +fi if grep -Pq '\x00' < $file then print_warning Console output contains nul bytes, old qemu still running? fi -egrep 'Badness|WARNING:|Warn|BUG|===========|Call Trace:|Oops:|detected stalls on CPUs/tasks:|self-detected stall on CPU|Stall ended before state dump start|\?\?\? Writer stall state|rcu_.*kthread starved for' < $file | grep -v 'ODEBUG: ' | grep -v 'Warning: unable to open an initial console' > $1.diags -if test -s $1.diags +cat /dev/null > $file.diags + +# Check for proper termination, except that rcuperf runs don't indicate this. +if test "$TORTURE_SUITE" != rcuperf then - print_warning Assertion failure in $file $title - # cat $1.diags + # check for abject failure + + if grep -q FAILURE $file || grep -q -e '-torture.*!!!' $file + then + nerrs=`grep --binary-files=text '!!!' $file | + tail -1 | + awk ' + { + for (i=NF-8;i<=NF;i++) + sum+=$i; + } + END { print sum }'` + print_bug $title FAILURE, $nerrs instances + exit + fi + + grep --binary-files=text 'torture:.*ver:' $file | + egrep --binary-files=text -v '\(null\)|rtc: 000000000* ' | + sed -e 's/^(initramfs)[^]]*] //' -e 's/^\[[^]]*] //' | + awk ' + BEGIN { + ver = 0; + badseq = 0; + } + + { + if (!badseq && ($5 + 0 != $5 || $5 <= ver)) { + badseqno1 = ver; + badseqno2 = $5; + badseqnr = NR; + badseq = 1; + } + ver = $5 + } + + END { + if (badseq) { + if (badseqno1 == badseqno2 && badseqno2 == ver) + print "GP HANG at " ver " torture stat " badseqnr; + else + print "BAD SEQ " badseqno1 ":" badseqno2 " last:" ver " version " badseqnr; + } + }' > $T.seq + + if grep -q SUCCESS $file + then + if test -s $T.seq + then + print_warning $title `cat $T.seq` + echo " " $file + exit 2 + fi + else + if grep -q "_HOTPLUG:" $file + then + print_warning HOTPLUG FAILURES $title `cat $T.seq` + echo " " $file + exit 3 + fi + echo $title no success message, `grep --binary-files=text 'ver:' $file | wc -l` successful version messages + if test -s $T.seq + then + print_warning $title `cat $T.seq` + fi + exit 2 + fi +fi | tee -a $file.diags + +egrep 'Badness|WARNING:|Warn|BUG|===========|Call Trace:|Oops:|detected stalls on CPUs/tasks:|self-detected stall on CPU|Stall ended before state dump start|\?\?\? Writer stall state|rcu_.*kthread starved for' < $file | +grep -v 'ODEBUG: ' | +grep -v 'Warning: unable to open an initial console' > $T.diags +if test -s $T.diags +then + print_warning "Assertion failure in $file $title" + # cat $T.diags summary="" - n_badness=`grep -c Badness $1` + n_badness=`grep -c Badness $file` if test "$n_badness" -ne 0 then summary="$summary Badness: $n_badness" fi - n_warn=`grep -v 'Warning: unable to open an initial console' $1 | egrep -c 'WARNING:|Warn'` + n_warn=`grep -v 'Warning: unable to open an initial console' $file | egrep -c 'WARNING:|Warn'` if test "$n_warn" -ne 0 then summary="$summary Warnings: $n_warn" fi - n_bugs=`egrep -c 'BUG|Oops:' $1` + n_bugs=`egrep -c 'BUG|Oops:' $file` if test "$n_bugs" -ne 0 then summary="$summary Bugs: $n_bugs" fi - n_calltrace=`grep -c 'Call Trace:' $1` + n_calltrace=`grep -c 'Call Trace:' $file` if test "$n_calltrace" -ne 0 then summary="$summary Call Traces: $n_calltrace" fi - n_lockdep=`grep -c =========== $1` + n_lockdep=`grep -c =========== $file` if test "$n_badness" -ne 0 then summary="$summary lockdep: $n_badness" fi - n_stalls=`egrep -c 'detected stalls on CPUs/tasks:|self-detected stall on CPU|Stall ended before state dump start|\?\?\? Writer stall state' $1` + n_stalls=`egrep -c 'detected stalls on CPUs/tasks:|self-detected stall on CPU|Stall ended before state dump start|\?\?\? Writer stall state' $file` if test "$n_stalls" -ne 0 then summary="$summary Stalls: $n_stalls" fi - n_starves=`grep -c 'rcu_.*kthread starved for' $1` + n_starves=`grep -c 'rcu_.*kthread starved for' $file` if test "$n_starves" -ne 0 then summary="$summary Starves: $n_starves" fi print_warning Summary: $summary -else - rm $1.diags + cat $T.diags >> $file.diags +fi +if ! test -s $file.diags +then + rm -f $file.diags fi diff --git a/tools/testing/selftests/rcutorture/bin/parse-torture.sh b/tools/testing/selftests/rcutorture/bin/parse-torture.sh deleted file mode 100755 index 5987e50cfeb4..000000000000 --- a/tools/testing/selftests/rcutorture/bin/parse-torture.sh +++ /dev/null @@ -1,105 +0,0 @@ -#!/bin/bash -# -# Check the console output from a torture run for goodness. -# The "file" is a pathname on the local system, and "title" is -# a text string for error-message purposes. -# -# The file must contain torture output, but can be interspersed -# with other dmesg text, as in console-log output. -# -# Usage: parse-torture.sh file title -# -# This program is free software; you can redistribute it and/or modify -# it under the terms of the GNU General Public License as published by -# the Free Software Foundation; either version 2 of the License, or -# (at your option) any later version. -# -# This program is distributed in the hope that it will be useful, -# but WITHOUT ANY WARRANTY; without even the implied warranty of -# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -# GNU General Public License for more details. -# -# You should have received a copy of the GNU General Public License -# along with this program; if not, you can access it online at -# http://www.gnu.org/licenses/gpl-2.0.html. -# -# Copyright (C) IBM Corporation, 2011 -# -# Authors: Paul E. McKenney <paulmck@linux.vnet.ibm.com> - -T=${TMPDIR-/tmp}/parse-torture.sh.$$ -file="$1" -title="$2" - -trap 'rm -f $T.seq' 0 - -. functions.sh - -# check for presence of torture output file. - -if test -f "$file" -a -r "$file" -then - : -else - echo $title unreadable torture output file: $file - exit 1 -fi - -# check for abject failure - -if grep -q FAILURE $file || grep -q -e '-torture.*!!!' $file -then - nerrs=`grep --binary-files=text '!!!' $file | tail -1 | awk '{for (i=NF-8;i<=NF;i++) sum+=$i; } END {print sum}'` - print_bug $title FAILURE, $nerrs instances - echo " " $url - exit -fi - -grep --binary-files=text 'torture:.*ver:' $file | egrep --binary-files=text -v '\(null\)|rtc: 000000000* ' | sed -e 's/^(initramfs)[^]]*] //' -e 's/^\[[^]]*] //' | -awk ' -BEGIN { - ver = 0; - badseq = 0; - } - - { - if (!badseq && ($5 + 0 != $5 || $5 <= ver)) { - badseqno1 = ver; - badseqno2 = $5; - badseqnr = NR; - badseq = 1; - } - ver = $5 - } - -END { - if (badseq) { - if (badseqno1 == badseqno2 && badseqno2 == ver) - print "GP HANG at " ver " torture stat " badseqnr; - else - print "BAD SEQ " badseqno1 ":" badseqno2 " last:" ver " version " badseqnr; - } - }' > $T.seq - -if grep -q SUCCESS $file -then - if test -s $T.seq - then - print_warning $title $title `cat $T.seq` - echo " " $file - exit 2 - fi -else - if grep -q "_HOTPLUG:" $file - then - print_warning HOTPLUG FAILURES $title `cat $T.seq` - echo " " $file - exit 3 - fi - echo $title no success message, `grep --binary-files=text 'ver:' $file | wc -l` successful version messages - if test -s $T.seq - then - print_warning $title `cat $T.seq` - fi - exit 2 -fi diff --git a/tools/testing/selftests/seccomp/seccomp_bpf.c b/tools/testing/selftests/seccomp/seccomp_bpf.c index 168c66d74fc5..e1473234968d 100644 --- a/tools/testing/selftests/seccomp/seccomp_bpf.c +++ b/tools/testing/selftests/seccomp/seccomp_bpf.c @@ -134,11 +134,15 @@ struct seccomp_data { #endif #ifndef SECCOMP_FILTER_FLAG_TSYNC -#define SECCOMP_FILTER_FLAG_TSYNC 1 +#define SECCOMP_FILTER_FLAG_TSYNC (1UL << 0) #endif #ifndef SECCOMP_FILTER_FLAG_LOG -#define SECCOMP_FILTER_FLAG_LOG 2 +#define SECCOMP_FILTER_FLAG_LOG (1UL << 1) +#endif + +#ifndef SECCOMP_FILTER_FLAG_SPEC_ALLOW +#define SECCOMP_FILTER_FLAG_SPEC_ALLOW (1UL << 2) #endif #ifndef PTRACE_SECCOMP_GET_METADATA @@ -2072,14 +2076,26 @@ TEST(seccomp_syscall_mode_lock) TEST(detect_seccomp_filter_flags) { unsigned int flags[] = { SECCOMP_FILTER_FLAG_TSYNC, - SECCOMP_FILTER_FLAG_LOG }; + SECCOMP_FILTER_FLAG_LOG, + SECCOMP_FILTER_FLAG_SPEC_ALLOW }; unsigned int flag, all_flags; int i; long ret; /* Test detection of known-good filter flags */ for (i = 0, all_flags = 0; i < ARRAY_SIZE(flags); i++) { + int bits = 0; + flag = flags[i]; + /* Make sure the flag is a single bit! */ + while (flag) { + if (flag & 0x1) + bits ++; + flag >>= 1; + } + ASSERT_EQ(1, bits); + flag = flags[i]; + ret = seccomp(SECCOMP_SET_MODE_FILTER, flag, NULL); ASSERT_NE(ENOSYS, errno) { TH_LOG("Kernel does not support seccomp syscall!"); diff --git a/tools/testing/selftests/x86/Makefile b/tools/testing/selftests/x86/Makefile index d744991c0f4f..39f66bc29b82 100644 --- a/tools/testing/selftests/x86/Makefile +++ b/tools/testing/selftests/x86/Makefile @@ -11,7 +11,7 @@ CAN_BUILD_X86_64 := $(shell ./check_cc.sh $(CC) trivial_64bit_program.c) TARGETS_C_BOTHBITS := single_step_syscall sysret_ss_attrs syscall_nt test_mremap_vdso \ check_initial_reg_state sigreturn iopl mpx-mini-test ioperm \ - protection_keys test_vdso test_vsyscall + protection_keys test_vdso test_vsyscall mov_ss_trap TARGETS_C_32BIT_ONLY := entry_from_vm86 syscall_arg_fault test_syscall_vdso unwind_vdso \ test_FCMOV test_FCOMI test_FISTTP \ vdso_restorer diff --git a/tools/testing/selftests/x86/mov_ss_trap.c b/tools/testing/selftests/x86/mov_ss_trap.c new file mode 100644 index 000000000000..3c3a022654f3 --- /dev/null +++ b/tools/testing/selftests/x86/mov_ss_trap.c @@ -0,0 +1,285 @@ +/* SPDX-License-Identifier: GPL-2.0 */ +/* + * mov_ss_trap.c: Exercise the bizarre side effects of a watchpoint on MOV SS + * + * This does MOV SS from a watchpointed address followed by various + * types of kernel entries. A MOV SS that hits a watchpoint will queue + * up a #DB trap but will not actually deliver that trap. The trap + * will be delivered after the next instruction instead. The CPU's logic + * seems to be: + * + * - Any fault: drop the pending #DB trap. + * - INT $N, INT3, INTO, SYSCALL, SYSENTER: enter the kernel and then + * deliver #DB. + * - ICEBP: enter the kernel but do not deliver the watchpoint trap + * - breakpoint: only one #DB is delivered (phew!) + * + * There are plenty of ways for a kernel to handle this incorrectly. This + * test tries to exercise all the cases. + * + * This should mostly cover CVE-2018-1087 and CVE-2018-8897. + */ +#define _GNU_SOURCE + +#include <stdlib.h> +#include <sys/ptrace.h> +#include <sys/types.h> +#include <sys/wait.h> +#include <sys/user.h> +#include <sys/syscall.h> +#include <unistd.h> +#include <errno.h> +#include <stddef.h> +#include <stdio.h> +#include <err.h> +#include <string.h> +#include <setjmp.h> +#include <sys/prctl.h> + +#define X86_EFLAGS_RF (1UL << 16) + +#if __x86_64__ +# define REG_IP REG_RIP +#else +# define REG_IP REG_EIP +#endif + +unsigned short ss; +extern unsigned char breakpoint_insn[]; +sigjmp_buf jmpbuf; +static unsigned char altstack_data[SIGSTKSZ]; + +static void enable_watchpoint(void) +{ + pid_t parent = getpid(); + int status; + + pid_t child = fork(); + if (child < 0) + err(1, "fork"); + + if (child) { + if (waitpid(child, &status, 0) != child) + err(1, "waitpid for child"); + } else { + unsigned long dr0, dr1, dr7; + + dr0 = (unsigned long)&ss; + dr1 = (unsigned long)breakpoint_insn; + dr7 = ((1UL << 1) | /* G0 */ + (3UL << 16) | /* RW0 = read or write */ + (1UL << 18) | /* LEN0 = 2 bytes */ + (1UL << 3)); /* G1, RW1 = insn */ + + if (ptrace(PTRACE_ATTACH, parent, NULL, NULL) != 0) + err(1, "PTRACE_ATTACH"); + + if (waitpid(parent, &status, 0) != parent) + err(1, "waitpid for child"); + + if (ptrace(PTRACE_POKEUSER, parent, (void *)offsetof(struct user, u_debugreg[0]), dr0) != 0) + err(1, "PTRACE_POKEUSER DR0"); + + if (ptrace(PTRACE_POKEUSER, parent, (void *)offsetof(struct user, u_debugreg[1]), dr1) != 0) + err(1, "PTRACE_POKEUSER DR1"); + + if (ptrace(PTRACE_POKEUSER, parent, (void *)offsetof(struct user, u_debugreg[7]), dr7) != 0) + err(1, "PTRACE_POKEUSER DR7"); + + printf("\tDR0 = %lx, DR1 = %lx, DR7 = %lx\n", dr0, dr1, dr7); + + if (ptrace(PTRACE_DETACH, parent, NULL, NULL) != 0) + err(1, "PTRACE_DETACH"); + + exit(0); + } +} + +static void sethandler(int sig, void (*handler)(int, siginfo_t *, void *), + int flags) +{ + struct sigaction sa; + memset(&sa, 0, sizeof(sa)); + sa.sa_sigaction = handler; + sa.sa_flags = SA_SIGINFO | flags; + sigemptyset(&sa.sa_mask); + if (sigaction(sig, &sa, 0)) + err(1, "sigaction"); +} + +static char const * const signames[] = { + [SIGSEGV] = "SIGSEGV", + [SIGBUS] = "SIBGUS", + [SIGTRAP] = "SIGTRAP", + [SIGILL] = "SIGILL", +}; + +static void sigtrap(int sig, siginfo_t *si, void *ctx_void) +{ + ucontext_t *ctx = ctx_void; + + printf("\tGot SIGTRAP with RIP=%lx, EFLAGS.RF=%d\n", + (unsigned long)ctx->uc_mcontext.gregs[REG_IP], + !!(ctx->uc_mcontext.gregs[REG_EFL] & X86_EFLAGS_RF)); +} + +static void handle_and_return(int sig, siginfo_t *si, void *ctx_void) +{ + ucontext_t *ctx = ctx_void; + + printf("\tGot %s with RIP=%lx\n", signames[sig], + (unsigned long)ctx->uc_mcontext.gregs[REG_IP]); +} + +static void handle_and_longjmp(int sig, siginfo_t *si, void *ctx_void) +{ + ucontext_t *ctx = ctx_void; + + printf("\tGot %s with RIP=%lx\n", signames[sig], + (unsigned long)ctx->uc_mcontext.gregs[REG_IP]); + + siglongjmp(jmpbuf, 1); +} + +int main() +{ + unsigned long nr; + + asm volatile ("mov %%ss, %[ss]" : [ss] "=m" (ss)); + printf("\tSS = 0x%hx, &SS = 0x%p\n", ss, &ss); + + if (prctl(PR_SET_PTRACER, PR_SET_PTRACER_ANY, 0, 0, 0) == 0) + printf("\tPR_SET_PTRACER_ANY succeeded\n"); + + printf("\tSet up a watchpoint\n"); + sethandler(SIGTRAP, sigtrap, 0); + enable_watchpoint(); + + printf("[RUN]\tRead from watched memory (should get SIGTRAP)\n"); + asm volatile ("mov %[ss], %[tmp]" : [tmp] "=r" (nr) : [ss] "m" (ss)); + + printf("[RUN]\tMOV SS; INT3\n"); + asm volatile ("mov %[ss], %%ss; int3" :: [ss] "m" (ss)); + + printf("[RUN]\tMOV SS; INT 3\n"); + asm volatile ("mov %[ss], %%ss; .byte 0xcd, 0x3" :: [ss] "m" (ss)); + + printf("[RUN]\tMOV SS; CS CS INT3\n"); + asm volatile ("mov %[ss], %%ss; .byte 0x2e, 0x2e; int3" :: [ss] "m" (ss)); + + printf("[RUN]\tMOV SS; CSx14 INT3\n"); + asm volatile ("mov %[ss], %%ss; .fill 14,1,0x2e; int3" :: [ss] "m" (ss)); + + printf("[RUN]\tMOV SS; INT 4\n"); + sethandler(SIGSEGV, handle_and_return, SA_RESETHAND); + asm volatile ("mov %[ss], %%ss; int $4" :: [ss] "m" (ss)); + +#ifdef __i386__ + printf("[RUN]\tMOV SS; INTO\n"); + sethandler(SIGSEGV, handle_and_return, SA_RESETHAND); + nr = -1; + asm volatile ("add $1, %[tmp]; mov %[ss], %%ss; into" + : [tmp] "+r" (nr) : [ss] "m" (ss)); +#endif + + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; ICEBP\n"); + + /* Some emulators (e.g. QEMU TCG) don't emulate ICEBP. */ + sethandler(SIGILL, handle_and_longjmp, SA_RESETHAND); + + asm volatile ("mov %[ss], %%ss; .byte 0xf1" :: [ss] "m" (ss)); + } + + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; CLI\n"); + sethandler(SIGSEGV, handle_and_longjmp, SA_RESETHAND); + asm volatile ("mov %[ss], %%ss; cli" :: [ss] "m" (ss)); + } + + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; #PF\n"); + sethandler(SIGSEGV, handle_and_longjmp, SA_RESETHAND); + asm volatile ("mov %[ss], %%ss; mov (-1), %[tmp]" + : [tmp] "=r" (nr) : [ss] "m" (ss)); + } + + /* + * INT $1: if #DB has DPL=3 and there isn't special handling, + * then the kernel will die. + */ + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; INT 1\n"); + sethandler(SIGSEGV, handle_and_longjmp, SA_RESETHAND); + asm volatile ("mov %[ss], %%ss; int $1" :: [ss] "m" (ss)); + } + +#ifdef __x86_64__ + /* + * In principle, we should test 32-bit SYSCALL as well, but + * the calling convention is so unpredictable that it's + * not obviously worth the effort. + */ + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; SYSCALL\n"); + sethandler(SIGILL, handle_and_longjmp, SA_RESETHAND); + nr = SYS_getpid; + /* + * Toggle the high bit of RSP to make it noncanonical to + * strengthen this test on non-SMAP systems. + */ + asm volatile ("btc $63, %%rsp\n\t" + "mov %[ss], %%ss; syscall\n\t" + "btc $63, %%rsp" + : "+a" (nr) : [ss] "m" (ss) + : "rcx" +#ifdef __x86_64__ + , "r11" +#endif + ); + } +#endif + + printf("[RUN]\tMOV SS; breakpointed NOP\n"); + asm volatile ("mov %[ss], %%ss; breakpoint_insn: nop" :: [ss] "m" (ss)); + + /* + * Invoking SYSENTER directly breaks all the rules. Just handle + * the SIGSEGV. + */ + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; SYSENTER\n"); + stack_t stack = { + .ss_sp = altstack_data, + .ss_size = SIGSTKSZ, + }; + if (sigaltstack(&stack, NULL) != 0) + err(1, "sigaltstack"); + sethandler(SIGSEGV, handle_and_longjmp, SA_RESETHAND | SA_ONSTACK); + nr = SYS_getpid; + asm volatile ("mov %[ss], %%ss; SYSENTER" : "+a" (nr) + : [ss] "m" (ss) : "flags", "rcx" +#ifdef __x86_64__ + , "r11" +#endif + ); + + /* We're unreachable here. SYSENTER forgets RIP. */ + } + + if (sigsetjmp(jmpbuf, 1) == 0) { + printf("[RUN]\tMOV SS; INT $0x80\n"); + sethandler(SIGSEGV, handle_and_longjmp, SA_RESETHAND); + nr = 20; /* compat getpid */ + asm volatile ("mov %[ss], %%ss; int $0x80" + : "+a" (nr) : [ss] "m" (ss) + : "flags" +#ifdef __x86_64__ + , "r8", "r9", "r10", "r11" +#endif + ); + } + + printf("[OK]\tI aten't dead\n"); + return 0; +} diff --git a/tools/testing/selftests/x86/mpx-mini-test.c b/tools/testing/selftests/x86/mpx-mini-test.c index 9c0325e1ea68..50f7e9272481 100644 --- a/tools/testing/selftests/x86/mpx-mini-test.c +++ b/tools/testing/selftests/x86/mpx-mini-test.c @@ -368,6 +368,11 @@ static int expected_bnd_index = -1; uint64_t shadow_plb[NR_MPX_BOUNDS_REGISTERS][2]; /* shadow MPX bound registers */ unsigned long shadow_map[NR_MPX_BOUNDS_REGISTERS]; +/* Failed address bound checks: */ +#ifndef SEGV_BNDERR +# define SEGV_BNDERR 3 +#endif + /* * The kernel is supposed to provide some information about the bounds * exception in the siginfo. It should match what we have in the bounds @@ -419,8 +424,6 @@ void handler(int signum, siginfo_t *si, void *vucontext) br_count++; dprintf1("#BR 0x%jx (total seen: %d)\n", status, br_count); -#define SEGV_BNDERR 3 /* failed address bound checks */ - dprintf2("Saw a #BR! status 0x%jx at %016lx br_reason: %jx\n", status, ip, br_reason); dprintf2("si_signo: %d\n", si->si_signo); diff --git a/tools/testing/selftests/x86/pkey-helpers.h b/tools/testing/selftests/x86/pkey-helpers.h index b3cb7670e026..254e5436bdd9 100644 --- a/tools/testing/selftests/x86/pkey-helpers.h +++ b/tools/testing/selftests/x86/pkey-helpers.h @@ -26,30 +26,26 @@ static inline void sigsafe_printf(const char *format, ...) { va_list ap; - va_start(ap, format); if (!dprint_in_signal) { + va_start(ap, format); vprintf(format, ap); + va_end(ap); } else { int ret; - int len = vsnprintf(dprint_in_signal_buffer, - DPRINT_IN_SIGNAL_BUF_SIZE, - format, ap); /* - * len is amount that would have been printed, - * but actual write is truncated at BUF_SIZE. + * No printf() functions are signal-safe. + * They deadlock easily. Write the format + * string to get some output, even if + * incomplete. */ - if (len > DPRINT_IN_SIGNAL_BUF_SIZE) - len = DPRINT_IN_SIGNAL_BUF_SIZE; - ret = write(1, dprint_in_signal_buffer, len); + ret = write(1, format, strlen(format)); if (ret < 0) - abort(); + exit(1); } - va_end(ap); } #define dprintf_level(level, args...) do { \ if (level <= DEBUG_LEVEL) \ sigsafe_printf(args); \ - fflush(NULL); \ } while (0) #define dprintf0(args...) dprintf_level(0, args) #define dprintf1(args...) dprintf_level(1, args) diff --git a/tools/testing/selftests/x86/protection_keys.c b/tools/testing/selftests/x86/protection_keys.c index f15aa5a76fe3..460b4bdf4c1e 100644 --- a/tools/testing/selftests/x86/protection_keys.c +++ b/tools/testing/selftests/x86/protection_keys.c @@ -72,10 +72,9 @@ extern void abort_hooks(void); test_nr, iteration_nr); \ dprintf0("errno at assert: %d", errno); \ abort_hooks(); \ - assert(condition); \ + exit(__LINE__); \ } \ } while (0) -#define raw_assert(cond) assert(cond) void cat_into_file(char *str, char *file) { @@ -87,12 +86,17 @@ void cat_into_file(char *str, char *file) * these need to be raw because they are called under * pkey_assert() */ - raw_assert(fd >= 0); + if (fd < 0) { + fprintf(stderr, "error opening '%s'\n", str); + perror("error: "); + exit(__LINE__); + } + ret = write(fd, str, strlen(str)); if (ret != strlen(str)) { perror("write to file failed"); fprintf(stderr, "filename: '%s' str: '%s'\n", file, str); - raw_assert(0); + exit(__LINE__); } close(fd); } @@ -191,26 +195,30 @@ void lots_o_noops_around_write(int *write_to_me) #ifdef __i386__ #ifndef SYS_mprotect_key -# define SYS_mprotect_key 380 +# define SYS_mprotect_key 380 #endif + #ifndef SYS_pkey_alloc -# define SYS_pkey_alloc 381 -# define SYS_pkey_free 382 +# define SYS_pkey_alloc 381 +# define SYS_pkey_free 382 #endif -#define REG_IP_IDX REG_EIP -#define si_pkey_offset 0x14 + +#define REG_IP_IDX REG_EIP +#define si_pkey_offset 0x14 #else #ifndef SYS_mprotect_key -# define SYS_mprotect_key 329 +# define SYS_mprotect_key 329 #endif + #ifndef SYS_pkey_alloc -# define SYS_pkey_alloc 330 -# define SYS_pkey_free 331 +# define SYS_pkey_alloc 330 +# define SYS_pkey_free 331 #endif -#define REG_IP_IDX REG_RIP -#define si_pkey_offset 0x20 + +#define REG_IP_IDX REG_RIP +#define si_pkey_offset 0x20 #endif @@ -225,8 +233,14 @@ void dump_mem(void *dumpme, int len_bytes) } } -#define SEGV_BNDERR 3 /* failed address bound checks */ -#define SEGV_PKUERR 4 +/* Failed address bound checks: */ +#ifndef SEGV_BNDERR +# define SEGV_BNDERR 3 +#endif + +#ifndef SEGV_PKUERR +# define SEGV_PKUERR 4 +#endif static char *si_code_str(int si_code) { @@ -289,13 +303,6 @@ void signal_handler(int signum, siginfo_t *si, void *vucontext) dump_mem(pkru_ptr - 128, 256); pkey_assert(*pkru_ptr); - si_pkey_ptr = (u32 *)(((u8 *)si) + si_pkey_offset); - dprintf1("si_pkey_ptr: %p\n", si_pkey_ptr); - dump_mem(si_pkey_ptr - 8, 24); - siginfo_pkey = *si_pkey_ptr; - pkey_assert(siginfo_pkey < NR_PKEYS); - last_si_pkey = siginfo_pkey; - if ((si->si_code == SEGV_MAPERR) || (si->si_code == SEGV_ACCERR) || (si->si_code == SEGV_BNDERR)) { @@ -303,6 +310,13 @@ void signal_handler(int signum, siginfo_t *si, void *vucontext) exit(4); } + si_pkey_ptr = (u32 *)(((u8 *)si) + si_pkey_offset); + dprintf1("si_pkey_ptr: %p\n", si_pkey_ptr); + dump_mem((u8 *)si_pkey_ptr - 8, 24); + siginfo_pkey = *si_pkey_ptr; + pkey_assert(siginfo_pkey < NR_PKEYS); + last_si_pkey = siginfo_pkey; + dprintf1("signal pkru from xsave: %08x\n", *pkru_ptr); /* need __rdpkru() version so we do not do shadow_pkru checking */ dprintf1("signal pkru from pkru: %08x\n", __rdpkru()); @@ -311,22 +325,6 @@ void signal_handler(int signum, siginfo_t *si, void *vucontext) dprintf1("WARNING: set PRKU=0 to allow faulting instruction to continue\n"); pkru_faults++; dprintf1("<<<<==================================================\n"); - return; - if (trapno == 14) { - fprintf(stderr, - "ERROR: In signal handler, page fault, trapno = %d, ip = %016lx\n", - trapno, ip); - fprintf(stderr, "si_addr %p\n", si->si_addr); - fprintf(stderr, "REG_ERR: %lx\n", - (unsigned long)uctxt->uc_mcontext.gregs[REG_ERR]); - exit(1); - } else { - fprintf(stderr, "unexpected trap %d! at 0x%lx\n", trapno, ip); - fprintf(stderr, "si_addr %p\n", si->si_addr); - fprintf(stderr, "REG_ERR: %lx\n", - (unsigned long)uctxt->uc_mcontext.gregs[REG_ERR]); - exit(2); - } dprint_in_signal = 0; } @@ -393,10 +391,15 @@ pid_t fork_lazy_child(void) return forkret; } -#define PKEY_DISABLE_ACCESS 0x1 -#define PKEY_DISABLE_WRITE 0x2 +#ifndef PKEY_DISABLE_ACCESS +# define PKEY_DISABLE_ACCESS 0x1 +#endif + +#ifndef PKEY_DISABLE_WRITE +# define PKEY_DISABLE_WRITE 0x2 +#endif -u32 pkey_get(int pkey, unsigned long flags) +static u32 hw_pkey_get(int pkey, unsigned long flags) { u32 mask = (PKEY_DISABLE_ACCESS|PKEY_DISABLE_WRITE); u32 pkru = __rdpkru(); @@ -418,7 +421,7 @@ u32 pkey_get(int pkey, unsigned long flags) return masked_pkru; } -int pkey_set(int pkey, unsigned long rights, unsigned long flags) +static int hw_pkey_set(int pkey, unsigned long rights, unsigned long flags) { u32 mask = (PKEY_DISABLE_ACCESS|PKEY_DISABLE_WRITE); u32 old_pkru = __rdpkru(); @@ -452,15 +455,15 @@ void pkey_disable_set(int pkey, int flags) pkey, flags); pkey_assert(flags & (PKEY_DISABLE_ACCESS | PKEY_DISABLE_WRITE)); - pkey_rights = pkey_get(pkey, syscall_flags); + pkey_rights = hw_pkey_get(pkey, syscall_flags); - dprintf1("%s(%d) pkey_get(%d): %x\n", __func__, + dprintf1("%s(%d) hw_pkey_get(%d): %x\n", __func__, pkey, pkey, pkey_rights); pkey_assert(pkey_rights >= 0); pkey_rights |= flags; - ret = pkey_set(pkey, pkey_rights, syscall_flags); + ret = hw_pkey_set(pkey, pkey_rights, syscall_flags); assert(!ret); /*pkru and flags have the same format */ shadow_pkru |= flags << (pkey * 2); @@ -468,8 +471,8 @@ void pkey_disable_set(int pkey, int flags) pkey_assert(ret >= 0); - pkey_rights = pkey_get(pkey, syscall_flags); - dprintf1("%s(%d) pkey_get(%d): %x\n", __func__, + pkey_rights = hw_pkey_get(pkey, syscall_flags); + dprintf1("%s(%d) hw_pkey_get(%d): %x\n", __func__, pkey, pkey, pkey_rights); dprintf1("%s(%d) pkru: 0x%x\n", __func__, pkey, rdpkru()); @@ -483,24 +486,24 @@ void pkey_disable_clear(int pkey, int flags) { unsigned long syscall_flags = 0; int ret; - int pkey_rights = pkey_get(pkey, syscall_flags); + int pkey_rights = hw_pkey_get(pkey, syscall_flags); u32 orig_pkru = rdpkru(); pkey_assert(flags & (PKEY_DISABLE_ACCESS | PKEY_DISABLE_WRITE)); - dprintf1("%s(%d) pkey_get(%d): %x\n", __func__, + dprintf1("%s(%d) hw_pkey_get(%d): %x\n", __func__, pkey, pkey, pkey_rights); pkey_assert(pkey_rights >= 0); pkey_rights |= flags; - ret = pkey_set(pkey, pkey_rights, 0); + ret = hw_pkey_set(pkey, pkey_rights, 0); /* pkru and flags have the same format */ shadow_pkru &= ~(flags << (pkey * 2)); pkey_assert(ret >= 0); - pkey_rights = pkey_get(pkey, syscall_flags); - dprintf1("%s(%d) pkey_get(%d): %x\n", __func__, + pkey_rights = hw_pkey_get(pkey, syscall_flags); + dprintf1("%s(%d) hw_pkey_get(%d): %x\n", __func__, pkey, pkey, pkey_rights); dprintf1("%s(%d) pkru: 0x%x\n", __func__, pkey, rdpkru()); @@ -674,10 +677,12 @@ int mprotect_pkey(void *ptr, size_t size, unsigned long orig_prot, struct pkey_malloc_record { void *ptr; long size; + int prot; }; struct pkey_malloc_record *pkey_malloc_records; +struct pkey_malloc_record *pkey_last_malloc_record; long nr_pkey_malloc_records; -void record_pkey_malloc(void *ptr, long size) +void record_pkey_malloc(void *ptr, long size, int prot) { long i; struct pkey_malloc_record *rec = NULL; @@ -709,6 +714,8 @@ void record_pkey_malloc(void *ptr, long size) (int)(rec - pkey_malloc_records), rec, ptr, size); rec->ptr = ptr; rec->size = size; + rec->prot = prot; + pkey_last_malloc_record = rec; nr_pkey_malloc_records++; } @@ -753,7 +760,7 @@ void *malloc_pkey_with_mprotect(long size, int prot, u16 pkey) pkey_assert(ptr != (void *)-1); ret = mprotect_pkey((void *)ptr, PAGE_SIZE, prot, pkey); pkey_assert(!ret); - record_pkey_malloc(ptr, size); + record_pkey_malloc(ptr, size, prot); rdpkru(); dprintf1("%s() for pkey %d @ %p\n", __func__, pkey, ptr); @@ -774,7 +781,7 @@ void *malloc_pkey_anon_huge(long size, int prot, u16 pkey) size = ALIGN_UP(size, HPAGE_SIZE * 2); ptr = mmap(NULL, size, PROT_NONE, MAP_ANONYMOUS|MAP_PRIVATE, -1, 0); pkey_assert(ptr != (void *)-1); - record_pkey_malloc(ptr, size); + record_pkey_malloc(ptr, size, prot); mprotect_pkey(ptr, size, prot, pkey); dprintf1("unaligned ptr: %p\n", ptr); @@ -847,7 +854,7 @@ void *malloc_pkey_hugetlb(long size, int prot, u16 pkey) pkey_assert(ptr != (void *)-1); mprotect_pkey(ptr, size, prot, pkey); - record_pkey_malloc(ptr, size); + record_pkey_malloc(ptr, size, prot); dprintf1("mmap()'d hugetlbfs for pkey %d @ %p\n", pkey, ptr); return ptr; @@ -869,7 +876,7 @@ void *malloc_pkey_mmap_dax(long size, int prot, u16 pkey) mprotect_pkey(ptr, size, prot, pkey); - record_pkey_malloc(ptr, size); + record_pkey_malloc(ptr, size, prot); dprintf1("mmap()'d for pkey %d @ %p\n", pkey, ptr); close(fd); @@ -918,13 +925,21 @@ void *malloc_pkey(long size, int prot, u16 pkey) } int last_pkru_faults; +#define UNKNOWN_PKEY -2 void expected_pk_fault(int pkey) { dprintf2("%s(): last_pkru_faults: %d pkru_faults: %d\n", __func__, last_pkru_faults, pkru_faults); dprintf2("%s(%d): last_si_pkey: %d\n", __func__, pkey, last_si_pkey); pkey_assert(last_pkru_faults + 1 == pkru_faults); - pkey_assert(last_si_pkey == pkey); + + /* + * For exec-only memory, we do not know the pkey in + * advance, so skip this check. + */ + if (pkey != UNKNOWN_PKEY) + pkey_assert(last_si_pkey == pkey); + /* * The signal handler shold have cleared out PKRU to let the * test program continue. We now have to restore it. @@ -939,10 +954,11 @@ void expected_pk_fault(int pkey) last_si_pkey = -1; } -void do_not_expect_pk_fault(void) -{ - pkey_assert(last_pkru_faults == pkru_faults); -} +#define do_not_expect_pk_fault(msg) do { \ + if (last_pkru_faults != pkru_faults) \ + dprintf0("unexpected PK fault: %s\n", msg); \ + pkey_assert(last_pkru_faults == pkru_faults); \ +} while (0) int test_fds[10] = { -1 }; int nr_test_fds; @@ -1151,12 +1167,15 @@ void test_pkey_alloc_exhaust(int *ptr, u16 pkey) pkey_assert(i < NR_PKEYS*2); /* - * There are 16 pkeys supported in hardware. One is taken - * up for the default (0) and another can be taken up by - * an execute-only mapping. Ensure that we can allocate - * at least 14 (16-2). + * There are 16 pkeys supported in hardware. Three are + * allocated by the time we get here: + * 1. The default key (0) + * 2. One possibly consumed by an execute-only mapping. + * 3. One allocated by the test code and passed in via + * 'pkey' to this function. + * Ensure that we can allocate at least another 13 (16-3). */ - pkey_assert(i >= NR_PKEYS-2); + pkey_assert(i >= NR_PKEYS-3); for (i = 0; i < nr_allocated_pkeys; i++) { err = sys_pkey_free(allocated_pkeys[i]); @@ -1165,6 +1184,35 @@ void test_pkey_alloc_exhaust(int *ptr, u16 pkey) } } +/* + * pkey 0 is special. It is allocated by default, so you do not + * have to call pkey_alloc() to use it first. Make sure that it + * is usable. + */ +void test_mprotect_with_pkey_0(int *ptr, u16 pkey) +{ + long size; + int prot; + + assert(pkey_last_malloc_record); + size = pkey_last_malloc_record->size; + /* + * This is a bit of a hack. But mprotect() requires + * huge-page-aligned sizes when operating on hugetlbfs. + * So, make sure that we use something that's a multiple + * of a huge page when we can. + */ + if (size >= HPAGE_SIZE) + size = HPAGE_SIZE; + prot = pkey_last_malloc_record->prot; + + /* Use pkey 0 */ + mprotect_pkey(ptr, size, prot, 0); + + /* Make sure that we can set it back to the original pkey. */ + mprotect_pkey(ptr, size, prot, pkey); +} + void test_ptrace_of_child(int *ptr, u16 pkey) { __attribute__((__unused__)) int peek_result; @@ -1228,7 +1276,7 @@ void test_ptrace_of_child(int *ptr, u16 pkey) pkey_assert(ret != -1); /* Now access from the current task, and expect NO exception: */ peek_result = read_ptr(plain_ptr); - do_not_expect_pk_fault(); + do_not_expect_pk_fault("read plain pointer after ptrace"); ret = ptrace(PTRACE_DETACH, child_pid, ignored, 0); pkey_assert(ret != -1); @@ -1241,12 +1289,9 @@ void test_ptrace_of_child(int *ptr, u16 pkey) free(plain_ptr_unaligned); } -void test_executing_on_unreadable_memory(int *ptr, u16 pkey) +void *get_pointer_to_instructions(void) { void *p1; - int scratch; - int ptr_contents; - int ret; p1 = ALIGN_PTR_UP(&lots_o_noops_around_write, PAGE_SIZE); dprintf3("&lots_o_noops: %p\n", &lots_o_noops_around_write); @@ -1256,7 +1301,23 @@ void test_executing_on_unreadable_memory(int *ptr, u16 pkey) /* Point 'p1' at the *second* page of the function: */ p1 += PAGE_SIZE; + /* + * Try to ensure we fault this in on next touch to ensure + * we get an instruction fault as opposed to a data one + */ madvise(p1, PAGE_SIZE, MADV_DONTNEED); + + return p1; +} + +void test_executing_on_unreadable_memory(int *ptr, u16 pkey) +{ + void *p1; + int scratch; + int ptr_contents; + int ret; + + p1 = get_pointer_to_instructions(); lots_o_noops_around_write(&scratch); ptr_contents = read_ptr(p1); dprintf2("ptr (%p) contents@%d: %x\n", p1, __LINE__, ptr_contents); @@ -1272,12 +1333,55 @@ void test_executing_on_unreadable_memory(int *ptr, u16 pkey) */ madvise(p1, PAGE_SIZE, MADV_DONTNEED); lots_o_noops_around_write(&scratch); - do_not_expect_pk_fault(); + do_not_expect_pk_fault("executing on PROT_EXEC memory"); ptr_contents = read_ptr(p1); dprintf2("ptr (%p) contents@%d: %x\n", p1, __LINE__, ptr_contents); expected_pk_fault(pkey); } +void test_implicit_mprotect_exec_only_memory(int *ptr, u16 pkey) +{ + void *p1; + int scratch; + int ptr_contents; + int ret; + + dprintf1("%s() start\n", __func__); + + p1 = get_pointer_to_instructions(); + lots_o_noops_around_write(&scratch); + ptr_contents = read_ptr(p1); + dprintf2("ptr (%p) contents@%d: %x\n", p1, __LINE__, ptr_contents); + + /* Use a *normal* mprotect(), not mprotect_pkey(): */ + ret = mprotect(p1, PAGE_SIZE, PROT_EXEC); + pkey_assert(!ret); + + dprintf2("pkru: %x\n", rdpkru()); + + /* Make sure this is an *instruction* fault */ + madvise(p1, PAGE_SIZE, MADV_DONTNEED); + lots_o_noops_around_write(&scratch); + do_not_expect_pk_fault("executing on PROT_EXEC memory"); + ptr_contents = read_ptr(p1); + dprintf2("ptr (%p) contents@%d: %x\n", p1, __LINE__, ptr_contents); + expected_pk_fault(UNKNOWN_PKEY); + + /* + * Put the memory back to non-PROT_EXEC. Should clear the + * exec-only pkey off the VMA and allow it to be readable + * again. Go to PROT_NONE first to check for a kernel bug + * that did not clear the pkey when doing PROT_NONE. + */ + ret = mprotect(p1, PAGE_SIZE, PROT_NONE); + pkey_assert(!ret); + + ret = mprotect(p1, PAGE_SIZE, PROT_READ|PROT_EXEC); + pkey_assert(!ret); + ptr_contents = read_ptr(p1); + do_not_expect_pk_fault("plain read on recently PROT_EXEC area"); +} + void test_mprotect_pkey_on_unsupported_cpu(int *ptr, u16 pkey) { int size = PAGE_SIZE; @@ -1302,6 +1406,8 @@ void (*pkey_tests[])(int *ptr, u16 pkey) = { test_kernel_gup_of_access_disabled_region, test_kernel_gup_write_to_write_disabled_region, test_executing_on_unreadable_memory, + test_implicit_mprotect_exec_only_memory, + test_mprotect_with_pkey_0, test_ptrace_of_child, test_pkey_syscalls_on_non_allocated_pkey, test_pkey_syscalls_bad_args, diff --git a/tools/usb/usbip/libsrc/vhci_driver.c b/tools/usb/usbip/libsrc/vhci_driver.c index c9c81614a66a..4204359c9fee 100644 --- a/tools/usb/usbip/libsrc/vhci_driver.c +++ b/tools/usb/usbip/libsrc/vhci_driver.c @@ -135,11 +135,11 @@ static int refresh_imported_device_list(void) return 0; } -static int get_nports(void) +static int get_nports(struct udev_device *hc_device) { const char *attr_nports; - attr_nports = udev_device_get_sysattr_value(vhci_driver->hc_device, "nports"); + attr_nports = udev_device_get_sysattr_value(hc_device, "nports"); if (!attr_nports) { err("udev_device_get_sysattr_value nports failed"); return -1; @@ -242,35 +242,41 @@ static int read_record(int rhport, char *host, unsigned long host_len, int usbip_vhci_driver_open(void) { + int nports; + struct udev_device *hc_device; + udev_context = udev_new(); if (!udev_context) { err("udev_new failed"); return -1; } - vhci_driver = calloc(1, sizeof(struct usbip_vhci_driver)); - /* will be freed in usbip_driver_close() */ - vhci_driver->hc_device = + hc_device = udev_device_new_from_subsystem_sysname(udev_context, USBIP_VHCI_BUS_TYPE, USBIP_VHCI_DEVICE_NAME); - if (!vhci_driver->hc_device) { + if (!hc_device) { err("udev_device_new_from_subsystem_sysname failed"); goto err; } - vhci_driver->nports = get_nports(); - dbg("available ports: %d", vhci_driver->nports); - - if (vhci_driver->nports <= 0) { + nports = get_nports(hc_device); + if (nports <= 0) { err("no available ports"); goto err; - } else if (vhci_driver->nports > MAXNPORT) { - err("port number exceeds %d", MAXNPORT); + } + dbg("available ports: %d", nports); + + vhci_driver = calloc(1, sizeof(struct usbip_vhci_driver) + + nports * sizeof(struct usbip_imported_device)); + if (!vhci_driver) { + err("vhci_driver allocation failed"); goto err; } + vhci_driver->nports = nports; + vhci_driver->hc_device = hc_device; vhci_driver->ncontrollers = get_ncontrollers(); dbg("available controllers: %d", vhci_driver->ncontrollers); @@ -285,7 +291,7 @@ int usbip_vhci_driver_open(void) return 0; err: - udev_device_unref(vhci_driver->hc_device); + udev_device_unref(hc_device); if (vhci_driver) free(vhci_driver); diff --git a/tools/usb/usbip/libsrc/vhci_driver.h b/tools/usb/usbip/libsrc/vhci_driver.h index 418b404d5121..6c9aca216705 100644 --- a/tools/usb/usbip/libsrc/vhci_driver.h +++ b/tools/usb/usbip/libsrc/vhci_driver.h @@ -13,7 +13,6 @@ #define USBIP_VHCI_BUS_TYPE "platform" #define USBIP_VHCI_DEVICE_NAME "vhci_hcd.0" -#define MAXNPORT 128 enum hub_speed { HUB_SPEED_HIGH = 0, @@ -41,7 +40,7 @@ struct usbip_vhci_driver { int ncontrollers; int nports; - struct usbip_imported_device idev[MAXNPORT]; + struct usbip_imported_device idev[]; }; diff --git a/tools/usb/usbip/src/usbip_detach.c b/tools/usb/usbip/src/usbip_detach.c index 9db9d21bb2ec..777f7286a0c5 100644 --- a/tools/usb/usbip/src/usbip_detach.c +++ b/tools/usb/usbip/src/usbip_detach.c @@ -43,9 +43,12 @@ void usbip_detach_usage(void) static int detach_port(char *port) { - int ret; + int ret = 0; uint8_t portnum; char path[PATH_MAX+1]; + int i; + struct usbip_imported_device *idev; + int found = 0; unsigned int port_len = strlen(port); @@ -55,27 +58,48 @@ static int detach_port(char *port) return -1; } - /* check max port */ - portnum = atoi(port); - /* remove the port state file */ + ret = usbip_vhci_driver_open(); + if (ret < 0) { + err("open vhci_driver"); + return -1; + } + + /* check for invalid port */ + for (i = 0; i < vhci_driver->nports; i++) { + idev = &vhci_driver->idev[i]; + + if (idev->port == portnum) { + found = 1; + if (idev->status != VDEV_ST_NULL) + break; + info("Port %d is already detached!\n", idev->port); + goto call_driver_close; + } + } + if (!found) { + err("Invalid port %s > maxports %d", + port, vhci_driver->nports); + goto call_driver_close; + } + + /* remove the port state file */ snprintf(path, PATH_MAX, VHCI_STATE_PATH"/port%d", portnum); remove(path); rmdir(VHCI_STATE_PATH); - ret = usbip_vhci_driver_open(); + ret = usbip_vhci_detach_device(portnum); if (ret < 0) { - err("open vhci_driver"); - return -1; + ret = -1; + err("Port %d detach request failed!\n", portnum); + goto call_driver_close; } + info("Port %d is now detached!\n", portnum); - ret = usbip_vhci_detach_device(portnum); - if (ret < 0) - return -1; - +call_driver_close: usbip_vhci_driver_close(); return ret; diff --git a/tools/virtio/linux/dma-mapping.h b/tools/virtio/linux/dma-mapping.h index 1571e24e9494..f91aeb5fe571 100644 --- a/tools/virtio/linux/dma-mapping.h +++ b/tools/virtio/linux/dma-mapping.h @@ -6,8 +6,6 @@ # error Virtio userspace code does not support CONFIG_HAS_DMA #endif -#define PCI_DMA_BUS_IS_PHYS 1 - enum dma_data_direction { DMA_BIDIRECTIONAL = 0, DMA_TO_DEVICE = 1, |