summaryrefslogtreecommitdiffstats
path: root/gcc/cse.c
Commit message (Collapse)AuthorAgeFilesLines
...
* Merge in gcc2 snapshot 19980929. See gcc/ChangeLog and gcc/FSFChangeLog forlaw1999-01-271-1/+1
| | | | | | | details. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24879 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (fold_rtx): Revert 29 Dec change.rth1999-01-211-21/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | (cse_insn): Revert 12 Jan change. * expr.c (expand_builtin): Don't emit CONST around CONSTANT_P_RTX. * regclass.c (reg_scan_mark_refs): Revert 29 Dec change. * rtl.def: Likewise. * rtl.h (CONSTANT_P): Likewise. * expr.c (emit_move_insn): Never try to flush CONSTANT_P_RTX to memory. * recog.c (immediate_operand): Accept CONSTANT_P_RTX. * alpha.c (input_operand): Likewise. * c4x.c (const_operand): Likewise. * explow.c (allocate_dynamic_stack_space): Use register_operand instead of arith_operand, which does not exist. * 1750a.h: Fix comment closure. * a29k.c (a29k_set_memflags): Fix typo in 19 Jan change. * arc.md (one_cmplsi2_set_cc_insn): Fix set mode mismatch. * arm.h (TARGET_SWITCHES): Fix typo. * i370.md (anon mult and div patterns): Fix set mode mismatch. * i860.c (output_delayed_branch): Fix operands to constrain_operands. (output_delay_insn): Likewise. * m88k.md (anon rotate insns): Fix set mode mismatch. (anon BLKmode moves): Commonize and fix set mode mismatches. * ns32k.md (udivmoddi[shq]i4_internal): Fix mode mismatch. * romp.md (movdf): Fix typo. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24796 138bc75d-0d04-0410-961f-82ee72b054a4
* Update copyrightsmmitchel1999-01-191-1/+1
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24765 138bc75d-0d04-0410-961f-82ee72b054a4
* * rtl.h (rtx_def): Update documentation.mmitchel1999-01-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | (MEM_IN_STRUCT_P): Likewise. (MEM_SCALAR_P): New macro. (MEM_COPY_ATTRIBUTES): Likewise. (MEM_SET_IN_STRUCT_P): Likewise. * rtl.texi (MEM_SCALAR_P): Document. * alias.c (canon_rtx): Use MEM_COPY_ATTRIBUTES. (fixed_scalar_and_varying_struct_p): New function. Use MEM_SCALAR_P rather than !MEM_IN_STRUCT_P. (aliases_everything_p): Likewise. (true_dependence): Use them. (write_dependence_p): New function, containing code common to anti_dependence and output_dependence. (anti_dependence): Use it. (output_dependence): Likewise. * calls.c (save_fixed_argument_area): Don't clear MEM_IN_STRUCT_P. (expand_call): Use MEM_SET_IN_STRUCT_P. (emit_library_call): Don't clear MEM_IN_STRUCT_P. (emit_library_call_value): Likewise. (store_one_arg): Use MEM_SET_IN_STRUCT_P. * combine.c (simplify_rtx): Use MEM_COPY_ATTRIBUTES. (make_extraction): Likewise. (simplify_shift_const): Likewise. (gen_lowpart_for_combine): Likewise. * cse.c (gen_lowpart_if_possible): Use MEM_COPY_ATTRIBUTES. * emit-rtl.c (operand_subword): Likewise. (change_address): Likewise. * explow.c (stabilize): Use MEM_COPY_ATTRIBUTES. * expr.c (protect_from_queue): Use MEM_COPY_ATTRIBUTES. (emit_group_store): Use MEM_SET_IN_STRUCT_P. (copy_blkmode_from_reg): Likewise. (store_field): Likewise. (expand_expr): Remove bogus guesswork setting MEM_IN_STRUCT_P heuristically. Use MEM_SET_IN_STRUCT_P. (get_memory_rtx): Likewise. * final.c (alter_subreg): Use MEM_COPY_ATTRIBUTES. * function.c (assign_stack_temp): Clear MEM_SCALAR_P and MEM_ALIAS_SET on newly returned MEMs. (assign_temp): Use MEM_SET_IN_STRUCT_P. (put_reg_into_stack): Likewise. (fixup_var_refs1): Use MEM_COPY_ATTRIBUTES. (gen_mem_addressof): Use MEM_SET_IN_STRUCT_P. (assign_parms): Likewise. (expand_function): Likewise. * integrate.c (expand_inline_function): Likewise. (copy_rtx_and_substitute): Use MEM_COPY_ATTRIBUTES. * loop.c (note_addr_stored): Remove check on MEM_IN_STRUCT_P. * optabs.c (gen_move_insn): Use MEM_COPY_ATTRIBUTES. * print-rtl.c (print_rtx): Print /f for frame_related. * recog.c (validate_replace_rtx_1): Use MEM_COPY_ATTRIBUTES. * reload1.c (reload): Copy MEM_SCALAR_P as well. * stmt.c (expand_decl): Use MEM_SET_IN_STRUCT_P. (expand_anon_union_decl): Use MEM_COPY_ATTRIBUTES. * varasm.c (make_decl_rtl): Use MEM_SET_IN_STRUCT_P. (output_constant_def): Likewise. * a29k.c (a29k_set_memflags_1): Take scalar_p. Set MEM_SCALAR_P. (a29k_set_memflags): Use it. * alpha.c (get_aligned_mem): Use MEM_COPY_ATTRIBUTES. * c4x.c (c4x_scan_for_ld): Likewise. * h8300.c (fix_bit_operand): Likewise. * m88k.c (legitimize_address): Likewise. (block_move_loop): Likewise. (block_move_no_loop): Likewise. (block_move_sequence): Likewise. (m88k_builtin_saveregs): Use MEM_SET_IN_STRUCT_P. * mips/abi64.h (SETUP_INCOMING_VARARGS): Likewise. * rs6000.c (expand_block_move_insn): Use MEM_COPY_ATTRIBUTES. * sh.c (sh_builtin_saveregs): Use MEM_SET_IN_STRUCT_P. * arm.h (arm_gen_load_multiple): Take scalar_p. (arm_store_load_multiple): Likewise. * arm.c (arm_gen_load_multiple): Likewise. (arm_gen_store_multiple): Likewise. (arm_gen_movstrqi): Treat MEM_SCALAR_P like MEM_IN_STRUCT_P. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24759 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_insn): Never prefer (const (constant_p_rtx)).rth1999-01-121-0/+6
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24637 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (invalidate_skipped_block): Call invalidate_from_clobberslaw1998-12-301-0/+1
| | | | | | | | for each insn in the skipped block. Fixes m68k codegen bug. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24450 138bc75d-0d04-0410-961f-82ee72b054a4
* Richard Kenner <kenner@vlsi1.ultra.nyu.edu>:rth1998-12-291-6/+15
| | | | | | | | | | | | | | | * rtl.def (CONSTANT_P_RTX): Clarify commentary. * expr.c (expand_builtin, case BUILT_IN_CONSTANT_P): Rework to consider constant CONSTRUCTOR constant and to defer some cases to cse. * cse.c (fold_rtx, case CONST): Add handling for CONSTANT_P_RTX. * regclass.c (reg_scan_mark_refs, case CONST): Likewise. Richard Henderson <rth@cygnus.com> * expr.c (init_expr_once): Kill can_handle_constant_p recognition. * cse.c (fold_rtx, case 'x'): Remove standalone CONSTANT_P_RTX code. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24439 138bc75d-0d04-0410-961f-82ee72b054a4
* Warning fixes:ghazi1998-12-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * alias.c (record_alias_subset): Remove ignored `&'. (init_alias_once): Likewise. * c-lex.c (UNGETC): Cast first argument of comma expression to void. * config/mips/mips.c (mips_asm_file_end): Cast the result of fwrite to `int' when comparing against one. * config/mips/mips.h (CAN_ELIMINATE): Add parens around && within ||. (INITIAL_ELIMINATION_OFFSET): Add braces to avoid ambiguous `else'. * cse.c (rehash_using_reg): Change type of variable `i' to unsigned int. * dwarf2out.c (initial_return_save): Cast -1 to unsigned before assigning it to one. * except.c (duplicate_eh_handlers): Remove unused variable `tmp'. * final.c (final_scan_insn): Likewise for variable `i'. (output_asm_insn): Cast a char to unsigned char when used as an array index. * gcse.c (compute_pre_ppinout): Cast -1 to SBITMAP_ELT_TYPE when assigning it to one. * loop.c (strength_reduce): Remove unused variables `count' and `temp'. * recog.c (preprocess_constraints): Cast a char to unsigned char when used as an array index. * regmove.c (find_matches): Likewise. * reload1.c (calculate_needs): Add default case in switch. (eliminate_regs_in_insn): Initialize variable `offset'. (set_offsets_for_label): Change type of variable `i' to unsigned. (reload_as_needed): Wrap variable `i' in macro check on AUTO_INC_DEC || INSN_CLOBBERS_REGNO_P. * scan-decls.c (scan_decls): Mark parameters `argc' and `argv' with ATTRIBUTE_UNUSED. Cast variable `start_written' to size_t when comparing against one. * stor-layout.c (layout_decl): Cast maximum_field_alignment to unsigned when comparing against one. Likewise for GET_MODE_ALIGNMENT(). (layout_record): Cast record_align to int when comparing against a signed value. (layout_type): Cast TYPE_ALIGN() to int when comparing against a signed value. * tree.c (get_identifier): Cast variable `len' to unsigned when comparing against one. (maybe_get_identifier): Likewise git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24403 138bc75d-0d04-0410-961f-82ee72b054a4
* Fix alpha-x-m32r-elf bugs.wilson1998-12-101-0/+13
| | | | | | | | | | | | | * cse.c (simplify_unary_operation): Sign-extend constants when they have the most significant bit set for the target. * real.c (endian): Sign-extend 32 bit output values on a 64 bit host. * m32r/m32r.c (m32r_expand_prologue): Store pretend_size in HOST_WIDE_INT temporary before negating it. * m32r/m32r.md (movsi_insn+1): Use ~0xffff instead of 0xffff0000. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@24254 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (fold_rtx): Make autoincrement addressing mode tests belaw1998-11-241-8/+8
| | | | | | | | | | | | | | | | | | | runtime selectable. * expr.c (move_by_pieces): Similarly. (move_by_pieces_1, clear_by_pieces, clear_by_pieces_1): Similarly. * flow.c (find_auto_inc): Similarly. (try_pre_increment): Similarly. * loop.c (strength_reduce): Similarly. * regclass.c (auto_inc_dec_reg_p): Similarly. * regmove.c (try_auto_increment): Similarly. (fixup_match_1): Similarly. * rtl.h (HAVE_PRE_INCREMENT): Define if not already defined. (HAVE_PRE_DECREMENT): Similarly. (HAVE_POST_INCREMENT, HAVE_POST_DECREMENT): Similarly. sponding changes to all target header files. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@23837 138bc75d-0d04-0410-961f-82ee72b054a4
* Warning fixes:ghazi1998-10-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Makefile.in (flow.o): Depend on recog.h. * cpplib.h (directive_table): Add missing initializiers. (finclude): Change type of variable `bsize' to size_t. * cse.c (rtx_cost): Mark parameter `outer_code' with ATTRIBUTE_UNUSED. * dwarfout.h (dwarfout_label): Wrap prototype in macro RTX_CODE. * fix-header.c (lookup_std_proto): Cast the result of `strlen' to `int' when comparing against one. (cpp_file_line_for_message): Mark parameter `pfile' with ATTRIBUTE_UNUSED. (cpp_fatal): Mark parameter `pfile' with ATTRIBUTE_UNUSED. * flow.c: Include recog.h. (sbitmap_copy): Cast arguments 1 & 2 of `bcopy' to (PTR). * function.c (thread_prologue_and_epilogue_insns): Mark parameter `f' with ATTRIBUTE_UNUSED. (reposition_prologue_and_epilogue_notes): Likewise. * genopinit.c (gen_insn): Cast argument of ctype functions to `unsigned char'. * haifa-sched.c: Include recog.h. (blockage_range): Cast result of UNIT_BLOCKED macro to (int) when comparing against one. * libgcc2.a (__throw): Revert ATTRIBUTE_UNUSED change for now. * mips-tfile.c (parse_end): Cast the argument of ctype function to `unsigned char'. (parse_ent): Likewise. (parse_input): Likewise. * optabs.c (init_libfuncs): Likewise. * protoize.c (find_rightmost_formals_list): Likewise. * recog.h (const_double_operand): Fix typo in prototype. * tlink.c (scan_linker_output): Cast the argument of ctype function to `unsigned char'. * toplev.c (check_lang_option): Cast the result of `strlen' to `int' when comparing against one. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@23155 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_basic_block): Fixup hash flushing loop so we do notdavem1998-10-161-5/+5
| | | | | | | | accidently walk into the free list. Comment how that can happen. (invalidate): Fix indentation. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@23122 138bc75d-0d04-0410-961f-82ee72b054a4
* Check for NULL return from gen_lowpart_if_possible().nickc1998-10-131-1/+1
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@23049 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (insert_regs): Fix bug in Sep 24 change.amylaar1998-10-061-1/+1
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@22866 138bc75d-0d04-0410-961f-82ee72b054a4
* * expr.c (store_constructor): When initializing a field that is smalleramylaar1998-09-241-3/+131
| | | | | | | | | | | | | | | | than a word, at the start of a word, try to widen it to a full word. * cse.c (cse_insn): When we are about to change a register, remove any invalid references to it. (remove_invalid_subreg_refs): New function. (mention_regs): Special treatment for SUBREGs. (insert_regs): Don't strip SUBREG for call to mention_regs. Check if reg_tick needs to be bumped up before that call. (lookup_as_function): Try to match known word_mode constants when looking for a norrower constant. (canon_hash): Special treatment for SUBREGs. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@22567 138bc75d-0d04-0410-961f-82ee72b054a4
* * i386.h (MODES_TIEABLE_P): Reorganize to shut up warnings.jason1998-08-141-1/+1
| | | | | | | | * alias.c (memrefs_conflict_p): Add braces to shut up warnings. * cse.c (cse_basic_block): Add parens to shut up warnings. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@21734 138bc75d-0d04-0410-961f-82ee72b054a4
* vmakarov1998-07-281-3/+7
| | | | | | | | | * cse.c (cse_insn): Enable subsitution inside libcall only for REG, SUBREG, MEM. * rtlanal.c (replace_rtx): Prohibit replaces in CONST_DOUBLE. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@21435 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (count_reg_usage): Count registers used in addresses oflaw1998-07-081-1/+7
| | | | | | | CLOBBERs. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@21012 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse (cse_insn): Don't make change without validation.amylaar1998-07-071-11/+18
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20996 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (CSE_ADDRESS_COST): New macro, based on ADDRESS_COST, butmmitchel1998-07-061-17/+29
| | | | | | | | dealing with ADDRESSOF. (find_best_addr): Use it. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20945 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_insn): Second arg is an RTX now. Update all callers.law1998-07-051-10/+23
| | | | | | | | (cse_basic_block): Keep track of the current RETVAL insn for a libcall instead of just noting that we're in a libcall. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20936 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_insn): When SETting (MEM (ADDRESSOF (X))) to Y,law1998-07-051-2/+13
| | | | | | | don't claim that the former is equivalent to the latter. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20935 138bc75d-0d04-0410-961f-82ee72b054a4
* * expr.c (emit_group_load, emit_group_store): Rewrite consideringrth1998-07-011-0/+18
| | | | | | | | | | the size and alignment of the structure being manipulated. * expr.c, calls.c, function.c: Update all callers. * expr.h: Update prototypes. * cse.c (invalidate): Cope with parallels. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20867 138bc75d-0d04-0410-961f-82ee72b054a4
* * rtl.def (CONSTANT_P_RTX): New.rth1998-06-301-0/+6
| | | | | | | | | | | | * rtl.h (CONSTANT_P): Recognize it. * cse.c (fold_rtx): Eliminate it. * expr.c (can_handle_constant_p): New variable. (init_expr_once): Initialize it. (expand_builtin): Generate CONSTANT_P_RTX if the expression is not immediately recognizable as a constant. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20846 138bc75d-0d04-0410-961f-82ee72b054a4
* * Merge from gcc2 June 9, 1998 snapshot. See ChangeLog.13 forlaw1998-06-291-1/+1
| | | | | | | details. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20808 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_basic_block): Don't include NOTE insns in the countmmitchel1998-06-171-5/+8
| | | | | | | | that is used to decide whether or not it is time to erase the equivalence table. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20548 138bc75d-0d04-0410-961f-82ee72b054a4
* Warning fixes:ghazi1998-06-081-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Makefile.in (varasm.o): Depend on dbxout.h. (cse.o): Depend on toplev.h and output.h. (gcse.o): Depend on output.h. * mips.c: Include system.h and toplev.h and remove redundant code. Include output.h after tree.h so all its prototypes get activated. * mips.md (table_jump): Remove unused variable `dest'. * sparc.h: Add prototype for `v8plus_regcmp_op'. * crtstuff.c (fini_dummy, init_dummy): Mark function definitions with __attribute__ ((__unused__)). (__frame_dummy): Provide prototype before use, wrap it with EH_FRAME_SECTION_ASM_OP. * cse.c: Move inclusion of <setjmp.h> above local headers. Include toplev.h and output.h. * dbxout.h: Add prototype for `dbxout_begin_function'. * final.c (final_scan_insn): Wrap variable `max_skip' in macro ASM_OUTPUT_MAX_SKIP_ALIGN. * gcse.c: Include system.h and output.h. (dump_cuid_table, dump_rd_table, dump_cprop_data, dump_pre_data): Make extern instead of static. (compute_can_copy): Only declare variables `reg' and `insn' when AVOID_CCMODE_COPIES is not defined. (record_set_info): Mark parameter `setter' with ATTRIBUTE_UNUSED. (hash_scan_clobber): Likewise for `x' and `insn'. (hash_scan_call): Likewise. (record_last_set_info): Likewise for `setter'. (mark_call): Likewise for `pat'. (pre_insert_insn): Wrap variable `note' in macro HAVE_cc0. * libgcc2.c (__bb_init_prg): Replace bzero with memset and fix the length parameter so that it multiplies the number of elements by the sizeof(element). * output.h: Add prototype for `weak_finish'. * recog.h: Likewise for `validate_replace_src'. * rtl.h: Likewise for `optimize_save_area_alloca', `fix_sched_param', `purge_addressof', `gcse_main', `regmove_optimize', `dbr_schedule', `branch_prob' and `end_branch_prob'. * toplev.h: Likewise for `set_float_handler' and `output_quoted_string'. * varasm.c: Include dbxout.h. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@20351 138bc75d-0d04-0410-961f-82ee72b054a4
* * m68k.h: Declare more functions used in macros.law1998-05-231-1/+4
| | | | | | | | | | | | | | | | | | | (REG_CLASS_CONTENTS): Completely embrace initializer. * m68k.md (adddi3, subdi3): Add abort call to avoid warning about returning no value. * cse.c (find_best_addr): Declare p and found_better only if needed. * dbxout.c (dbxout_continue): Define only if DBX_CONTIN_LENGTH > 0. * dwarfout.c (string_length_attribute): #if 0 away. * function.c (expand_function_end): Define varible blktramp only if needed. * jump.c (find_insert_position): Define only if !HAVE_cc0. * loop.c (combine_givs_p): Define variable tem only if needed. * real.c: Comment out unused functions eabs, eround, e{24,53,64,113}toasc and eiinfin. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@19998 138bc75d-0d04-0410-961f-82ee72b054a4
* Warning fixes:ghazi1998-05-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Makefile.in (c-lang.o): Depend on c-tree.h, c-lex.h and toplev.h. (c-lex.o): Depend on output.h. (c-common.o): Likewise. (stmt.o): Likewise. (calls.o): Likewise. (integrate.o): Depend on toplev.h. (regclass.o): Depend on output.h. (final.o): Depend on reload.h. * c-common.c: Include output.h. (check_format_info): Remove unused variable `integral_format'. * c-decl.c (print_lang_decl): Mark parameters `file', `node' and `indent' with ATTRIBUTE_UNUSED. (print_lang_type): Likewise. (maybe_build_cleanup): Likewise for parameter `decl'. (copy_lang_decl): Likewise for parameter `node'. * c-lang.c: Include c-tree.h, c-lex.h and toplev.h. (lang_print_xnode): Mark parameters `file', `node' and `indent' with ATTRIBUTE_UNUSED. (lookup_interface): Likewise for parameter `arg'. (is_class_name): Likewise. (maybe_objc_check_decl): Likewise for parameter `decl'. (maybe_objc_comptypes): Likewise for parameters `lhs', `rhs' and `reflexive'. (maybe_objc_method_name): Likewise for parameter `decl'. (build_objc_string): Likewise for parameters `len' and `str'. * c-lex.c: Include output.h. * c-lex.h (position_after_white_space): Correct typo in prototype. * c-tree.h (finish_file, c_expand_start_cond, c_expand_start_else, c_expand_end_cond, init_iterators): Add prototypes. * caller-save.c (set_reg_live): Mark parameters `reg' and `setter' with ATTRIBUTE_UNUSED. * calls.c: Include output.h. * cccp.c (pipe_closed): Mark parameter `signo' with ATTRIBUTE_UNUSED. * combine.c: Move inclusion of expr.h to after insn-config.h. * iris6.h (ASM_IDENTIFY_GCC, ASM_IDENTIFY_LANGUAGE): Don't define as empty, rather define as ((void)0). * sparc.c (sparc_check_64): Add braces around ambiguous `else'. Add parentheses around assignment used as truth value. * cplus-dem.c (squangle_mop_up): Change return type to void. (internal_cplus_demangle): Remove unused parameter `options'. All callers changed. (cplus_demangle_opname): Remove function wide variable `int i' and replace with `size_t i' at each location where it is used. (cplus_demangle_opname): change type of `i' from int to size_t. * cppexp.c (right_shift): Mark parameter `pfile' with ATTRIBUTE_UNUSED. * cpphash.c (cpp_lookup): Likewise. (cpp_hash_cleanup): Likewise. * cpplib.c (parse_name): Add a prototype and make it static. (null_underflow): Mark parameter `pfile' with ATTRIBUTE_UNUSED. (null_cleanup): Likewise for parameters `pbuf' and `pfile'. (macro_cleanup): Likewise for parameter `pfile'. (file_cleanup): Likewise. * cpplib.h (cpp_reader_init, cpp_options_init, cpp_start_read, cpp_read_check_assertion, skip_rest_of_line): Add prototypes. * crtstuff.c (force_to_data, __CTOR_LIST__, force_to_data, __DTOR_END__, __FRAME_END__): Mark with ATTRIBUTE_UNUSED. * cse.c (cse_check_loop_start): Mark parameter `set' with ATTRIBUTE_UNUSED. * dbxout.c (flag_minimal_debug, have_used_extensions, source_label_number): Move inside macro wrapper check against defined (DBX_DEBUGGING_INFO) || defined (XCOFF_DEBUGGING_INFO). * dwarf2out.c (gen_entry_point_die): Hide prototype and definition. * except.h (doing_eh): Provide prototype. * expr.c: Move inclusion of expr.h to after insn-config.h. * final.c: Include reload.h. (shorten_branches): Cast the first argument of bzero to char *. * fix-header.c (cpp_print_containing_files): Mark parameter `pfile' with ATTRIBUTE_UNUSED. (cpp_fatal): Likewise. * flow.c (find_basic_blocks_1): Cast the first argument of bzero to char *. * genattrtab.c (make_length_attrs): Change the type of variable `i' from int to size_t. (zero_fn): Mark parameter `exp' with ATTRIBUTE_UNUSED. (one_fn): Likewise. * genextract.c (main): When generating insn-extract.c, mark variable `junk' with ATTRIBUTE_UNUSED. * gengenrtl.c (gencode): When generating genrtl.c, cast the first argument of bzero to char*. * integrate.c: Include toplev.h. * libgcc2.c: Wrap `struct exception_table' and `find_exception_handler' in macro DWARF2_UNWIND_INFO. * objc/Make-lang.in (objc-act.o): Depend on toplev.h. * objc/objc-act.c: Include toplev.h. (lang_print_xnode): Mark parameters `file', `node' and `indent' with ATTRIBUTE_UNUSED. (finish_protocol): Likewise for parameter `protocol'. * output.h (declare_weak): Add prototype. (decode_reg_name): Don't wrap with TREE_CODE macro. (assemble_alias): Add prototype. * regclass.c: Include output.h. * reload.h (reloads_conflict): Add prototype. * rtl.h (print_rtl_single, mark_elimiation, reg_class_subset_p, output_func_start_profiler): Add prototypes. * rtlanal.c (reg_set_p_1): Mark parameters `x' and `pat' with ATTRIBUTE_UNUSED. * scan-decls.c: Include scan.h. * scan.h (recognized_function, recognized_extern): Add prototypes. * stmt.c: Include output.h. * toplev.c (error_for_asm, warning_for_asm): Remove prototypes. (output_lang_identify): Hide prototype and definition. (float_signal): Mark parameter `signo' with ATTRIBUTE_UNUSED. (pipe_closed): Likewise. * toplev.h (count_error, strip_off_ending, error_for_asm, warning_for_asm): Add prototypes. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@19712 138bc75d-0d04-0410-961f-82ee72b054a4
* typo typo fixes fixeslaw1998-05-061-1/+1
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@19601 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_set_around_loop): Don't do optimization whenamylaar1998-04-241-3/+18
| | | | | | | new pseudos are created. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@19404 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (count_reg_usage): Correctly handle REG_NONNEG notes.law1998-04-111-6/+6
| | | | | | | | | | | (delete_trivially_dead_insns): Renamed from delete_dead_from_cse. * toplev.c (rest_of_compilation): Call delete_trivially_dead_insns instead of delete_dead_from_cse. Also call delete_trivially_dead_insns between loop optimization passes. * rtl.h: Updated appropriately. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@19100 138bc75d-0d04-0410-961f-82ee72b054a4
* * Check in merge from gcc2. See ChangeLog.11 and ChangeLog.12law1998-04-041-0/+4
| | | | | | | | | for details. * haifa-sched.c: Mirror recent changes from gcc2. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@18984 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (rtx_cost): Only call CONST_COSTS if it is defined.law1998-03-231-0/+2
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@18787 138bc75d-0d04-0410-961f-82ee72b054a4
* Major cutover to using system.h:ghazi1998-03-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Makefile.in (alias.o, bitmap.o, c-aux-info.o, c-common.o, c-decl.o, c-iterate.o, c-lang.o, c-lex.o, c-pragma.o, c-typeck.o, caller-save.o, calls.o, collect2.o, combine.o, cse.o, dbxout.o, dwarf2out.o, dwarfout.o, emit-rtl.o, except.o, explow.o, expmed.o, expr.o, final.o, flow.o, function.o, getpwd.o, global.o, integrate.o, jump.o, local-alloc.o, loop.o, optabs.o, pexecute.o, prefix.o, print-rtl.o, print-tree.o, profile.o, real.o, recog.o, reg-stack.o, regclass.o, regmove.o, reload.o, reload1.o, reorg.o, rtl.o, rtlanal.o, sdbout.o, stmt.o, stor-layout.o, stupid.o, tlink.o, toplev.o, tree.o, unroll.o, varasm.o, xcoffout.o): Depend on system.h. * alias.c, bitmap.c, c-aux-info.c, c-common.c, c-decl.c, c-iterate.c, c-lang.c, c-lex.c, c-pragma.c, c-typeck.c, caller-save.c, calls.c, collect2.c, combine.c, cse.c, dbxout.c, dwarf2out.c, dwarfout.c, emit-rtl.c, except.c, explow.c, expmed.c, expr.c, final.c, flow.c, function.c, gcc.c, getpwd.c, global.c, integrate.c, jump.c, local-alloc.c, loop.c, optabs.c, pexecute.c, prefix.c, print-rtl.c, print-tree.c, profile.c, real.c, recog.c, reg-stack.c, regclass.c, regmove.c, reload.c, reload1.c, reorg.c, rtl.c, rtlanal.c, sched.c, sdbout.c, stmt.c, stor-layout.c, stupid.c, tlink.c, toplev.c, tree.c, unroll.c, varasm.c, xcoffout.c: Include system.h. Organize include ordering so that stdarg/varargs comes before other system headers. Remove spurious casts of functions assured of a prototype in system.h. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@18726 138bc75d-0d04-0410-961f-82ee72b054a4
* Warning fixes, resulting in the addition of a new target macro:ghazi1998-03-121-0/+6
| | | | | | | | | | * tm.texi (DEFAULT_RTX_COSTS): Document new macro. * arm.h (DEFAULT_RTX_COSTS): Define instead of RTX_COSTS. * cse.c (rtx_cost): Provide a default case in an enumeration switch, and call DEFAULT_RTX_COSTS if it's defined. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@18513 138bc75d-0d04-0410-961f-82ee72b054a4
* Fix warious warnings:ghazi1998-02-281-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * c-aux-info.c: Include string.h/strings.h. * pa.c: Include stdlib.h. (pa_combine_instructions): Prototype the function. (pa_can_combine_p, forward_branch_p, shadd_constant_p): Likewise. (reloc_needed): Add default case for enumeration switch. (remove_useless_addtr_insns): Remove unused variable `all'. (hppa_expand_prologue): Add explicit braces to avoid ambiguous `else'. (output_function_epilogue): Remove unused variable `i'. (output_millicode_call): Remove unused variable `link'. (shadd_constant_p, forward_branch_p): Make the function static. (following_call): Explicitly declare to return int. (pa_reorg): Declare as void. (pa_combine_instructions): Declare as static void. Add parentheses around && within ||. * pa.h: Add prototypes for pa_reorg, symbolic_operand, following_call, function_label_operand, lhs_lshift_cint_operand and zdepi_cint_p. * pa.md: Add parentheses around && within ||. * cppalloc.c: Include stdlib.h. * cpperror.c (cpp_print_containing_files): Remove unused variable `i'. Fix format specifier in fprintf. * cse.c (cse_around_loop): Add explicit braces to avoid ambiguous `else'. (delete_dead_from_cse): Wrap variable `tem' in macro HAVE_cc0. * expr.c (expand_expr): Add parentheses around && within ||. * final.c (app_enable): Replace fprintf with fputs where there are no format specifiers and no trailing argument after the string. Eg, when printing ASM_APP_ON/ASM_APP_OFF. (app_disable): Likewise. (final_end_function): Likewise. (final_scan_insn): Likewise. Remove unused variable `set'. (profile_function): Wrap empty if-statement body in {} brackets. * function.c: Include stdlib.h. (pad_below): Wrap prototype and definition in ARGS_GROW_DOWNWARD. (reposition_prologue_and_epilogue_notes): Add parentheses around assignment used as truth value. * integrate.c (expand_inline_function): Wrap variable `cc0_insn' in macro HAVE_cc0. * jump.c (jump_optimize): Wrap variable `q' in macro HAVE_cc0. Remove unused variable `prev1'. * libgcc2.c (__bb_exit_trace_func): Add parentheses around && within ||. Fix format specifier in fprintf. (__bb_init_prg): Add parentheses around assignment used as truth value. * local-alloc.c: Include stdlib.h. (requires_inout): Add parentheses around assignment used as truth value. * loop.c (analyze_loop_iterations): Wrap prototype and definition in macro HAVE_decrement_and_branch_on_count. (insert_bct, instrument_loop_bct): Likewise. (move_movables): Add parentheses around assignment used as truth value. (consec_sets_invariant_p): Likewise. (maybe_eliminate_biv_1): Wrap variable `new' in macro HAVE_cc0. * objc/objc-act.c: Include stdlib.h. (lookup_method_in_protocol_list): Wrap empty else-statement body in braces. (lookup_protocol_in_reflist): Likewise. (objc_add_static_instance): Remove unused variables `decl_expr' and `decl_spec'. (get_objc_string_decl): Remove unused variable `decl'. (generate_static_references): Remove unused variables `idecl' and `instance'. (check_protocols): Wrap empty else-statement body in braces. * protoize.c: Include stdlib.h. (substr): Add parentheses around assignment used as truth value. (abspath): Likewise. (shortpath): Likewise. * regmove.c (fixup_match_1): Add parentheses around assignment used as truth value. * reload.c (push_secondary_reload): Remove unused variable `i'. (find_reloads): Add parentheses around assignment used as truth value. * reload1.c: Include stdlib.h. * rtl.h: Correct typo in prototype of offsettable_memref_p. * stmt.c (add_case_node): Add parentheses around assignment used as truth value. (case_tree2list): Likewise. * tree.c (valid_machine_attribute): Wrap variable `decl_attr_list' in macro VALID_MACHINE_DECL_ATTRIBUTE. Wrap variable `type_attr_list' in macro VALID_MACHINE_TYPE_ATTRIBUTE. (merge_attributes): Add explicit braces to avoid ambiguous `else'. * unroll.c (copy_loop_body): Wrap variable `cc0_insn' in macro HAVE_cc0. * varasm.c: Include stdlib.h. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@18290 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (delete_dead_from_cse): If a libcall produces a constantlaw1998-02-121-6/+33
| | | | | | | | | result and that result can be substituted into SET_SRC of the insn with the REG_RETVAL note, then perform the substitution and delete the libcall. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17871 138bc75d-0d04-0410-961f-82ee72b054a4
* alaw1998-01-271-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * c-lex.c: Include <stdlib.h> and <string.h>/<strings.h>. Add prototype for `handle_sysv_pragma', and make it static. Add parentheses around assignment used as truth value. * combine.c (combine_instructions): Protect variable `prev' with macro HAVE_cc0. (can_combine_p): Protect variable `link' with AUTO_INC_DEC. (extract_left_shift): Add parentheses around operand of &. (merge_outer_ops): Avoid an empty body in an else-statement. (gen_rtx_combine): Remove unused variable `i'. * sparc/gmon-sol2.c: Include <fcntl.h>. Make return type of function monstartup `void'. Likewise for internal_mcount. Add `static void' prototype for moncontrol. Reconcile sprintf format vs. args. * sparc/sparc.c: Include <stdlib.h> and <string.h>/<strings.h>. Make return type of function_arg_slotno explicitly `int'. (reg_unused_after): Add parentheses around assignment used as truth value. (save_regs): Add explicit braces to avoid ambiguous `else'. (function_arg_slotno): Add parentheses around && within ||. (function_arg_pass_by_reference): Likewise. (sparc_flat_output_function_prologue): Reconcile fprintf format vs. args. * svr4.h (ASM_OUTPUT_LIMITED_STRING): Add parentheses around assignment used as truth value. * cplus-dem.c: Include <stdlib.h>. (demangle_signature): Avoid an empty body in an else-statement. (do_type): Remove unused variable `lvl'. * cppexp.c: Don't have <stdlib.h> depend on MULTIBYTE_CHARS. Include <string.h>/<strings.h>. (cpp_lex): Remove unused variable `namelen'. (cpp_lex): Explicitly declare `num_chars' as an int. * cpplib.c: Avoid duplicate inclusion of <stdlib.h>, include <unistd.h> instead. Explicitly declare is_system_include returning int. (make_assertion): Remove unused variable `kt'. (cpp_expand_to_buffer): Hide variable `obuf'. (output_line_command): Remove unused variables, `line_end', `line_cmd_buf' and `len'. (macarg): Remove unused variable `arg_start'. (special_symbol): Remove unused variable `i'. Add parentheses around assignment used as truth value. (do_include): Remove unused variables `pcfname' and `retried', hide `pcf' and `pcfbuflimit'. (do_line): Remove unused variable `i'. (finclude): Hide variable `missing_newline'. (cpp_handle_options): Remove unused variable `j'. (read_token_list): Remove unused variable `eofp'. (cpp_error_with_line): Remove unused variable `i'. (cpp_warning_with_line): Likewise. (cpp_pedwarn_with_line): Explicitly declare `column' as int. (cpp_error_from_errno): Remove unused variable `i'. * cse.c (invalidate): Add parentheses around assignment used as truth value. (find_best_addr): Move declaration of variable `our_cost' inside the conditional macro where its used. (fold_rtx): Avoid an empty body in an if-statement. (cse_insn): Wrap variables `this_insn_cc0_mode' and `this_insn_cc0' in macro HAVE_cc0. * dwarf2out.c: Include <stdlib.h> and <string.h>/<string.h>. (ASM_OUTPUT_DWARF_DATA8): Reconcile format vs. args in fprintf's. (output_uleb128): Likewise. (output_sleb128): Likewise. (output_cfi): Likewise. (output_call_frame_info): Remove unused variables `j', `fde_size' and `fde_pad'. (comp_unit_has_inlines): Hide declaration as per rest of file. (size_of_line_prolog): Correct typo in prototype. (add_arange): Likewise. (output_aranges): Likewise. (add_name_and_src_coords_attributes): Likewise. (gen_array_type_die): Likewise. (gen_inlined_subroutine_die): Likewise. (equate_decl_number_to_die): Remove unused variable `i'. (print_die): Reconcile format vs. args in fprintf's. (print_dwarf_line_table): Likewise. (output_die): Likewise. (output_line_info): Likewise. (add_subscript_info): Avoid an empty body in an else-statement. (gen_subprogram_die): Remove unused variable `fp_loc'. * dwarfout.c: Explicitly declare `next_pubname_number' as int. Protect `ordering_attribute' prototype with USE_ORDERING_ATTRIBUTE macro. Protect `src_coords_attribute' prototype with DWARF_DECL_COORDINATES macro. Hide `output_entry_point_die' prototype as in the rest of the file. Likewise for `output_pointer_type_die' and `output_reference_type_die'. Remove prototype for `type_of_for_scope'. (output_unsigned_leb128): Reconcile format vs. args in fprintf. (type_attribute): Add explicit braces to avoid ambiguous `else'. * final.c: Include <stdlib.h> and <string.h>/<strings.h>. (shorten_branches): Protect declaration of tmp_length with SHORTEN_WITH_ADJUST_INSN_LENGTH and ADJUST_INSN_LENGTH macros. (profile_function): Protect declaration of `sval' and `cxt' variables with appropriate macros. (final_scan_insn): Likewise for `note' variable. Add explicit braces to avoid empty body in an if-statement. (output_asm_insn): Move variable `i' inside macro conditional where it is used. Add parentheses around assignment used as truth value. (asm_fprintf) Likewise, likewise. * fix-header.c (main): Remove unused variable `done'. Protect declaration of `i' with FIXPROTO_IGNORE_LIST. * pexecute.c: Include <unistd.h>. Prototype `my_strerror'. * print-rtl.c (print_inline_rtx): Explicitly declare the parameter `ind'. * profile.c: Include <string.h>/<strings.h>. (instrument_arcs): Remove unused variables `note', `inverted', `zero' and `neg_one'. (branch_prob): Avoid empty body in an if-statement. * regclass.c: Include <stdlib.h>. (reg_alternate_class): Explicitly declare parameter `regno'. * regmove.c (regmove_optimize): Remove unused variable `p'. Add parentheses around assignment used as truth value. (find_matches): Remove unused variables `output_operand' and `matching_operand'. (fixup_match_1): Remove statement with no effect: "if (0) ;". * scan.c (sstring_append): Explicitly declare `count' as int. (scan_string): Explicitly declare parameter `init' as int. * sched.c: Include <stdlib.h>. (BLOCKAGE_RANGE): Add parentheses around arithmetic in operand of |. (rank_for_schedule): Add parentheses around assignment used as truth value. (schedule_block): Likewise. (regno_use_in): Likewise. (schedule_insns): Remove unused variable `i'. * toplev.c: Include <stdlib.h> and <string.h>/<strings.h>. (v_message_with_decl): Remove unused variable `n'. (botch): Explicitly declare parameter `s' as char *. (main): Add parentheses around assignment used as truth value. * tree.c (make_node): Protect the variable `kind' with the GATHER_STATISTICS macro. (real_value_from_int_cst): Move variable `e' inside conditional macro area where it is used. (tree_last): Add parentheses around assignment used as truth value. (build1): Protect the variable `kind' with the GATHER_STATISTICS macro. (print_obstack_statistics): Reconcile format vs. args in fprintf. Protect variables `i', `total_nodes', and `total_bytes' with the GATHER_STATISTICS macro. Lots more -W -Wall warnings disappear. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17515 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (simplify_ternary_operation): Don't try to simplifylaw1998-01-251-1/+1
| | | | | | | | IF_THEN_ELSE expressions (created by combine) that don't use relational operators. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17472 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (simplify_ternary_operation): Handle more IF_THEN_ELSElaw1998-01-231-0/+11
| | | | | | | simplifications. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17465 138bc75d-0d04-0410-961f-82ee72b054a4
* * varasm.c (immed_double_const): Add casts to HOST_WIDE_INT wherelaw1998-01-171-2/+2
| | | | | | | | | | | | | | | necessary. (const_hash): Hash val is unsigned long. (SYMHASH): Likewise. * tree.c (TYPE_HASH): Type of hash val is unsigned long. * print-tree.c (print_node_brief): HOST_PTR_PRINTF format wants a char pointer, not HOST_WIDE_INT. (print_node): Likewise. Also hash is unsigned long not HOST_WIDE_INT. * cse.c (canon_hash): Hash is unsigned long not HOST_WIDE_INT. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17403 138bc75d-0d04-0410-961f-82ee72b054a4
* * alias.c: Change all uses of gen_rtx(FOO...) to gen_rtx_FOO;rth1998-01-141-40/+41
| | | | | | | | | | | | | | | change gen_rtx(expr...) to gen_rtx_fmt_foo(expr...). * caller-save.c, calls.c, combine.c, cse.c: Likewise. * dwarf2out.c, except.c, explow.c, expmed.c, expr.c: Likewise. * final.c, flow.c, function.c, genpeep.c, haifa-sched.c: Likewise. * halfpic.c, integrate.c, jump.c, local-alloc.c, loop.c: Likewise. * profile.c, recog.c, reg-stack.c, regclass.c, regmove.c: Likewise. * reload.c, reload1.c, reorg.c, sched.c, stmt.c, stupid.c: Likewise. * unroll.c, varasm.c: Likewise. * config/alpha/alpha.c, config/alpha/alpha.md: Likewise. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17357 138bc75d-0d04-0410-961f-82ee72b054a4
* Bring in final gcc-2.8.0 changes.law1998-01-141-1/+1
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17355 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (rtx_cost): Remove conflicting default case.law1997-12-271-3/+0
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17245 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (max_insn_uid): New variable.law1997-12-241-1/+14
| | | | | | | | | (invalidate): Remove CYGNUS LOCAL patch. (cse_around_loop): Use max_insn_uid. (cse_main): Set max_insn_uid. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17231 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (rtx_cost): Add default case in enumeration switch.law1997-12-221-0/+3
| | | | | | | | | | | | * fix-header.c (recognized_macro): Likewise. (recognized_extern): Likewise. (write_rbrac): Likewise. * objc/objc-act.c (encode_aggregate): Likewise. (gen_declarator): Likewise. (gen_declspecs): Likewise. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@17186 138bc75d-0d04-0410-961f-82ee72b054a4
* Merge from gcc-2.8law1997-12-071-2/+11
| | | | git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@16987 138bc75d-0d04-0410-961f-82ee72b054a4
* * m68k.c: Include tree.h for dwarf2out_cfi_label.law1997-12-061-0/+5
| | | | | | | | | | | | | | | * gcc.c (process_command): Do not take address of function fatal when calling lang_specific_driver. * config/i386/cygwin32.h (DWARF2_UNWIND): Exception handling doesn't work with it yet, so set it to 0. * config/i386/xm-cygwin32.h (NO_SYS_SIGLIST): Define. * cse.c (cse_insn): Check for invalid entries when taking references. More assorted pending patches. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@16978 138bc75d-0d04-0410-961f-82ee72b054a4
* * cse.c (cse_insn): Don't look at JUMP_LABEL field of a conditionllaw1997-11-171-1/+3
| | | | | | | | return. (cse_end_of_basic_block): Similarly. git-svn-id: svn+ssh://gcc.gnu.org/svn/gcc/trunk@16534 138bc75d-0d04-0410-961f-82ee72b054a4
OpenPOWER on IntegriCloud